Filtered Search Results
Palladium, 5% on calcium carbonate, lead poisoned, A305060-5, Thermo Scientific Chemicals
CAS: 5-3-7440 Molecular Formula: Pd Molecular Weight (g/mol): 106.42 MDL Number: MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 InChI Key: KDLHZDBZIXYQEI-UHFFFAOYSA-N Synonym: black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon PubChem CID: 23938 ChEBI: CHEBI:33363 IUPAC Name: palladium SMILES: [Pd]
| PubChem CID | 23938 |
|---|---|
| CAS | 5-3-7440 |
| Molecular Weight (g/mol) | 106.42 |
| ChEBI | CHEBI:33363 |
| MDL Number | MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 |
| SMILES | [Pd] |
| Synonym | black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon |
| IUPAC Name | palladium |
| InChI Key | KDLHZDBZIXYQEI-UHFFFAOYSA-N |
| Molecular Formula | Pd |
Palladium, 2.5% Platinum, 2.5% on carbon paste, Type 122
CAS: 5-3-7440 Molecular Formula: Pd Molecular Weight (g/mol): 106.42 MDL Number: MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 InChI Key: KDLHZDBZIXYQEI-UHFFFAOYSA-N Synonym: black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon PubChem CID: 23938 ChEBI: CHEBI:33363 IUPAC Name: palladium SMILES: [Pd]
| PubChem CID | 23938 |
|---|---|
| CAS | 5-3-7440 |
| Molecular Weight (g/mol) | 106.42 |
| ChEBI | CHEBI:33363 |
| MDL Number | MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 |
| SMILES | [Pd] |
| Synonym | black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon |
| IUPAC Name | palladium |
| InChI Key | KDLHZDBZIXYQEI-UHFFFAOYSA-N |
| Molecular Formula | Pd |
Palladium, 10% on carbon, Type 487, dry
CAS: 5-3-7440 Molecular Formula: Pd Molecular Weight (g/mol): 106.42 MDL Number: MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 InChI Key: KDLHZDBZIXYQEI-UHFFFAOYSA-N Synonym: black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon PubChem CID: 23938 ChEBI: CHEBI:33363 IUPAC Name: palladium SMILES: [Pd]
| PubChem CID | 23938 |
|---|---|
| CAS | 5-3-7440 |
| Molecular Weight (g/mol) | 106.42 |
| ChEBI | CHEBI:33363 |
| MDL Number | MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 |
| SMILES | [Pd] |
| Synonym | black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon |
| IUPAC Name | palladium |
| InChI Key | KDLHZDBZIXYQEI-UHFFFAOYSA-N |
| Molecular Formula | Pd |
Palladium nitrate & Magnesium nitrate, Matrix Modifier Solution, Specpure™
Molecular Formula: 0.1% Pd and 0.06% Mg(NO3)2 in 2% HNO3 MDL Number: MFCD09910543
| MDL Number | MFCD09910543 |
|---|---|
| Molecular Formula | 0.1% Pd and 0.06% Mg(NO3)2 in 2% HNO3 |
Bis[1,2,3,4,5-pentaphenyl-1'-(di-tert-butylphosphino)ferrocene]palladium(0), Thermo Scientific Chemicals
CAS: 565441-56-7 Molecular Formula: C96H94Fe2P2Pd Molecular Weight (g/mol): 1527.87 MDL Number: MFCD15071401 Synonym: Pd(Qhos)2 IUPAC Name: Bis[1,2,3,4,5-pentaphenyl-1'-(di-tert-butylphosphino)ferrocene]palladium(0) SMILES: [Fe].[Fe].[Pd].CC(C)(C)P(c1cccc1)C(C)(C)C.CC(C)(C)P(c1cccc1)C(C)(C)C.C1=CC=C(C=C1)c1c(c(c(c1C1=CC=CC=C1)C1=CC=CC=C1)C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)c1c(c(c(c1C1=CC=CC=C1)C1=CC=CC=C1)C1=CC=CC=C1)C1=CC=CC=C1
| CAS | 565441-56-7 |
|---|---|
| Molecular Weight (g/mol) | 1527.87 |
| MDL Number | MFCD15071401 |
| SMILES | [Fe].[Fe].[Pd].CC(C)(C)P(c1cccc1)C(C)(C)C.CC(C)(C)P(c1cccc1)C(C)(C)C.C1=CC=C(C=C1)c1c(c(c(c1C1=CC=CC=C1)C1=CC=CC=C1)C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)c1c(c(c(c1C1=CC=CC=C1)C1=CC=CC=C1)C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | Pd(Qhos)2 |
| IUPAC Name | Bis[1,2,3,4,5-pentaphenyl-1'-(di-tert-butylphosphino)ferrocene]palladium(0) |
| Molecular Formula | C96H94Fe2P2Pd |
Allyl(chloro)[di-tert-butyl(4-dimethylaminophenyl)phosphine]palladium(II)
CAS: 1235509-04-2 Molecular Formula: C19H33ClNPPd Molecular Weight (g/mol): 448.324 MDL Number: MFCD25372543 InChI Key: OSTWSTKYPFRHAA-UHFFFAOYSA-M Synonym: pdclallyl amphos,allyl chloro di-tert-butyl 4-dimethylaminophenyl phosphine palladium ii PubChem CID: 73994976 IUPAC Name: chloropalladium(1+);1-(4-ditert-butylphosphanylphenyl)-N-methylmethanamine;prop-1-ene SMILES: CC(C)(C)P(C1=CC=C(C=C1)CNC)C(C)(C)C.[CH2-]C=C.Cl[Pd+]
| PubChem CID | 73994976 |
|---|---|
| CAS | 1235509-04-2 |
| Molecular Weight (g/mol) | 448.324 |
| MDL Number | MFCD25372543 |
| SMILES | CC(C)(C)P(C1=CC=C(C=C1)CNC)C(C)(C)C.[CH2-]C=C.Cl[Pd+] |
| Synonym | pdclallyl amphos,allyl chloro di-tert-butyl 4-dimethylaminophenyl phosphine palladium ii |
| IUPAC Name | chloropalladium(1+);1-(4-ditert-butylphosphanylphenyl)-N-methylmethanamine;prop-1-ene |
| InChI Key | OSTWSTKYPFRHAA-UHFFFAOYSA-M |
| Molecular Formula | C19H33ClNPPd |
Dibromo(1,5-cyclooctadiene)palladium(II), Pd 28.4%
CAS: 12145-47-0 Molecular Formula: C8H12Br2Pd Molecular Weight (g/mol): 374.41 MDL Number: MFCD00799635 InChI Key: MTEMVOIUTLIPJT-PHFPKPIQSA-L Synonym: dibromo 1,5-cyclooctadiene palladium ii,pdbr2 cod,dibromo 1,5-cyclooctadiene palladium,1,5-cyclooctadiene, z,z-; palladium ii bromide PubChem CID: 11187970 IUPAC Name: (1Z,5Z)-cycloocta-1,5-diene;dibromopalladium SMILES: Br[Pd+]Br.C1C\C=C/CC\C=C/1
| PubChem CID | 11187970 |
|---|---|
| CAS | 12145-47-0 |
| Molecular Weight (g/mol) | 374.41 |
| MDL Number | MFCD00799635 |
| SMILES | Br[Pd+]Br.C1C\C=C/CC\C=C/1 |
| Synonym | dibromo 1,5-cyclooctadiene palladium ii,pdbr2 cod,dibromo 1,5-cyclooctadiene palladium,1,5-cyclooctadiene, z,z-; palladium ii bromide |
| IUPAC Name | (1Z,5Z)-cycloocta-1,5-diene;dibromopalladium |
| InChI Key | MTEMVOIUTLIPJT-PHFPKPIQSA-L |
| Molecular Formula | C8H12Br2Pd |
Dichloro[1,1'-bis(dicyclohexylphosphino)ferrocene]palladium(II), Pd 14.1%, Thermo Scientific Chemicals
CAS: 917511-90-1 Molecular Formula: C34H52Cl2FeP2Pd Molecular Weight (g/mol): 755.90 MDL Number: MFCD11656081 Synonym: PdCl2(dcypf); [1,1'-Bis(dicyclohexylphosphino)ferrocene]dichloropalladium(II) IUPAC Name: Dichloro[1,1'-bis(dicyclohexylphosphino)ferrocene]palladium(II) SMILES: [Fe].Cl[Pd]Cl.C1CCC(CC1)P(C1CCCCC1)c1cccc1.C1CCC(CC1)P(C1CCCCC1)c1cccc1
| CAS | 917511-90-1 |
|---|---|
| Molecular Weight (g/mol) | 755.90 |
| MDL Number | MFCD11656081 |
| SMILES | [Fe].Cl[Pd]Cl.C1CCC(CC1)P(C1CCCCC1)c1cccc1.C1CCC(CC1)P(C1CCCCC1)c1cccc1 |
| Synonym | PdCl2(dcypf); [1,1'-Bis(dicyclohexylphosphino)ferrocene]dichloropalladium(II) |
| IUPAC Name | Dichloro[1,1'-bis(dicyclohexylphosphino)ferrocene]palladium(II) |
| Molecular Formula | C34H52Cl2FeP2Pd |
Palladium, 1% on granular carbon, reduced
CAS: 5-3-7440 Molecular Formula: Pd Molecular Weight (g/mol): 106.42 MDL Number: MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 InChI Key: KDLHZDBZIXYQEI-UHFFFAOYSA-N Synonym: black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon PubChem CID: 23938 ChEBI: CHEBI:33363 IUPAC Name: palladium SMILES: [Pd]
| PubChem CID | 23938 |
|---|---|
| CAS | 5-3-7440 |
| Molecular Weight (g/mol) | 106.42 |
| ChEBI | CHEBI:33363 |
| MDL Number | MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 |
| SMILES | [Pd] |
| Synonym | black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon |
| IUPAC Name | palladium |
| InChI Key | KDLHZDBZIXYQEI-UHFFFAOYSA-N |
| Molecular Formula | Pd |
Chloro(crotyl)[1,2,3,4,5-pentaphenyl-1'-(di-tert-butylphosphino)ferrocene]palladium(II), Thermo Scientific Chemicals
CAS: 1252598-33-6 Molecular Formula: C52H54ClFePPd Molecular Weight (g/mol): 907.69 MDL Number: MFCD25372545 InChI Key: ZDJQQIXNGDRDQM-UHFFFAOYSA-M Synonym: pdcl crotyl qphos,chloro crotyl 1,2,3,4,5-pentaphenyl-1'-di-tert-butylphosphino ferrocene palladium ii PubChem CID: 73994979 IUPAC Name: λ²-iron(2+) 3-(di-tert-butylphosphanyl)cyclopenta-2,4-dien-1-ide but-2-en-1-ide chloropalladiumylium pentaphenylcyclopenta-2,4-dien-1-ide SMILES: Cl[Pd++].C\C=C/C.CC(C)(C)P(c1cccc1[Fe])C(C)(C)C.C1=CC=C(C=C1)c1c(c(c(c1C1=CC=CC=C1)C1=CC=CC=C1)C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 73994979 |
|---|---|
| CAS | 1252598-33-6 |
| Molecular Weight (g/mol) | 907.69 |
| MDL Number | MFCD25372545 |
| SMILES | Cl[Pd++].C\C=C/C.CC(C)(C)P(c1cccc1[Fe])C(C)(C)C.C1=CC=C(C=C1)c1c(c(c(c1C1=CC=CC=C1)C1=CC=CC=C1)C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | pdcl crotyl qphos,chloro crotyl 1,2,3,4,5-pentaphenyl-1'-di-tert-butylphosphino ferrocene palladium ii |
| IUPAC Name | λ²-iron(2+) 3-(di-tert-butylphosphanyl)cyclopenta-2,4-dien-1-ide but-2-en-1-ide chloropalladiumylium pentaphenylcyclopenta-2,4-dien-1-ide |
| InChI Key | ZDJQQIXNGDRDQM-UHFFFAOYSA-M |
| Molecular Formula | C52H54ClFePPd |
Dichloro[9,9-dimethyl-4,5-bis(diphenylphosphino)xanthene]palladium(II), Pd 12.1%
CAS: 205319-10-4 Molecular Formula: C39H32Cl2OP2Pd Molecular Weight (g/mol): 755.95 MDL Number: MFCD14155707 InChI Key: MNBAPNBMBOYNAW-UHFFFAOYSA-L Synonym: dichloro 9,9-dimethyl-4,5-bis diphenylphosphino xanthene palladium ii,palladium 2+ xantphos dichloride,4,5-bis diphenylphosphino-9,9-dimethylxanthene dichloropalladium ii,4,5-bis diphenylphosphino-9,9-dimethylxanthene palladium ii dichloride PubChem CID: 86280406 IUPAC Name: (5-diphenylphosphanyl-9,9-dimethylxanthen-4-yl)-diphenylphosphane;palladium(2+);dichloride SMILES: Cl[Pd++]Cl.CC1(C)C2=C(OC3=C1C=CC=C3P(C1=CC=CC=C1)C1=CC=CC=C1)C(=CC=C2)P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 86280406 |
|---|---|
| CAS | 205319-10-4 |
| Molecular Weight (g/mol) | 755.95 |
| MDL Number | MFCD14155707 |
| SMILES | Cl[Pd++]Cl.CC1(C)C2=C(OC3=C1C=CC=C3P(C1=CC=CC=C1)C1=CC=CC=C1)C(=CC=C2)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | dichloro 9,9-dimethyl-4,5-bis diphenylphosphino xanthene palladium ii,palladium 2+ xantphos dichloride,4,5-bis diphenylphosphino-9,9-dimethylxanthene dichloropalladium ii,4,5-bis diphenylphosphino-9,9-dimethylxanthene palladium ii dichloride |
| IUPAC Name | (5-diphenylphosphanyl-9,9-dimethylxanthen-4-yl)-diphenylphosphane;palladium(2+);dichloride |
| InChI Key | MNBAPNBMBOYNAW-UHFFFAOYSA-L |
| Molecular Formula | C39H32Cl2OP2Pd |
Palladium hydroxide, Pd 5% on carbon powder, Type A403002-5, nominally 50% water
CAS: 12135-22-7 Molecular Formula: H2O2Pd Molecular Weight (g/mol): 140.43 MDL Number: MFCD00064599 InChI Key: NXJCBFBQEVOTOW-UHFFFAOYSA-L Synonym: palladium hydroxide,palladium ii hydroxide,pearlman's catalyst,pearlmans catalyst,dihydroxypalladium,palladiumhydroxide,pearlman catalyst,peariman's catalyst,pearl man's catalyst,pd oh 2 on carbon PubChem CID: 9942167 IUPAC Name: palladium(2+);dihydroxide SMILES: [OH-].[OH-].[Pd++]
| PubChem CID | 9942167 |
|---|---|
| CAS | 12135-22-7 |
| Molecular Weight (g/mol) | 140.43 |
| MDL Number | MFCD00064599 |
| SMILES | [OH-].[OH-].[Pd++] |
| Synonym | palladium hydroxide,palladium ii hydroxide,pearlman's catalyst,pearlmans catalyst,dihydroxypalladium,palladiumhydroxide,pearlman catalyst,peariman's catalyst,pearl man's catalyst,pd oh 2 on carbon |
| IUPAC Name | palladium(2+);dihydroxide |
| InChI Key | NXJCBFBQEVOTOW-UHFFFAOYSA-L |
| Molecular Formula | H2O2Pd |
Bis(tricyclohexylphosphine)palladium(0), 97% min
CAS: 33309-88-5 Molecular Formula: C36H66P2Pd Molecular Weight (g/mol): 667.29 MDL Number: MFCD01073796 InChI Key: JGBZTJWQMWZVNX-UHFFFAOYSA-N Synonym: bis tricyclohexylphosphine palladium 0,bis tricyclohexylphosphine palladium o,bis tricyclohexylphosphine palladium,palladium, bis tricyclohexylphosphine,pd pcy3 2,palladium; tricyclohexylphosphane,palladium-tricyclohexylphosphine 1:2,bis tricyclohexylphosphine-palladium o PubChem CID: 2734559 IUPAC Name: palladium;tricyclohexylphosphane SMILES: [Pd].C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.C1CCC(CC1)P(C1CCCCC1)C1CCCCC1
| PubChem CID | 2734559 |
|---|---|
| CAS | 33309-88-5 |
| Molecular Weight (g/mol) | 667.29 |
| MDL Number | MFCD01073796 |
| SMILES | [Pd].C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.C1CCC(CC1)P(C1CCCCC1)C1CCCCC1 |
| Synonym | bis tricyclohexylphosphine palladium 0,bis tricyclohexylphosphine palladium o,bis tricyclohexylphosphine palladium,palladium, bis tricyclohexylphosphine,pd pcy3 2,palladium; tricyclohexylphosphane,palladium-tricyclohexylphosphine 1:2,bis tricyclohexylphosphine-palladium o |
| IUPAC Name | palladium;tricyclohexylphosphane |
| InChI Key | JGBZTJWQMWZVNX-UHFFFAOYSA-N |
| Molecular Formula | C36H66P2Pd |
Bis(tri-o-tolylphosphine)palladium(0), Pd 14.9%
CAS: 69861-71-8 Molecular Formula: C42H42P2Pd Molecular Weight (g/mol): 715.166 MDL Number: MFCD12911908 InChI Key: CUBIJGNGGJBNOC-UHFFFAOYSA-N Synonym: bis tri-o-tolylphosphine palladium 0,pd o-tol 3p 2,bis tris 2-methylphenyl phosphine palladium,bis tris 2-tolyl phosphine palladium,palladium, bis tris 2-methylphenyl phosphine,bis tris 2-methylphenyl phosphane palladium PubChem CID: 10952654 IUPAC Name: palladium;tris(2-methylphenyl)phosphane SMILES: CC1=CC=CC=C1P(C2=CC=CC=C2C)C3=CC=CC=C3C.CC1=CC=CC=C1P(C2=CC=CC=C2C)C3=CC=CC=C3C.[Pd]
| PubChem CID | 10952654 |
|---|---|
| CAS | 69861-71-8 |
| Molecular Weight (g/mol) | 715.166 |
| MDL Number | MFCD12911908 |
| SMILES | CC1=CC=CC=C1P(C2=CC=CC=C2C)C3=CC=CC=C3C.CC1=CC=CC=C1P(C2=CC=CC=C2C)C3=CC=CC=C3C.[Pd] |
| Synonym | bis tri-o-tolylphosphine palladium 0,pd o-tol 3p 2,bis tris 2-methylphenyl phosphine palladium,bis tris 2-tolyl phosphine palladium,palladium, bis tris 2-methylphenyl phosphine,bis tris 2-methylphenyl phosphane palladium |
| IUPAC Name | palladium;tris(2-methylphenyl)phosphane |
| InChI Key | CUBIJGNGGJBNOC-UHFFFAOYSA-N |
| Molecular Formula | C42H42P2Pd |
Bis(di-tert-butyl-phenylphosphine)palladium(0), 98%
CAS: 52359-17-8 Molecular Formula: C28H46P2Pd Molecular Weight (g/mol): 551.04 MDL Number: MFCD15071400 InChI Key: KJTQUBRAVOMHKY-UHFFFAOYSA-N Synonym: palladium, bis bis 1,1-dimethylethyl phenylphosphine,di-tert-butyl phenyl phosphane-palladium 2/1,bis di-tert-butyl phenyl phosphane palladium PubChem CID: 71365671 IUPAC Name: ditert-butyl(phenyl)phosphane;palladium SMILES: [Pd].CC(C)(C)P(C1=CC=CC=C1)C(C)(C)C.CC(C)(C)P(C1=CC=CC=C1)C(C)(C)C
| PubChem CID | 71365671 |
|---|---|
| CAS | 52359-17-8 |
| Molecular Weight (g/mol) | 551.04 |
| MDL Number | MFCD15071400 |
| SMILES | [Pd].CC(C)(C)P(C1=CC=CC=C1)C(C)(C)C.CC(C)(C)P(C1=CC=CC=C1)C(C)(C)C |
| Synonym | palladium, bis bis 1,1-dimethylethyl phenylphosphine,di-tert-butyl phenyl phosphane-palladium 2/1,bis di-tert-butyl phenyl phosphane palladium |
| IUPAC Name | ditert-butyl(phenyl)phosphane;palladium |
| InChI Key | KJTQUBRAVOMHKY-UHFFFAOYSA-N |
| Molecular Formula | C28H46P2Pd |