missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals ADA, 99%, for biochemistry
CAS: 26239-55-4 | C6H10N2O5 | 190.155 g/mol
Supplier: Thermo Scientific Chemicals 228010250
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Biological bufferGreener Choice Claims
- Environmental benefits include:
- Recycled Content
- Free-of a substance that causes environmental harm
Specifications
| (9% soln. in 1 M NaOH), (9% soln. in 1 M NaOH) at 0nm, 0.08 max. at 300nm | |
| For biochemistry | |
| 219.0°C | |
| 98.5 | |
| White | |
| 25 g | |
| Authentic | |
| C6H10N2O5 | |
| MFCD00008031 | |
| 15, 135 | |
| Solubility in water: soluble. Other solubilities: soluble in alcohol, insoluble in benzene, chloroform | |
| C(C(=O)N)N(CC(=O)O)CC(=O)O | |
| 190.155 | |
| CHEBI:43960 | |
| 99% |
| ADA | |
| (9% soln. in 1M NaOH) | |
| 26239-55-4 | |
| 100.0 | |
| Fine Crystalline Powder | |
| 99% | |
| 0.5% max. (110°C, 5 hrs) | |
| H2NCOCH2N(CH2CO2H)2 | |
| Glass bottle | |
| N-(2-Acetamido)iminodiacetic acid, N-(Carbamoylmethyl)iminodiacetic acid | |
| QZTKDVCDBIDYMD-UHFFFAOYSA-N | |
| 2-[(2-amino-2-oxoethyl)-(carboxymethyl)amino]acetic acid | |
| 117765 | |
| 190.16 | |
| Biochemical |
Chemical Identifiers
| 26239-55-4 | |
| 190.155 | |
| QZTKDVCDBIDYMD-UHFFFAOYSA-N | |
| 117765 | |
| 2-[(2-amino-2-oxoethyl)-(carboxymethyl)amino]acetic acid |
| C6H10N2O5 | |
| MFCD00008031 | |
| N-(2-Acetamido)iminodiacetic acid, N-(Carbamoylmethyl)iminodiacetic acid | |
| CHEBI:43960 | |
| C(C(=O)N)N(CC(=O)O)CC(=O)O |
RUO – Research Use Only