missing translation for 'onlineSavingsMsg'
Learn More
Learn More
2-Naphthylacetic acid, 99%
CAS: 581-96-4 | C12H10O2 | 186.21 g/mol
Supplier: Thermo Scientific Chemicals 128220050
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| 2-Naphthylacetic acid | |
| 98.5 | |
| 141.0°C to 143.0°C | |
| Authentic | |
| Glass bottle | |
| C10H7CH2CO2H | |
| 5 g | |
| 2-naphthylacetic acid, 2-naphthaleneacetic acid, 2-naphthalen-2-yl acetic acid, betoxan, 2-2-naphthyl acetic acid, beta-naphthylacetic acid, beta-naphthaleneacetic acid, beta-naphthaleneacetate, naphthalen-2-ylacetic acid, .beta.-naphthaleneacetic acid | |
| VIBOGIYPPWLDTI-UHFFFAOYSA-N | |
| 2-naphthalen-2-ylacetic acid | |
| 11393 | |
| 186.21 | |
| Crystalline Powder or Flakes |
| 581-96-4 | |
| 100.0 | |
| White | |
| 99% | |
| C12H10O2 | |
| MFCD00004126 | |
| 09, 667 | |
| Solubility in water: insoluble | |
| OC(=O)CC1=CC=C2C=CC=CC2=C1 | |
| 186.21 | |
| CHEBI:37837 | |
| 99% |
Chemical Identifiers
| 581-96-4 | |
| 186.21 | |
| VIBOGIYPPWLDTI-UHFFFAOYSA-N | |
| 11393 | |
| 2-naphthalen-2-ylacetic acid |
| C12H10O2 | |
| MFCD00004126 | |
| 2-naphthylacetic acid, 2-naphthaleneacetic acid, 2-naphthalen-2-yl acetic acid, betoxan, 2-2-naphthyl acetic acid, beta-naphthylacetic acid, beta-naphthaleneacetic acid, beta-naphthaleneacetate, naphthalen-2-ylacetic acid, .beta.-naphthaleneacetic acid | |
| CHEBI:37837 | |
| OC(=O)CC1=CC=C2C=CC=CC2=C1 |
Safety and Handling
GHS Signal Word: Warning
EINECSNumber : 209-475-
RUO – Research Use Only