missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Ethylenediaminetetraacetic Acid (0.5M Solution/pH 8.0), Fisher BioReagents
Supplier: Fisher BioReagents BP2482100
Description
EDTA is used extensively in molecular biology to minimize metal ion impurities in reaction buffers. Ideal for DNA work.Specifications
Ethylenediamine Tetraacetic Acid | |
0.5 M Solution, pH 8.0 (for DNA Work) | |
C10H16N2O8 | |
MFCD00003541 | |
15, 3565 | |
KCXVZYZYPLLWCC-UHFFFAOYSA-N | |
2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid | |
6049 | |
292.25 | |
Poly Bottle | |
100 mL |
Colorless | |
60-00-4,7732-18-5 | |
(HOOCCH2)2NCH2CH2N(CH2COOH)2 | |
0.475 to 0.525M | |
edta, edetic acid, ethylenediaminetetraacetic acid, edathamil, versene, endrate, havidote, titriplex, edta acid, sequestrol | |
OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O | |
292.24 | |
CHEBI:42191 | |
Pass Test | |
8.0 | |
Liquid |
Chemical Identifiers
60-00-4 | |
292.24 | |
KCXVZYZYPLLWCC-UHFFFAOYSA-N | |
6049 | |
2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid |
C10H16N2O8 | |
MFCD00003541 | |
edta, edetic acid, ethylenediaminetetraacetic acid, edathamil, versene, endrate, havidote, titriplex, edta acid, sequestrolShow More | |
CHEBI:42191 | |
OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
Safety and Handling

Recommended Storage : RT