missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
DL-Propranolol hydrochloride, 99%, ACROS Organics™
$1,054.68 - $1,054.68
Chemical Identifiers
| CAS | 318-98-9 |
|---|---|
| Molecular Formula | C16H21NO2·HCl |
| Molecular Weight (g/mol) | 295.8 |
| MDL Number | MFCD00012558 |
| InChI Key | ZMRUPTIKESYGQW-UHFFFAOYSA-N |
| Synonym | avlocardyl, dociton, herzbase, ikopal, inderal, inderalici, naprilin, pronovan, propranolol hcl, propranolol hydrochloride |
| PubChem CID | 62882 |
| ChEBI | CHEBI:8500 |
| IUPAC Name | 1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol;hydrochloride |
| SMILES | CC(C)NCC(COC1=CC=CC2=CC=CC=C21)O.Cl |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC207320050
|
Fisher Scientific Acros
207320050 |
5g | Glass bottle | N/A | N/A | ||||
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
|
AC207320250
|
Thermo Fisher Scientific
AC207320250 |
25g | Glass bottle | N/A | N/A | ||||
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
|
AC207321000
|
Thermo Fisher Scientific
AC207321000 |
100g | Glass bottle |
Each for $1,054.68
|
|
||||
Chemical Identifiers
| 318-98-9 | |
| 295.8 | |
| ZMRUPTIKESYGQW-UHFFFAOYSA-N | |
| 62882 | |
| 1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol;hydrochloride |
| C16H21NO2·HCl | |
| MFCD00012558 | |
| avlocardyl, dociton, herzbase, ikopal, inderal, inderalici, naprilin, pronovan, propranolol hcl, propranolol hydrochloride | |
| CHEBI:8500 | |
| CC(C)NCC(COC1=CC=CC2=CC=CC=C21)O.Cl |
Specifications
| Authentic | |
| White to Yellow | |
| 5g | |
| 99% | |
| C10H7OCH2CH(OH)CH2NHCH(CH3)2·HCl | |
| 15, 7953 | |
| Solubility in water: soluble. Other solubilities: soluble in alcohol, practically insoluble in ether, benzene and ethyl, acetate | |
| CC(C)NCC(COC1=CC=CC2=CC=CC=C21)O.Cl | |
| 295.8 | |
| CHEBI:8500 | |
| Powder | |
| DL-Propranolol hydrochloride |
| Glass bottle | |
| 163.0°C to 166.0°C | |
| 318-98-9 | |
| C16H21NO2·HCl | |
| MFCD00012558 | |
| avlocardyl, dociton, herzbase, ikopal, inderal, inderalici, naprilin, pronovan, propranolol hcl, propranolol hydrochloride | |
| ZMRUPTIKESYGQW-UHFFFAOYSA-N | |
| 1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol;hydrochloride | |
| 62882 | |
| 295.8 | |
| 99% |
Safety and Handling
GHS H Statement
Harmful if swallowed.
GHS P Statement
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
GHS Signal Word: Warning
EINECSNumber : 206-268-7