missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Calcium phosphate, monobasic, 90%, pure, ACROS Organics™
Manufacturer: Thermo Fisher Scientific AC378610010
Specifications
| Calcium phosphate, monobasic | |
| 88% min. (Complexometry) | |
| Ca(H2PO4)2 | |
| 15,1695 | |
| Solubility in water: insoluble | |
| OP(=O)(O)[O-].OP(=O)(O)[O-].[Ca+2] | |
| 234.05 | |
| CHEBI:35433 | |
| 90% | |
| Plastic bottle | |
| 1kg |
| 7758-23-8 | |
| CaH4O8P2 | |
| MFCD00010898 | |
| acid calcium phosphate, c 38 phosphate, calcium biphosphate, calcium dihydrogen orthophosphate, calcium dihydrogen phosphate, calcium diorthophosphate, monobasic calcium phosphate, monocalcium orthophosphate, monocalcium phosphate, monobasic, primary calcium phosphate | |
| YYRMJZQKEFZXMX-UHFFFAOYSA-L | |
| calcium;dihydrogen phosphate | |
| 24454 | |
| 234.05 | |
| Pure | |
| Solubility in water: insoluble in water. |
Chemical Identifiers
| 7758-23-8 | |
| 234.05 | |
| YYRMJZQKEFZXMX-UHFFFAOYSA-L | |
| 24454 | |
| calcium;dihydrogen phosphate |
| CaH4O8P2 | |
| MFCD00010898 | |
| acid calcium phosphate, c 38 phosphate, calcium biphosphate, calcium dihydrogen orthophosphate, calcium dihydrogen phosphate, calcium diorthophosphate, monobasic calcium phosphate, monocalcium orthophosphate, monocalcium phosphate, monobasic, primary calcium phosphate | |
| CHEBI:35433 | |
| OP(=O)(O)[O-].OP(=O)(O)[O-].[Ca+2] |
Safety and Handling
GHS H Statement
Causes serious eye damage.
GHS P Statement
Wear eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if present and easy to do.
Continue rinsing.
Immediately call a POISON CENTER or doctor/physici
GHS Signal Word: Danger
EINECSNumber : 231-837-1