Alkyl Halides
Filtered Search Results
2-(Bromomethyl)-1,3-benzothiazole, 95%, Thermo Scientific™
CAS: 106086-78-6 Molecular Formula: C8H6BrNS Molecular Weight (g/mol): 228.107 InChI Key: WFLCAOGKZQTOIG-UHFFFAOYSA-N Synonym: 2-bromomethyl-1,3-benzothiazole,2-bromomethyl benzo d thiazole,2-bromomethyl benzothiazole,benzothiazole, 2-bromomethyl,benzo d thiazol-2-yl methyl bromide,zlchem 58,pubchem3912,acmc-1bpju,2-bromomethylbenzothiazole PubChem CID: 2776258 IUPAC Name: 2-(bromomethyl)-1,3-benzothiazole SMILES: C1=CC=C2C(=C1)N=C(S2)CBr
| PubChem CID | 2776258 |
|---|---|
| CAS | 106086-78-6 |
| Molecular Weight (g/mol) | 228.107 |
| SMILES | C1=CC=C2C(=C1)N=C(S2)CBr |
| Synonym | 2-bromomethyl-1,3-benzothiazole,2-bromomethyl benzo d thiazole,2-bromomethyl benzothiazole,benzothiazole, 2-bromomethyl,benzo d thiazol-2-yl methyl bromide,zlchem 58,pubchem3912,acmc-1bpju,2-bromomethylbenzothiazole |
| IUPAC Name | 2-(bromomethyl)-1,3-benzothiazole |
| InChI Key | WFLCAOGKZQTOIG-UHFFFAOYSA-N |
| Molecular Formula | C8H6BrNS |
Perfluoro-1-butanesulfonyl fluoride, 92%
CAS: 375-72-4 Molecular Formula: C4F10O2S Molecular Weight (g/mol): 302.09 MDL Number: MFCD00007422 InChI Key: LUYQYZLEHLTPBH-UHFFFAOYSA-N Synonym: nonafluorobutanesulfonyl fluoride,perfluorobutanesulfonyl fluoride,perfluoro-1-butanesulfonyl fluoride,perfluorobutanesulfonylfluoride,perfluorobutylsulfonyl fluoride,nonafluorobutanesulphonyl fluoride,perfluoro n-butylsulfonyl fluoride,nonafluorobutane-1-sulfonyl fluoride,nonafluoro-1-butanesulfonyl fluoride,1-butanesulfonyl fluoride, 1,1,2,2,3,3,4,4,4-nonafluoro PubChem CID: 67814 IUPAC Name: 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonyl fluoride SMILES: C(C(C(F)(F)S(=O)(=O)F)(F)F)(C(F)(F)F)(F)F
| PubChem CID | 67814 |
|---|---|
| CAS | 375-72-4 |
| Molecular Weight (g/mol) | 302.09 |
| MDL Number | MFCD00007422 |
| SMILES | C(C(C(F)(F)S(=O)(=O)F)(F)F)(C(F)(F)F)(F)F |
| Synonym | nonafluorobutanesulfonyl fluoride,perfluorobutanesulfonyl fluoride,perfluoro-1-butanesulfonyl fluoride,perfluorobutanesulfonylfluoride,perfluorobutylsulfonyl fluoride,nonafluorobutanesulphonyl fluoride,perfluoro n-butylsulfonyl fluoride,nonafluorobutane-1-sulfonyl fluoride,nonafluoro-1-butanesulfonyl fluoride,1-butanesulfonyl fluoride, 1,1,2,2,3,3,4,4,4-nonafluoro |
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonyl fluoride |
| InChI Key | LUYQYZLEHLTPBH-UHFFFAOYSA-N |
| Molecular Formula | C4F10O2S |
Pentafluoropropionic acid, 97%
CAS: 422-64-0 Molecular Formula: C3HF5O2 Molecular Weight (g/mol): 164.03 MDL Number: MFCD00004170 InChI Key: LRMSQVBRUNSOJL-UHFFFAOYSA-N Synonym: pentafluoropropionic acid,perfluoropropionic acid,pentafluoropropanoic acid,propanoic acid, pentafluoro,propionic acid, pentafluoro,2,2,3,3,3-pentafluoropropionic acid,ipc-pffa-3,perfluoropropanoic acid,propanoic acid, 2,2,3,3,3-pentafluoro,perfluoropropionicacid PubChem CID: 62356 SMILES: OC(=O)C(F)(F)C(F)(F)F
| PubChem CID | 62356 |
|---|---|
| CAS | 422-64-0 |
| Molecular Weight (g/mol) | 164.03 |
| MDL Number | MFCD00004170 |
| SMILES | OC(=O)C(F)(F)C(F)(F)F |
| Synonym | pentafluoropropionic acid,perfluoropropionic acid,pentafluoropropanoic acid,propanoic acid, pentafluoro,propionic acid, pentafluoro,2,2,3,3,3-pentafluoropropionic acid,ipc-pffa-3,perfluoropropanoic acid,propanoic acid, 2,2,3,3,3-pentafluoro,perfluoropropionicacid |
| InChI Key | LRMSQVBRUNSOJL-UHFFFAOYSA-N |
| Molecular Formula | C3HF5O2 |
Ethyl pentafluoropropionate, 98+%
CAS: 426-65-3 Molecular Formula: C5H5F5O2 Molecular Weight (g/mol): 192.085 MDL Number: MFCD00000431 InChI Key: DBOFMRQAMAZKQY-UHFFFAOYSA-N Synonym: ethyl pentafluoropropionate,ethyl perfluoropropionate,ethylpentafluoropropionate,ethyl pentafluoropropanoate,pentafluoropropionic acid ethyl ester,propanoic acid, pentafluoro-, ethyl ester,propanoic acid, 2,2,3,3,3-pentafluoro-, ethyl ester,2,2,3,3,3-pentafluoro-propionic acid ethyl ester,pubchem12575,acmc-1asrx PubChem CID: 67928 IUPAC Name: ethyl 2,2,3,3,3-pentafluoropropanoate SMILES: CCOC(=O)C(C(F)(F)F)(F)F
| PubChem CID | 67928 |
|---|---|
| CAS | 426-65-3 |
| Molecular Weight (g/mol) | 192.085 |
| MDL Number | MFCD00000431 |
| SMILES | CCOC(=O)C(C(F)(F)F)(F)F |
| Synonym | ethyl pentafluoropropionate,ethyl perfluoropropionate,ethylpentafluoropropionate,ethyl pentafluoropropanoate,pentafluoropropionic acid ethyl ester,propanoic acid, pentafluoro-, ethyl ester,propanoic acid, 2,2,3,3,3-pentafluoro-, ethyl ester,2,2,3,3,3-pentafluoro-propionic acid ethyl ester,pubchem12575,acmc-1asrx |
| IUPAC Name | ethyl 2,2,3,3,3-pentafluoropropanoate |
| InChI Key | DBOFMRQAMAZKQY-UHFFFAOYSA-N |
| Molecular Formula | C5H5F5O2 |
Heptafluorobutyric acid, 99%
CAS: 375-22-4 Molecular Formula: C4HF7O2 Molecular Weight (g/mol): 214.039 MDL Number: MFCD00004171 InChI Key: YPJUNDFVDDCYIH-UHFFFAOYSA-N Synonym: heptafluorobutyric acid,perfluorobutyric acid,heptafluorobutanoic acid,perfluorobutanoic acid,butanoic acid, heptafluoro,heptafluoro-1-butanoic acid,perfluoropropanecarboxylic acid,butyric acid, heptafluoro,kyselina heptafluormaselna,kyselina heptafluormaselna czech PubChem CID: 9777 ChEBI: CHEBI:39426 IUPAC Name: 2,2,3,3,4,4,4-heptafluorobutanoic acid SMILES: C(=O)(C(C(C(F)(F)F)(F)F)(F)F)O
| PubChem CID | 9777 |
|---|---|
| CAS | 375-22-4 |
| Molecular Weight (g/mol) | 214.039 |
| ChEBI | CHEBI:39426 |
| MDL Number | MFCD00004171 |
| SMILES | C(=O)(C(C(C(F)(F)F)(F)F)(F)F)O |
| Synonym | heptafluorobutyric acid,perfluorobutyric acid,heptafluorobutanoic acid,perfluorobutanoic acid,butanoic acid, heptafluoro,heptafluoro-1-butanoic acid,perfluoropropanecarboxylic acid,butyric acid, heptafluoro,kyselina heptafluormaselna,kyselina heptafluormaselna czech |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutanoic acid |
| InChI Key | YPJUNDFVDDCYIH-UHFFFAOYSA-N |
| Molecular Formula | C4HF7O2 |
Heptafluorobutyric acid Solution, 0.5M in Water, MilliporeSigma™ Supelco™
MDL Number: MFCD00004171 Synonym: HFBA solution; Perfluorobutbutyric acid solution
| MDL Number | MFCD00004171 |
|---|---|
| Synonym | HFBA solution; Perfluorobutbutyric acid solution |
Iodomethane, 99+%, stab. with copper
CAS: 74-88-4 Molecular Formula: CH3I Molecular Weight (g/mol): 141.94 MDL Number: MFCD00001073 InChI Key: INQOMBQAUSQDDS-UHFFFAOYSA-N Synonym: methyl iodide,monoiodomethane,methane, iodo,methyljodid,jod-methan,methyliodide,methyljodide,iodometano,joodmethaan,metylu jodek PubChem CID: 6328 ChEBI: CHEBI:39282 IUPAC Name: iodomethane SMILES: CI
| PubChem CID | 6328 |
|---|---|
| CAS | 74-88-4 |
| Molecular Weight (g/mol) | 141.94 |
| ChEBI | CHEBI:39282 |
| MDL Number | MFCD00001073 |
| SMILES | CI |
| Synonym | methyl iodide,monoiodomethane,methane, iodo,methyljodid,jod-methan,methyliodide,methyljodide,iodometano,joodmethaan,metylu jodek |
| IUPAC Name | iodomethane |
| InChI Key | INQOMBQAUSQDDS-UHFFFAOYSA-N |
| Molecular Formula | CH3I |
Dichloromethane, anhydrous, 99.7+%, packaged under Argon in resealable ChemSeal™ bottles, stab. with amylene
CAS: 75-09-2 Molecular Formula: CH2Cl2 Molecular Weight (g/mol): 84.93 MDL Number: MFCD00000881 InChI Key: YMWUJEATGCHHMB-UHFFFAOYSA-N Synonym: methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm PubChem CID: 6344 ChEBI: CHEBI:15767 IUPAC Name: dichloromethane SMILES: ClCCl
| PubChem CID | 6344 |
|---|---|
| CAS | 75-09-2 |
| Molecular Weight (g/mol) | 84.93 |
| ChEBI | CHEBI:15767 |
| MDL Number | MFCD00000881 |
| SMILES | ClCCl |
| Synonym | methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm |
| IUPAC Name | dichloromethane |
| InChI Key | YMWUJEATGCHHMB-UHFFFAOYSA-N |
| Molecular Formula | CH2Cl2 |
Dibromomethane, 99%
CAS: 74-95-3 Molecular Formula: CH2Br2 Molecular Weight (g/mol): 173.835 MDL Number: MFCD00000168 InChI Key: FJBFPHVGVWTDIP-UHFFFAOYSA-N Synonym: methylene bromide,methane, dibromo,methylene dibromide,dibromomethylene,rcra waste number u068,dibrommethan,methylenbromid,dibromo-methane,ccris 939,rcra waste no. u068 PubChem CID: 3024 ChEBI: CHEBI:47077 IUPAC Name: dibromomethane SMILES: C(Br)Br
| PubChem CID | 3024 |
|---|---|
| CAS | 74-95-3 |
| Molecular Weight (g/mol) | 173.835 |
| ChEBI | CHEBI:47077 |
| MDL Number | MFCD00000168 |
| SMILES | C(Br)Br |
| Synonym | methylene bromide,methane, dibromo,methylene dibromide,dibromomethylene,rcra waste number u068,dibrommethan,methylenbromid,dibromo-methane,ccris 939,rcra waste no. u068 |
| IUPAC Name | dibromomethane |
| InChI Key | FJBFPHVGVWTDIP-UHFFFAOYSA-N |
| Molecular Formula | CH2Br2 |
Dibromomethane, 99%
CAS: 74-95-3 Molecular Formula: CH2Br2 Molecular Weight (g/mol): 173.83 MDL Number: MFCD00000168 InChI Key: FJBFPHVGVWTDIP-UHFFFAOYSA-N Synonym: methylene bromide,methane, dibromo,methylene dibromide,dibromomethylene,rcra waste number u068,dibrommethan,methylenbromid,dibromo-methane,ccris 939,rcra waste no. u068 PubChem CID: 3024 ChEBI: CHEBI:47077 IUPAC Name: dibromomethane SMILES: C(Br)Br
| PubChem CID | 3024 |
|---|---|
| CAS | 74-95-3 |
| Molecular Weight (g/mol) | 173.83 |
| ChEBI | CHEBI:47077 |
| MDL Number | MFCD00000168 |
| SMILES | C(Br)Br |
| Synonym | methylene bromide,methane, dibromo,methylene dibromide,dibromomethylene,rcra waste number u068,dibrommethan,methylenbromid,dibromo-methane,ccris 939,rcra waste no. u068 |
| IUPAC Name | dibromomethane |
| InChI Key | FJBFPHVGVWTDIP-UHFFFAOYSA-N |
| Molecular Formula | CH2Br2 |
Chloroiodomethane, 98%, stabilized
CAS: 593-71-5 Molecular Formula: CH2ClI Molecular Weight (g/mol): 176.38 InChI Key: PJGJQVRXEUVAFT-UHFFFAOYSA-N Synonym: chloro iodo methane,methane, chloroiodo,methylene chloroiodide,chloro-iodomethane,chloro-iodo-methane,iodochloromethane,chlor iod methan,chloroiodo-methane,chloromethyl iodide,qmablxaih@ PubChem CID: 11644 IUPAC Name: chloro(iodo)methane SMILES: C(Cl)I
| PubChem CID | 11644 |
|---|---|
| CAS | 593-71-5 |
| Molecular Weight (g/mol) | 176.38 |
| SMILES | C(Cl)I |
| Synonym | chloro iodo methane,methane, chloroiodo,methylene chloroiodide,chloro-iodomethane,chloro-iodo-methane,iodochloromethane,chlor iod methan,chloroiodo-methane,chloromethyl iodide,qmablxaih@ |
| IUPAC Name | chloro(iodo)methane |
| InChI Key | PJGJQVRXEUVAFT-UHFFFAOYSA-N |
| Molecular Formula | CH2ClI |
Diiodomethane, 99+%, stabilized with silver wire
CAS: 75-11-6 Molecular Formula: CH2I2 Molecular Weight (g/mol): 267.84 MDL Number: MFCD00001079 InChI Key: NZZFYRREKKOMAT-UHFFFAOYSA-N Synonym: methylene iodide,methane, diiodo,methylene diiodide,mi-gee,dijodmethan,methylenjodid,dijodmethan czech,methylenjodid czech,di-iodomethane,diiodo-methane PubChem CID: 6346 IUPAC Name: diiodomethane SMILES: ICI
| PubChem CID | 6346 |
|---|---|
| CAS | 75-11-6 |
| Molecular Weight (g/mol) | 267.84 |
| MDL Number | MFCD00001079 |
| SMILES | ICI |
| Synonym | methylene iodide,methane, diiodo,methylene diiodide,mi-gee,dijodmethan,methylenjodid,dijodmethan czech,methylenjodid czech,di-iodomethane,diiodo-methane |
| IUPAC Name | diiodomethane |
| InChI Key | NZZFYRREKKOMAT-UHFFFAOYSA-N |
| Molecular Formula | CH2I2 |
Dichloromethane, 99.8%, Extra Dry over Molecular Sieve, Stabilized, AcroSeal™
CAS: 75-09-2 Molecular Formula: CH2Cl2 Molecular Weight (g/mol): 84.93 MDL Number: MFCD00000881 InChI Key: YMWUJEATGCHHMB-UHFFFAOYSA-N Synonym: methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm PubChem CID: 6344 ChEBI: CHEBI:15767 IUPAC Name: dichloromethane SMILES: ClCCl
| PubChem CID | 6344 |
|---|---|
| CAS | 75-09-2 |
| Molecular Weight (g/mol) | 84.93 |
| ChEBI | CHEBI:15767 |
| MDL Number | MFCD00000881 |
| SMILES | ClCCl |
| Synonym | methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm |
| IUPAC Name | dichloromethane |
| InChI Key | YMWUJEATGCHHMB-UHFFFAOYSA-N |
| Molecular Formula | CH2Cl2 |
Dichloromethane-d2, for NMR, 99.5 atom % D, AcroSeal™
CAS: 1665-00-5 Molecular Formula: CCl2D2 Molecular Weight (g/mol): 86.95 InChI Key: YMWUJEATGCHHMB-DICFDUPASA-N Synonym: dichloromethane-d2,methylene chloride-d2,dichloro 2h2 methane,methane-d2, dichloro,cd2cl2,deuterated dichloromethane,dichloro dideuterio methane,dideuteromethylene chloride,dichloromethane-d2, 99.9 atom % d,dichloromethane-d', 99.96 atom % d PubChem CID: 160586 IUPAC Name: dichloro(dideuterio)methane SMILES: C(Cl)Cl
| PubChem CID | 160586 |
|---|---|
| CAS | 1665-00-5 |
| Molecular Weight (g/mol) | 86.95 |
| SMILES | C(Cl)Cl |
| Synonym | dichloromethane-d2,methylene chloride-d2,dichloro 2h2 methane,methane-d2, dichloro,cd2cl2,deuterated dichloromethane,dichloro dideuterio methane,dideuteromethylene chloride,dichloromethane-d2, 99.9 atom % d,dichloromethane-d', 99.96 atom % d |
| IUPAC Name | dichloro(dideuterio)methane |
| InChI Key | YMWUJEATGCHHMB-DICFDUPASA-N |
| Molecular Formula | CCl2D2 |
Iodomethane, 99+%, stab. with copper
CAS: 74-88-4 Molecular Formula: CH3I Molecular Weight (g/mol): 141.94 MDL Number: MFCD00001073 InChI Key: INQOMBQAUSQDDS-UHFFFAOYSA-N Synonym: methyl iodide,monoiodomethane,methane, iodo,methyljodid,jod-methan,methyliodide,methyljodide,iodometano,joodmethaan,metylu jodek PubChem CID: 6328 ChEBI: CHEBI:39282 IUPAC Name: iodomethane SMILES: CI
| PubChem CID | 6328 |
|---|---|
| CAS | 74-88-4 |
| Molecular Weight (g/mol) | 141.94 |
| ChEBI | CHEBI:39282 |
| MDL Number | MFCD00001073 |
| SMILES | CI |
| Synonym | methyl iodide,monoiodomethane,methane, iodo,methyljodid,jod-methan,methyliodide,methyljodide,iodometano,joodmethaan,metylu jodek |
| IUPAC Name | iodomethane |
| InChI Key | INQOMBQAUSQDDS-UHFFFAOYSA-N |
| Molecular Formula | CH3I |