missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Adenosine-5'-diphosphate Monosodium Salt, 97.7%, MP Biomedicals™
Supplier: MP Biomedicals Inc 0219014901
Specifications
| Adenosine-5'-diphosphate Monosodium Salt | |
| White | |
| C10H15N5O10P2 | |
| 1 g | |
| XTWYTFMLZFPYCI-KQYNXXCUSA-N | |
| [({[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy]phosphonic acid | |
| 87704518 | |
| Powder |
| 20398-34-9 | |
| 0.977 | |
| MFCD00066473,MFCD00065470,MFCD00066635 | |
| adp monosodium salt, adenosine 5'-diphosphate, sodium salt, adenosine 5'-diphosphate sodium salt | |
| NC1=C2N=CN([C@@H]3O[C@H](COP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]3O)C2=NC=N1 | |
| 427.20 | |
| 449.19 |
Chemical Identifiers
| 20398-34-9 | |
| 427.20 | |
| XTWYTFMLZFPYCI-KQYNXXCUSA-N | |
| 87704518 | |
| NC1=C2N=CN([C@@H]3O[C@H](COP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]3O)C2=NC=N1 |
| C10H15N5O10P2 | |
| MFCD00066473,MFCD00065470,MFCD00066635 | |
| adp monosodium salt, adenosine 5'-diphosphate, sodium salt, adenosine 5'-diphosphate sodium salt | |
| [({[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy]phosphonic acid |