missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Methyl linoleate, 99%, Acros Organics™
$86.22 - $307.54
Chemical Identifiers
| CAS | 112-63-0 |
|---|---|
| Molecular Formula | C19H34O2 |
| Molecular Weight (g/mol) | 294.479 |
| MDL Number | MFCD00009534 |
| InChI Key | WTTJVINHCBCLGX-NQLNTKRDSA-N |
| Synonym | methyl linoleate, linoleic acid methyl ester, methyl lineoleate, methyl 9z,12z-octadeca-9,12-dienoate, methyl octadecadienoate, methyl 9-cis,12-cis-octadecadienoate, linoleic acid,methyl ester, linoleic acid, methyl ester, methyl linoleate, native, 9,12-octadecadienoic acid z,z-, methyl ester |
| PubChem CID | 5284421 |
| ChEBI | CHEBI:69080 |
| IUPAC Name | methyl (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)OC |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
| AC428130050 SDS |
Acros Organics
AC428130050 |
5g | Glass bottle |
Each for $86.22
|
|
AC428130250 SDS |
Acros Organics
AC428130250 |
25g | Glass bottle |
Each for $307.54
|
|
AC428131000 SDS |
Acros Organics
AC428131000 |
100g | Glass bottle | N/A | N/A |
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
Chemical Identifiers
| 112-63-0 | |
| 294.479 | |
| WTTJVINHCBCLGX-NQLNTKRDSA-N | |
| 5284421 | |
| methyl (9Z,12Z)-octadeca-9,12-dienoate |
| C19H34O2 | |
| MFCD00009534 | |
| methyl linoleate, linoleic acid methyl ester, methyl lineoleate, methyl 9z,12z-octadeca-9,12-dienoate, methyl octadecadienoate, methyl 9-cis,12-cis-octadecadienoate, linoleic acid,methyl ester, linoleic acid, methyl ester, methyl linoleate, native, 9,12-octadecadienoic acid z,z-, methyl ester | |
| CHEBI:69080 | |
| CCCCCC=CCC=CCCCCCCCC(=O)OC |
Specifications
| 0.8900g/mL | |
| Glass bottle | |
| -35.0°C | |
| 112-63-0 | |
| C19H34O2 | |
| MFCD00009534 | |
| methyl linoleate, linoleic acid methyl ester, methyl lineoleate, methyl 9z,12z-octadeca-9,12-dienoate, methyl octadecadienoate, methyl 9-cis,12-cis-octadecadienoate, linoleic acid,methyl ester, linoleic acid, methyl ester, methyl linoleate, native, 9,12-octadecadienoic acid z,z-, methyl ester | |
| CCCCCC=CCC=CCCCCCCCC(=O)OC | |
| 294.479 | |
| CHEBI:69080 | |
| 99% |
| >200°C | |
| 212.0°C (16.0 mmHg) | |
| 5g | |
| 99% | |
| CH3(CH2)4CH=CHCH2CH=CH(CH2)7CO2CH3 | |
| 15, 6167 | |
| WTTJVINHCBCLGX-NQLNTKRDSA-N | |
| methyl (9Z,12Z)-octadeca-9,12-dienoate | |
| 5284421 | |
| 294.48 | |
| Methyl linoleate |