Carbothioic Derivatives
- (2)
- (6)
- (1)
- (1)
- (1)
- (12)
- (2)
- (1)
- (8)
- (2)
- (2)
- (1)
- (2)
- (4)
- (2)
- (2)
- (1)
- (3)
- (2)
- (2)
- (1)
- (1)
- (2)
- (2)
- (9)
- (5)
- (2)
- (5)
- (2)
- (1)
- (2)
- (4)
- (7)
- (1)
- (3)
- (5)
- (6)
- (6)
- (2)
- (17)
- (2)
- (1)
- (1)
- (2)
- (2)
- (2)
- (1)
- (3)
- (1)
- (3)
- (3)
- (3)
- (2)
Résultats de la recherche filtrée
Thioacetic acid, 98%
CAS: 507-09-5 Formule moléculaire: C2H4OS Poids moléculaire (g/mol): 76.11 Numéro MDL: MFCD00004853 Clé InChI: DUYAAUVXQSMXQP-UHFFFAOYSA-N Synonyme: thioacetic acid,ethanethioic acid,thiacetic acid,thioacetic s-acid,acetyl mercaptan,ethanethiolic acid,thiolacetic acid,thionoacetic acid,methanecarbothiolic acid,ch3cosh CID PubChem: 10484 ChEBI: CHEBI:16555 Nom IUPAC: ethanethioic S-acid SMILES: CC(S)=O
| Poids moléculaire (g/mol) | 76.11 |
|---|---|
| Synonyme | thioacetic acid,ethanethioic acid,thiacetic acid,thioacetic s-acid,acetyl mercaptan,ethanethiolic acid,thiolacetic acid,thionoacetic acid,methanecarbothiolic acid,ch3cosh |
| Numéro MDL | MFCD00004853 |
| CAS | 507-09-5 |
| CID PubChem | 10484 |
| ChEBI | CHEBI:16555 |
| Nom IUPAC | ethanethioic S-acid |
| Clé InChI | DUYAAUVXQSMXQP-UHFFFAOYSA-N |
| SMILES | CC(S)=O |
| Formule moléculaire | C2H4OS |
Thioacetic acid, 97%
CAS: 507-09-5 Formule moléculaire: C2H4OS Poids moléculaire (g/mol): 76.11 Numéro MDL: MFCD00004853 Clé InChI: DUYAAUVXQSMXQP-UHFFFAOYSA-N Synonyme: thioacetic acid,ethanethioic acid,thiacetic acid,thioacetic s-acid,acetyl mercaptan,ethanethiolic acid,thiolacetic acid,thionoacetic acid,methanecarbothiolic acid,ch3cosh CID PubChem: 10484 ChEBI: CHEBI:16555 Nom IUPAC: ethanethioic S-acid SMILES: CC(S)=O
| Poids moléculaire (g/mol) | 76.11 |
|---|---|
| Synonyme | thioacetic acid,ethanethioic acid,thiacetic acid,thioacetic s-acid,acetyl mercaptan,ethanethiolic acid,thiolacetic acid,thionoacetic acid,methanecarbothiolic acid,ch3cosh |
| Numéro MDL | MFCD00004853 |
| CAS | 507-09-5 |
| CID PubChem | 10484 |
| ChEBI | CHEBI:16555 |
| Nom IUPAC | ethanethioic S-acid |
| Clé InChI | DUYAAUVXQSMXQP-UHFFFAOYSA-N |
| SMILES | CC(S)=O |
| Formule moléculaire | C2H4OS |
Potassium thioacetate, 98%
CAS: 10387-40-3 Formule moléculaire: C2H4KOS Poids moléculaire (g/mol): 115.211 Numéro MDL: MFCD00083065 Clé InChI: SDJHDRMYZQFJJO-UHFFFAOYSA-N Synonyme: potassium thioacetate,ethanethioic s-acid; potassium,schiff reagent potassium CID PubChem: 24201352 Nom IUPAC: ethanethioic S-acid;potassium SMILES: CC(=O)S.[K]
| Poids moléculaire (g/mol) | 115.211 |
|---|---|
| Synonyme | potassium thioacetate,ethanethioic s-acid; potassium,schiff reagent potassium |
| Numéro MDL | MFCD00083065 |
| CAS | 10387-40-3 |
| CID PubChem | 24201352 |
| Nom IUPAC | ethanethioic S-acid;potassium |
| Clé InChI | SDJHDRMYZQFJJO-UHFFFAOYSA-N |
| SMILES | CC(=O)S.[K] |
| Formule moléculaire | C2H4KOS |
Thermo Scientific Chemicals DL-Homocysteinethiolactone hydrochloride, 99%
CAS: 6038-19-3 Numéro MDL: MFCD00012724 Clé InChI: ZSEGSUBKDDEALH-UHFFFAOYSA-N Synonyme: dl-homocysteine thiolactone hydrochloride,3-aminodihydrothiophen-2 3h-one hydrochloride,3-aminothiolan-2-one hydrochloride,hctl hydrochloride,dl-homocysteinethiolactone hydrochloride,d,l-homocysteine thiolactone hydrochloride,d,l-homocysteinthiolakton chlorid german,+--dihydro-3-amino-2 3h-thiophenone hydrochloride,2 3h-thiophenone, dihydro-3-amino-, hydrochloride, +-,l-2-amino-4-mercaptobutyric acid 1,4-thiolactone hydrochloride CID PubChem: 110753 Nom IUPAC: 3-aminothiolan-2-one;hydrochloride SMILES: C1CSC(=O)C1N.Cl
| Synonyme | dl-homocysteine thiolactone hydrochloride,3-aminodihydrothiophen-2 3h-one hydrochloride,3-aminothiolan-2-one hydrochloride,hctl hydrochloride,dl-homocysteinethiolactone hydrochloride,d,l-homocysteine thiolactone hydrochloride,d,l-homocysteinthiolakton chlorid german,+--dihydro-3-amino-2 3h-thiophenone hydrochloride,2 3h-thiophenone, dihydro-3-amino-, hydrochloride, +-,l-2-amino-4-mercaptobutyric acid 1,4-thiolactone hydrochloride |
|---|---|
| Numéro MDL | MFCD00012724 |
| CAS | 6038-19-3 |
| CID PubChem | 110753 |
| Nom IUPAC | 3-aminothiolan-2-one;hydrochloride |
| Clé InChI | ZSEGSUBKDDEALH-UHFFFAOYSA-N |
| SMILES | C1CSC(=O)C1N.Cl |
S-Ethyl thioacetate, 98+%
CAS: 625-60-5 Formule moléculaire: C4H8OS Poids moléculaire (g/mol): 104.167 Numéro MDL: MFCD00015178 Clé InChI: APTGPWJUOYMUCE-UHFFFAOYSA-N Synonyme: s-ethyl thioacetate,ethanethioic acid, ethyl ester,ethanethioic acid, s-ethyl ester,ethyl thiolacetate,ethyl ethanethioate,ethanethioic acid s-ethyl ester,s-ethyl thiolacetate,acetic acid, thio-, ethyl ester,thioethyl compound,acetic acid, thio-, s-ethyl ester CID PubChem: 61171 Nom IUPAC: S-ethyl ethanethioate SMILES: CCSC(=O)C
| Poids moléculaire (g/mol) | 104.167 |
|---|---|
| Synonyme | s-ethyl thioacetate,ethanethioic acid, ethyl ester,ethanethioic acid, s-ethyl ester,ethyl thiolacetate,ethyl ethanethioate,ethanethioic acid s-ethyl ester,s-ethyl thiolacetate,acetic acid, thio-, ethyl ester,thioethyl compound,acetic acid, thio-, s-ethyl ester |
| Numéro MDL | MFCD00015178 |
| CAS | 625-60-5 |
| CID PubChem | 61171 |
| Nom IUPAC | S-ethyl ethanethioate |
| Clé InChI | APTGPWJUOYMUCE-UHFFFAOYSA-N |
| SMILES | CCSC(=O)C |
| Formule moléculaire | C4H8OS |
Spironolactone, British Pharmacopoeia (BP) Reference Standard, MilliporeSigma™ Supelco™
This product is provided as delivered and specified by the issuing Pharmacopoeia. All information provided in support of this product, including SDS and any product information leaflets, has been developed and issued under the Authority of the issuing Pharmacopoeia.
DL-Homocysteine thiolactone hydrochloride, 99%
CAS: 6038-19-3 Formule moléculaire: C4H8ClNOS Poids moléculaire (g/mol): 153.624 Numéro MDL: MFCD00012724 Clé InChI: ZSEGSUBKDDEALH-UHFFFAOYSA-N Synonyme: dl-homocysteine thiolactone hydrochloride,3-aminodihydrothiophen-2 3h-one hydrochloride,3-aminothiolan-2-one hydrochloride,hctl hydrochloride,dl-homocysteinethiolactone hydrochloride,d,l-homocysteine thiolactone hydrochloride,d,l-homocysteinthiolakton chlorid german,+--dihydro-3-amino-2 3h-thiophenone hydrochloride,2 3h-thiophenone, dihydro-3-amino-, hydrochloride, +-,l-2-amino-4-mercaptobutyric acid 1,4-thiolactone hydrochloride CID PubChem: 110753 Nom IUPAC: 3-aminothiolan-2-one;hydrochloride SMILES: C1CSC(=O)C1N.Cl
| Poids moléculaire (g/mol) | 153.624 |
|---|---|
| Synonyme | dl-homocysteine thiolactone hydrochloride,3-aminodihydrothiophen-2 3h-one hydrochloride,3-aminothiolan-2-one hydrochloride,hctl hydrochloride,dl-homocysteinethiolactone hydrochloride,d,l-homocysteine thiolactone hydrochloride,d,l-homocysteinthiolakton chlorid german,+--dihydro-3-amino-2 3h-thiophenone hydrochloride,2 3h-thiophenone, dihydro-3-amino-, hydrochloride, +-,l-2-amino-4-mercaptobutyric acid 1,4-thiolactone hydrochloride |
| Numéro MDL | MFCD00012724 |
| CAS | 6038-19-3 |
| CID PubChem | 110753 |
| Nom IUPAC | 3-aminothiolan-2-one;hydrochloride |
| Clé InChI | ZSEGSUBKDDEALH-UHFFFAOYSA-N |
| SMILES | C1CSC(=O)C1N.Cl |
| Formule moléculaire | C4H8ClNOS |
Thermo Scientific Chemicals Spironolactone, 99%
CAS: 52-01-7 Formule moléculaire: C24H32O4S Poids moléculaire (g/mol): 416.57 Numéro MDL: MFCD00082250 Clé InChI: LXMSZDCAJNLERA-ZHYRCANASA-N Synonyme: spironolactone,aldactone,spirolactone,verospiron,euteberol,spiroctan,spirolang,verospirone,aldactone a,spironocompren CID PubChem: 5833 ChEBI: CHEBI:9241 Nom IUPAC: S-[(7R,8R,9S,10R,13S,14S,17R)-10,13-dimethyl-3,5'-dioxospiro[2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,2'-oxolane]-7-yl] ethanethioate SMILES: CC(=O)SC1CC2=CC(=O)CCC2(C3C1C4CCC5(C4(CC3)C)CCC(=O)O5)C
| Poids moléculaire (g/mol) | 416.57 |
|---|---|
| Synonyme | spironolactone,aldactone,spirolactone,verospiron,euteberol,spiroctan,spirolang,verospirone,aldactone a,spironocompren |
| Numéro MDL | MFCD00082250 |
| CAS | 52-01-7 |
| CID PubChem | 5833 |
| ChEBI | CHEBI:9241 |
| Nom IUPAC | S-[(7R,8R,9S,10R,13S,14S,17R)-10,13-dimethyl-3,5'-dioxospiro[2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,2'-oxolane]-7-yl] ethanethioate |
| Clé InChI | LXMSZDCAJNLERA-ZHYRCANASA-N |
| SMILES | CC(=O)SC1CC2=CC(=O)CCC2(C3C1C4CCC5(C4(CC3)C)CCC(=O)O5)C |
| Formule moléculaire | C24H32O4S |
S-Methyl thioacetate, 98+%
CAS: 1534-08-3 Formule moléculaire: C3H6OS Poids moléculaire (g/mol): 90.14 Numéro MDL: MFCD00014989 Clé InChI: OATSQCXMYKYFQO-UHFFFAOYSA-N Synonyme: s-methyl thioacetate,methylthioacetate,ethanethioic acid, s-methyl ester,methanethiol acetate,thioacetic acid s-methyl ester,methyl thiolacetate,methyl ethanethioate,unii-pf2d4mwx79,ch3c o sch3,acetic acid, thio-, s-methyl ester CID PubChem: 73750 ChEBI: CHEBI:51280 Nom IUPAC: S-methyl ethanethioate SMILES: CC(=O)SC
| Poids moléculaire (g/mol) | 90.14 |
|---|---|
| Synonyme | s-methyl thioacetate,methylthioacetate,ethanethioic acid, s-methyl ester,methanethiol acetate,thioacetic acid s-methyl ester,methyl thiolacetate,methyl ethanethioate,unii-pf2d4mwx79,ch3c o sch3,acetic acid, thio-, s-methyl ester |
| Numéro MDL | MFCD00014989 |
| CAS | 1534-08-3 |
| CID PubChem | 73750 |
| ChEBI | CHEBI:51280 |
| Nom IUPAC | S-methyl ethanethioate |
| Clé InChI | OATSQCXMYKYFQO-UHFFFAOYSA-N |
| SMILES | CC(=O)SC |
| Formule moléculaire | C3H6OS |
S-Ethyl Thiopropionate 98.0+%, TCI America™
CAS: 2432-42-0 Formule moléculaire: C5H10OS Poids moléculaire (g/mol): 118.194 Numéro MDL: MFCD00027016 Clé InChI: HNEVHBHRLCAKKQ-UHFFFAOYSA-N Synonyme: s-ethyl thiopropionate,ethyl thiopropionate,propanethioic acid, s-ethyl ester,thiopropionic acid s-ethyl ester,1-ethylsulfanyl propan-1-one,ethanethiol propionate,acmc-1ceeh,propanethioicacid,s-ethylester,thiopropionic acid, s-ethyl ester,propanethioic acid,s-ethyl ester CID PubChem: 75513 Nom IUPAC: S-ethyl propanethioate SMILES: CCC(=O)SCC
| Poids moléculaire (g/mol) | 118.194 |
|---|---|
| Synonyme | s-ethyl thiopropionate,ethyl thiopropionate,propanethioic acid, s-ethyl ester,thiopropionic acid s-ethyl ester,1-ethylsulfanyl propan-1-one,ethanethiol propionate,acmc-1ceeh,propanethioicacid,s-ethylester,thiopropionic acid, s-ethyl ester,propanethioic acid,s-ethyl ester |
| Numéro MDL | MFCD00027016 |
| CAS | 2432-42-0 |
| CID PubChem | 75513 |
| Nom IUPAC | S-ethyl propanethioate |
| Clé InChI | HNEVHBHRLCAKKQ-UHFFFAOYSA-N |
| SMILES | CCC(=O)SCC |
| Formule moléculaire | C5H10OS |
S-Methyl Thioacetate 95.0+%, TCI America™
CAS: 1534-08-3 Formule moléculaire: C3H6OS Poids moléculaire (g/mol): 90.14 Numéro MDL: MFCD00014989 Clé InChI: OATSQCXMYKYFQO-UHFFFAOYSA-N Synonyme: s-methyl thioacetate,methylthioacetate,ethanethioic acid, s-methyl ester,methanethiol acetate,thioacetic acid s-methyl ester,methyl thiolacetate,methyl ethanethioate,unii-pf2d4mwx79,ch3c o sch3,acetic acid, thio-, s-methyl ester CID PubChem: 73750 ChEBI: CHEBI:51280 Nom IUPAC: S-methyl ethanethioate SMILES: CC(=O)SC
| Poids moléculaire (g/mol) | 90.14 |
|---|---|
| Synonyme | s-methyl thioacetate,methylthioacetate,ethanethioic acid, s-methyl ester,methanethiol acetate,thioacetic acid s-methyl ester,methyl thiolacetate,methyl ethanethioate,unii-pf2d4mwx79,ch3c o sch3,acetic acid, thio-, s-methyl ester |
| Numéro MDL | MFCD00014989 |
| CAS | 1534-08-3 |
| CID PubChem | 73750 |
| ChEBI | CHEBI:51280 |
| Nom IUPAC | S-methyl ethanethioate |
| Clé InChI | OATSQCXMYKYFQO-UHFFFAOYSA-N |
| SMILES | CC(=O)SC |
| Formule moléculaire | C3H6OS |
S-Potassium Thioacetate 97.0+%, TCI America™
CAS: 10387-40-3 Formule moléculaire: C2H4KOS Poids moléculaire (g/mol): 115.211 Numéro MDL: MFCD00083065 Clé InChI: SDJHDRMYZQFJJO-UHFFFAOYSA-N Synonyme: potassium thioacetate,ethanethioic s-acid; potassium,schiff reagent potassium CID PubChem: 24201352 Nom IUPAC: ethanethioic S-acid;potassium SMILES: CC(=O)S.[K]
| Poids moléculaire (g/mol) | 115.211 |
|---|---|
| Synonyme | potassium thioacetate,ethanethioic s-acid; potassium,schiff reagent potassium |
| Numéro MDL | MFCD00083065 |
| CAS | 10387-40-3 |
| CID PubChem | 24201352 |
| Nom IUPAC | ethanethioic S-acid;potassium |
| Clé InChI | SDJHDRMYZQFJJO-UHFFFAOYSA-N |
| SMILES | CC(=O)S.[K] |
| Formule moléculaire | C2H4KOS |
S-(2-Benzothiazolyl) (Z)-2-(2-Amino-4-thiazolyl)-2-(methoxyimino)thioacetate 97.0+%, TCI America™
CAS: 80756-85-0 Formule moléculaire: C13H10N4O2S3 Poids moléculaire (g/mol): 350.43 Numéro MDL: MFCD00129148,MFCD00071547 Clé InChI: COFDRZLHVALCDU-YVLHZVERSA-N CID PubChem: 5702580 Nom IUPAC: (2Z)-2-(2-amino-1,3-thiazol-4-yl)-1-(1,3-benzothiazol-2-ylsulfanyl)-2-(methoxyimino)ethan-1-one SMILES: CO\N=C(/C(=O)SC1=NC2=CC=CC=C2S1)C1=CSC(N)=N1
| Poids moléculaire (g/mol) | 350.43 |
|---|---|
| Numéro MDL | MFCD00129148,MFCD00071547 |
| CAS | 80756-85-0 |
| CID PubChem | 5702580 |
| Nom IUPAC | (2Z)-2-(2-amino-1,3-thiazol-4-yl)-1-(1,3-benzothiazol-2-ylsulfanyl)-2-(methoxyimino)ethan-1-one |
| Clé InChI | COFDRZLHVALCDU-YVLHZVERSA-N |
| SMILES | CO\N=C(/C(=O)SC1=NC2=CC=CC=C2S1)C1=CSC(N)=N1 |
| Formule moléculaire | C13H10N4O2S3 |
S-Ethyl Trifluorothioacetate 98.0+%, TCI America™
CAS: 383-64-2 Formule moléculaire: C4H5F3OS Poids moléculaire (g/mol): 158.138 Numéro MDL: MFCD00000421 Clé InChI: VGGUKFAVHPGNBF-UHFFFAOYSA-N Synonyme: s-ethyl trifluorothioacetate,ethanethioic acid, trifluoro-, s-ethyl ester,ethyl trifluorothiolacetate,s-ethyl trifluoroethanethioate,trifluoroacetonylmercaptoethanol,acetic acid, trifluorothio-, s-ethyl ester,s-ethylthiotrifluoroacetate,trifluorothioacetic acid s-ethyl ester,ethanethioic acid, 2,2,2-trifluoro-, s-ethyl ester,1-ethylsulfanyl-2,2,2-trifluoroethanone CID PubChem: 67844 Nom IUPAC: S-ethyl 2,2,2-trifluoroethanethioate SMILES: CCSC(=O)C(F)(F)F
| Poids moléculaire (g/mol) | 158.138 |
|---|---|
| Synonyme | s-ethyl trifluorothioacetate,ethanethioic acid, trifluoro-, s-ethyl ester,ethyl trifluorothiolacetate,s-ethyl trifluoroethanethioate,trifluoroacetonylmercaptoethanol,acetic acid, trifluorothio-, s-ethyl ester,s-ethylthiotrifluoroacetate,trifluorothioacetic acid s-ethyl ester,ethanethioic acid, 2,2,2-trifluoro-, s-ethyl ester,1-ethylsulfanyl-2,2,2-trifluoroethanone |
| Numéro MDL | MFCD00000421 |
| CAS | 383-64-2 |
| CID PubChem | 67844 |
| Nom IUPAC | S-ethyl 2,2,2-trifluoroethanethioate |
| Clé InChI | VGGUKFAVHPGNBF-UHFFFAOYSA-N |
| SMILES | CCSC(=O)C(F)(F)F |
| Formule moléculaire | C4H5F3OS |
S-(2-Methyl-3-furyl) Thioacetate 96.0+%, TCI America™
CAS: 55764-25-5 Formule moléculaire: C7H8O2S Poids moléculaire (g/mol): 156.20 Numéro MDL: MFCD01632595 Clé InChI: PQFIBPDAGFGLBY-UHFFFAOYSA-N Synonyme: 2-methylfuran-3-thiol acetate,3-acetylthio-2-methylfuran,ethanethioic acid, s-2-methyl-3-furanyl ester,s-2-methyl-3-furyl thioacetate,s-2-methyl-3-furyl ethanethioate,2-methyl-3-furanthiol, acetate,unii-7277jee7af,s-2-methylfuran-3-yl ethanethioate,thioacetic acid s-2-methyl-3-furyl ester,1-2-methylfuran-3-yl sulfanyl ethanone CID PubChem: 108765 Nom IUPAC: 1-[(2-methylfuran-3-yl)sulfanyl]ethan-1-one SMILES: CC(=O)SC1=C(C)OC=C1
| Poids moléculaire (g/mol) | 156.20 |
|---|---|
| Synonyme | 2-methylfuran-3-thiol acetate,3-acetylthio-2-methylfuran,ethanethioic acid, s-2-methyl-3-furanyl ester,s-2-methyl-3-furyl thioacetate,s-2-methyl-3-furyl ethanethioate,2-methyl-3-furanthiol, acetate,unii-7277jee7af,s-2-methylfuran-3-yl ethanethioate,thioacetic acid s-2-methyl-3-furyl ester,1-2-methylfuran-3-yl sulfanyl ethanone |
| Numéro MDL | MFCD01632595 |
| CAS | 55764-25-5 |
| CID PubChem | 108765 |
| Nom IUPAC | 1-[(2-methylfuran-3-yl)sulfanyl]ethan-1-one |
| Clé InChI | PQFIBPDAGFGLBY-UHFFFAOYSA-N |
| SMILES | CC(=O)SC1=C(C)OC=C1 |
| Formule moléculaire | C7H8O2S |