missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 97%, ACROS Organics™
Manufacturer: Acros Organics AC366390050
Specifications
| 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid | |
| Glass bottle | |
| 227.0°C to 232.0°C | |
| 97% | |
| 96.0 | |
| 97% | |
| MFCD01863710 | |
| Solubility in water: insoluble. | |
| B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)O | |
| 248.09 | |
| 248.09 | |
| 97% |
| Authentic | |
| White | |
| 5g | |
| 180516-87-4 | |
| 100.0 | |
| C13H17BO4 | |
| 4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl benzoic acid | |
| IYDKBQIEOBXLTP-UHFFFAOYSA-N | |
| 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid | |
| 2734621 | |
| Crystalline Powder |
Chemical Identifiers
| 180516-87-4 | |
| 248.09 | |
| IYDKBQIEOBXLTP-UHFFFAOYSA-N | |
| 2734621 | |
| B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)O |
| C13H17BO4 | |
| MFCD01863710 | |
| 4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl benzoic acid | |
| 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.
If skin irritation occurs: Get medical advice/attention.
If eye irritation persists: Get medical advice/attention.
Recommended Storage : Refrigerator +4°C