missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
2-Naphthylacetic acid, 99%, ACROS Organics™
$77.24 - $77.24
Chemical Identifiers
| CAS | 581-96-4 |
|---|---|
| Molecular Formula | C12H10O2 |
| Molecular Weight (g/mol) | 186.21 |
| MDL Number | MFCD00004126 |
| InChI Key | VIBOGIYPPWLDTI-UHFFFAOYSA-N |
| Synonym | 2-naphthylacetic acid, 2-naphthaleneacetic acid, 2-naphthalen-2-yl acetic acid, betoxan, 2-2-naphthyl acetic acid, beta-naphthylacetic acid, beta-naphthaleneacetic acid, beta-naphthaleneacetate, naphthalen-2-ylacetic acid, .beta.-naphthaleneacetic acid |
| PubChem CID | 11393 |
| ChEBI | CHEBI:37837 |
| IUPAC Name | 2-naphthalen-2-ylacetic acid |
| SMILES | C1=CC=C2C=C(C=CC2=C1)CC(=O)O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
| AC128220050 SDS |
Acros Organics
128220050 |
5g | Glass bottle |
Each for $77.24
|
|
AC128220250 SDS |
Acros Organics
128220250 |
25g | Glass bottle | N/A | N/A |
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
| AC128221000 SDS |
Acros Organics
AC128221000 |
100g | Glass bottle | N/A | N/A | ||||
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
Chemical Identifiers
| 581-96-4 | |
| 186.21 | |
| VIBOGIYPPWLDTI-UHFFFAOYSA-N | |
| 11393 | |
| 2-naphthalen-2-ylacetic acid |
| C12H10O2 | |
| MFCD00004126 | |
| 2-naphthylacetic acid, 2-naphthaleneacetic acid, 2-naphthalen-2-yl acetic acid, betoxan, 2-2-naphthyl acetic acid, beta-naphthylacetic acid, beta-naphthaleneacetic acid, beta-naphthaleneacetate, naphthalen-2-ylacetic acid, .beta.-naphthaleneacetic acid | |
| CHEBI:37837 | |
| C1=CC=C2C=C(C=CC2=C1)CC(=O)O |
Specifications
| Authentic | |
| White | |
| 5g | |
| 98.5 | |
| 99% | |
| C10H7CH2CO2H | |
| 09, 667 | |
| VIBOGIYPPWLDTI-UHFFFAOYSA-N | |
| 2-naphthalen-2-ylacetic acid | |
| 11393 | |
| 186.21 | |
| 99% |
| Glass bottle | |
| 141.0°C to 143.0°C | |
| 581-96-4 | |
| 100.0 | |
| C12H10O2 | |
| MFCD00004126 | |
| 2-naphthylacetic acid, 2-naphthaleneacetic acid, 2-naphthalen-2-yl acetic acid, betoxan, 2-2-naphthyl acetic acid, beta-naphthylacetic acid, beta-naphthaleneacetic acid, beta-naphthaleneacetate, naphthalen-2-ylacetic acid, .beta.-naphthaleneacetic acid | |
| C1=CC=C2C=C(C=CC2=C1)CC(=O)O | |
| 186.21 | |
| CHEBI:37837 | |
| Crystalline Powder or Flakes | |
| 2-Naphthylacetic acid |