Learn More
Diphenyl Phosphite, Contains Varying Amounts of Phenol and (C6H5O)3P, ACROS Organics™
$26.12 - $221.66
Chemical Identifiers
| CAS | 4712-55-4 |
|---|---|
| Molecular Formula | C12H11O3P |
| Molecular Weight (g/mol) | 234.19 |
| MDL Number | MFCD00044497 |
| InChI Key | CDXVUROVRIFQMV-UHFFFAOYSA-N |
| Synonym | diphenoxyphosphine oxide, diphenyl hydrogen phosphite, diphenyl phosphite, diphenyl phosphonate, phenyl phosphonate pho 2hpo, phenyl phosphonate, pho 2hpo, phosphonic acid diphenyl ester, phosphonic acid, diphenyl ester, phosphorous acid, diphenyl ester, unii-5144js6xum |
| PubChem CID | 6327546 |
| IUPAC Name | oxo(diphenoxy)phosphanium |
| SMILES | C1=CC=C(C=C1)O[P+](=O)OC2=CC=CC=C2 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC117390050
|
Thermo Fisher Scientific
117390050 |
5g | Glass bottle |
Each for $26.12
|
|
AC117395000
|
Thermo Fisher Scientific
117395000 |
500g | Glass bottle |
Each for $111.46
|
|
AC117390010
|
Thermo Fisher Scientific
117390010 |
1kg | Glass bottle |
Each for $221.66
|
|
Chemical Identifiers
| 4712-55-4 | |
| 234.19 | |
| CDXVUROVRIFQMV-UHFFFAOYSA-N | |
| 6327546 | |
| C1=CC=C(C=C1)O[P+](=O)OC2=CC=CC=C2 |
| C12H11O3P | |
| MFCD00044497 | |
| diphenoxyphosphine oxide, diphenyl hydrogen phosphite, diphenyl phosphite, diphenyl phosphonate, phenyl phosphonate pho 2hpo, phenyl phosphonate, pho 2hpo, phosphonic acid diphenyl ester, phosphonic acid, diphenyl ester, phosphorous acid, diphenyl ester, unii-5144js6xum | |
| oxo(diphenoxy)phosphanium |
Specifications
| 15mg KOH/g max. | |
| 176°C | |
| Glass bottle | |
| 1.217 | |
| Undesignated | |
| 5g | |
| C12H11O3P | |
| MFCD00044497 | |
| 04,210 | |
| Solubility in water: insoluble | |
| C1=CC=C(C=C1)O[P+](=O)OC2=CC=CC=C2 | |
| 234.19 | |
| 234.19 | |
| Diphenyl phosphite |
| 1.2170g/mL | |
| Authentic | |
| 1.5565 to 1.5585 | |
| 218°C to 219°C (26.0mmHg) | |
| 12°C | |
| 4712-55-4 | |
| (C6H5O)2P(O)H | |
| 06, I, 94 | |
| diphenoxyphosphine oxide, diphenyl hydrogen phosphite, diphenyl phosphite, diphenyl phosphonate, phenyl phosphonate pho 2hpo, phenyl phosphonate, pho 2hpo, phosphonic acid diphenyl ester, phosphonic acid, diphenyl ester, phosphorous acid, diphenyl ester, unii-5144js6xum | |
| CDXVUROVRIFQMV-UHFFFAOYSA-N | |
| oxo(diphenoxy)phosphanium | |
| 6327546 | |
| Liquid |
Safety and Handling
GHS H Statement:
Causes serious eye damage.
Causes severe skin burns and eye damage.
GHS P Statement:
IF SWALLOWED: rinse mouth. Do NOT induce vomiting.
Wear eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.
Immediately call a POISON CENTER or doctor/physician.
WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification.
GHS Signal Word: Danger
EINECSNumber : 225-202-8
TSCA : TSCA