Organometallic Compounds
Filtered Search Results
N,O-Bis(trimethylsilyl)trifluoroacetamide, 98+%
CAS: 25561-30-2 Molecular Formula: C8H18F3NOSi2 Molecular Weight (g/mol): 257.39 MDL Number: MFCD00008269 InChI Key: XCOBLONWWXQEBS-GHXNOFRVSA-N Synonym: bstfa,n,o-bis trimethylsilyl trifluoroacetamide,acetamide, 2,2,2-trifluoro-o,n-bis trimethylsilyl,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl acetimidate,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanimidate,trimethylsilyl 1z-2,2,2-trifluoro-n-z-trimethylsilyl ethanimidoate #,n,o-bis trimethylsilyl trifluoroacetamide bstfa,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanecarboximidate PubChem CID: 9601896 IUPAC Name: trimethylsilyl (1Z)-2,2,2-trifluoro-N-trimethylsilylethanimidate SMILES: C[Si](C)(C)N=C(C(F)(F)F)O[Si](C)(C)C
| PubChem CID | 9601896 |
|---|---|
| CAS | 25561-30-2 |
| Molecular Weight (g/mol) | 257.39 |
| MDL Number | MFCD00008269 |
| SMILES | C[Si](C)(C)N=C(C(F)(F)F)O[Si](C)(C)C |
| Synonym | bstfa,n,o-bis trimethylsilyl trifluoroacetamide,acetamide, 2,2,2-trifluoro-o,n-bis trimethylsilyl,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl acetimidate,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanimidate,trimethylsilyl 1z-2,2,2-trifluoro-n-z-trimethylsilyl ethanimidoate #,n,o-bis trimethylsilyl trifluoroacetamide bstfa,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanecarboximidate |
| IUPAC Name | trimethylsilyl (1Z)-2,2,2-trifluoro-N-trimethylsilylethanimidate |
| InChI Key | XCOBLONWWXQEBS-GHXNOFRVSA-N |
| Molecular Formula | C8H18F3NOSi2 |
(3-Aminopropyl)trimethoxysilane, 97%
CAS: 13822-56-5 Molecular Formula: C6H17NO3Si Molecular Weight (g/mol): 179.291 MDL Number: MFCD00008206 InChI Key: SJECZPVISLOESU-UHFFFAOYSA-N Synonym: 3-aminopropyltrimethoxysilane,3-aminopropyl trimethoxysilane,3-trimethoxysilyl-1-propanamine,3-trimethoxysilyl propan-1-amine,3-trimethoxysilyl propylamine,1-propanamine, 3-trimethoxysilyl,silane sc 3900,n-trimethoxysilylpropyl amine,propylamine, 3-trimethoxysilyl,unii-7mry0c9sb6 PubChem CID: 83756 IUPAC Name: 3-trimethoxysilylpropan-1-amine SMILES: CO[Si](CCCN)(OC)OC
| PubChem CID | 83756 |
|---|---|
| CAS | 13822-56-5 |
| Molecular Weight (g/mol) | 179.291 |
| MDL Number | MFCD00008206 |
| SMILES | CO[Si](CCCN)(OC)OC |
| Synonym | 3-aminopropyltrimethoxysilane,3-aminopropyl trimethoxysilane,3-trimethoxysilyl-1-propanamine,3-trimethoxysilyl propan-1-amine,3-trimethoxysilyl propylamine,1-propanamine, 3-trimethoxysilyl,silane sc 3900,n-trimethoxysilylpropyl amine,propylamine, 3-trimethoxysilyl,unii-7mry0c9sb6 |
| IUPAC Name | 3-trimethoxysilylpropan-1-amine |
| InChI Key | SJECZPVISLOESU-UHFFFAOYSA-N |
| Molecular Formula | C6H17NO3Si |
Phenylselenenyl bromide, 98%
CAS: 34837-55-3 Molecular Formula: C6H5BrSe Molecular Weight (g/mol): 235.981 MDL Number: MFCD00000047 InChI Key: LCEFEIBEOBPPSJ-UHFFFAOYSA-N Synonym: phenylselenyl bromide,benzeneselenenyl bromide,phenylselenenyl bromide,bromoselenobenzene,phsebr,phenylselenylbromide,benzeneselenyl bromide,phenylselanyl bromane,brseph,phenylseleno bromide PubChem CID: 123446 IUPAC Name: phenyl selenohypobromite SMILES: C1=CC=C(C=C1)[Se]Br
| PubChem CID | 123446 |
|---|---|
| CAS | 34837-55-3 |
| Molecular Weight (g/mol) | 235.981 |
| MDL Number | MFCD00000047 |
| SMILES | C1=CC=C(C=C1)[Se]Br |
| Synonym | phenylselenyl bromide,benzeneselenenyl bromide,phenylselenenyl bromide,bromoselenobenzene,phsebr,phenylselenylbromide,benzeneselenyl bromide,phenylselanyl bromane,brseph,phenylseleno bromide |
| IUPAC Name | phenyl selenohypobromite |
| InChI Key | LCEFEIBEOBPPSJ-UHFFFAOYSA-N |
| Molecular Formula | C6H5BrSe |
Copper(II) phthalocyanine
CAS: 147-14-8 Molecular Formula: C32H16CuN8 MDL Number: MFCD00010719 Synonym: C.I. 74160; Pigment Blue 15
| CAS | 147-14-8 |
|---|---|
| MDL Number | MFCD00010719 |
| Synonym | C.I. 74160; Pigment Blue 15 |
| Molecular Formula | C32H16CuN8 |
N,O-Bis(trimethylsilyl)trifluoroacetamide, with 1% TMCS, packaged under Argon in resealable ChemSeal™ bottles
CAS: 25561-30-2 Molecular Formula: C8H18F3NOSi2 Molecular Weight (g/mol): 257.403 MDL Number: MFCD00008269 InChI Key: XCOBLONWWXQEBS-GHXNOFRVSA-N Synonym: bstfa,n,o-bis trimethylsilyl trifluoroacetamide,acetamide, 2,2,2-trifluoro-o,n-bis trimethylsilyl,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl acetimidate,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanimidate,trimethylsilyl 1z-2,2,2-trifluoro-n-z-trimethylsilyl ethanimidoate #,n,o-bis trimethylsilyl trifluoroacetamide bstfa,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanecarboximidate PubChem CID: 9601896 IUPAC Name: trimethylsilyl (1Z)-2,2,2-trifluoro-N-trimethylsilylethanimidate SMILES: C[Si](C)(C)N=C(C(F)(F)F)O[Si](C)(C)C
| PubChem CID | 9601896 |
|---|---|
| CAS | 25561-30-2 |
| Molecular Weight (g/mol) | 257.403 |
| MDL Number | MFCD00008269 |
| SMILES | C[Si](C)(C)N=C(C(F)(F)F)O[Si](C)(C)C |
| Synonym | bstfa,n,o-bis trimethylsilyl trifluoroacetamide,acetamide, 2,2,2-trifluoro-o,n-bis trimethylsilyl,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl acetimidate,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanimidate,trimethylsilyl 1z-2,2,2-trifluoro-n-z-trimethylsilyl ethanimidoate #,n,o-bis trimethylsilyl trifluoroacetamide bstfa,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanecarboximidate |
| IUPAC Name | trimethylsilyl (1Z)-2,2,2-trifluoro-N-trimethylsilylethanimidate |
| InChI Key | XCOBLONWWXQEBS-GHXNOFRVSA-N |
| Molecular Formula | C8H18F3NOSi2 |
N,O-Bis(trimethylsilyl)trifluoroacetamide, with 1% TMCS
CAS: 25561-30-2 Molecular Formula: C8H18F3NOSi2 Molecular Weight (g/mol): 257.403 MDL Number: MFCD00008269 InChI Key: XCOBLONWWXQEBS-GHXNOFRVSA-N Synonym: bstfa,n,o-bis trimethylsilyl trifluoroacetamide,acetamide, 2,2,2-trifluoro-o,n-bis trimethylsilyl,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl acetimidate,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanimidate,trimethylsilyl 1z-2,2,2-trifluoro-n-z-trimethylsilyl ethanimidoate #,n,o-bis trimethylsilyl trifluoroacetamide bstfa,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanecarboximidate PubChem CID: 9601896 IUPAC Name: trimethylsilyl (1Z)-2,2,2-trifluoro-N-trimethylsilylethanimidate SMILES: C[Si](C)(C)N=C(C(F)(F)F)O[Si](C)(C)C
| PubChem CID | 9601896 |
|---|---|
| CAS | 25561-30-2 |
| Molecular Weight (g/mol) | 257.403 |
| MDL Number | MFCD00008269 |
| SMILES | C[Si](C)(C)N=C(C(F)(F)F)O[Si](C)(C)C |
| Synonym | bstfa,n,o-bis trimethylsilyl trifluoroacetamide,acetamide, 2,2,2-trifluoro-o,n-bis trimethylsilyl,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl acetimidate,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanimidate,trimethylsilyl 1z-2,2,2-trifluoro-n-z-trimethylsilyl ethanimidoate #,n,o-bis trimethylsilyl trifluoroacetamide bstfa,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanecarboximidate |
| IUPAC Name | trimethylsilyl (1Z)-2,2,2-trifluoro-N-trimethylsilylethanimidate |
| InChI Key | XCOBLONWWXQEBS-GHXNOFRVSA-N |
| Molecular Formula | C8H18F3NOSi2 |
Octakis(trimethylsiloxy)silsesquioxane
CAS: 51777-38-9 Molecular Formula: C24H72O10Si11 Molecular Weight (g/mol): 829.765 MDL Number: MFCD01310212 InChI Key: VLEKPQBXDHFSQO-UHFFFAOYSA-N Synonym: octakis trimethylsiloxy si-lsesquioxane,octakis trimethylsiloxy-t8-silsesquioxane PubChem CID: 71306897 IUPAC Name: bis(trimethylsilyl) bis[tris(trimethylsilyloxy)silyl] silicate SMILES: C[Si](C)(C)O[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C
| PubChem CID | 71306897 |
|---|---|
| CAS | 51777-38-9 |
| Molecular Weight (g/mol) | 829.765 |
| MDL Number | MFCD01310212 |
| SMILES | C[Si](C)(C)O[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| Synonym | octakis trimethylsiloxy si-lsesquioxane,octakis trimethylsiloxy-t8-silsesquioxane |
| IUPAC Name | bis(trimethylsilyl) bis[tris(trimethylsilyloxy)silyl] silicate |
| InChI Key | VLEKPQBXDHFSQO-UHFFFAOYSA-N |
| Molecular Formula | C24H72O10Si11 |
mu-Chloro-mu-methylenebis(cyclopentadienyl)titaniumdimethylaluminum, 0.5M in toluene
CAS: 67719-69-1 Molecular Formula: C13H18AlClTi MDL Number: MFCD00151575 Synonym: Tebbe Reagent
| CAS | 67719-69-1 |
|---|---|
| MDL Number | MFCD00151575 |
| Synonym | Tebbe Reagent |
| Molecular Formula | C13H18AlClTi |
Silicon(IV) 2-ethylhexanoate, nominally 75% in ethanol
CAS: 67939-81-5 Molecular Formula: C32H60O8Si Molecular Weight (g/mol): 600.909 MDL Number: MFCD00269842 InChI Key: UNKOLEUDCQIVBV-UHFFFAOYSA-N Synonym: silicon 2-ethylhexanoate,tetrakis 2-ethylhexanoic acid, tetraanhydride with silicic acid,2-ethylhexanoic acid tetraanhydride with silicic acid h4sio4,hexanoic acid, 2-ethyl-, 1,1',1,1'-tetraanhydride with silicic acid h4sio4,hexanoic acid, 2-ethyl-, tetraanhydride with silicic acid h4sio4,silicon 2-ethylhexanoate, min. 90,tris 2-ethylhexanoyloxy silyl 2-ethylhexanoate,silicon iv 2-ethylhexanoate in ethanol,silicic acid tetrakis 2-ethylhexanoic tetraanhydride,silicon iv 2-ethylhexanoate, nominally in ethanol PubChem CID: 106984 IUPAC Name: tris(2-ethylhexanoyloxy)silyl 2-ethylhexanoate SMILES: CCCCC(CC)C(=O)O[Si](OC(=O)C(CC)CCCC)(OC(=O)C(CC)CCCC)OC(=O)C(CC)CCCC
| PubChem CID | 106984 |
|---|---|
| CAS | 67939-81-5 |
| Molecular Weight (g/mol) | 600.909 |
| MDL Number | MFCD00269842 |
| SMILES | CCCCC(CC)C(=O)O[Si](OC(=O)C(CC)CCCC)(OC(=O)C(CC)CCCC)OC(=O)C(CC)CCCC |
| Synonym | silicon 2-ethylhexanoate,tetrakis 2-ethylhexanoic acid, tetraanhydride with silicic acid,2-ethylhexanoic acid tetraanhydride with silicic acid h4sio4,hexanoic acid, 2-ethyl-, 1,1',1,1'-tetraanhydride with silicic acid h4sio4,hexanoic acid, 2-ethyl-, tetraanhydride with silicic acid h4sio4,silicon 2-ethylhexanoate, min. 90,tris 2-ethylhexanoyloxy silyl 2-ethylhexanoate,silicon iv 2-ethylhexanoate in ethanol,silicic acid tetrakis 2-ethylhexanoic tetraanhydride,silicon iv 2-ethylhexanoate, nominally in ethanol |
| IUPAC Name | tris(2-ethylhexanoyloxy)silyl 2-ethylhexanoate |
| InChI Key | UNKOLEUDCQIVBV-UHFFFAOYSA-N |
| Molecular Formula | C32H60O8Si |
Aluminum 2,4-pentanedionate, 99.995+% (metals basis)
CAS: 13963-57-0 Molecular Formula: C15H21AlO6 Molecular Weight (g/mol): 324.31 MDL Number: MFCD00000013 InChI Key: KILURZWTCGSYRE-LNTINUHCSA-K Synonym: Aluminum acetylacetonate IUPAC Name: aluminium(3+) tris((2Z)-4-oxopent-2-en-2-olate) SMILES: [Al+3].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O
| CAS | 13963-57-0 |
|---|---|
| Molecular Weight (g/mol) | 324.31 |
| MDL Number | MFCD00000013 |
| SMILES | [Al+3].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O |
| Synonym | Aluminum acetylacetonate |
| IUPAC Name | aluminium(3+) tris((2Z)-4-oxopent-2-en-2-olate) |
| InChI Key | KILURZWTCGSYRE-LNTINUHCSA-K |
| Molecular Formula | C15H21AlO6 |
Bis(trimethylsilyl)sulfide, tech.
CAS: 3385-94-2 Molecular Formula: C6H18SSi2 Molecular Weight (g/mol): 178.44 MDL Number: MFCD00014851 InChI Key: RLECCBFNWDXKPK-UHFFFAOYSA-N Synonym: bis trimethylsilyl sulfide,hexamethyldisilthiane,hexamethyldisilathiane,disilathiane, hexamethyl,1,1,1,3,3,3-hexamethyldisilathiane,disilthiane, hexamethyl,disilathiane, 1,1,1,3,3,3-hexamethyl,thiobis trimethylsilane,acmc-1ckj8 PubChem CID: 76920 IUPAC Name: trimethyl(trimethylsilylsulfanyl)silane SMILES: C[Si](C)(C)S[Si](C)(C)C
| PubChem CID | 76920 |
|---|---|
| CAS | 3385-94-2 |
| Molecular Weight (g/mol) | 178.44 |
| MDL Number | MFCD00014851 |
| SMILES | C[Si](C)(C)S[Si](C)(C)C |
| Synonym | bis trimethylsilyl sulfide,hexamethyldisilthiane,hexamethyldisilathiane,disilathiane, hexamethyl,1,1,1,3,3,3-hexamethyldisilathiane,disilthiane, hexamethyl,disilathiane, 1,1,1,3,3,3-hexamethyl,thiobis trimethylsilane,acmc-1ckj8 |
| IUPAC Name | trimethyl(trimethylsilylsulfanyl)silane |
| InChI Key | RLECCBFNWDXKPK-UHFFFAOYSA-N |
| Molecular Formula | C6H18SSi2 |
Dimethyl selenide
CAS: 593-79-3 Molecular Formula: C2H6Se Molecular Weight (g/mol): 109.041 MDL Number: MFCD00014848 InChI Key: RVIXKDRPFPUUOO-UHFFFAOYSA-N Synonym: dimethylselenide,dimethylselenium,dimethyl selenide,methyl selenide,methyl selenium,methane, selenobis,selenium dimethyl,selenide, dimethyl,ch3 2se,unii-yk0r6jkt6h PubChem CID: 11648 ChEBI: CHEBI:4610 IUPAC Name: methylselanylmethane SMILES: C[Se]C
| PubChem CID | 11648 |
|---|---|
| CAS | 593-79-3 |
| Molecular Weight (g/mol) | 109.041 |
| ChEBI | CHEBI:4610 |
| MDL Number | MFCD00014848 |
| SMILES | C[Se]C |
| Synonym | dimethylselenide,dimethylselenium,dimethyl selenide,methyl selenide,methyl selenium,methane, selenobis,selenium dimethyl,selenide, dimethyl,ch3 2se,unii-yk0r6jkt6h |
| IUPAC Name | methylselanylmethane |
| InChI Key | RVIXKDRPFPUUOO-UHFFFAOYSA-N |
| Molecular Formula | C2H6Se |
n-Butyltin trichloride, 96%
CAS: 1118-46-3 Molecular Formula: C4H9Cl3Sn Molecular Weight (g/mol): 282.176 MDL Number: MFCD00000515 InChI Key: YMLFYGFCXGNERH-UHFFFAOYSA-K Synonym: butyltin trichloride,stannane, butyltrichloro,monobutyltin trichloride,butyltrichlorotin,trichlorobutyltin,butyl trichloro stannane,n-butyltin trichloride,trichlorobutylstannane,stannane, trichlorobutyl,monotributyltin trichloride PubChem CID: 14236 IUPAC Name: butyl(trichloro)stannane SMILES: CCCC[Sn](Cl)(Cl)Cl
| PubChem CID | 14236 |
|---|---|
| CAS | 1118-46-3 |
| Molecular Weight (g/mol) | 282.176 |
| MDL Number | MFCD00000515 |
| SMILES | CCCC[Sn](Cl)(Cl)Cl |
| Synonym | butyltin trichloride,stannane, butyltrichloro,monobutyltin trichloride,butyltrichlorotin,trichlorobutyltin,butyl trichloro stannane,n-butyltin trichloride,trichlorobutylstannane,stannane, trichlorobutyl,monotributyltin trichloride |
| IUPAC Name | butyl(trichloro)stannane |
| InChI Key | YMLFYGFCXGNERH-UHFFFAOYSA-K |
| Molecular Formula | C4H9Cl3Sn |
Di-n-butyltin dilaurate, 95%
CAS: 77-58-7 Molecular Formula: C32H64O4Sn MDL Number: MFCD00008963 Synonym: Di-n-butyltin didodecanoate
| CAS | 77-58-7 |
|---|---|
| MDL Number | MFCD00008963 |
| Synonym | Di-n-butyltin didodecanoate |
| Molecular Formula | C32H64O4Sn |
Diphenyltin dichloride, 90+%
CAS: 1135-99-5 Molecular Formula: C12H12Cl2Sn Molecular Weight (g/mol): 345.84 MDL Number: MFCD00000516 InChI Key: WSXPROXKZIMZIU-UHFFFAOYSA-N Synonym: diphenyltin dichloride,stannane, dichlorodiphenyl,dichlorodiphenyltin,diphenyldichlorotin,diphenyltin chloride,diphenylstannyl dichloride,tin, diphenyl-, dichloride,dichloro diphenyl stannane,diphenylstannium dichloride,unii-0y7mz4k0dr PubChem CID: 14342 IUPAC Name: dichloro(diphenyl)stannane SMILES: Cl.Cl.[SnH2](C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 14342 |
|---|---|
| CAS | 1135-99-5 |
| Molecular Weight (g/mol) | 345.84 |
| MDL Number | MFCD00000516 |
| SMILES | Cl.Cl.[SnH2](C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | diphenyltin dichloride,stannane, dichlorodiphenyl,dichlorodiphenyltin,diphenyldichlorotin,diphenyltin chloride,diphenylstannyl dichloride,tin, diphenyl-, dichloride,dichloro diphenyl stannane,diphenylstannium dichloride,unii-0y7mz4k0dr |
| IUPAC Name | dichloro(diphenyl)stannane |
| InChI Key | WSXPROXKZIMZIU-UHFFFAOYSA-N |
| Molecular Formula | C12H12Cl2Sn |