Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Polyethylene Glycol 8000 (PEG), Fisher BioReagents™
CAS: 25322-68-3 Molecular Formula: (C2H4O)n Molecular Weight (g/mol): 62.07 MDL Number: MFCD01779601 InChI Key: LYCAIKOWRPUZTN-UHFFFAOYSA-N Synonym: PEG 8000,Polyethylene Oxide,Carbowax™ IUPAC Name: ethane-1,2-diol SMILES: [H]OCCO
| CAS | 25322-68-3 |
|---|---|
| Molecular Weight (g/mol) | 62.07 |
| MDL Number | MFCD01779601 |
| SMILES | [H]OCCO |
| Synonym | PEG 8000,Polyethylene Oxide,Carbowax™ |
| IUPAC Name | ethane-1,2-diol |
| InChI Key | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| Molecular Formula | (C2H4O)n |
Decane, Fisher Chemical
CAS: 124-18-5 Molecular Formula: C10H22 Molecular Weight (g/mol): 142.286 MDL Number: MFCD00008954 InChI Key: DIOQZVSQGTUSAI-UHFFFAOYSA-N Synonym: n-decane,nonane, methyl,decyl hydride,unii-nk85062oiy,ccris 653,hsdb 63,dsstox_cid_4913,decane, analytical standard,dsstox_rid_77577,dsstox_gsid_24913 PubChem CID: 15600 ChEBI: CHEBI:41808 IUPAC Name: decane SMILES: CCCCCCCCCC
| PubChem CID | 15600 |
|---|---|
| CAS | 124-18-5 |
| Molecular Weight (g/mol) | 142.286 |
| ChEBI | CHEBI:41808 |
| MDL Number | MFCD00008954 |
| SMILES | CCCCCCCCCC |
| Synonym | n-decane,nonane, methyl,decyl hydride,unii-nk85062oiy,ccris 653,hsdb 63,dsstox_cid_4913,decane, analytical standard,dsstox_rid_77577,dsstox_gsid_24913 |
| IUPAC Name | decane |
| InChI Key | DIOQZVSQGTUSAI-UHFFFAOYSA-N |
| Molecular Formula | C10H22 |
| Boiling Point | 100°C |
|---|---|
| Color | Colorless |
| Physical Form | Liquid |
| Chemical Name or Material | Starch Solution |
| ChemAlert Storage Symbol | Gray |
| Density | 1.0g/cm³ |
| Vapor Pressure | 14mmHg |
| Sensitivity | Pass Test |
| Name Note | Stabilized |
| CAS | 7732-18-5 |
| MDL Number | MFCD00082026 |
| Packaging | Poly Bottle |
| Molecular Formula | (C6H10O5)n |
| Melting Point | 0°C |
Formaldehyde, 37% by Weight (Histological), Fisher Chemical™
CAS: 50-00-0 Molecular Formula: CH2O Molecular Weight (g/mol): 30.03 MDL Number: MFCD00003274 InChI Key: WSFSSNUMVMOOMR-UHFFFAOYSA-N Synonym: formalin,methanal,formol,methylene oxide,paraformaldehyde,oxomethane,paraform,formic aldehyde,oxymethylene,methyl aldehyde PubChem CID: 712 ChEBI: CHEBI:16842 IUPAC Name: formaldehyde SMILES: C=O
| PubChem CID | 712 |
|---|---|
| CAS | 50-00-0 |
| Molecular Weight (g/mol) | 30.03 |
| ChEBI | CHEBI:16842 |
| MDL Number | MFCD00003274 |
| SMILES | C=O |
| Synonym | formalin,methanal,formol,methylene oxide,paraformaldehyde,oxomethane,paraform,formic aldehyde,oxymethylene,methyl aldehyde |
| IUPAC Name | formaldehyde |
| InChI Key | WSFSSNUMVMOOMR-UHFFFAOYSA-N |
| Molecular Formula | CH2O |
Methyl Cellulose (Powder/USP/FCC), Fisher Chemical
CAS: 9004-67-5 Molecular Formula: C20H38O11 Molecular Weight (g/mol): 454.513 MDL Number: MFCD00081763 InChI Key: YLGXILFCIXHCMC-JHGZEJCSSA-N Synonym: Cellulose Methyl Ether PubChem CID: 51063134 IUPAC Name: (5R)-2,3,4-trimethoxy-6-(methoxymethyl)-5-[(2S)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxyoxane SMILES: COCC1C(C(C(C(O1)OC2C(OC(C(C2OC)OC)OC)COC)OC)OC)OC
| PubChem CID | 51063134 |
|---|---|
| CAS | 9004-67-5 |
| Molecular Weight (g/mol) | 454.513 |
| MDL Number | MFCD00081763 |
| SMILES | COCC1C(C(C(C(O1)OC2C(OC(C(C2OC)OC)OC)COC)OC)OC)OC |
| Synonym | Cellulose Methyl Ether |
| IUPAC Name | (5R)-2,3,4-trimethoxy-6-(methoxymethyl)-5-[(2S)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxyoxane |
| InChI Key | YLGXILFCIXHCMC-JHGZEJCSSA-N |
| Molecular Formula | C20H38O11 |
Sodium L-(+)-Tartrate Dihydrate (Crystalline/Certified ACS), Fisher Chemical™
CAS: 6106-24-7 Molecular Formula: C4H8Na2O8 Molecular Weight (g/mol): 230.08 MDL Number: MFCD00150035 InChI Key: FGJLAJMGHXGFDE-UDMGOBQRNA-L Synonym: unii-dia7c37aow,disodium tartrate dihydrate,disodium l-+-tartrate dihydrate,dia7c37aow,disodium +-tartrate dihydrate,sodium l-+-tartrate dihydrate,butanedioic acid, 2,3-dihydroxy-2r,3r-, disodium salt, dihydrate,disodium tartarate dihydrate,sodium tartrate nf,sodium tartrate dihydrate mi PubChem CID: 131855972 IUPAC Name: disodium (2R,3R)-2,3-dihydroxybutanedioate dihydrate SMILES: O.O.[Na+].[Na+].O[C@H]([C@@H](O)C([O-])=O)C([O-])=O
| PubChem CID | 131855972 |
|---|---|
| CAS | 6106-24-7 |
| Molecular Weight (g/mol) | 230.08 |
| MDL Number | MFCD00150035 |
| SMILES | O.O.[Na+].[Na+].O[C@H]([C@@H](O)C([O-])=O)C([O-])=O |
| Synonym | unii-dia7c37aow,disodium tartrate dihydrate,disodium l-+-tartrate dihydrate,dia7c37aow,disodium +-tartrate dihydrate,sodium l-+-tartrate dihydrate,butanedioic acid, 2,3-dihydroxy-2r,3r-, disodium salt, dihydrate,disodium tartarate dihydrate,sodium tartrate nf,sodium tartrate dihydrate mi |
| IUPAC Name | disodium (2R,3R)-2,3-dihydroxybutanedioate dihydrate |
| InChI Key | FGJLAJMGHXGFDE-UDMGOBQRNA-L |
| Molecular Formula | C4H8Na2O8 |
Benzyl Alcohol (Certified ACS), Fisher Chemical™
CAS: 100-51-6 Molecular Formula: C7H8O Molecular Weight (g/mol): 108.14 MDL Number: MFCD00004599,MFCD03792087 InChI Key: WVDDGKGOMKODPV-UHFFFAOYSA-N Synonym: benzyl alcohol,benzenemethanol,phenylcarbinol,benzoyl alcohol,hydroxytoluene,benzenecarbinol,phenylmethyl alcohol,alpha-toluenol,hydroxymethyl benzene,benzylalcohol PubChem CID: 244 ChEBI: CHEBI:17987 IUPAC Name: phenylmethanol SMILES: OCC1=CC=CC=C1
| PubChem CID | 244 |
|---|---|
| CAS | 100-51-6 |
| Molecular Weight (g/mol) | 108.14 |
| ChEBI | CHEBI:17987 |
| MDL Number | MFCD00004599,MFCD03792087 |
| SMILES | OCC1=CC=CC=C1 |
| Synonym | benzyl alcohol,benzenemethanol,phenylcarbinol,benzoyl alcohol,hydroxytoluene,benzenecarbinol,phenylmethyl alcohol,alpha-toluenol,hydroxymethyl benzene,benzylalcohol |
| IUPAC Name | phenylmethanol |
| InChI Key | WVDDGKGOMKODPV-UHFFFAOYSA-N |
| Molecular Formula | C7H8O |
Pyruvic Acid Sodium Salt (Reagent), Fisher Chemical
CAS: 113-24-6 Molecular Formula: C3H3NaO3 Molecular Weight (g/mol): 110.044 MDL Number: MFCD00002586 InChI Key: DAEPDZWVDSPTHF-UHFFFAOYSA-M Synonym: sodium pyruvate,pyruvic acid sodium salt,sodium 2-oxopropanoate,pyruvic acid, sodium salt,propanoic acid, 2-oxo-, sodium salt,sodium alpha-ketopropionate,pyruvate sodium,unii-pod38aif08,2-oxopropanoic acid sodium salt,pod38aif08 PubChem CID: 23662274 ChEBI: CHEBI:50144 IUPAC Name: sodium;2-oxopropanoate SMILES: CC(=O)C(=O)[O-].[Na+]
| PubChem CID | 23662274 |
|---|---|
| CAS | 113-24-6 |
| Molecular Weight (g/mol) | 110.044 |
| ChEBI | CHEBI:50144 |
| MDL Number | MFCD00002586 |
| SMILES | CC(=O)C(=O)[O-].[Na+] |
| Synonym | sodium pyruvate,pyruvic acid sodium salt,sodium 2-oxopropanoate,pyruvic acid, sodium salt,propanoic acid, 2-oxo-, sodium salt,sodium alpha-ketopropionate,pyruvate sodium,unii-pod38aif08,2-oxopropanoic acid sodium salt,pod38aif08 |
| IUPAC Name | sodium;2-oxopropanoate |
| InChI Key | DAEPDZWVDSPTHF-UHFFFAOYSA-M |
| Molecular Formula | C3H3NaO3 |
Formaldehyde (USP), Fisher Chemical™
CAS: 50-00-0 Molecular Formula: CH2O Molecular Weight (g/mol): 30.03 MDL Number: MFCD00003274 InChI Key: WSFSSNUMVMOOMR-UHFFFAOYSA-N Synonym: formalin,methanal,formol,methylene oxide,paraformaldehyde,oxomethane,paraform,formic aldehyde,oxymethylene,methyl aldehyde PubChem CID: 712 ChEBI: CHEBI:16842 IUPAC Name: formaldehyde SMILES: C=O
| PubChem CID | 712 |
|---|---|
| CAS | 50-00-0 |
| Molecular Weight (g/mol) | 30.03 |
| ChEBI | CHEBI:16842 |
| MDL Number | MFCD00003274 |
| SMILES | C=O |
| Synonym | formalin,methanal,formol,methylene oxide,paraformaldehyde,oxomethane,paraform,formic aldehyde,oxymethylene,methyl aldehyde |
| IUPAC Name | formaldehyde |
| InChI Key | WSFSSNUMVMOOMR-UHFFFAOYSA-N |
| Molecular Formula | CH2O |
Formaldehyde, 37% by Weight (With Preservative/Certified ACS), Fisher Chemical™
CAS: 50-00-0 Molecular Formula: CH2O Molecular Weight (g/mol): 30.03 MDL Number: MFCD00003274 InChI Key: WSFSSNUMVMOOMR-UHFFFAOYSA-N Synonym: formalin,methanal,formol,methylene oxide,paraformaldehyde,oxomethane,paraform,formic aldehyde,oxymethylene,methyl aldehyde PubChem CID: 712 ChEBI: CHEBI:16842 IUPAC Name: formaldehyde SMILES: C=O
| PubChem CID | 712 |
|---|---|
| CAS | 50-00-0 |
| Molecular Weight (g/mol) | 30.03 |
| ChEBI | CHEBI:16842 |
| MDL Number | MFCD00003274 |
| SMILES | C=O |
| Synonym | formalin,methanal,formol,methylene oxide,paraformaldehyde,oxomethane,paraform,formic aldehyde,oxymethylene,methyl aldehyde |
| IUPAC Name | formaldehyde |
| InChI Key | WSFSSNUMVMOOMR-UHFFFAOYSA-N |
| Molecular Formula | CH2O |
Triethylamine (Reagent), Fisher Chemical™
CAS: 121-44-8 Molecular Formula: C6H15N Molecular Weight (g/mol): 101.193 MDL Number: MFCD00009051 InChI Key: ZMANZCXQSJIPKH-UHFFFAOYSA-N Synonym: triethylamine,ethanamine, n,n-diethyl,diethylamino ethane,triaethylamin,triethylamin,trietilamina,triethyl amine,n,n,n-triethylamine,net3,diethylaminoethane PubChem CID: 8471 ChEBI: CHEBI:35026 IUPAC Name: N,N-diethylethanamine SMILES: CCN(CC)CC
| PubChem CID | 8471 |
|---|---|
| CAS | 121-44-8 |
| Molecular Weight (g/mol) | 101.193 |
| ChEBI | CHEBI:35026 |
| MDL Number | MFCD00009051 |
| SMILES | CCN(CC)CC |
| Synonym | triethylamine,ethanamine, n,n-diethyl,diethylamino ethane,triaethylamin,triethylamin,trietilamina,triethyl amine,n,n,n-triethylamine,net3,diethylaminoethane |
| IUPAC Name | N,N-diethylethanamine |
| InChI Key | ZMANZCXQSJIPKH-UHFFFAOYSA-N |
| Molecular Formula | C6H15N |
3-(Bromomethyl)-5-methylisoxazole, 97%, Thermo Scientific™
CAS: 130628-75-0 Molecular Formula: C5H6BrNO Molecular Weight (g/mol): 176.01 MDL Number: MFCD02677720 InChI Key: ASGJFGPILHALRC-UHFFFAOYSA-N Synonym: 3-bromomethyl-5-methylisoxazole,3-bromomethyl-5-methyl-1,2-oxazole,3-bromomethyl-5-methyl-isoxazole,isoxazole,3-bromomethyl-5-methyl,zlchem 1313,acmc-1ca86,3-bromomethyl-5-methylisoxazol,5-brimomethyl-3-methylisoxazle PubChem CID: 2776304 IUPAC Name: 3-(bromomethyl)-5-methyl-1,2-oxazole SMILES: CC1=CC(CBr)=NO1
| PubChem CID | 2776304 |
|---|---|
| CAS | 130628-75-0 |
| Molecular Weight (g/mol) | 176.01 |
| MDL Number | MFCD02677720 |
| SMILES | CC1=CC(CBr)=NO1 |
| Synonym | 3-bromomethyl-5-methylisoxazole,3-bromomethyl-5-methyl-1,2-oxazole,3-bromomethyl-5-methyl-isoxazole,isoxazole,3-bromomethyl-5-methyl,zlchem 1313,acmc-1ca86,3-bromomethyl-5-methylisoxazol,5-brimomethyl-3-methylisoxazle |
| IUPAC Name | 3-(bromomethyl)-5-methyl-1,2-oxazole |
| InChI Key | ASGJFGPILHALRC-UHFFFAOYSA-N |
| Molecular Formula | C5H6BrNO |
Urea (Certified ACS), Fisher Chemical™
CAS: 57-13-6 Molecular Formula: CH4N2O Molecular Weight (g/mol): 60.056 MDL Number: MFCD00008022 InChI Key: XSQUKJJJFZCRTK-UHFFFAOYSA-N Synonym: carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate PubChem CID: 1176 ChEBI: CHEBI:48376 IUPAC Name: urea SMILES: C(=O)(N)N
| PubChem CID | 1176 |
|---|---|
| CAS | 57-13-6 |
| Molecular Weight (g/mol) | 60.056 |
| ChEBI | CHEBI:48376 |
| MDL Number | MFCD00008022 |
| SMILES | C(=O)(N)N |
| Synonym | carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate |
| IUPAC Name | urea |
| InChI Key | XSQUKJJJFZCRTK-UHFFFAOYSA-N |
| Molecular Formula | CH4N2O |
2-Methyl-5-phenyl-3-furoic acid, 97%, Thermo Scientific™
CAS: 108124-17-0 Molecular Formula: C12H9O3 Molecular Weight (g/mol): 201.20 MDL Number: MFCD00221070 InChI Key: VLMNACSEESRUAK-UHFFFAOYSA-M Synonym: 2-methyl-5-phenyl-3-furoic acid,3-furancarboxylic acid, 2-methyl-5-phenyl,3-furancarboxylic acid,2-methyl-5-phenyl,acmc-1bptp,maybridge1_002369,cbmicro_037931,cambridge id 5930829,2-methyl-5-phenyl-3-furancarboxylic acid,2-methyl-5-phenyl-furan-3-carboxylic acid PubChem CID: 736516 IUPAC Name: 2-methyl-5-phenylfuran-3-carboxylic acid SMILES: CC1=C(C=C(O1)C1=CC=CC=C1)C([O-])=O
| PubChem CID | 736516 |
|---|---|
| CAS | 108124-17-0 |
| Molecular Weight (g/mol) | 201.20 |
| MDL Number | MFCD00221070 |
| SMILES | CC1=C(C=C(O1)C1=CC=CC=C1)C([O-])=O |
| Synonym | 2-methyl-5-phenyl-3-furoic acid,3-furancarboxylic acid, 2-methyl-5-phenyl,3-furancarboxylic acid,2-methyl-5-phenyl,acmc-1bptp,maybridge1_002369,cbmicro_037931,cambridge id 5930829,2-methyl-5-phenyl-3-furancarboxylic acid,2-methyl-5-phenyl-furan-3-carboxylic acid |
| IUPAC Name | 2-methyl-5-phenylfuran-3-carboxylic acid |
| InChI Key | VLMNACSEESRUAK-UHFFFAOYSA-M |
| Molecular Formula | C12H9O3 |
N1-Methyl-4-(trifluoromethoxy)aniline, 95%, Thermo Scientific™
CAS: 41419-59-4 Molecular Formula: C8H8F3NO Molecular Weight (g/mol): 191.153 MDL Number: MFCD00052332 InChI Key: MGCCWCLGIPNIBP-UHFFFAOYSA-N Synonym: n-methyl-4-trifluoromethoxy aniline,n1-methyl-4-trifluoromethoxy aniline,benzenamine,n-methyl-4-trifluoromethoxy,methyl 4-trifluoromethoxy phenyl amine,pubchem8511,4-trifluoromethoxy-n-methylaniline,methyl 4-trifluoromethoxyphenyl amine,methyl-4-trifluoromethoxy-phenyl-amine,n-methyl-4-trifluoromethoxyphenyl amine PubChem CID: 737351 IUPAC Name: N-methyl-4-(trifluoromethoxy)aniline SMILES: CNC1=CC=C(C=C1)OC(F)(F)F
| PubChem CID | 737351 |
|---|---|
| CAS | 41419-59-4 |
| Molecular Weight (g/mol) | 191.153 |
| MDL Number | MFCD00052332 |
| SMILES | CNC1=CC=C(C=C1)OC(F)(F)F |
| Synonym | n-methyl-4-trifluoromethoxy aniline,n1-methyl-4-trifluoromethoxy aniline,benzenamine,n-methyl-4-trifluoromethoxy,methyl 4-trifluoromethoxy phenyl amine,pubchem8511,4-trifluoromethoxy-n-methylaniline,methyl 4-trifluoromethoxyphenyl amine,methyl-4-trifluoromethoxy-phenyl-amine,n-methyl-4-trifluoromethoxyphenyl amine |
| IUPAC Name | N-methyl-4-(trifluoromethoxy)aniline |
| InChI Key | MGCCWCLGIPNIBP-UHFFFAOYSA-N |
| Molecular Formula | C8H8F3NO |