missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Cellulose Gum, Low Viscosity, FCC, 99.5-100.5%, Spectrum™ Chemical
C1103, 9004-32-4
$348.23 - $2298.74
Chemical Identifiers
| CAS | 9004-32-4 |
|---|---|
| Molecular Formula | (C12 H14 O9 R6)n |
| Molecular Weight (g/mol) | 263.20 |
| MDL Number | MFCD00081472 |
| InChI Key | DPXJVFZANSGRMM-UHFFFAOYNA-N |
| IUPAC Name | 2,3,4,5,6-pentahydroxyhexanal acetic acid sodium |
| SMILES | [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
18601534
|
Spectrum Chemical Mfg Cor
C1103125GM |
125 g | Poly Bottle |
Each for $348.23
|
|
||||
|
18601535
|
Spectrum Chemical Mfg Cor
C1103500GM |
500 g | Poly Bottle |
Each for $881.63
|
|
||||
|
18601536
|
Spectrum Chemical Mfg Cor
C110325KG |
2.5 kg | Poly Pail |
Each for $2,298.74
|
|
||||
Description
Spectrum™ Chemical Cellulose Gum, Low Viscosity, FCC is used as a thickener and stabilizer in food products. The FCC grade meets the requirements of the Food Chemical Codex indicates and is suitable for all food, beverage and nutritional supplement applications. Spectrum Chemical offers over 300 Food Grade (FCC) chemical ingredients packaged in laboratory size bottles to production drum quantities and are manufactured, packaged and stored under current Good Manufacturing Practices (cGMP) per 21CFR part 211 in FDA registered and inspected facilities.Chemical Identifiers
| 9004-32-4 | |
| 263.20 | |
| DPXJVFZANSGRMM-UHFFFAOYNA-N | |
| [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O |
| (C12 H14 O9 R6)n | |
| MFCD00081472 | |
| 2,3,4,5,6-pentahydroxyhexanal acetic acid sodium |
Specifications
| 9004-32-4 | |
| 10% | |
| (C12 H14 O9 R6)n | |
| 125 g | |
| [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O | |
| 263.20 | |
| FCC |
| 100% | |
| Poly Bottle | |
| MFCD00081472 | |
| DPXJVFZANSGRMM-UHFFFAOYNA-N | |
| 2,3,4,5,6-pentahydroxyhexanal acetic acid sodium | |
| 99.5 to 100.5% |