missing translation for 'onlineSavingsMsg'
Learn More
Learn More
HEPES (Fine White Crystals/Molecular Biology), Fisher BioReagents™
Commonly used buffering agent | CAS: 7365-45-9 | C8H18N2O4S | 238.30 g/mol
$108.23 - $1825.63
Specifications
| Absorbance | 0.01 max. (0.1M solution) at 280nm |
|---|---|
| Chemical Name or Material | HEPES |
| CAS | 7365-45-9 |
| Color | White |
| pH | 5.0 to 6.5 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
BP310-100
|
Fisher BioReagents
BP310100 |
100 g | Glass Bottle |
Each for $108.23
Case of 6 Each for $649.38
|
|
||||
BP310-500
|
Fisher BioReagents
BP310500 |
500 g | Poly Bottle |
Each for $245.48
Case of 6 Each for $1,472.88
|
|
||||
|
BP310-1
|
Fisher BioReagents
FLBP3101 |
1 kg | Poly Bottle |
Each for $515.25
Case of 4 Each for $2,061.00
|
|
||||
|
BP310-5
|
Fisher BioReagents
FLBP3105 |
5 kg | Poly Pail |
Each for $1,825.63
|
|
||||
Description
Commonly used buffering agent
HEPES is commonly used as a buffering agent.Specifications
| 0.01 max. (0.1M solution) at 280nm | |
| 7365-45-9 | |
| 5.0 to 6.5 | |
| DNase-, RNase- and Protease-Free | |
| Pass Test | |
| MFCD00006158 | |
| 15, 4689 | |
| JKMHFZQWWAIEOD-UHFFFAOYSA-N | |
| 238.30 | |
| CHEBI:42334 | |
| Molecular Biology |
| HEPES | |
| White | |
| DNase free | |
| ≥99 % | |
| C8H18N2O4S | |
| Protease free | |
| Soluble in water | |
| OCCN1CCN(CCS(O)(=O)=O)CC1 | |
| 23831 | |
| ≥99% |