Filtered Search Results
Potassium Dichromate, 0.0100 N (N/100), Ricca Chemical
CAS: 7778-50-9 Molecular Formula: Cr2K2O7 Molecular Weight (g/mol): 294.182 InChI Key: KMUONIBRACKNSN-UHFFFAOYSA-N Synonym: potassium dichromate,potassium bichromate,kaliumdichromat,iopezite,dipotassium bichromate,dipotassium dichromate,potassium dichromate vi,dichromic acid dipotassium salt,dipotassium dichromium heptaoxide,bichromate of potash PubChem CID: 24502 ChEBI: CHEBI:53444 IUPAC Name: dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium SMILES: [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+]
| PubChem CID | 24502 |
|---|---|
| CAS | 7778-50-9 |
| Molecular Weight (g/mol) | 294.182 |
| ChEBI | CHEBI:53444 |
| SMILES | [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] |
| Synonym | potassium dichromate,potassium bichromate,kaliumdichromat,iopezite,dipotassium bichromate,dipotassium dichromate,potassium dichromate vi,dichromic acid dipotassium salt,dipotassium dichromium heptaoxide,bichromate of potash |
| IUPAC Name | dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium |
| InChI Key | KMUONIBRACKNSN-UHFFFAOYSA-N |
| Molecular Formula | Cr2K2O7 |
Potassium Iodate, 0.0250 N (N/40), Ricca Chemical
Molecular Formula: IKO3 Molecular Weight (g/mol): 214.00 InChI Key: JLKDVMWYMMLWTI-UHFFFAOYSA-M IUPAC Name: potassium iodate SMILES: [K+].[O-][I](=O)=O
| Molecular Weight (g/mol) | 214.00 |
|---|---|
| SMILES | [K+].[O-][I](=O)=O |
| IUPAC Name | potassium iodate |
| InChI Key | JLKDVMWYMMLWTI-UHFFFAOYSA-M |
| Molecular Formula | IKO3 |
Potassium Iodate, 0.100 N (N/10), 0.01667 M (M/60), Ricca Chemical
CAS: 7758-05-6 Molecular Formula: IKO3 Molecular Weight (g/mol): 214.00 InChI Key: JLKDVMWYMMLWTI-UHFFFAOYSA-M Synonym: potassium iodate,potassium triodate,caswell no. 693a,iodic acid, potassium salt,unii-i139e44nhl,potassium iodine oxide kio3,iodic acid hio3 , potassium salt,epa pesticide chemical code 075703,iodic acid hio3 , potassium salt 1:1,kaliumjodat PubChem CID: 23665710 IUPAC Name: potassium;iodate SMILES: [O-]I(=O)=O.[K+]
| PubChem CID | 23665710 |
|---|---|
| CAS | 7758-05-6 |
| Molecular Weight (g/mol) | 214.00 |
| SMILES | [O-]I(=O)=O.[K+] |
| Synonym | potassium iodate,potassium triodate,caswell no. 693a,iodic acid, potassium salt,unii-i139e44nhl,potassium iodine oxide kio3,iodic acid hio3 , potassium salt,epa pesticide chemical code 075703,iodic acid hio3 , potassium salt 1:1,kaliumjodat |
| IUPAC Name | potassium;iodate |
| InChI Key | JLKDVMWYMMLWTI-UHFFFAOYSA-M |
| Molecular Formula | IKO3 |
Sodium Thiosulfate, 0.00200 N (N/500), Ricca Chemical
CAS: 10102-17-7 Molecular Formula: H10Na2O8S2 Molecular Weight (g/mol): 248.17 InChI Key: PODWXQQNRWNDGD-UHFFFAOYSA-L Synonym: sodium thiosulfate pentahydrate,ametox,sodium thiosulfate, pentahydrate,antichlor,tinver,disodium thiosulfate pentahydrate,unii-hx1032v43m,ccris 3952,thiosulfuric acid, disodium salt, pentahydrate,sodium hyposulfite pentahydrate PubChem CID: 61475 ChEBI: CHEBI:32150 IUPAC Name: disodium pentahydrate sulfanidesulfonate SMILES: O.O.O.O.O.[Na+].[Na+].[O-]S([S-])(=O)=O
| PubChem CID | 61475 |
|---|---|
| CAS | 10102-17-7 |
| Molecular Weight (g/mol) | 248.17 |
| ChEBI | CHEBI:32150 |
| SMILES | O.O.O.O.O.[Na+].[Na+].[O-]S([S-])(=O)=O |
| Synonym | sodium thiosulfate pentahydrate,ametox,sodium thiosulfate, pentahydrate,antichlor,tinver,disodium thiosulfate pentahydrate,unii-hx1032v43m,ccris 3952,thiosulfuric acid, disodium salt, pentahydrate,sodium hyposulfite pentahydrate |
| IUPAC Name | disodium pentahydrate sulfanidesulfonate |
| InChI Key | PODWXQQNRWNDGD-UHFFFAOYSA-L |
| Molecular Formula | H10Na2O8S2 |
Sodium Thiosulfate, 0.00500 N (N/200), Ricca Chemical
CAS: 10102-17-7 Molecular Formula: H10Na2O8S2 Molecular Weight (g/mol): 248.17 InChI Key: PODWXQQNRWNDGD-UHFFFAOYSA-L Synonym: sodium thiosulfate pentahydrate,ametox,sodium thiosulfate, pentahydrate,antichlor,tinver,disodium thiosulfate pentahydrate,unii-hx1032v43m,ccris 3952,thiosulfuric acid, disodium salt, pentahydrate,sodium hyposulfite pentahydrate PubChem CID: 61475 ChEBI: CHEBI:32150 IUPAC Name: disodium pentahydrate sulfanidesulfonate SMILES: O.O.O.O.O.[Na+].[Na+].[O-]S([S-])(=O)=O
| PubChem CID | 61475 |
|---|---|
| CAS | 10102-17-7 |
| Molecular Weight (g/mol) | 248.17 |
| ChEBI | CHEBI:32150 |
| SMILES | O.O.O.O.O.[Na+].[Na+].[O-]S([S-])(=O)=O |
| Synonym | sodium thiosulfate pentahydrate,ametox,sodium thiosulfate, pentahydrate,antichlor,tinver,disodium thiosulfate pentahydrate,unii-hx1032v43m,ccris 3952,thiosulfuric acid, disodium salt, pentahydrate,sodium hyposulfite pentahydrate |
| IUPAC Name | disodium pentahydrate sulfanidesulfonate |
| InChI Key | PODWXQQNRWNDGD-UHFFFAOYSA-L |
| Molecular Formula | H10Na2O8S2 |
Sodium Thiosulfate, 0.100 N (N/10), Ricca Chemical
CAS: 10102-17-7 Molecular Formula: H10Na2O8S2 InChI Key: PODWXQQNRWNDGD-UHFFFAOYSA-L Synonym: sodium thiosulfate pentahydrate,ametox,sodium thiosulfate, pentahydrate,antichlor,tinver,disodium thiosulfate pentahydrate,unii-hx1032v43m,ccris 3952,thiosulfuric acid, disodium salt, pentahydrate,sodium hyposulfite pentahydrate PubChem CID: 61475 ChEBI: CHEBI:32150
| PubChem CID | 61475 |
|---|---|
| CAS | 10102-17-7 |
| ChEBI | CHEBI:32150 |
| Synonym | sodium thiosulfate pentahydrate,ametox,sodium thiosulfate, pentahydrate,antichlor,tinver,disodium thiosulfate pentahydrate,unii-hx1032v43m,ccris 3952,thiosulfuric acid, disodium salt, pentahydrate,sodium hyposulfite pentahydrate |
| InChI Key | PODWXQQNRWNDGD-UHFFFAOYSA-L |
| Molecular Formula | H10Na2O8S2 |
| CAS | 10102-17-7 |
|---|---|
| Physical Form | Liquid |
| CAS Min % | 0.0023 |
| Chemical Name or Material | Starch Indicator |
| CAS Max % | 0.0023 |
Starch Indicator, 2% (w/v), Mercury Free, for Iodometric Titrations, Ricca Chemical
Iodometric Titrations
| Percent Purity | 2% W/V |
|---|---|
| CAS | 69-72-7 |
| Color | White |
| Physical Form | Liquid |
| pH | 5 to 7 |
| CAS Min % | 0.19 |
| Chemical Name or Material | Starch Indicator |
| Grade | Indicator |
| Concentration | 2% (w/v) |
| Shelf Life | 24 months |
| Solvent or Matrix | Aqueous Solution |
| CAS Max % | 0.2 |
| Name Note | With Chloroform Preservative |
|---|---|
| Percent Purity | 1% W/V |
| CAS | 67-66-3 |
| Color | Colorless |
| Physical Form | Liquid |
| pH | 5 to 7 |
| CAS Min % | 0.1 |
| Chemical Name or Material | Starch Indicator |
| Grade | Indicator |
| Concentration | 1% (w/v) |
| Solvent or Matrix | Aqueous Solution |
| CAS Max % | 0.4 |
Sodium Thiosulfate, 0.0375 N, Ricca Chemical
CAS: 10102-17-7 Molecular Formula: H10Na2O8S2 Molecular Weight (g/mol): 248.17 InChI Key: PODWXQQNRWNDGD-UHFFFAOYSA-L Synonym: sodium thiosulfate pentahydrate,ametox,sodium thiosulfate, pentahydrate,antichlor,tinver,disodium thiosulfate pentahydrate,unii-hx1032v43m,ccris 3952,thiosulfuric acid, disodium salt, pentahydrate,sodium hyposulfite pentahydrate PubChem CID: 61475 ChEBI: CHEBI:32150 IUPAC Name: disodium pentahydrate sulfanidesulfonate SMILES: O.O.O.O.O.[Na+].[Na+].[O-]S([S-])(=O)=O
| PubChem CID | 61475 |
|---|---|
| CAS | 10102-17-7 |
| Molecular Weight (g/mol) | 248.17 |
| ChEBI | CHEBI:32150 |
| SMILES | O.O.O.O.O.[Na+].[Na+].[O-]S([S-])(=O)=O |
| Synonym | sodium thiosulfate pentahydrate,ametox,sodium thiosulfate, pentahydrate,antichlor,tinver,disodium thiosulfate pentahydrate,unii-hx1032v43m,ccris 3952,thiosulfuric acid, disodium salt, pentahydrate,sodium hyposulfite pentahydrate |
| IUPAC Name | disodium pentahydrate sulfanidesulfonate |
| InChI Key | PODWXQQNRWNDGD-UHFFFAOYSA-L |
| Molecular Formula | H10Na2O8S2 |
Sodium Thiosulfate, 0.0500 N (N/20), Ricca Chemical
CAS: 10102-17-7 Molecular Formula: H10Na2O8S2 Molecular Weight (g/mol): 248.17 InChI Key: PODWXQQNRWNDGD-UHFFFAOYSA-L Synonym: sodium thiosulfate pentahydrate,ametox,sodium thiosulfate, pentahydrate,antichlor,tinver,disodium thiosulfate pentahydrate,unii-hx1032v43m,ccris 3952,thiosulfuric acid, disodium salt, pentahydrate,sodium hyposulfite pentahydrate PubChem CID: 61475 ChEBI: CHEBI:32150 IUPAC Name: disodium pentahydrate sulfanidesulfonate SMILES: O.O.O.O.O.[Na+].[Na+].[O-]S([S-])(=O)=O
| PubChem CID | 61475 |
|---|---|
| CAS | 10102-17-7 |
| Molecular Weight (g/mol) | 248.17 |
| ChEBI | CHEBI:32150 |
| SMILES | O.O.O.O.O.[Na+].[Na+].[O-]S([S-])(=O)=O |
| Synonym | sodium thiosulfate pentahydrate,ametox,sodium thiosulfate, pentahydrate,antichlor,tinver,disodium thiosulfate pentahydrate,unii-hx1032v43m,ccris 3952,thiosulfuric acid, disodium salt, pentahydrate,sodium hyposulfite pentahydrate |
| IUPAC Name | disodium pentahydrate sulfanidesulfonate |
| InChI Key | PODWXQQNRWNDGD-UHFFFAOYSA-L |
| Molecular Formula | H10Na2O8S2 |
Sodium Thiosulfate, 0.200 N (N/5), Ricca Chemical
CAS: 10102-17-7 Molecular Formula: H10Na2O8S2 Molecular Weight (g/mol): 248.17 InChI Key: PODWXQQNRWNDGD-UHFFFAOYSA-L Synonym: sodium thiosulfate pentahydrate,ametox,sodium thiosulfate, pentahydrate,antichlor,tinver,disodium thiosulfate pentahydrate,unii-hx1032v43m,ccris 3952,thiosulfuric acid, disodium salt, pentahydrate,sodium hyposulfite pentahydrate PubChem CID: 61475 ChEBI: CHEBI:32150 IUPAC Name: disodium pentahydrate sulfanidesulfonate SMILES: O.O.O.O.O.[Na+].[Na+].[O-]S([S-])(=O)=O
| PubChem CID | 61475 |
|---|---|
| CAS | 10102-17-7 |
| Molecular Weight (g/mol) | 248.17 |
| ChEBI | CHEBI:32150 |
| SMILES | O.O.O.O.O.[Na+].[Na+].[O-]S([S-])(=O)=O |
| Synonym | sodium thiosulfate pentahydrate,ametox,sodium thiosulfate, pentahydrate,antichlor,tinver,disodium thiosulfate pentahydrate,unii-hx1032v43m,ccris 3952,thiosulfuric acid, disodium salt, pentahydrate,sodium hyposulfite pentahydrate |
| IUPAC Name | disodium pentahydrate sulfanidesulfonate |
| InChI Key | PODWXQQNRWNDGD-UHFFFAOYSA-L |
| Molecular Formula | H10Na2O8S2 |
Sodium Thiosulfate, 0.250 N (N/4), Ricca Chemical
CAS: 10102-17-7 Molecular Formula: H10Na2O8S2 Molecular Weight (g/mol): 248.17 InChI Key: PODWXQQNRWNDGD-UHFFFAOYSA-L Synonym: sodium thiosulfate pentahydrate,ametox,sodium thiosulfate, pentahydrate,antichlor,tinver,disodium thiosulfate pentahydrate,unii-hx1032v43m,ccris 3952,thiosulfuric acid, disodium salt, pentahydrate,sodium hyposulfite pentahydrate PubChem CID: 61475 ChEBI: CHEBI:32150 IUPAC Name: disodium pentahydrate sulfanidesulfonate SMILES: O.O.O.O.O.[Na+].[Na+].[O-]S([S-])(=O)=O
| PubChem CID | 61475 |
|---|---|
| CAS | 10102-17-7 |
| Molecular Weight (g/mol) | 248.17 |
| ChEBI | CHEBI:32150 |
| SMILES | O.O.O.O.O.[Na+].[Na+].[O-]S([S-])(=O)=O |
| Synonym | sodium thiosulfate pentahydrate,ametox,sodium thiosulfate, pentahydrate,antichlor,tinver,disodium thiosulfate pentahydrate,unii-hx1032v43m,ccris 3952,thiosulfuric acid, disodium salt, pentahydrate,sodium hyposulfite pentahydrate |
| IUPAC Name | disodium pentahydrate sulfanidesulfonate |
| InChI Key | PODWXQQNRWNDGD-UHFFFAOYSA-L |
| Molecular Formula | H10Na2O8S2 |