missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Genistein, MP Biomedicals™
Manufacturer: Mp Biomedicals 0215235510
Specifications
| Genistein | |
| 10mg | |
| C15H10O5 | |
| TZBJGXHYKVUXJN-UHFFFAOYSA-N | |
| 5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one | |
| 5280961 | |
| 270.2 |
| White | |
| 446-72-0 | |
| 4',5,7-trihydroxyisoflavone, 5,7,4'-trihydroxyisoflavone, 5,7-dihydroxy-3-4-hydroxyphenyl-4h-chromen-4-one, bonistein, genestein, genistein, genisteol, genisterin, prunetol, sophoricol | |
| C1=CC(=CC=C1C2=COC3=CC(=CC(=C3C2=O)O)O)O | |
| 270.24 | |
| CHEBI:28088 | |
| Free-Flowing Powder |
Chemical Identifiers
| 446-72-0 | |
| 270.24 | |
| 4',5,7-trihydroxyisoflavone, 5,7,4'-trihydroxyisoflavone, 5,7-dihydroxy-3-4-hydroxyphenyl-4h-chromen-4-one, bonistein, genestein, genistein, genisteol, genisterin, prunetol, sophoricol | |
| CHEBI:28088 | |
| C1=CC(=CC=C1C2=COC3=CC(=CC(=C3C2=O)O)O)O |
| C15H10O5 | |
| TZBJGXHYKVUXJN-UHFFFAOYSA-N | |
| 5280961 | |
| 5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one |