missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
4-Epichlortetracycline hydrochloride, ≥80%, can be used as secondary standard, ACROS Organics™
Manufacturer: Acros Organics 268231000
Specifications
| 4-Epichlortetracycline hydrochloride | |
| Glass bottle | |
| 250.0°C | |
| 97% | |
| 96.0 | |
| 97% | |
| MFCD09842537 | |
| Solubility in water: 67g/L. Other solubilities: 20g/L methanol | |
| CC1(C2CC3C(C(=O)C(=C(C3(C(=O)C2=C(C4=C(C=CC(=C41)Cl)O)O)O)O)C(=O)N)N(C)C)O.Cl | |
| 515.34 | |
| 515.34 | |
| ≥97.0% Total Base (on anhydrous substance), ≥80 wt% (as is, calculated) (HPLC) |
| Authentic | |
| Orange to Yellow | |
| 100mg | |
| 101342-45-4 | |
| 100.0 | |
| C22H24Cl2N2O8 | |
| epichlortetracycline hydrochloride | |
| QYAPHLRPFNSDNH-PNEIEYGESA-N | |
| (4R,4aS,5aS,6R,12aR)-7-chloro-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide;hydrochloride | |
| 92043146 | |
| Powder |
Chemical Identifiers
| 101342-45-4 | |
| 515.34 | |
| QYAPHLRPFNSDNH-PNEIEYGESA-N | |
| 92043146 | |
| CC1(C2CC3C(C(=O)C(=C(C3(C(=O)C2=C(C4=C(C=CC(=C41)Cl)O)O)O)O)C(=O)N)N(C)C)O.Cl |
| C22H24Cl2N2O8 | |
| MFCD09842537 | |
| epichlortetracycline hydrochloride | |
| (4R,4aS,5aS,6R,12aR)-7-chloro-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide;hydrochloride |
Safety and Handling
GHS P Statement Causes serious eye irritation. Suspected of damaging the unborn child.
GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. IF exposed or concerned: Get medical advice/attention.
LIGHT SENSITIVE