Carboxylic acid esters
- (16)
- (79)
- (11)
- (3)
- (2)
- (22)
- (1)
- (83)
- (3)
- (2)
- (2)
- (8)
- (3)
- (4)
- (1)
- (1)
- (7)
- (15)
- (5)
- (2)
- (2)
- (5)
- (2)
- (4)
- (2)
- (4)
- (3)
- (1)
- (7)
- (6)
- (3)
- (3)
- (16)
- (3)
- (112)
- (4)
- (2)
- (2)
- (4)
- (1)
Résultats de la recherche filtrée
MilliporeSigma™ Dihydrorhodamine 123, Calbiochem™,
CAS: 109244-58-8 Formule moléculaire: C21H18N2O3 Poids moléculaire (g/mol): 346.39 Numéro MDL: MFCD04221428 Clé InChI: FNEZBBILNYNQGC-UHFFFAOYSA-N Synonyme: dihydrorhodamine 123,dihydrorhodamine,methyl 2-3,6-diamino-9h-xanthen-9-yl benzoate,benzoic acid, 2-3,6-diamino-9h-xanthen-9-yl-, methyl ester,dihydrorhodamine-123 CID PubChem: 105032 Nom IUPAC: methyl 2-(3,6-diamino-9H-xanthen-9-yl)benzoate SMILES: COC(=O)C1=CC=CC=C1C1C2=CC=C(N)C=C2OC2=CC(N)=CC=C12
| Poids moléculaire (g/mol) | 346.39 |
|---|---|
| Synonyme | dihydrorhodamine 123,dihydrorhodamine,methyl 2-3,6-diamino-9h-xanthen-9-yl benzoate,benzoic acid, 2-3,6-diamino-9h-xanthen-9-yl-, methyl ester,dihydrorhodamine-123 |
| Numéro MDL | MFCD04221428 |
| CAS | 109244-58-8 |
| CID PubChem | 105032 |
| Nom IUPAC | methyl 2-(3,6-diamino-9H-xanthen-9-yl)benzoate |
| Clé InChI | FNEZBBILNYNQGC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC=C1C1C2=CC=C(N)C=C2OC2=CC(N)=CC=C12 |
| Formule moléculaire | C21H18N2O3 |
Mono-Methyl Phthalate Analytical Standard, MilliporeSigma™ Supelco™
Mono-Methyl phthalate belongs to the class of phthalates that is broadly employed as plasticizers in various domestic. Commonly used in industrial products, personal care products, pharmaceuticals, medical devices, and paints.
Dimethyl Fumarate, Certified Reference Material, MilliporeSigma™ Supelco™
Pharmaceutical secondary standards for application in quality control. Provides pharma laboratories and manufacturers with a convenient, and cost-effective alternative to the preparation of in-house working standards.
Methyl tiglate, 98%
CAS: 6622-76-0 Formule moléculaire: C6H10O2 Poids moléculaire (g/mol): 114.14 Numéro MDL: MFCD00016654 Clé InChI: YYJWBYNQJLBIGS-PLNGDYQASA-N Synonyme: methyl tiglate,tiglic acid methyl ester,methyl 2-methylbut-2-enoate,methyl 2-methyl-2-butenoate,methyl e-2-methylcrotonate,methyl 2-methylcrotonate,methyl alpha-methylcrotonate,methyl trans-2-methylcrotonate,2-butenoic acid, 2-methyl-, methyl ester, e,crotonic acid, 2-methyl-, methyl ester, e CID PubChem: 5323652 Nom IUPAC: methyl (E)-2-methylbut-2-enoate SMILES: COC(=O)C(\C)=C/C
| Poids moléculaire (g/mol) | 114.14 |
|---|---|
| Synonyme | methyl tiglate,tiglic acid methyl ester,methyl 2-methylbut-2-enoate,methyl 2-methyl-2-butenoate,methyl e-2-methylcrotonate,methyl 2-methylcrotonate,methyl alpha-methylcrotonate,methyl trans-2-methylcrotonate,2-butenoic acid, 2-methyl-, methyl ester, e,crotonic acid, 2-methyl-, methyl ester, e |
| Numéro MDL | MFCD00016654 |
| CAS | 6622-76-0 |
| CID PubChem | 5323652 |
| Nom IUPAC | methyl (E)-2-methylbut-2-enoate |
| Clé InChI | YYJWBYNQJLBIGS-PLNGDYQASA-N |
| SMILES | COC(=O)C(\C)=C/C |
| Formule moléculaire | C6H10O2 |
Dimethyl fumarate, 99%
CAS: 624-49-7 Formule moléculaire: C6H8O4 Poids moléculaire (g/mol): 144.13 Numéro MDL: MFCD00064438 Clé InChI: LDCRTTXIJACKKU-ONEGZZNKSA-N Synonyme: dimethyl fumarate,tecfidera,e-dimethyl fumarate,fumaderm,dimethyl e-but-2-enedioate,fumaric acid, dimethyl ester,boletic acid dimethyl ester,fumaric acid dimethyl ester,methyl fumarate,dimethyl trans-ethylenedicarboxylate CID PubChem: 637568 ChEBI: CHEBI:76004 Nom IUPAC: dimethyl (E)-but-2-enedioate SMILES: COC(=O)C=CC(=O)OC
| Poids moléculaire (g/mol) | 144.13 |
|---|---|
| Synonyme | dimethyl fumarate,tecfidera,e-dimethyl fumarate,fumaderm,dimethyl e-but-2-enedioate,fumaric acid, dimethyl ester,boletic acid dimethyl ester,fumaric acid dimethyl ester,methyl fumarate,dimethyl trans-ethylenedicarboxylate |
| Numéro MDL | MFCD00064438 |
| CAS | 624-49-7 |
| CID PubChem | 637568 |
| ChEBI | CHEBI:76004 |
| Nom IUPAC | dimethyl (E)-but-2-enedioate |
| Clé InChI | LDCRTTXIJACKKU-ONEGZZNKSA-N |
| SMILES | COC(=O)C=CC(=O)OC |
| Formule moléculaire | C6H8O4 |
2,2,2-Trifluoroethyl methacrylate, 99%, stabilized, Thermo Scientific Chemicals
CAS: 352-87-4 Formule moléculaire: C6H7F3O2 Poids moléculaire (g/mol): 168.12 Numéro MDL: MFCD00013576,MFCD00274739 Clé InChI: QTKPMCIBUROOGY-UHFFFAOYSA-N Synonyme: 2,2,2-trifluoroethyl methacrylate,trifluoroethyl methacrylate,methacrylic acid 2,2,2-trifluoroethyl ester,2,2,2-trifluoroethylmethacrylate,2-propenoic acid, 2-methyl-, 2,2,2-trifluoroethyl ester,2-methyl-acrylic acid 2,2,2-trifluoro-ethyl ester,2-propenoic acid, 2-methyl-, trifluoroethyl ester,2-methyl-2-propenoic acid 2,2,2-trifluoroethyl ester,2,2,2-trifluoroethyl m,acmc-1af8z CID PubChem: 9608 Nom IUPAC: 2,2,2-trifluoroethyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCC(F)(F)F
| Poids moléculaire (g/mol) | 168.12 |
|---|---|
| Synonyme | 2,2,2-trifluoroethyl methacrylate,trifluoroethyl methacrylate,methacrylic acid 2,2,2-trifluoroethyl ester,2,2,2-trifluoroethylmethacrylate,2-propenoic acid, 2-methyl-, 2,2,2-trifluoroethyl ester,2-methyl-acrylic acid 2,2,2-trifluoro-ethyl ester,2-propenoic acid, 2-methyl-, trifluoroethyl ester,2-methyl-2-propenoic acid 2,2,2-trifluoroethyl ester,2,2,2-trifluoroethyl m,acmc-1af8z |
| Numéro MDL | MFCD00013576,MFCD00274739 |
| CAS | 352-87-4 |
| CID PubChem | 9608 |
| Nom IUPAC | 2,2,2-trifluoroethyl 2-methylprop-2-enoate |
| Clé InChI | QTKPMCIBUROOGY-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCC(F)(F)F |
| Formule moléculaire | C6H7F3O2 |
Methyl 1-methylpyrrole-2-carboxylate, 99%
CAS: 37619-24-2 Formule moléculaire: C7H9NO2 Poids moléculaire (g/mol): 139.154 Numéro MDL: MFCD00052747 Clé InChI: APHVGKYWHWFAQV-UHFFFAOYSA-N Synonyme: methyl 1-methyl-1h-pyrrole-2-carboxylate,methyl1-methyl-1h-pyrrole-2-carboxylate,1-methyl-1h-pyrrole-2-carboxylic acid methyl ester,methyl 1-methyl-2-pyrrolecarboxylate,1-methylpyrrole-2-carboxylic acid methyl ester,pubchem12438,acmc-209iue,methylmethylpyrrolecarboxylate,2-methoxycarbonyl-1-methylpyrrole,methyl 1-methyl-pyrrole-2-carboxylate CID PubChem: 142178 Nom IUPAC: methyl 1-methylpyrrole-2-carboxylate SMILES: CN1C=CC=C1C(=O)OC
| Poids moléculaire (g/mol) | 139.154 |
|---|---|
| Synonyme | methyl 1-methyl-1h-pyrrole-2-carboxylate,methyl1-methyl-1h-pyrrole-2-carboxylate,1-methyl-1h-pyrrole-2-carboxylic acid methyl ester,methyl 1-methyl-2-pyrrolecarboxylate,1-methylpyrrole-2-carboxylic acid methyl ester,pubchem12438,acmc-209iue,methylmethylpyrrolecarboxylate,2-methoxycarbonyl-1-methylpyrrole,methyl 1-methyl-pyrrole-2-carboxylate |
| Numéro MDL | MFCD00052747 |
| CAS | 37619-24-2 |
| CID PubChem | 142178 |
| Nom IUPAC | methyl 1-methylpyrrole-2-carboxylate |
| Clé InChI | APHVGKYWHWFAQV-UHFFFAOYSA-N |
| SMILES | CN1C=CC=C1C(=O)OC |
| Formule moléculaire | C7H9NO2 |
Dimethyl fumarate, 99%
CAS: 624-49-7 Formule moléculaire: C6H8O4 Poids moléculaire (g/mol): 144.126 Numéro MDL: MFCD00064438 Clé InChI: LDCRTTXIJACKKU-ONEGZZNKSA-N Synonyme: dimethyl fumarate,tecfidera,e-dimethyl fumarate,fumaderm,dimethyl e-but-2-enedioate,fumaric acid, dimethyl ester,boletic acid dimethyl ester,fumaric acid dimethyl ester,methyl fumarate,dimethyl trans-ethylenedicarboxylate CID PubChem: 637568 ChEBI: CHEBI:76004 Nom IUPAC: dimethyl (E)-but-2-enedioate SMILES: COC(=O)C=CC(=O)OC
| Poids moléculaire (g/mol) | 144.126 |
|---|---|
| Synonyme | dimethyl fumarate,tecfidera,e-dimethyl fumarate,fumaderm,dimethyl e-but-2-enedioate,fumaric acid, dimethyl ester,boletic acid dimethyl ester,fumaric acid dimethyl ester,methyl fumarate,dimethyl trans-ethylenedicarboxylate |
| Numéro MDL | MFCD00064438 |
| CAS | 624-49-7 |
| CID PubChem | 637568 |
| ChEBI | CHEBI:76004 |
| Nom IUPAC | dimethyl (E)-but-2-enedioate |
| Clé InChI | LDCRTTXIJACKKU-ONEGZZNKSA-N |
| SMILES | COC(=O)C=CC(=O)OC |
| Formule moléculaire | C6H8O4 |
Isopropenyl acetate, 99%
CAS: 108-22-5 Formule moléculaire: C5H8O2 Poids moléculaire (g/mol): 100.12 Numéro MDL: MFCD00008709 Clé InChI: HETCEOQFVDFGSY-UHFFFAOYSA-N Synonyme: isopropenyl acetate,2-acetoxypropene,1-methylvinyl acetate,2-acetoxypropylene,methylvinyl acetate,1-propen-2-ol, acetate,propen-2-yl acetate,acetic acid isopropenyl ester,1-acetoxy-1-methylethylene,1-propen-2-yl acetate CID PubChem: 7916 Nom IUPAC: prop-1-en-2-yl acetate SMILES: CC(=C)OC(C)=O
| Poids moléculaire (g/mol) | 100.12 |
|---|---|
| Synonyme | isopropenyl acetate,2-acetoxypropene,1-methylvinyl acetate,2-acetoxypropylene,methylvinyl acetate,1-propen-2-ol, acetate,propen-2-yl acetate,acetic acid isopropenyl ester,1-acetoxy-1-methylethylene,1-propen-2-yl acetate |
| Numéro MDL | MFCD00008709 |
| CAS | 108-22-5 |
| CID PubChem | 7916 |
| Nom IUPAC | prop-1-en-2-yl acetate |
| Clé InChI | HETCEOQFVDFGSY-UHFFFAOYSA-N |
| SMILES | CC(=C)OC(C)=O |
| Formule moléculaire | C5H8O2 |
Ethyl propiolate, 99%
CAS: 623-47-2 Formule moléculaire: C5H6O2 Poids moléculaire (g/mol): 98.10 Numéro MDL: MFCD00009184 Clé InChI: FMVJYQGSRWVMQV-UHFFFAOYSA-N Synonyme: ethyl propiolate,ethyl acetylenecarboxylate,2-propynoic acid, ethyl ester,propiolic acid ethyl ester,ethyl propynoate,ethoxycarbonyl acetylene,ethyl 2-propynoate,propiolic acid, ethyl ester,unii-w235g5u52s,propynoic acid ethyl ester CID PubChem: 12182 ChEBI: CHEBI:51740 Nom IUPAC: ethyl prop-2-ynoate SMILES: CCOC(=O)C#C
| Poids moléculaire (g/mol) | 98.10 |
|---|---|
| Synonyme | ethyl propiolate,ethyl acetylenecarboxylate,2-propynoic acid, ethyl ester,propiolic acid ethyl ester,ethyl propynoate,ethoxycarbonyl acetylene,ethyl 2-propynoate,propiolic acid, ethyl ester,unii-w235g5u52s,propynoic acid ethyl ester |
| Numéro MDL | MFCD00009184 |
| CAS | 623-47-2 |
| CID PubChem | 12182 |
| ChEBI | CHEBI:51740 |
| Nom IUPAC | ethyl prop-2-ynoate |
| Clé InChI | FMVJYQGSRWVMQV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C#C |
| Formule moléculaire | C5H6O2 |
Methyl Propionate, 99+%
CAS: 554-12-1 Formule moléculaire: C4H8O2 Poids moléculaire (g/mol): 88.11 Numéro MDL: MFCD00009306 Clé InChI: RJUFJBKOKNCXHH-UHFFFAOYSA-N Synonyme: methyl propionate,propanoic acid, methyl ester,methyl propylate,methylpropionate,propionic acid, methyl ester,propionate de methyle,propanoic acid methyl ester,fema number 2742,propionic acid methyl ester,methyl propionate natural CID PubChem: 11124 Nom IUPAC: methyl propanoate SMILES: CCC(=O)OC
| Poids moléculaire (g/mol) | 88.11 |
|---|---|
| Synonyme | methyl propionate,propanoic acid, methyl ester,methyl propylate,methylpropionate,propionic acid, methyl ester,propionate de methyle,propanoic acid methyl ester,fema number 2742,propionic acid methyl ester,methyl propionate natural |
| Numéro MDL | MFCD00009306 |
| CAS | 554-12-1 |
| CID PubChem | 11124 |
| Nom IUPAC | methyl propanoate |
| Clé InChI | RJUFJBKOKNCXHH-UHFFFAOYSA-N |
| SMILES | CCC(=O)OC |
| Formule moléculaire | C4H8O2 |
Methyl methoxyacetate, 99%
CAS: 6290-49-9 Formule moléculaire: C4H8O3 Poids moléculaire (g/mol): 104.11 Numéro MDL: MFCD00008451 Clé InChI: QRMHDGWGLNLHMN-UHFFFAOYSA-N Synonyme: methyl methoxyacetate,acetic acid, methoxy-, methyl ester,methoxyacetic acid methyl ester,methyl-2-methoxyacetate,methoxyacetic acid, methyl ester,acetic acid, 2-methoxy-, methyl ester,unii-n960nq69lf,methoxy acetic acid methyl ester,methyl metoxyacetate,methyl methoxylacetate CID PubChem: 80507 ChEBI: CHEBI:34841 Nom IUPAC: methyl 2-methoxyacetate SMILES: COCC(=O)OC
| Poids moléculaire (g/mol) | 104.11 |
|---|---|
| Synonyme | methyl methoxyacetate,acetic acid, methoxy-, methyl ester,methoxyacetic acid methyl ester,methyl-2-methoxyacetate,methoxyacetic acid, methyl ester,acetic acid, 2-methoxy-, methyl ester,unii-n960nq69lf,methoxy acetic acid methyl ester,methyl metoxyacetate,methyl methoxylacetate |
| Numéro MDL | MFCD00008451 |
| CAS | 6290-49-9 |
| CID PubChem | 80507 |
| ChEBI | CHEBI:34841 |
| Nom IUPAC | methyl 2-methoxyacetate |
| Clé InChI | QRMHDGWGLNLHMN-UHFFFAOYSA-N |
| SMILES | COCC(=O)OC |
| Formule moléculaire | C4H8O3 |
Methyl p-toluate, 99%
CAS: 99-75-2 Formule moléculaire: C9H10O2 Poids moléculaire (g/mol): 150.177 Numéro MDL: MFCD00008441 Clé InChI: QSSJZLPUHJDYKF-UHFFFAOYSA-N Synonyme: methyl p-toluate,methyl-p-toluate,p-carbomethoxytoluene,methyl 4-toluate,4-methylbenzoic acid methyl ester,methyl p-methylbenzoate,benzoic acid, 4-methyl-, methyl ester,4-methoxycarbonyl toluene,p-toluic acid, methyl ester,methyl p-toluenecarboxylate CID PubChem: 7455 Nom IUPAC: methyl 4-methylbenzoate SMILES: CC1=CC=C(C=C1)C(=O)OC
| Poids moléculaire (g/mol) | 150.177 |
|---|---|
| Synonyme | methyl p-toluate,methyl-p-toluate,p-carbomethoxytoluene,methyl 4-toluate,4-methylbenzoic acid methyl ester,methyl p-methylbenzoate,benzoic acid, 4-methyl-, methyl ester,4-methoxycarbonyl toluene,p-toluic acid, methyl ester,methyl p-toluenecarboxylate |
| Numéro MDL | MFCD00008441 |
| CAS | 99-75-2 |
| CID PubChem | 7455 |
| Nom IUPAC | methyl 4-methylbenzoate |
| Clé InChI | QSSJZLPUHJDYKF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)OC |
| Formule moléculaire | C9H10O2 |
Methyl trifluoroacetate, 99%
CAS: 431-47-0 Formule moléculaire: C3H3F3O2 Poids moléculaire (g/mol): 128.05 Numéro MDL: MFCD00000417 Clé InChI: VMVNZNXAVJHNDJ-UHFFFAOYSA-N Synonyme: methyl trifluoroacetate,trifluoroacetic acid methyl ester,acetic acid, trifluoro-, methyl ester,methyltrifluoroacetate,2,2,2-trifluoromethylacetate,acetic acid, 2,2,2-trifluoro-, methyl ester,methyl trifluoracetate,tfamt,methyl triflouroacetate,pubchem12490 CID PubChem: 9893 Nom IUPAC: methyl 2,2,2-trifluoroacetate SMILES: COC(=O)C(F)(F)F
| Poids moléculaire (g/mol) | 128.05 |
|---|---|
| Synonyme | methyl trifluoroacetate,trifluoroacetic acid methyl ester,acetic acid, trifluoro-, methyl ester,methyltrifluoroacetate,2,2,2-trifluoromethylacetate,acetic acid, 2,2,2-trifluoro-, methyl ester,methyl trifluoracetate,tfamt,methyl triflouroacetate,pubchem12490 |
| Numéro MDL | MFCD00000417 |
| CAS | 431-47-0 |
| CID PubChem | 9893 |
| Nom IUPAC | methyl 2,2,2-trifluoroacetate |
| Clé InChI | VMVNZNXAVJHNDJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C(F)(F)F |
| Formule moléculaire | C3H3F3O2 |
Methyl m-toluate, 98%
CAS: 99-36-5 Formule moléculaire: C9H10O2 Poids moléculaire (g/mol): 150.177 Numéro MDL: MFCD00008436 Clé InChI: CPXCDEMFNPKOEF-UHFFFAOYSA-N Synonyme: methyl m-toluate,methyl 3-toluate,benzoic acid, 3-methyl-, methyl ester,methyl m-methylbenzoate,meta-toluic acid, methyl ester,3-methylbenzoic acid methyl ester,methyl-m-methyl benzoate,m-toluic acid, methyl ester,methyl3-methylbenzoate,m-toluic acid methyl ester CID PubChem: 7435 Nom IUPAC: methyl 3-methylbenzoate SMILES: CC1=CC=CC(=C1)C(=O)OC
| Poids moléculaire (g/mol) | 150.177 |
|---|---|
| Synonyme | methyl m-toluate,methyl 3-toluate,benzoic acid, 3-methyl-, methyl ester,methyl m-methylbenzoate,meta-toluic acid, methyl ester,3-methylbenzoic acid methyl ester,methyl-m-methyl benzoate,m-toluic acid, methyl ester,methyl3-methylbenzoate,m-toluic acid methyl ester |
| Numéro MDL | MFCD00008436 |
| CAS | 99-36-5 |
| CID PubChem | 7435 |
| Nom IUPAC | methyl 3-methylbenzoate |
| Clé InChI | CPXCDEMFNPKOEF-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC(=C1)C(=O)OC |
| Formule moléculaire | C9H10O2 |