missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Potassium Dichromate, 0.500 N (N/2), Ricca Chemical
$158.47 - $260.43
Chemical Identifiers
| CAS | 7778-50-9 |
|---|---|
| Molecular Formula | Cr2K2O7 |
| Molecular Weight (g/mol) | 294.182 |
| InChI Key | KMUONIBRACKNSN-UHFFFAOYSA-N |
| Synonym | potassium dichromate, potassium bichromate, kaliumdichromat, iopezite, dipotassium bichromate, dipotassium dichromate, potassium dichromate vi, dichromic acid dipotassium salt, dipotassium dichromium heptaoxide, bichromate of potash |
| PubChem CID | 24502 |
| ChEBI | CHEBI:53444 |
| IUPAC Name | dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium |
| SMILES | [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] |
Chemical Identifiers
| 7778-50-9 | |
| 294.182 | |
| potassium dichromate, potassium bichromate, kaliumdichromat, iopezite, dipotassium bichromate, dipotassium dichromate, potassium dichromate vi, dichromic acid dipotassium salt, dipotassium dichromium heptaoxide, bichromate of potash | |
| CHEBI:53444 | |
| [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] |
| Cr2K2O7 | |
| KMUONIBRACKNSN-UHFFFAOYSA-N | |
| 24502 | |
| dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium |
Specifications
| Orange | |
| 96.0,2.35 | |
| Cr2K2O7 | |
| KMUONIBRACKNSN-UHFFFAOYSA-N | |
| dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium | |
| 24502 | |
| Laboratory | |
| ∼3.5 to 4 | |
| Liquid | |
| Potassium Dichromate |
| 7778-50-9,7732-18-5 | |
| 100.0,2.44 | |
| potassium dichromate, potassium bichromate, kaliumdichromat, iopezite, dipotassium bichromate, dipotassium dichromate, potassium dichromate vi, dichromic acid dipotassium salt, dipotassium dichromium heptaoxide, bichromate of potash | |
| [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] | |
| 294.182 | |
| CHEBI:53444 | |
| Natural Poly Bottle | |
| 500 mL | |
| 0.500Normal |