Learn More
D-Sucrose (Molecular Biology), Fisher BioReagents
For the preparation of density gradients for DNA ultracentrifugation
$87.43 - $497.00
Chemical Identifiers
| CAS | 57-50-1 |
|---|---|
| Molecular Formula | C12H22O11 |
| Molecular Weight (g/mol) | 342.30 |
| MDL Number | MFCD00006626 |
| InChI Key | CZMRCDWAGMRECN-PWPRYFECNA-N |
| Synonym | sucrose, saccharose, cane sugar, sugar, table sugar, white sugar, d-sucrose, saccharum, rohrzucker, amerfand |
| PubChem CID | 5988 |
| ChEBI | CHEBI:17992 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
BP220-1
|
Fisher BioReagents
FLBP2201 |
1 kg | Poly Bottle |
Each for $87.43
Case of 6 Each for $524.58
|
|
||||
|
BP220-212
|
Fisher BioReagents
FLBP220212 |
2.5 kg | Glass Bottle |
Each for $176.00
Case of 4 Each for $704.00
|
|
||||
|
BP220-10
|
Fisher BioReagents
BP22010 |
10 kg | Poly Pail |
Each for $497.00
|
|
||||
Description
D-Sucrose is suitable for the preparation of density gradients used in purification of proteins and nucleic acids by ultracentrifugation.Chemical Identifiers
| 57-50-1 | |
| 342.30 | |
| CZMRCDWAGMRECN-PWPRYFECNA-N | |
| 5988 | |
| (2R,3R,4S,5S,6R)-2-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| C12H22O11 | |
| MFCD00006626 | |
| sucrose, saccharose, cane sugar, sugar, table sugar, white sugar, d-sucrose, saccharum, rohrzucker, amerfand | |
| CHEBI:17992 | |
| OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O |
Specifications
| Sucrose | |
| 190°C | |
| 6.5 to 7.5 | |
| 0.03% max. | |
| Poly Bottle | |
| MFCD00006626 | |
| 15, 9012 | |
| sucrose, saccharose, cane sugar, sugar, table sugar, white sugar, d-sucrose, saccharum, rohrzucker, amerfand | |
| CZMRCDWAGMRECN-PWPRYFECNA-N | |
| (2R,3R,4S,5S,6R)-2-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol | |
| 5988 | |
| 342.29 | |
| DNase-, RNase- and Protease-Free | |
| D-Sucrose |
| 57-50-1 | |
| White | |
| 0.01% max. | |
| ≥99.9% | |
| C12H22O11 | |
| 1 kg | |
| +66 to +67° (+ or -) | |
| 0.005% max. Insoluble Matter | |
| OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O | |
| 342.30 | |
| CHEBI:17992 | |
| ≥99.9% | |
| Solid |
Safety and Handling
CAUTION!
Emergency Overview
May cause skin, eye, and respiratory tract irritation. Wear personal protective equipment. Ensure adequate ventilation. Avoid contact with skin, eyes and clothing. Avoid ingestion and inhalation. Use personal protective equipment. Wash off immediately with plenty of water for at least 15 minutes. Get medical attention immediately if symptoms occur. Rinse immediately with plenty of water, also under the eyelids, for at least 15 minutes. Obtain medical attention. Move to fresh air. If breathing is difficult, give oxygen. If breathing is difficult, give oxygen. Get medical attention immediately if symptoms occur.
NFPA
Health:1
Flammability:1
Instability:0
Recommended Storage : RT