Filtered Search Results
Ethanol, 70% Solution, Molecular Biology Grade, Denatured, Fisher BioReagents™
CAS: 64-17-5 Molecular Formula: C2H6O Molecular Weight (g/mol): 46.069 InChI Key: LFQSCWFLJHTTHZ-UHFFFAOYSA-N Synonym: ethyl alcohol,alcohol,methylcarbinol,grain alcohol,ethyl hydroxide,ethyl hydrate,algrain,alcohol,anhydrol,tecsol PubChem CID: 702 ChEBI: CHEBI:16236 IUPAC Name: ethanol SMILES: CCO
| PubChem CID | 702 |
|---|---|
| CAS | 64-17-5 |
| Molecular Weight (g/mol) | 46.069 |
| ChEBI | CHEBI:16236 |
| SMILES | CCO |
| Synonym | ethyl alcohol,alcohol,methylcarbinol,grain alcohol,ethyl hydroxide,ethyl hydrate,algrain,alcohol,anhydrol,tecsol |
| IUPAC Name | ethanol |
| InChI Key | LFQSCWFLJHTTHZ-UHFFFAOYSA-N |
| Molecular Formula | C2H6O |
Sodium Dodecyl Sulfate (SDS), White Powder, Electrophoresis, Fisher BioReagents™
Molecular Formula: C12H25NaO4S Molecular Weight (g/mol): 288.38 MDL Number: MFCD00036175 InChI Key: DBMJMQXJHONAFJ-UHFFFAOYSA-M Synonym: Sodium Lauryl Sulfate,SDS PubChem CID: 3423265 ChEBI: CHEBI:8984 IUPAC Name: sodium dodecyl sulfate SMILES: [Na+].CCCCCCCCCCCCOS([O-])(=O)=O
| PubChem CID | 3423265 |
|---|---|
| Molecular Weight (g/mol) | 288.38 |
| ChEBI | CHEBI:8984 |
| MDL Number | MFCD00036175 |
| SMILES | [Na+].CCCCCCCCCCCCOS([O-])(=O)=O |
| Synonym | Sodium Lauryl Sulfate,SDS |
| IUPAC Name | sodium dodecyl sulfate |
| InChI Key | DBMJMQXJHONAFJ-UHFFFAOYSA-M |
| Molecular Formula | C12H25NaO4S |
Glycerol (Molecular Biology), Fisher BioReagents™
CAS: 56-81-5 Molecular Formula: C3H8O3 Molecular Weight (g/mol): 92.09 MDL Number: MFCD00004722 InChI Key: PEDCQBHIVMGVHV-UHFFFAOYSA-N Synonym: glycerol,glycerin,glycerine,1,2,3-propanetriol,glycyl alcohol,trihydroxypropane,glyceritol,propanetriol,1,2,3-trihydroxypropane,osmoglyn PubChem CID: 753 ChEBI: CHEBI:17754 IUPAC Name: propane-1,2,3-triol SMILES: OCC(O)CO
| PubChem CID | 753 |
|---|---|
| CAS | 56-81-5 |
| Molecular Weight (g/mol) | 92.09 |
| ChEBI | CHEBI:17754 |
| MDL Number | MFCD00004722 |
| SMILES | OCC(O)CO |
| Synonym | glycerol,glycerin,glycerine,1,2,3-propanetriol,glycyl alcohol,trihydroxypropane,glyceritol,propanetriol,1,2,3-trihydroxypropane,osmoglyn |
| IUPAC Name | propane-1,2,3-triol |
| InChI Key | PEDCQBHIVMGVHV-UHFFFAOYSA-N |
| Molecular Formula | C3H8O3 |
2-Propanol, Molecular Biology Grade, Fisher BioReagents™
CAS: 67-63-0 Molecular Formula: C3H8O Molecular Weight (g/mol): 60.096 InChI Key: KFZMGEQAYNKOFK-UHFFFAOYSA-N Synonym: isopropanol,2-propanol,isopropyl alcohol,2-hydroxypropane,alkolave,avantine,hartosol,dimethylcarbinol,sec-propyl alcohol,petrohol PubChem CID: 3776 ChEBI: CHEBI:17824 IUPAC Name: propan-2-ol SMILES: CC(C)O
| PubChem CID | 3776 |
|---|---|
| CAS | 67-63-0 |
| Molecular Weight (g/mol) | 60.096 |
| ChEBI | CHEBI:17824 |
| SMILES | CC(C)O |
| Synonym | isopropanol,2-propanol,isopropyl alcohol,2-hydroxypropane,alkolave,avantine,hartosol,dimethylcarbinol,sec-propyl alcohol,petrohol |
| IUPAC Name | propan-2-ol |
| InChI Key | KFZMGEQAYNKOFK-UHFFFAOYSA-N |
| Molecular Formula | C3H8O |
HEPES (Fine White Crystals/Molecular Biology), Fisher BioReagents™
Commonly used buffering agent | CAS: 7365-45-9 | C8H18N2O4S | 238.30 g/mol
| Molecular Weight (g/mol) | 238.30 |
|---|---|
| ChEBI | CHEBI:42334 |
| Color | White |
| Chemical Name or Material | HEPES |
| Grade | Molecular Biology |
| SMILES | OCCN1CCN(CCS(O)(=O)=O)CC1 |
| Identification | Pass Test |
| DNase | DNase free |
| Merck Index | 15, 4689 |
| InChI Key | JKMHFZQWWAIEOD-UHFFFAOYSA-N |
| ChemAlert Storage Symbol | Gray |
| Assay Percent Range | ≥99 % |
| PubChem CID | 23831 |
| Absorbance | 0.01 max. (0.1M solution) at 280nm |
| Percent Purity | ≥99% |
| CAS | 7365-45-9 |
| Protease | Protease free |
| Health Hazard 3 | Emergency Overview Causes eye, skin, and respiratory tract irritation. Use personal protective equipment. Ensure adequate ventilation. Wash off immediately with plenty of water for at least 15 minutes. Obtain medical attention. Rinse immediately with plenty of water, also under the eyelids, for at least 15 minutes. Obtain medical attention. Move to fresh air. If breathing is difficult, give oxygen. Obtain medical attention. Do not induce vomiting. Obtain medical attention. Obtain medical attention. . NFPA Health:2 Flammability:1 Instability:1 |
| MDL Number | MFCD00006158 |
| Health Hazard 2 | WARNING! |
| Solubility Information | Soluble in water |
| pH | 5.0 to 6.5 |
| Purity Grade Notes | DNase-, RNase- and Protease-Free |
| Recommended Storage | RT |
| Molecular Formula | C8H18N2O4S |
Urea (Colorless-to-White Crystals or Crystalline Powder/Mol. Biol.), Fisher BioReagents™
CAS: 57-13-6 Molecular Formula: CH4N2O Molecular Weight (g/mol): 60.056 InChI Key: XSQUKJJJFZCRTK-UHFFFAOYSA-N Synonym: carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate PubChem CID: 1176 ChEBI: CHEBI:48376 IUPAC Name: urea SMILES: C(=O)(N)N
| PubChem CID | 1176 |
|---|---|
| CAS | 57-13-6 |
| Molecular Weight (g/mol) | 60.056 |
| ChEBI | CHEBI:48376 |
| SMILES | C(=O)(N)N |
| Synonym | carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate |
| IUPAC Name | urea |
| InChI Key | XSQUKJJJFZCRTK-UHFFFAOYSA-N |
| Molecular Formula | CH4N2O |
Dithiothreitol (White Crystals or Powder/Electrophoresis), Fisher BioReagents™
CAS: 12-3-3483 Molecular Formula: C4H10O2S2 Molecular Weight (g/mol): 154.24 InChI Key: VHJLVAABSRFDPM-IMJSIDKUSA-N Synonym: dithiothreitol,dl-1,4-dithiothreitol,dl-dithiothreitol,1,4-dithio-dl-threitol,d-1,4-dithiothreitol,d-dtt,2s,3s-1,4-dimercaptobutane-2,3-diol,threo-1,4-dimercapto-2,3-butanediol,1,4-dithiothreitol,dtt PubChem CID: 446094 ChEBI: CHEBI:42170 IUPAC Name: (2S,3S)-1,4-bis(sulfanyl)butane-2,3-diol SMILES: C(C(C(CS)O)O)S
| PubChem CID | 446094 |
|---|---|
| CAS | 12-3-3483 |
| Molecular Weight (g/mol) | 154.24 |
| ChEBI | CHEBI:42170 |
| SMILES | C(C(C(CS)O)O)S |
| Synonym | dithiothreitol,dl-1,4-dithiothreitol,dl-dithiothreitol,1,4-dithio-dl-threitol,d-1,4-dithiothreitol,d-dtt,2s,3s-1,4-dimercaptobutane-2,3-diol,threo-1,4-dimercapto-2,3-butanediol,1,4-dithiothreitol,dtt |
| IUPAC Name | (2S,3S)-1,4-bis(sulfanyl)butane-2,3-diol |
| InChI Key | VHJLVAABSRFDPM-IMJSIDKUSA-N |
| Molecular Formula | C4H10O2S2 |
Phenol, Saturated (pH 6.6/7.9, Liq.), Fisher BioReagents™
CAS: 108-95-2 Molecular Formula: C6H6O Molecular Weight (g/mol): 94.11 MDL Number: MFCD00002143 InChI Key: ISWSIDIOOBJBQZ-UHFFFAOYSA-N Synonym: carbolic acid,hydroxybenzene,phenic acid,phenylic acid,oxybenzene,benzenol,phenyl hydrate,monophenol,phenyl hydroxide,phenylic alcohol PubChem CID: 996 ChEBI: CHEBI:15882 IUPAC Name: phenol SMILES: OC1=CC=CC=C1
| PubChem CID | 996 |
|---|---|
| CAS | 108-95-2 |
| Molecular Weight (g/mol) | 94.11 |
| ChEBI | CHEBI:15882 |
| MDL Number | MFCD00002143 |
| SMILES | OC1=CC=CC=C1 |
| Synonym | carbolic acid,hydroxybenzene,phenic acid,phenylic acid,oxybenzene,benzenol,phenyl hydrate,monophenol,phenyl hydroxide,phenylic alcohol |
| IUPAC Name | phenol |
| InChI Key | ISWSIDIOOBJBQZ-UHFFFAOYSA-N |
| Molecular Formula | C6H6O |
D-Sucrose (Molecular Biology), Fisher BioReagents
CAS: 57-50-1 Molecular Formula: C12H22O11 Molecular Weight (g/mol): 342.30 MDL Number: MFCD00006626 InChI Key: CZMRCDWAGMRECN-PWPRYFECNA-N Synonym: sucrose,saccharose,cane sugar,sugar,table sugar,white sugar,d-sucrose,saccharum,rohrzucker,amerfand PubChem CID: 5988 ChEBI: CHEBI:17992 IUPAC Name: (2R,3R,4S,5S,6R)-2-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol SMILES: OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O
| PubChem CID | 5988 |
|---|---|
| CAS | 57-50-1 |
| Molecular Weight (g/mol) | 342.30 |
| ChEBI | CHEBI:17992 |
| MDL Number | MFCD00006626 |
| SMILES | OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O |
| Synonym | sucrose,saccharose,cane sugar,sugar,table sugar,white sugar,d-sucrose,saccharum,rohrzucker,amerfand |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChI Key | CZMRCDWAGMRECN-PWPRYFECNA-N |
| Molecular Formula | C12H22O11 |
| Color | Colorless |
|---|---|
| Physical Form | Liquid |
| Chemical Name or Material | Tris-EDTA |
| Grade | Molecular Biology |
| DNase | DNase free |
| Filtered Through | Filtered through a 5-micron filter. |
| ChemAlert Storage Symbol | Gray |
| Name Note | 1X Solution, pH 8.0 |
| CAS | 7732-18-5 |
| Protease | Protease free |
| Health Hazard 3 | Emergency Overview May cause eye, skin, and respiratory tract irritation. Avoid contact with skin and eyes. Do not breathe dust. Do not breathe vapors or spray mist. Wash off immediately with soap and plenty of water removing all contaminated clothes and shoes. Obtain medical attention. Rinse immediately with plenty of water, also under the eyelids, for at least 15 minutes. Obtain medical attention. Remove from exposure, lie down. Move to fresh air. If breathing is difficult, give oxygen. If not breathing, give artificial respiration. If not breathing, give artificial respiration. Obtain medical attention. NFPA Health:1 Flammability:0 Instability:0 |
| Health Hazard 2 | CAUTION! |
| pH | 7.4 to 8.1 |
| Synonym | TE |
| Recommended Storage | RT |
Water, (DNASE, RNASE free), Fisher BioReagents™
CAS: 7732-18-5 Molecular Formula: H2O Molecular Weight (g/mol): 18.015 InChI Key: XLYOFNOQVPJJNP-UHFFFAOYSA-N Synonym: dihydrogen oxide,dihydrogen monoxide PubChem CID: 962 ChEBI: CHEBI:15377 IUPAC Name: oxidane SMILES: O
| PubChem CID | 962 |
|---|---|
| CAS | 7732-18-5 |
| Molecular Weight (g/mol) | 18.015 |
| ChEBI | CHEBI:15377 |
| SMILES | O |
| Synonym | dihydrogen oxide,dihydrogen monoxide |
| IUPAC Name | oxidane |
| InChI Key | XLYOFNOQVPJJNP-UHFFFAOYSA-N |
| Molecular Formula | H2O |
HEPES Buffer, 1M Solution, pH 7.3 (Molecular Biology), Fisher BioReagents™
Commonly used buffering agent
| Color | Undesignated |
|---|---|
| Physical Form | Liquid |
| Chemical Name or Material | HEPES Buffer |
| Grade | Molecular Biology |
| Identification | Pass Test |
| DNase | DNase free |
| Merck Index | 15, 4689 |
| Concentration | 0.95 to 1.05 M |
| ChemAlert Storage Symbol | Gray |
| Absorbance | ≤0.01(0.1M solution) at 260nm,0.004 max. (0.1M solution) at 280nm |
| Name Note | 1M Solution, pH 7.3 |
| CAS | 7732-18-5 |
| Protease | Protease free |
| pH | 7.2 to 7.5 |
| Synonym | N-(2-Hydroxyethyl)piperazine-N«-2-ethanesulfonic Acid |
| Purity Grade Notes | DNase-, RNase- and Protease-Free |
| Recommended Storage | RT |
| Molecular Formula | C8H18N2O4S |
| Formula Weight | 238.197 |
| Components | 25 to 50% Water, >50% Glycerin |
|---|---|
| Cut Site | GC.GGCCGC |
| Content And Storage | Keep container tightly closed |
| Form | Liquid |
| Product Type | NotI |
| Storage Buffer | 20mM Tris HCl (pH 7.8 at 25°C), 100mM NaCl, 0.1mM EDTA, 1mM DTT, 0.02% Triton™ X-100, 0.2mg/mL BSA, 50% Glycerol |
| pH | 7.4 |
| Concentration | 10 U/μL |
| For Use With (Application) | >90% of DNA fragments can be ligated and re-cut after 50-fold over-digestion with Not I |
| Components | 10X OPTIZYME™ Buffer 4 |
|---|---|
| Cut Site | CCC.GGG |
| Form | Liquid |
| Product Type | SmaI |
| Storage Buffer | 10mM Tris HCl (pH 7.4 at 25°C), 100mM KCl, 1mM EDTA, 1mM DTT, 0.2mg/mL BSA, 50% Glycerol |
| pH | 7.4 |
| Incubator Temperature | 30°C |
| Concentration | 10 U/μL |
| For Use With (Application) | >90% of pUC19 DNA fragments can be ligated and re-cut after 50-fold over-digestion with SmaI |