missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
4-Fluorophenyl sulfone, 99%, ACROS Organics™
$115.63 - $115.63
Chemical Identifiers
| CAS | 383-29-9 |
|---|---|
| Molecular Formula | C12H8F2O2S |
| Molecular Weight (g/mol) | 254.251 |
| MDL Number | MFCD00000350 |
| InChI Key | PLVUIVUKKJTSDM-UHFFFAOYSA-N |
| Synonym | 4-fluorophenyl sulfone, bis p-fluorophenyl sulfone, 4,4'-sulfonylbis fluorobenzene, bis 4-fluorophenyl sulfone, 4,4'-difluorodiphenyl sulfone, 4-fluorophenyl sulphone, 4-fluorophenylsulfone, bis 4-fluorophenyl sulfone, benzene, 1,1'-sulfonylbis 4-fluoro, 4,4'-difluorodiphenyl sulphone |
| PubChem CID | 67842 |
| IUPAC Name | 1-fluoro-4-(4-fluorophenyl)sulfonylbenzene |
| SMILES | C1=CC(=CC=C1F)S(=O)(=O)C2=CC=C(C=C2)F |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
| AC119620250 SDS |
Acros Organics
119620250 |
25g | Glass bottle |
Each for $115.63
|
|
AC119621000 SDS |
Acros Organics
AC119621000 |
100g | Glass bottle | N/A | N/A |
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
Chemical Identifiers
| 383-29-9 | |
| 254.251 | |
| PLVUIVUKKJTSDM-UHFFFAOYSA-N | |
| 67842 | |
| C1=CC(=CC=C1F)S(=O)(=O)C2=CC=C(C=C2)F |
| C12H8F2O2S | |
| MFCD00000350 | |
| 4-fluorophenyl sulfone, bis p-fluorophenyl sulfone, 4,4'-sulfonylbis fluorobenzene, bis 4-fluorophenyl sulfone, 4,4'-difluorodiphenyl sulfone, 4-fluorophenyl sulphone, 4-fluorophenylsulfone, bis 4-fluorophenyl sulfone, benzene, 1,1'-sulfonylbis 4-fluoro, 4,4'-difluorodiphenyl sulphone | |
| 1-fluoro-4-(4-fluorophenyl)sulfonylbenzene |
Specifications
| Authentic | |
| Brown to White | |
| 25g | |
| 98.5 | |
| 99% | |
| (FC6H4)2SO2 | |
| 4-fluorophenyl sulfone, bis p-fluorophenyl sulfone, 4,4'-sulfonylbis fluorobenzene, bis 4-fluorophenyl sulfone, 4,4'-difluorodiphenyl sulfone, 4-fluorophenyl sulphone, 4-fluorophenylsulfone, bis 4-fluorophenyl sulfone, benzene, 1,1'-sulfonylbis 4-fluoro, 4,4'-difluorodiphenyl sulphone | |
| C1=CC(=CC=C1F)S(=O)(=O)C2=CC=C(C=C2)F | |
| 254.251 | |
| 254.25 | |
| 99% |
| Glass bottle | |
| 97.0°C to 100.0°C | |
| 383-29-9 | |
| 100.0 | |
| C12H8F2O2S | |
| MFCD00000350 | |
| PLVUIVUKKJTSDM-UHFFFAOYSA-N | |
| 1-fluoro-4-(4-fluorophenyl)sulfonylbenzene | |
| 67842 | |
| Crystals or Powder | |
| 4-Fluorophenyl sulfone |