Alkyl Halides
Filtered Search Results
2-(Bromomethyl)-1,3-benzothiazole, 95%, Thermo Scientific™
CAS: 106086-78-6 Molecular Formula: C8H6BrNS Molecular Weight (g/mol): 228.107 InChI Key: WFLCAOGKZQTOIG-UHFFFAOYSA-N Synonym: 2-bromomethyl-1,3-benzothiazole,2-bromomethyl benzo d thiazole,2-bromomethyl benzothiazole,benzothiazole, 2-bromomethyl,benzo d thiazol-2-yl methyl bromide,zlchem 58,pubchem3912,acmc-1bpju,2-bromomethylbenzothiazole PubChem CID: 2776258 IUPAC Name: 2-(bromomethyl)-1,3-benzothiazole SMILES: C1=CC=C2C(=C1)N=C(S2)CBr
| PubChem CID | 2776258 |
|---|---|
| CAS | 106086-78-6 |
| Molecular Weight (g/mol) | 228.107 |
| SMILES | C1=CC=C2C(=C1)N=C(S2)CBr |
| Synonym | 2-bromomethyl-1,3-benzothiazole,2-bromomethyl benzo d thiazole,2-bromomethyl benzothiazole,benzothiazole, 2-bromomethyl,benzo d thiazol-2-yl methyl bromide,zlchem 58,pubchem3912,acmc-1bpju,2-bromomethylbenzothiazole |
| IUPAC Name | 2-(bromomethyl)-1,3-benzothiazole |
| InChI Key | WFLCAOGKZQTOIG-UHFFFAOYSA-N |
| Molecular Formula | C8H6BrNS |
Perfluorodecanoic acid, 97%
CAS: 335-76-2 Molecular Formula: C10HF19O2 Molecular Weight (g/mol): 514.09 MDL Number: MFCD00004175 InChI Key: PCIUEQPBYFRTEM-UHFFFAOYSA-N Synonym: perfluorodecanoic acid,nonadecafluorodecanoic acid,ndfda,pfda,perfluoro-n-decanoic acid,nonadecafluoro-n-decanoic acid,decanoic acid, nonadecafluoro,ccris 4417,decanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluoro,perfluorocapric acid PubChem CID: 9555 ChEBI: CHEBI:35546 IUPAC Name: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecanoic acid SMILES: OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F
| PubChem CID | 9555 |
|---|---|
| CAS | 335-76-2 |
| Molecular Weight (g/mol) | 514.09 |
| ChEBI | CHEBI:35546 |
| MDL Number | MFCD00004175 |
| SMILES | OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Synonym | perfluorodecanoic acid,nonadecafluorodecanoic acid,ndfda,pfda,perfluoro-n-decanoic acid,nonadecafluoro-n-decanoic acid,decanoic acid, nonadecafluoro,ccris 4417,decanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluoro,perfluorocapric acid |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecanoic acid |
| InChI Key | PCIUEQPBYFRTEM-UHFFFAOYSA-N |
| Molecular Formula | C10HF19O2 |
LiChropur™ Pentafluoropropionic anhydride, 99%, MilliporeSigma™ Supelco™
MDL Number: MFCD00000429 Synonym: PFPA; Perfluoropropionic anhydride
| MDL Number | MFCD00000429 |
|---|---|
| Synonym | PFPA; Perfluoropropionic anhydride |
Heptafluorobutyric anhydride, 98%
CAS: 336-59-4 Molecular Formula: C8F14O3 Molecular Weight (g/mol): 410.06 MDL Number: MFCD00000432 InChI Key: UFFSXJKVKBQEHC-UHFFFAOYSA-N Synonym: heptafluorobutyric anhydride,perfluorobutyric anhydride,hfba,heptafluorobutanoic anhydride,2,2,3,3,4,4,4-heptafluorobutanoic anhydride,butanoic acid, heptafluoro-, anhydride,heptafluoro-n-butyric anhydride,heptafluorobutyric acid anhydride,butanoic acid, 2,2,3,3,4,4,4-heptafluoro-, 1,1'-anhydride,heptafluorobutyric anhydride, for gc derivatization PubChem CID: 67643 ChEBI: CHEBI:39424 IUPAC Name: 2,2,3,3,4,4,4-heptafluorobutanoyl 2,2,3,3,4,4,4-heptafluorobutanoate SMILES: FC(F)(F)C(F)(F)C(F)(F)C(=O)OC(=O)C(F)(F)C(F)(F)C(F)(F)F
| PubChem CID | 67643 |
|---|---|
| CAS | 336-59-4 |
| Molecular Weight (g/mol) | 410.06 |
| ChEBI | CHEBI:39424 |
| MDL Number | MFCD00000432 |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(=O)OC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| Synonym | heptafluorobutyric anhydride,perfluorobutyric anhydride,hfba,heptafluorobutanoic anhydride,2,2,3,3,4,4,4-heptafluorobutanoic anhydride,butanoic acid, heptafluoro-, anhydride,heptafluoro-n-butyric anhydride,heptafluorobutyric acid anhydride,butanoic acid, 2,2,3,3,4,4,4-heptafluoro-, 1,1'-anhydride,heptafluorobutyric anhydride, for gc derivatization |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutanoyl 2,2,3,3,4,4,4-heptafluorobutanoate |
| InChI Key | UFFSXJKVKBQEHC-UHFFFAOYSA-N |
| Molecular Formula | C8F14O3 |
Heptafluorobutyric anhydride, ≥99.0%, MilliporeSigma™ Supelco™
MDL Number: MFCD00000432 Synonym: HFBA; HFAA; HFBA; Perfluorobutyric anhydride
| MDL Number | MFCD00000432 |
|---|---|
| Synonym | HFBA; HFAA; HFBA; Perfluorobutyric anhydride |
Heptafluorobutyric acid, 99%
CAS: 375-22-4 Molecular Formula: C4HF7O2 Molecular Weight (g/mol): 214.04 MDL Number: MFCD00004171 InChI Key: YPJUNDFVDDCYIH-UHFFFAOYSA-N Synonym: heptafluorobutyric acid,perfluorobutyric acid,heptafluorobutanoic acid,perfluorobutanoic acid,butanoic acid, heptafluoro,heptafluoro-1-butanoic acid,perfluoropropanecarboxylic acid,butyric acid, heptafluoro,kyselina heptafluormaselna,kyselina heptafluormaselna czech PubChem CID: 9777 ChEBI: CHEBI:39426 IUPAC Name: 2,2,3,3,4,4,4-heptafluorobutanoic acid SMILES: C(=O)(C(C(C(F)(F)F)(F)F)(F)F)O
| PubChem CID | 9777 |
|---|---|
| CAS | 375-22-4 |
| Molecular Weight (g/mol) | 214.04 |
| ChEBI | CHEBI:39426 |
| MDL Number | MFCD00004171 |
| SMILES | C(=O)(C(C(C(F)(F)F)(F)F)(F)F)O |
| Synonym | heptafluorobutyric acid,perfluorobutyric acid,heptafluorobutanoic acid,perfluorobutanoic acid,butanoic acid, heptafluoro,heptafluoro-1-butanoic acid,perfluoropropanecarboxylic acid,butyric acid, heptafluoro,kyselina heptafluormaselna,kyselina heptafluormaselna czech |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutanoic acid |
| InChI Key | YPJUNDFVDDCYIH-UHFFFAOYSA-N |
| Molecular Formula | C4HF7O2 |
Iodomethane, 99+%, stab. with copper
CAS: 74-88-4 Molecular Formula: CH3I Molecular Weight (g/mol): 141.94 MDL Number: MFCD00001073 InChI Key: INQOMBQAUSQDDS-UHFFFAOYSA-N Synonym: methyl iodide,monoiodomethane,methane, iodo,methyljodid,jod-methan,methyliodide,methyljodide,iodometano,joodmethaan,metylu jodek PubChem CID: 6328 ChEBI: CHEBI:39282 IUPAC Name: iodomethane SMILES: CI
| PubChem CID | 6328 |
|---|---|
| CAS | 74-88-4 |
| Molecular Weight (g/mol) | 141.94 |
| ChEBI | CHEBI:39282 |
| MDL Number | MFCD00001073 |
| SMILES | CI |
| Synonym | methyl iodide,monoiodomethane,methane, iodo,methyljodid,jod-methan,methyliodide,methyljodide,iodometano,joodmethaan,metylu jodek |
| IUPAC Name | iodomethane |
| InChI Key | INQOMBQAUSQDDS-UHFFFAOYSA-N |
| Molecular Formula | CH3I |
Dichloromethane, anhydrous, 99.7+%, packaged under Argon in resealable ChemSeal™ bottles, stab. with amylene
CAS: 75-09-2 Molecular Formula: CH2Cl2 Molecular Weight (g/mol): 84.93 MDL Number: MFCD00000881 InChI Key: YMWUJEATGCHHMB-UHFFFAOYSA-N Synonym: methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm PubChem CID: 6344 ChEBI: CHEBI:15767 IUPAC Name: dichloromethane SMILES: ClCCl
| PubChem CID | 6344 |
|---|---|
| CAS | 75-09-2 |
| Molecular Weight (g/mol) | 84.93 |
| ChEBI | CHEBI:15767 |
| MDL Number | MFCD00000881 |
| SMILES | ClCCl |
| Synonym | methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm |
| IUPAC Name | dichloromethane |
| InChI Key | YMWUJEATGCHHMB-UHFFFAOYSA-N |
| Molecular Formula | CH2Cl2 |
Bromotrichloromethane, 99%
CAS: 75-62-7 Molecular Formula: CBrCl3 Molecular Weight (g/mol): 198.27 MDL Number: MFCD00000783 InChI Key: XNNQFQFUQLJSQT-UHFFFAOYSA-N Synonym: methane, bromotrichloro,trichlorobromomethane,bromo trichloro methane,carbon bromotrichloride,monobromotrichloromethane,carbon trichlorobromide,trichloromethyl bromide,caswell no. 118,unii-ikj30qxm63,ccl3br PubChem CID: 6383 IUPAC Name: bromo(trichloro)methane SMILES: C(Cl)(Cl)(Cl)Br
| PubChem CID | 6383 |
|---|---|
| CAS | 75-62-7 |
| Molecular Weight (g/mol) | 198.27 |
| MDL Number | MFCD00000783 |
| SMILES | C(Cl)(Cl)(Cl)Br |
| Synonym | methane, bromotrichloro,trichlorobromomethane,bromo trichloro methane,carbon bromotrichloride,monobromotrichloromethane,carbon trichlorobromide,trichloromethyl bromide,caswell no. 118,unii-ikj30qxm63,ccl3br |
| IUPAC Name | bromo(trichloro)methane |
| InChI Key | XNNQFQFUQLJSQT-UHFFFAOYSA-N |
| Molecular Formula | CBrCl3 |
Iodomethane, 99%, stabilized
CAS: 74-88-4 Molecular Formula: CH3I Molecular Weight (g/mol): 141.94 MDL Number: MFCD00001073 InChI Key: INQOMBQAUSQDDS-UHFFFAOYSA-N Synonym: methyl iodide,monoiodomethane,methane, iodo,methyljodid,jod-methan,methyliodide,methyljodide,iodometano,joodmethaan,metylu jodek PubChem CID: 6328 ChEBI: CHEBI:39282 IUPAC Name: iodomethane SMILES: CI
| PubChem CID | 6328 |
|---|---|
| CAS | 74-88-4 |
| Molecular Weight (g/mol) | 141.94 |
| ChEBI | CHEBI:39282 |
| MDL Number | MFCD00001073 |
| SMILES | CI |
| Synonym | methyl iodide,monoiodomethane,methane, iodo,methyljodid,jod-methan,methyliodide,methyljodide,iodometano,joodmethaan,metylu jodek |
| IUPAC Name | iodomethane |
| InChI Key | INQOMBQAUSQDDS-UHFFFAOYSA-N |
| Molecular Formula | CH3I |
3,3'-Difluorobiphenyl, 97%
CAS: 396-64-5 Molecular Formula: C12H8F2 Molecular Weight (g/mol): 190.19 MDL Number: MFCD00039216 InChI Key: GAYJHUJLHJWCTH-UHFFFAOYSA-N Synonym: 3,3'-difluorobiphenyl,3,3'-difluoro-1,1'-biphenyl,1-fluoro-3-3-fluorophenyl benzene,1,1'-biphenyl,3,3'-difluoro,1,1'-biphenyl, 3,3'-difluoro,3-fluoro-1-3-fluorophenyl benzene,acmc-1agdg,3,3'-difluoro biphenyl,gayjhujlhjwcth-uhfffaoysa,3,3'-difluoro-1,1'-biphenyl # PubChem CID: 123058 IUPAC Name: 1-fluoro-3-(3-fluorophenyl)benzene SMILES: FC1=CC(=CC=C1)C1=CC(F)=CC=C1
| PubChem CID | 123058 |
|---|---|
| CAS | 396-64-5 |
| Molecular Weight (g/mol) | 190.19 |
| MDL Number | MFCD00039216 |
| SMILES | FC1=CC(=CC=C1)C1=CC(F)=CC=C1 |
| Synonym | 3,3'-difluorobiphenyl,3,3'-difluoro-1,1'-biphenyl,1-fluoro-3-3-fluorophenyl benzene,1,1'-biphenyl,3,3'-difluoro,1,1'-biphenyl, 3,3'-difluoro,3-fluoro-1-3-fluorophenyl benzene,acmc-1agdg,3,3'-difluoro biphenyl,gayjhujlhjwcth-uhfffaoysa,3,3'-difluoro-1,1'-biphenyl # |
| IUPAC Name | 1-fluoro-3-(3-fluorophenyl)benzene |
| InChI Key | GAYJHUJLHJWCTH-UHFFFAOYSA-N |
| Molecular Formula | C12H8F2 |
1,4-Bis(difluoromethyl)benzene, 98%
CAS: 369-54-0 Molecular Formula: C8H6F4 Molecular Weight (g/mol): 178.13 MDL Number: MFCD01320708 InChI Key: VWKMZVCSRVFUGW-UHFFFAOYSA-N Synonym: 1,4-bis difluoromethyl benzene,alpha,alpha,alpha',alpha'-tetrafluoro-p-xylene,acmc-1cr71,1,4-bis-difluoromethyl-benzene,a,a,a',a'-tetrafluoro-p-xylene,benzene,1,4-bis difluoromethyl,benzene, 1,4-bis difluoromethyl,1,4-bis bis fluoranyl methyl benzene,alpha,alpha,alpha,alpha-tetrafluoro-p-xylene PubChem CID: 2734031 IUPAC Name: 1,4-bis(difluoromethyl)benzene SMILES: C1=CC(=CC=C1C(F)F)C(F)F
| PubChem CID | 2734031 |
|---|---|
| CAS | 369-54-0 |
| Molecular Weight (g/mol) | 178.13 |
| MDL Number | MFCD01320708 |
| SMILES | C1=CC(=CC=C1C(F)F)C(F)F |
| Synonym | 1,4-bis difluoromethyl benzene,alpha,alpha,alpha',alpha'-tetrafluoro-p-xylene,acmc-1cr71,1,4-bis-difluoromethyl-benzene,a,a,a',a'-tetrafluoro-p-xylene,benzene,1,4-bis difluoromethyl,benzene, 1,4-bis difluoromethyl,1,4-bis bis fluoranyl methyl benzene,alpha,alpha,alpha,alpha-tetrafluoro-p-xylene |
| IUPAC Name | 1,4-bis(difluoromethyl)benzene |
| InChI Key | VWKMZVCSRVFUGW-UHFFFAOYSA-N |
| Molecular Formula | C8H6F4 |
1-Fluoronaphthalene, 98%
CAS: 321-38-0 Molecular Formula: C10H7F Molecular Weight (g/mol): 146.164 MDL Number: MFCD00003873 InChI Key: CWLKTJOTWITYSI-UHFFFAOYSA-N Synonym: fluoronaphthalene,naphthalene, 1-fluoro,alpha-fluoronaphthalene,1-fluornaftalen,.alpha.-fluoronaphthalene,1-fluornaftalen czech,1-fluoro naphthalene,fluoronaphtalene,fluoronapthalene,1-fluoronapthalene PubChem CID: 9450 IUPAC Name: 1-fluoronaphthalene SMILES: C1=CC=C2C(=C1)C=CC=C2F
| PubChem CID | 9450 |
|---|---|
| CAS | 321-38-0 |
| Molecular Weight (g/mol) | 146.164 |
| MDL Number | MFCD00003873 |
| SMILES | C1=CC=C2C(=C1)C=CC=C2F |
| Synonym | fluoronaphthalene,naphthalene, 1-fluoro,alpha-fluoronaphthalene,1-fluornaftalen,.alpha.-fluoronaphthalene,1-fluornaftalen czech,1-fluoro naphthalene,fluoronaphtalene,fluoronapthalene,1-fluoronapthalene |
| IUPAC Name | 1-fluoronaphthalene |
| InChI Key | CWLKTJOTWITYSI-UHFFFAOYSA-N |
| Molecular Formula | C10H7F |
2-Fluorobiphenyl, 98%
CAS: 321-60-8 Molecular Formula: C12H9F Molecular Weight (g/mol): 172.20 MDL Number: MFCD00000317 InChI Key: KLECYOQFQXJYBC-UHFFFAOYSA-N Synonym: 2-fluorobiphenyl,2-fluoro-1,1'-biphenyl,o-fluorodiphenyl,1,1'-biphenyl, 2-fluoro,biphenyl, 2-fluoro,ortho-fluorodiphenyl,2-fluorodiphenyl,2-fluoro-biphenyl,ccris 1659,2-fluoro-1-phenylbenzene PubChem CID: 67579 SMILES: FC1=CC=CC=C1C1=CC=CC=C1
| PubChem CID | 67579 |
|---|---|
| CAS | 321-60-8 |
| Molecular Weight (g/mol) | 172.20 |
| MDL Number | MFCD00000317 |
| SMILES | FC1=CC=CC=C1C1=CC=CC=C1 |
| Synonym | 2-fluorobiphenyl,2-fluoro-1,1'-biphenyl,o-fluorodiphenyl,1,1'-biphenyl, 2-fluoro,biphenyl, 2-fluoro,ortho-fluorodiphenyl,2-fluorodiphenyl,2-fluoro-biphenyl,ccris 1659,2-fluoro-1-phenylbenzene |
| InChI Key | KLECYOQFQXJYBC-UHFFFAOYSA-N |
| Molecular Formula | C12H9F |
4-Fluorobiphenyl, 97+%
CAS: 324-74-3 Molecular Formula: C12H9F Molecular Weight (g/mol): 172.202 MDL Number: MFCD00011650 InChI Key: RUYZJEIKQYLEGZ-UHFFFAOYSA-N Synonym: 4-fluorobiphenyl,4-fluoro-1,1'-biphenyl,p-fluorodiphenyl,4-fluoro-biphenyl,4-fluorodiphenyl,biphenyl, 4-fluoro,1,1'-biphenyl, 4-fluoro,para-fluorobiphenyl,4-fluorophenyl benzene,p-fluorobiphenyl PubChem CID: 9461 IUPAC Name: 1-fluoro-4-phenylbenzene SMILES: C1=CC=C(C=C1)C2=CC=C(C=C2)F
| PubChem CID | 9461 |
|---|---|
| CAS | 324-74-3 |
| Molecular Weight (g/mol) | 172.202 |
| MDL Number | MFCD00011650 |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)F |
| Synonym | 4-fluorobiphenyl,4-fluoro-1,1'-biphenyl,p-fluorodiphenyl,4-fluoro-biphenyl,4-fluorodiphenyl,biphenyl, 4-fluoro,1,1'-biphenyl, 4-fluoro,para-fluorobiphenyl,4-fluorophenyl benzene,p-fluorobiphenyl |
| IUPAC Name | 1-fluoro-4-phenylbenzene |
| InChI Key | RUYZJEIKQYLEGZ-UHFFFAOYSA-N |
| Molecular Formula | C12H9F |