missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Methyl Red sodium salt, 0.02% w/v Aqueous Solution, Alfa Aesar™
Manufacturer: Thermo Fisher Scientific 44161AE
Specifications
| Methyl Red sodium salt | |
| 0.02% w/v | |
| MFCD00002426 | |
| CN(C)C1=CC=C(C=C1)N=NC2=CC=CC=C2C(=O)[O-].[Na+] | |
| 291.286 | |
| 291.29 | |
| Odorless | |
| 100mL |
| 845-10-3 | |
| C15H14N3NaO2 | |
| GNTPCYMJCJNRQB-UHFFFAOYSA-M | |
| sodium;2-[[4-(dimethylamino)phenyl]diazenyl]benzoate | |
| 4465632 | |
| Liquid | |
| Colorless |
Chemical Identifiers
| 845-10-3 | |
| 291.286 | |
| GNTPCYMJCJNRQB-UHFFFAOYSA-M | |
| sodium;2-[[4-(dimethylamino)phenyl]diazenyl]benzoate |
| C15H14N3NaO2 | |
| MFCD00002426 | |
| 4465632 | |
| CN(C)C1=CC=C(C=C1)N=NC2=CC=CC=C2C(=O)[O-].[Na+] |
Safety and Handling
EINECSNumber : 212-682-9
TSCA : Yes
Recommended Storage : Ambient temperatures