missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Methyl linoleate, 99%, Thermo Scientific™
$90.24 - $828.83
Chemical Identifiers
| CAS | 112-63-0 |
|---|---|
| Molecular Formula | C19H34O2 |
| Molecular Weight (g/mol) | 294.48 |
| MDL Number | MFCD00009534 |
| InChI Key | WTTJVINHCBCLGX-NQLNTKRDSA-N |
| Synonym | 9,12-octadecadienoic acid z,z-, methyl ester, linoleic acid methyl ester, linoleic acid, methyl ester, linoleic acid,methyl ester, methyl 9-cis,12-cis-octadecadienoate, methyl 9z,12z-octadeca-9,12-dienoate, methyl lineoleate, methyl linoleate, methyl linoleate, native, methyl octadecadienoate |
| PubChem CID | 5284421 |
| ChEBI | CHEBI:69080 |
| IUPAC Name | methyl (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)OC |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC428130050
|
Thermo Fisher Scientific
AC428130050 |
5g | Glass bottle |
Each for $90.24
|
|
AC428130250
|
Thermo Fisher Scientific
AC428130250 |
25g | Glass bottle |
Each for $336.71
|
|
AC428131000
|
Thermo Fisher Scientific
AC428131000 |
100g | Glass bottle |
Each for $828.83
|
|
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 112-63-0 | |
| 294.48 | |
| WTTJVINHCBCLGX-NQLNTKRDSA-N | |
| 5284421 | |
| methyl (9Z,12Z)-octadeca-9,12-dienoate |
| C19H34O2 | |
| MFCD00009534 | |
| 9,12-octadecadienoic acid z,z-, methyl ester, linoleic acid methyl ester, linoleic acid, methyl ester, linoleic acid,methyl ester, methyl 9-cis,12-cis-octadecadienoate, methyl 9z,12z-octadeca-9,12-dienoate, methyl lineoleate, methyl linoleate, methyl linoleate, native, methyl octadecadienoate | |
| CHEBI:69080 | |
| CCCCCC=CCC=CCCCCCCCC(=O)OC |
Specifications
| 112-63-0 | |
| -35.0°C | |
| >200°C | |
| C19H34O2 | |
| MFCD00009534 | |
| 15, 6167 | |
| 5g | |
| WTTJVINHCBCLGX-NQLNTKRDSA-N | |
| CCCCCC=CCC=CCCCCCCCC(=O)OC | |
| 294.48 | |
| CHEBI:69080 | |
| 99% |
| 0.8900g/mL | |
| 212.0°C (16.0 mmHg) | |
| 98.5% min. (GC) | |
| CH3(CH2)4CH=CHCH2CH=CH(CH2)7CO2CH3 | |
| Glass bottle | |
| 9,12-octadecadienoic acid z,z-, methyl ester, linoleic acid methyl ester, linoleic acid, methyl ester, linoleic acid,methyl ester, methyl 9-cis,12-cis-octadecadienoate, methyl 9z,12z-octadeca-9,12-dienoate, methyl lineoleate, methyl linoleate, methyl linoleate, native, methyl octadecadienoate | |
| Solubility in water: insoluble. Other solubilities: miscible with dmf,fat solvents,oils | |
| 0.89 | |
| methyl (9Z,12Z)-octadeca-9,12-dienoate | |
| 5284421 | |
| 294.48 | |
| Methyl linoleate |
Safety and Handling
EINECSNumber : 203-993-
RUO – Research Use Only