missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
2-Naphthylacetic acid, 99%, Thermo Scientific™
$82.51 - $210.69
Chemical Identifiers
| CAS | 581-96-4 |
|---|---|
| Molecular Formula | C12H10O2 |
| Molecular Weight (g/mol) | 186.21 |
| MDL Number | MFCD00004126 |
| InChI Key | VIBOGIYPPWLDTI-UHFFFAOYSA-N |
| Synonym | .beta.-naphthaleneacetic acid, 2-2-naphthyl acetic acid, 2-naphthalen-2-yl acetic acid, 2-naphthaleneacetic acid, 2-naphthylacetic acid, beta-naphthaleneacetate, beta-naphthaleneacetic acid, beta-naphthylacetic acid, betoxan, naphthalen-2-ylacetic acid |
| PubChem CID | 11393 |
| ChEBI | CHEBI:37837 |
| IUPAC Name | 2-naphthalen-2-ylacetic acid |
| SMILES | OC(=O)CC1=CC=C2C=CC=CC2=C1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC128220050
|
Thermo Fisher Scientific
128220050 |
5g | Glass bottle |
Each for $82.51
|
|
AC128220250
|
Thermo Fisher Scientific
128220250 |
25g | Glass bottle |
Each for $210.69
|
|
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 581-96-4 | |
| 186.21 | |
| VIBOGIYPPWLDTI-UHFFFAOYSA-N | |
| 11393 | |
| 2-naphthalen-2-ylacetic acid |
| C12H10O2 | |
| MFCD00004126 | |
| .beta.-naphthaleneacetic acid, 2-2-naphthyl acetic acid, 2-naphthalen-2-yl acetic acid, 2-naphthaleneacetic acid, 2-naphthylacetic acid, beta-naphthaleneacetate, beta-naphthaleneacetic acid, beta-naphthylacetic acid, betoxan, naphthalen-2-ylacetic acid | |
| CHEBI:37837 | |
| OC(=O)CC1=CC=C2C=CC=CC2=C1 |
Specifications
| 581-96-4 | |
| 100.0 | |
| 141.0°C to 143.0°C | |
| Authentic | |
| C10H7CH2CO2H | |
| 09, 667 | |
| .beta.-naphthaleneacetic acid, 2-2-naphthyl acetic acid, 2-naphthalen-2-yl acetic acid, 2-naphthaleneacetic acid, 2-naphthylacetic acid, beta-naphthaleneacetate, beta-naphthaleneacetic acid, beta-naphthylacetic acid, betoxan, naphthalen-2-ylacetic acid | |
| Solubility in water: insoluble | |
| OC(=O)CC1=CC=C2C=CC=CC2=C1 | |
| 186.21 | |
| CHEBI:37837 | |
| Crystalline Powder or Flakes | |
| 2-Naphthylacetic acid |
| 98.5 | |
| White | |
| 99% | |
| C12H10O2 | |
| MFCD00004126 | |
| Glass bottle | |
| 5g | |
| VIBOGIYPPWLDTI-UHFFFAOYSA-N | |
| 2-naphthalen-2-ylacetic acid | |
| 11393 | |
| 186.21 | |
| 99% |
Safety and Handling
GHS Signal Word: Warning
EINECSNumber : 209-475-
RUO – Research Use Only