Carboxylic acid esters
- (15)
- (72)
- (9)
- (3)
- (22)
- (1)
- (80)
- (23)
- (3)
- (2)
- (2)
- (8)
- (3)
- (4)
- (1)
- (1)
- (7)
- (14)
- (5)
- (2)
- (1)
- (5)
- (2)
- (4)
- (2)
- (4)
- (3)
- (1)
- (7)
- (6)
- (3)
- (2)
- (16)
- (1)
- (112)
- (3)
- (1)
- (4)
- (2)
- (522)
Résultats de la recherche filtrée
Methyl 4,4,4-trifluorocrotonate, 97%
CAS: 85694-31-1 Formule moléculaire: C5H5F3O2 Poids moléculaire (g/mol): 154.09 Numéro MDL: MFCD00077567 Clé InChI: DMMZYYLXAGRBDO-NSCUHMNNSA-N Synonyme: methyl 4,4,4-trifluorocrotonate,methyl 2e-4,4,4-trifluorobut-2-enoate,methyl4,4,4-trifluorocrotonate,methyl e-3-trifluoromethyl propenoate,e-methyl 4,4,4-trifluorobut-2-enoate,methyl 4,4,4-trifluorobut-2-enoate,heddpndiaicichibemultbb`,methyl 4,4,4-trifluorocrotonat,methyl e-4,4,4-trifluorobut-2-enoate,4,4,4-trifluorocrotonic acid methyl ester CID PubChem: 5371282 Nom IUPAC: methyl (E)-4,4,4-trifluorobut-2-enoate SMILES: COC(=O)\C=C\C(F)(F)F
| Poids moléculaire (g/mol) | 154.09 |
|---|---|
| Synonyme | methyl 4,4,4-trifluorocrotonate,methyl 2e-4,4,4-trifluorobut-2-enoate,methyl4,4,4-trifluorocrotonate,methyl e-3-trifluoromethyl propenoate,e-methyl 4,4,4-trifluorobut-2-enoate,methyl 4,4,4-trifluorobut-2-enoate,heddpndiaicichibemultbb`,methyl 4,4,4-trifluorocrotonat,methyl e-4,4,4-trifluorobut-2-enoate,4,4,4-trifluorocrotonic acid methyl ester |
| Numéro MDL | MFCD00077567 |
| CAS | 85694-31-1 |
| CID PubChem | 5371282 |
| Nom IUPAC | methyl (E)-4,4,4-trifluorobut-2-enoate |
| Clé InChI | DMMZYYLXAGRBDO-NSCUHMNNSA-N |
| SMILES | COC(=O)\C=C\C(F)(F)F |
| Formule moléculaire | C5H5F3O2 |
n-Hexyl methacrylate, 97%, stab. with 100ppm 4-methoxyphenol
CAS: 142-09-6 Formule moléculaire: C10H18O2 Poids moléculaire (g/mol): 170.25 Numéro MDL: MFCD00015283 Clé InChI: LNCPIMCVTKXXOY-UHFFFAOYSA-N Synonyme: hexyl methacrylate,n-hexyl methacrylate,hexyl 2-methyl-2-propenoate,methacrylic acid, hexyl ester,2-propenoic acid, 2-methyl-, hexyl ester,unii-538b2q3hsv,ccris 4824,hexyl 2-methylacrylate,methacrylic acid hexyl ester,dsstox_cid_5406 CID PubChem: 8872 Nom IUPAC: hexyl 2-methylprop-2-enoate SMILES: CCCCCCOC(=O)C(C)=C
| Poids moléculaire (g/mol) | 170.25 |
|---|---|
| Synonyme | hexyl methacrylate,n-hexyl methacrylate,hexyl 2-methyl-2-propenoate,methacrylic acid, hexyl ester,2-propenoic acid, 2-methyl-, hexyl ester,unii-538b2q3hsv,ccris 4824,hexyl 2-methylacrylate,methacrylic acid hexyl ester,dsstox_cid_5406 |
| Numéro MDL | MFCD00015283 |
| CAS | 142-09-6 |
| CID PubChem | 8872 |
| Nom IUPAC | hexyl 2-methylprop-2-enoate |
| Clé InChI | LNCPIMCVTKXXOY-UHFFFAOYSA-N |
| SMILES | CCCCCCOC(=O)C(C)=C |
| Formule moléculaire | C10H18O2 |
2,2,3,3,4,4,5,5-Octafluoropentyl methacrylate, 98%, stab.
CAS: 355-93-1 Formule moléculaire: C9H8F8O2 Poids moléculaire (g/mol): 300.15 Numéro MDL: MFCD00039278 Clé InChI: ZNJXRXXJPIFFAO-UHFFFAOYSA-N Synonyme: 1h,1h,5h-octafluoropentyl methacrylate,2,2,3,3,4,4,5,5-octafluoropentyl methacrylate,octafluoropentyl methacrylate,1h,1h,5h-perfluoropentyl methacrylate,1h,1h,5h-octafluoropentyl methacrylate stabilized with mehq,2-propenoic acid, 2-methyl-, 2,2,3,3,4,4,5,5-octafluoropentyl ester,methacrylic acid 1h,1h,5h-perfluoropentyl ester,methacrylic acid 1h,1h,5h-octafluoropentyl ester,octafluoropentyl methacrylate polymer,1h,1h,5h-octafluoropentylmethacrylate CID PubChem: 67739 Nom IUPAC: 2,2,3,3,4,4,5,5-octafluoropentyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F
| Poids moléculaire (g/mol) | 300.15 |
|---|---|
| Synonyme | 1h,1h,5h-octafluoropentyl methacrylate,2,2,3,3,4,4,5,5-octafluoropentyl methacrylate,octafluoropentyl methacrylate,1h,1h,5h-perfluoropentyl methacrylate,1h,1h,5h-octafluoropentyl methacrylate stabilized with mehq,2-propenoic acid, 2-methyl-, 2,2,3,3,4,4,5,5-octafluoropentyl ester,methacrylic acid 1h,1h,5h-perfluoropentyl ester,methacrylic acid 1h,1h,5h-octafluoropentyl ester,octafluoropentyl methacrylate polymer,1h,1h,5h-octafluoropentylmethacrylate |
| Numéro MDL | MFCD00039278 |
| CAS | 355-93-1 |
| CID PubChem | 67739 |
| Nom IUPAC | 2,2,3,3,4,4,5,5-octafluoropentyl 2-methylprop-2-enoate |
| Clé InChI | ZNJXRXXJPIFFAO-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| Formule moléculaire | C9H8F8O2 |
Methyl 3-bromopropionate, 97%
CAS: 3395-91-3 Formule moléculaire: C4H7BrO2 Poids moléculaire (g/mol): 167.00 Numéro MDL: MFCD00000250 Clé InChI: KQEVIFKPZOGBMZ-UHFFFAOYSA-N Synonyme: methyl 3-bromopropionate,propanoic acid, 3-bromo-, methyl ester,methyl beta-bromopropionate,3-bromopropionic acid methyl ester,propionic acid, 3-bromo-, methyl ester,3-bromopropanoic acid methyl ester,unii-y803ch1p4w,beta-bromopropionic acid, methyl ester,methyl .beta.-bromopropionate,3-bromo-propionic acid methyl ester CID PubChem: 76934 Nom IUPAC: methyl 3-bromopropanoate SMILES: COC(=O)CCBr
| Poids moléculaire (g/mol) | 167.00 |
|---|---|
| Synonyme | methyl 3-bromopropionate,propanoic acid, 3-bromo-, methyl ester,methyl beta-bromopropionate,3-bromopropionic acid methyl ester,propionic acid, 3-bromo-, methyl ester,3-bromopropanoic acid methyl ester,unii-y803ch1p4w,beta-bromopropionic acid, methyl ester,methyl .beta.-bromopropionate,3-bromo-propionic acid methyl ester |
| Numéro MDL | MFCD00000250 |
| CAS | 3395-91-3 |
| CID PubChem | 76934 |
| Nom IUPAC | methyl 3-bromopropanoate |
| Clé InChI | KQEVIFKPZOGBMZ-UHFFFAOYSA-N |
| SMILES | COC(=O)CCBr |
| Formule moléculaire | C4H7BrO2 |
Dimethyl acetylenedicarboxylate, 98%
CAS: 762-42-5 Formule moléculaire: C6H6O4 Poids moléculaire (g/mol): 142.11 Numéro MDL: MFCD00008456 Clé InChI: VHILMKFSCRWWIJ-UHFFFAOYSA-N Synonyme: dimethyl acetylenedicarboxylate,2-butynedioic acid, dimethyl ester,1,4-dimethyl but-2-ynedioate,dimethyl butynedioate,dimethyl 2-butynedioate,acetylenedicarboxylic acid dimethyl ester,dmad,methyl acetylenedicarboxylate,bis methoxycarbonyl acetylene,di carbomethoxy acetylene CID PubChem: 12980 Nom IUPAC: dimethyl but-2-ynedioate SMILES: COC(=O)C#CC(=O)OC
| Poids moléculaire (g/mol) | 142.11 |
|---|---|
| Synonyme | dimethyl acetylenedicarboxylate,2-butynedioic acid, dimethyl ester,1,4-dimethyl but-2-ynedioate,dimethyl butynedioate,dimethyl 2-butynedioate,acetylenedicarboxylic acid dimethyl ester,dmad,methyl acetylenedicarboxylate,bis methoxycarbonyl acetylene,di carbomethoxy acetylene |
| Numéro MDL | MFCD00008456 |
| CAS | 762-42-5 |
| CID PubChem | 12980 |
| Nom IUPAC | dimethyl but-2-ynedioate |
| Clé InChI | VHILMKFSCRWWIJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C#CC(=O)OC |
| Formule moléculaire | C6H6O4 |
Methyl 4-aminobenzoate, 98%
CAS: 619-45-4 Formule moléculaire: C8H9NO2 Poids moléculaire (g/mol): 151.165 Numéro MDL: MFCD00007891 Clé InChI: LZXXNPOYQCLXRS-UHFFFAOYSA-N Synonyme: 4-aminobenzoic acid methyl ester,methyl p-aminobenzoate,benzoic acid, 4-amino-, methyl ester,p-methoxycarbonyl aniline,4-methoxycarbonyl aniline,p-aminobenzoic acid methyl ester,methyl aniline-4-carboxylate,4-carbomethoxyaniline,methyl4-aminobenzoate,benzoic acid, p-amino-, methyl ester CID PubChem: 12082 Nom IUPAC: methyl 4-aminobenzoate SMILES: COC(=O)C1=CC=C(C=C1)N
| Poids moléculaire (g/mol) | 151.165 |
|---|---|
| Synonyme | 4-aminobenzoic acid methyl ester,methyl p-aminobenzoate,benzoic acid, 4-amino-, methyl ester,p-methoxycarbonyl aniline,4-methoxycarbonyl aniline,p-aminobenzoic acid methyl ester,methyl aniline-4-carboxylate,4-carbomethoxyaniline,methyl4-aminobenzoate,benzoic acid, p-amino-, methyl ester |
| Numéro MDL | MFCD00007891 |
| CAS | 619-45-4 |
| CID PubChem | 12082 |
| Nom IUPAC | methyl 4-aminobenzoate |
| Clé InChI | LZXXNPOYQCLXRS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)N |
| Formule moléculaire | C8H9NO2 |
Diethyl acetylenedicarboxylate, 96%
CAS: 762-21-0 Formule moléculaire: C8H10O4 Poids moléculaire (g/mol): 170.164 Numéro MDL: MFCD00009186 Clé InChI: STRNXFOUBFLVIN-UHFFFAOYSA-N Synonyme: diethyl acetylenedicarboxylate,2-butynedioic acid, diethyl ester,diethyl 2-butynedioate,1,4-diethyl but-2-ynedioate,acetylenedicarboxylic acid, diethyl ester,acetylenedicarboxylic acid diethyl ester,diethylacetylenedicarboxylate,bis-ethoxycarbonyl acetylene,diethyl acetylene dicarboxylate,di-ethyl acetylenedicarboxylate CID PubChem: 69803 Nom IUPAC: diethyl but-2-ynedioate SMILES: CCOC(=O)C#CC(=O)OCC
| Poids moléculaire (g/mol) | 170.164 |
|---|---|
| Synonyme | diethyl acetylenedicarboxylate,2-butynedioic acid, diethyl ester,diethyl 2-butynedioate,1,4-diethyl but-2-ynedioate,acetylenedicarboxylic acid, diethyl ester,acetylenedicarboxylic acid diethyl ester,diethylacetylenedicarboxylate,bis-ethoxycarbonyl acetylene,diethyl acetylene dicarboxylate,di-ethyl acetylenedicarboxylate |
| Numéro MDL | MFCD00009186 |
| CAS | 762-21-0 |
| CID PubChem | 69803 |
| Nom IUPAC | diethyl but-2-ynedioate |
| Clé InChI | STRNXFOUBFLVIN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C#CC(=O)OCC |
| Formule moléculaire | C8H10O4 |
Ethyl tiglate, 98%
CAS: 5837-78-5 Formule moléculaire: C7H12O2 Poids moléculaire (g/mol): 128.171 Numéro MDL: MFCD00015183 Clé InChI: OAPHLAAOJMTMLY-GQCTYLIASA-N Synonyme: ethyl tiglate,tiglic acid, ethyl ester,ethyl 2-methylcrotonate,ethyl alpha-methylcrotonate,ethyl trans-2-methyl-2-butenoate,e-2-methyl-2-butenoic acid ethyl ester,ethyl e-2-methylcrotonate,ethyl trans-2-methylcrotonate,tiglic acid ethyl ester,ethyl 2-methylbut-2-enoate CID PubChem: 5281163 ChEBI: CHEBI:4892 Nom IUPAC: ethyl (E)-2-methylbut-2-enoate SMILES: CCOC(=O)C(=CC)C
| Poids moléculaire (g/mol) | 128.171 |
|---|---|
| Synonyme | ethyl tiglate,tiglic acid, ethyl ester,ethyl 2-methylcrotonate,ethyl alpha-methylcrotonate,ethyl trans-2-methyl-2-butenoate,e-2-methyl-2-butenoic acid ethyl ester,ethyl e-2-methylcrotonate,ethyl trans-2-methylcrotonate,tiglic acid ethyl ester,ethyl 2-methylbut-2-enoate |
| Numéro MDL | MFCD00015183 |
| CAS | 5837-78-5 |
| CID PubChem | 5281163 |
| ChEBI | CHEBI:4892 |
| Nom IUPAC | ethyl (E)-2-methylbut-2-enoate |
| Clé InChI | OAPHLAAOJMTMLY-GQCTYLIASA-N |
| SMILES | CCOC(=O)C(=CC)C |
| Formule moléculaire | C7H12O2 |
Methyl benzoate, 99%
CAS: 93-58-3 Formule moléculaire: C8H8O2 Poids moléculaire (g/mol): 136.15 Numéro MDL: MFCD00008421 Clé InChI: QPJVMBTYPHYUOC-UHFFFAOYSA-N Synonyme: methylbenzoate,benzoic acid, methyl ester,clorius,benzoic acid methyl ester,niobe oil,oil of niobe,methyl benzenecarboxylate,essence of niobe,oniobe oil,oxidate le CID PubChem: 7150 ChEBI: CHEBI:72775 Nom IUPAC: methyl benzoate SMILES: COC(=O)C1=CC=CC=C1
| Poids moléculaire (g/mol) | 136.15 |
|---|---|
| Synonyme | methylbenzoate,benzoic acid, methyl ester,clorius,benzoic acid methyl ester,niobe oil,oil of niobe,methyl benzenecarboxylate,essence of niobe,oniobe oil,oxidate le |
| Numéro MDL | MFCD00008421 |
| CAS | 93-58-3 |
| CID PubChem | 7150 |
| ChEBI | CHEBI:72775 |
| Nom IUPAC | methyl benzoate |
| Clé InChI | QPJVMBTYPHYUOC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC=C1 |
| Formule moléculaire | C8H8O2 |
Methyl 1-methylpyrrole-2-carboxylate, 99%
CAS: 37619-24-2 Formule moléculaire: C7H9NO2 Poids moléculaire (g/mol): 139.154 Numéro MDL: MFCD00052747 Clé InChI: APHVGKYWHWFAQV-UHFFFAOYSA-N Synonyme: methyl 1-methyl-1h-pyrrole-2-carboxylate,methyl1-methyl-1h-pyrrole-2-carboxylate,1-methyl-1h-pyrrole-2-carboxylic acid methyl ester,methyl 1-methyl-2-pyrrolecarboxylate,1-methylpyrrole-2-carboxylic acid methyl ester,pubchem12438,acmc-209iue,methylmethylpyrrolecarboxylate,2-methoxycarbonyl-1-methylpyrrole,methyl 1-methyl-pyrrole-2-carboxylate CID PubChem: 142178 Nom IUPAC: methyl 1-methylpyrrole-2-carboxylate SMILES: CN1C=CC=C1C(=O)OC
| Poids moléculaire (g/mol) | 139.154 |
|---|---|
| Synonyme | methyl 1-methyl-1h-pyrrole-2-carboxylate,methyl1-methyl-1h-pyrrole-2-carboxylate,1-methyl-1h-pyrrole-2-carboxylic acid methyl ester,methyl 1-methyl-2-pyrrolecarboxylate,1-methylpyrrole-2-carboxylic acid methyl ester,pubchem12438,acmc-209iue,methylmethylpyrrolecarboxylate,2-methoxycarbonyl-1-methylpyrrole,methyl 1-methyl-pyrrole-2-carboxylate |
| Numéro MDL | MFCD00052747 |
| CAS | 37619-24-2 |
| CID PubChem | 142178 |
| Nom IUPAC | methyl 1-methylpyrrole-2-carboxylate |
| Clé InChI | APHVGKYWHWFAQV-UHFFFAOYSA-N |
| SMILES | CN1C=CC=C1C(=O)OC |
| Formule moléculaire | C7H9NO2 |
Methyl methacrylate, 99%, stab.
CAS: 80-62-6 Formule moléculaire: C5H8O2 Numéro MDL: MFCD00008587 Clé InChI: VVQNEPGJFQJSBK-UHFFFAOYSA-N Synonyme: methyl methacrylate,methylmethacrylate,methacrylic acid methyl ester,methyl methylacrylate,methyl 2-methylpropenoate,pegalan,methyl-methacrylat,diakon,acryester m,methyl 2-methyl-2-propenoate CID PubChem: 6658 ChEBI: CHEBI:34840 Nom IUPAC: methyl 2-methylprop-2-enoate
| Synonyme | methyl methacrylate,methylmethacrylate,methacrylic acid methyl ester,methyl methylacrylate,methyl 2-methylpropenoate,pegalan,methyl-methacrylat,diakon,acryester m,methyl 2-methyl-2-propenoate |
|---|---|
| Numéro MDL | MFCD00008587 |
| CAS | 80-62-6 |
| CID PubChem | 6658 |
| ChEBI | CHEBI:34840 |
| Nom IUPAC | methyl 2-methylprop-2-enoate |
| Clé InChI | VVQNEPGJFQJSBK-UHFFFAOYSA-N |
| Formule moléculaire | C5H8O2 |
Methyl biphenyl-4-carboxylate, 98+%
CAS: 720-75-2 Formule moléculaire: C14H12O2 Poids moléculaire (g/mol): 212.25 Numéro MDL: MFCD00017200 Clé InChI: GATUGNVDXMYTJX-UHFFFAOYSA-N Synonyme: methyl 4-biphenylcarboxylate,methyl biphenyl-4-carboxylate,methyl 1,1'-biphenyl-4-carboxylate,methyl p-phenylbenzoate,4-biphenylcarboxylic acid, methyl ester,1,1'-biphenyl-4-carboxylic acid, methyl ester,p-phenylbenzoic acid methyl ester,methyl-4-phenylbenzoate,4-phenylbenzoic acid methyl ester CID PubChem: 69757 Nom IUPAC: methyl 4-phenylbenzoate SMILES: COC(=O)C1=CC=C(C=C1)C1=CC=CC=C1
| Poids moléculaire (g/mol) | 212.25 |
|---|---|
| Synonyme | methyl 4-biphenylcarboxylate,methyl biphenyl-4-carboxylate,methyl 1,1'-biphenyl-4-carboxylate,methyl p-phenylbenzoate,4-biphenylcarboxylic acid, methyl ester,1,1'-biphenyl-4-carboxylic acid, methyl ester,p-phenylbenzoic acid methyl ester,methyl-4-phenylbenzoate,4-phenylbenzoic acid methyl ester |
| Numéro MDL | MFCD00017200 |
| CAS | 720-75-2 |
| CID PubChem | 69757 |
| Nom IUPAC | methyl 4-phenylbenzoate |
| Clé InChI | GATUGNVDXMYTJX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C1=CC=CC=C1 |
| Formule moléculaire | C14H12O2 |
Ethyl cinnamate, 98+%
CAS: 103-36-6 Formule moléculaire: C11H12O2 Poids moléculaire (g/mol): 176.215 Numéro MDL: MFCD00009189 Clé InChI: KBEBGUQPQBELIU-CMDGGOBGSA-N Synonyme: ethyl cinnamate,ethyl 3-phenylacrylate,ethylcinnamate,cinnamic acid ethyl ester,ethylcinnamoate,cinnamic acid, ethyl ester,ethyl trans-cinnamate,e-ethyl cinnamate,ethyl 3-phenyl-2-propenoate,ethyl benzylideneacetate CID PubChem: 637758 ChEBI: CHEBI:4895 Nom IUPAC: ethyl (E)-3-phenylprop-2-enoate SMILES: CCOC(=O)C=CC1=CC=CC=C1
| Poids moléculaire (g/mol) | 176.215 |
|---|---|
| Synonyme | ethyl cinnamate,ethyl 3-phenylacrylate,ethylcinnamate,cinnamic acid ethyl ester,ethylcinnamoate,cinnamic acid, ethyl ester,ethyl trans-cinnamate,e-ethyl cinnamate,ethyl 3-phenyl-2-propenoate,ethyl benzylideneacetate |
| Numéro MDL | MFCD00009189 |
| CAS | 103-36-6 |
| CID PubChem | 637758 |
| ChEBI | CHEBI:4895 |
| Nom IUPAC | ethyl (E)-3-phenylprop-2-enoate |
| Clé InChI | KBEBGUQPQBELIU-CMDGGOBGSA-N |
| SMILES | CCOC(=O)C=CC1=CC=CC=C1 |
| Formule moléculaire | C11H12O2 |
Methyl pyruvate, 98%
CAS: 600-22-6 Formule moléculaire: C4H6O3 Poids moléculaire (g/mol): 102.089 Numéro MDL: MFCD00008754 Clé InChI: CWKLZLBVOJRSOM-UHFFFAOYSA-N Synonyme: methyl pyruvate,pyruvic acid, methyl ester,pyruvic acid methyl ester,methyl 2-oxopropionate,propanoic acid, 2-oxo-, methyl ester,methyl-pyruvate,methylglyoxylic acid methyl ester,unii-3kjm65g5xl,3kjm65g5xl,2-oxo-propionic acid methyl ester CID PubChem: 11748 ChEBI: CHEBI:51850 Nom IUPAC: methyl 2-oxopropanoate SMILES: CC(=O)C(=O)OC
| Poids moléculaire (g/mol) | 102.089 |
|---|---|
| Synonyme | methyl pyruvate,pyruvic acid, methyl ester,pyruvic acid methyl ester,methyl 2-oxopropionate,propanoic acid, 2-oxo-, methyl ester,methyl-pyruvate,methylglyoxylic acid methyl ester,unii-3kjm65g5xl,3kjm65g5xl,2-oxo-propionic acid methyl ester |
| Numéro MDL | MFCD00008754 |
| CAS | 600-22-6 |
| CID PubChem | 11748 |
| ChEBI | CHEBI:51850 |
| Nom IUPAC | methyl 2-oxopropanoate |
| Clé InChI | CWKLZLBVOJRSOM-UHFFFAOYSA-N |
| SMILES | CC(=O)C(=O)OC |
| Formule moléculaire | C4H6O3 |
Methyl isobutyrate, 98%
CAS: 547-63-7 Formule moléculaire: C5H10O2 Poids moléculaire (g/mol): 102.133 Numéro MDL: MFCD00008914 Clé InChI: BHIWKHZACMWKOJ-UHFFFAOYSA-N Synonyme: methyl isobutyrate,methyl 2-methylpropionate,methyl isobutanoate,propanoic acid, 2-methyl-, methyl ester,isobutyric acid, methyl ester,methylisobutyrate,isobutyric acid methyl ester,poly d-lactide,methyl isobutyrate natural,methylester kyseliny isomaselne CID PubChem: 11039 ChEBI: CHEBI:73689 Nom IUPAC: methyl 2-methylpropanoate SMILES: CC(C)C(=O)OC
| Poids moléculaire (g/mol) | 102.133 |
|---|---|
| Synonyme | methyl isobutyrate,methyl 2-methylpropionate,methyl isobutanoate,propanoic acid, 2-methyl-, methyl ester,isobutyric acid, methyl ester,methylisobutyrate,isobutyric acid methyl ester,poly d-lactide,methyl isobutyrate natural,methylester kyseliny isomaselne |
| Numéro MDL | MFCD00008914 |
| CAS | 547-63-7 |
| CID PubChem | 11039 |
| ChEBI | CHEBI:73689 |
| Nom IUPAC | methyl 2-methylpropanoate |
| Clé InChI | BHIWKHZACMWKOJ-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)OC |
| Formule moléculaire | C5H10O2 |