Organosulfur Compounds
Filtered Search Results
| Linear Formula | C5H6N2OS |
|---|---|
| CAS | 56-04-2 |
| MDL Number | MFCD00006040 |
| Physical Form | Neat |
| Health Hazard 1 | H317 |
| UN Number | UN 3077 9/PGIII |
| Grade | Analytical Standard |
| Synonym | 4-Hydroxy-2-mercapto 6-methylpyrimidine; MZU |
| RTECS Number | YR0875000 |
| Shelf Life | Limited shelf life, expiry date on the label |
| Molecular Formula | C5H6N2OS |
| Formula Weight | 142.18 |
| Melting Point | ∼330°C (decomposition) (literature) |
Sulindac, British Pharmacopoeia (BP) Reference Standard, MilliporeSigma™ Supelco™
This product is provided as delivered and specified by the issuing Pharmacopoeia. All information provided in support of this product, including SDS and any product information leaflets, has been developed and issued under the Authority of the issuing Pharmacopoeia.
Sulfapyridine, British Pharmacopoeia (BP) Reference Standard, MilliporeSigma™ Supelco™
This product is provided as delivered and specified by the issuing Pharmacopoeia. All information provided in support of this product, including SDS and any product information leaflets, has been developed and issued under the Authority of the issuing Pharmacopoeia.
Trospium Chloride Impurity Standard, British Pharmacopoeia (BP) Reference Standard, MilliporeSigma™ Supelco™
This product is provided as delivered and specified by the issuing Pharmacopoeia. All information provided in support of this product, including SDS and any product information leaflets, has been developed and issued under the Authority of the issuing Pharmacopoeia.
3-Methylthio-1-propanol, 98%
CAS: 505-10-2 Molecular Formula: C4H10OS Molecular Weight (g/mol): 106.18 MDL Number: MFCD00036560 InChI Key: CZUGFKJYCPYHHV-UHFFFAOYSA-N Synonym: methionol,3-methylthiopropanol,3-methylthio-1-propanol,3-hydroxypropyl methyl sulfide,3-methylthio propanol,3-methylmercapto-1-propanol,1-propanol, 3-methylthio,3-methylsulfanyl propan-1-ol,gamma-methylmercaptopropyl alcohol PubChem CID: 10448 ChEBI: CHEBI:49019 IUPAC Name: 3-methylsulfanylpropan-1-ol SMILES: CSCCCO
| PubChem CID | 10448 |
|---|---|
| CAS | 505-10-2 |
| Molecular Weight (g/mol) | 106.18 |
| ChEBI | CHEBI:49019 |
| MDL Number | MFCD00036560 |
| SMILES | CSCCCO |
| Synonym | methionol,3-methylthiopropanol,3-methylthio-1-propanol,3-hydroxypropyl methyl sulfide,3-methylthio propanol,3-methylmercapto-1-propanol,1-propanol, 3-methylthio,3-methylsulfanyl propan-1-ol,gamma-methylmercaptopropyl alcohol |
| IUPAC Name | 3-methylsulfanylpropan-1-ol |
| InChI Key | CZUGFKJYCPYHHV-UHFFFAOYSA-N |
| Molecular Formula | C4H10OS |
1-Butyl isothiocyanate, 98+%
CAS: 592-82-5 Molecular Formula: C5H9NS Molecular Weight (g/mol): 115.19 MDL Number: MFCD00004824 InChI Key: LIMQQADUEULBSO-UHFFFAOYSA-N Synonym: butyl isothiocyanate,n-butyl isothiocyanate,butyl mustard oil,butane, 1-isothiocyanato,1-butyl isothiocyanate,butylisothiocyanate,isothiocyanic acid, butyl ester,isothiocyanic acid n-butyl ester,1-isothiocyanato-butane,butanisothiocyanate PubChem CID: 11613 ChEBI: CHEBI:50534 IUPAC Name: 1-isothiocyanatobutane SMILES: CCCCN=C=S
| PubChem CID | 11613 |
|---|---|
| CAS | 592-82-5 |
| Molecular Weight (g/mol) | 115.19 |
| ChEBI | CHEBI:50534 |
| MDL Number | MFCD00004824 |
| SMILES | CCCCN=C=S |
| Synonym | butyl isothiocyanate,n-butyl isothiocyanate,butyl mustard oil,butane, 1-isothiocyanato,1-butyl isothiocyanate,butylisothiocyanate,isothiocyanic acid, butyl ester,isothiocyanic acid n-butyl ester,1-isothiocyanato-butane,butanisothiocyanate |
| IUPAC Name | 1-isothiocyanatobutane |
| InChI Key | LIMQQADUEULBSO-UHFFFAOYSA-N |
| Molecular Formula | C5H9NS |
(2-Benzimidazolylthio)acetic acid, 98%
CAS: 3042-00-0 Molecular Formula: C9H7N2O2S Molecular Weight (g/mol): 207.23 MDL Number: MFCD00022673 InChI Key: UYNVBLJQBCTRKV-UHFFFAOYSA-M Synonym: 2-benzimidazolythio acetic acid,2-benzimidazolylthio-acetic acid,2-benzimidazolylthio acetic acid,1h-benzoimidazol-2-ylsulfanyl acetic acid,1h-benzimidazol-2-ylthio acetic acid,2-1h-benzo d imidazol-2-yl thio acetic acid,2-1h-1,3-benzodiazol-2-ylsulfanyl acetic acid,1h-benzimidazol-2-ylsulfanyl acetic acid,1h-1,3-benzodiazol-2-ylsulfanyl acetic acid,2-benzimidazol-2-ylthioacetic acid PubChem CID: 137805 IUPAC Name: 2-(1H-benzimidazol-2-ylsulfanyl)acetic acid SMILES: [O-]C(=O)CSC1=NC2=CC=CC=C2N1
| PubChem CID | 137805 |
|---|---|
| CAS | 3042-00-0 |
| Molecular Weight (g/mol) | 207.23 |
| MDL Number | MFCD00022673 |
| SMILES | [O-]C(=O)CSC1=NC2=CC=CC=C2N1 |
| Synonym | 2-benzimidazolythio acetic acid,2-benzimidazolylthio-acetic acid,2-benzimidazolylthio acetic acid,1h-benzoimidazol-2-ylsulfanyl acetic acid,1h-benzimidazol-2-ylthio acetic acid,2-1h-benzo d imidazol-2-yl thio acetic acid,2-1h-1,3-benzodiazol-2-ylsulfanyl acetic acid,1h-benzimidazol-2-ylsulfanyl acetic acid,1h-1,3-benzodiazol-2-ylsulfanyl acetic acid,2-benzimidazol-2-ylthioacetic acid |
| IUPAC Name | 2-(1H-benzimidazol-2-ylsulfanyl)acetic acid |
| InChI Key | UYNVBLJQBCTRKV-UHFFFAOYSA-M |
| Molecular Formula | C9H7N2O2S |
p-Tolyl isothiocyanate, 97%
CAS: 622-59-3 Molecular Formula: C8H7NS Molecular Weight (g/mol): 149.211 MDL Number: MFCD00004813 InChI Key: ABQKHKWXTUVKGF-UHFFFAOYSA-N Synonym: p-tolyl isothiocyanate,4-methylphenyl isothiocyanate,4-methylphenylisothiocyanate,p-tolylisothiocyanate,4-tolylisothiocyanate,benzene, 1-isothiocyanato-4-methyl,4-tolyl isothiocyanate,isothiocyanic acid, p-tolyl ester,1-isothiocyanato-4-methyl-benzene,isothiocyanic acid, 4-tolyl ester PubChem CID: 12149 IUPAC Name: 1-isothiocyanato-4-methylbenzene SMILES: CC1=CC=C(C=C1)N=C=S
| PubChem CID | 12149 |
|---|---|
| CAS | 622-59-3 |
| Molecular Weight (g/mol) | 149.211 |
| MDL Number | MFCD00004813 |
| SMILES | CC1=CC=C(C=C1)N=C=S |
| Synonym | p-tolyl isothiocyanate,4-methylphenyl isothiocyanate,4-methylphenylisothiocyanate,p-tolylisothiocyanate,4-tolylisothiocyanate,benzene, 1-isothiocyanato-4-methyl,4-tolyl isothiocyanate,isothiocyanic acid, p-tolyl ester,1-isothiocyanato-4-methyl-benzene,isothiocyanic acid, 4-tolyl ester |
| IUPAC Name | 1-isothiocyanato-4-methylbenzene |
| InChI Key | ABQKHKWXTUVKGF-UHFFFAOYSA-N |
| Molecular Formula | C8H7NS |
Phenyl isothiocyanate, 97%
CAS: 103-72-0 Molecular Formula: C7H5NS Molecular Weight (g/mol): 135.18 MDL Number: MFCD00004798 InChI Key: QKFJKGMPGYROCL-UHFFFAOYSA-N Synonym: phenyl isothiocyanate,phenylisothiocyanate,thiocarbanil,phenyl mustard oil,benzene, isothiocyanato,pitc,isothiocyanic acid phenyl ester,benzene-1-isothiocyanate,phenylsenfoel,phenyl thioisocyanate PubChem CID: 7673 ChEBI: CHEBI:85103 IUPAC Name: isothiocyanatobenzene SMILES: S=C=NC1=CC=CC=C1
| PubChem CID | 7673 |
|---|---|
| CAS | 103-72-0 |
| Molecular Weight (g/mol) | 135.18 |
| ChEBI | CHEBI:85103 |
| MDL Number | MFCD00004798 |
| SMILES | S=C=NC1=CC=CC=C1 |
| Synonym | phenyl isothiocyanate,phenylisothiocyanate,thiocarbanil,phenyl mustard oil,benzene, isothiocyanato,pitc,isothiocyanic acid phenyl ester,benzene-1-isothiocyanate,phenylsenfoel,phenyl thioisocyanate |
| IUPAC Name | isothiocyanatobenzene |
| InChI Key | QKFJKGMPGYROCL-UHFFFAOYSA-N |
| Molecular Formula | C7H5NS |
2-(Methylthio)thiophene, 97%
CAS: 5780-36-9 Molecular Formula: C5H6S2 Molecular Weight (g/mol): 130.223 MDL Number: MFCD00052382 InChI Key: ZLSMPEVZXWDWEK-UHFFFAOYSA-N PubChem CID: 79844 IUPAC Name: 2-methylsulfanylthiophene SMILES: CSC1=CC=CS1
| PubChem CID | 79844 |
|---|---|
| CAS | 5780-36-9 |
| Molecular Weight (g/mol) | 130.223 |
| MDL Number | MFCD00052382 |
| SMILES | CSC1=CC=CS1 |
| IUPAC Name | 2-methylsulfanylthiophene |
| InChI Key | ZLSMPEVZXWDWEK-UHFFFAOYSA-N |
| Molecular Formula | C5H6S2 |
N,N'-Bis(acryloyl)cystamine, 98%
CAS: 60984-57-8 Molecular Formula: C10H16N2O2S2 Molecular Weight (g/mol): 260.37 MDL Number: MFCD00036225 InChI Key: DJVKJGIZQFBFGS-UHFFFAOYSA-N Synonym: n,n'-bis acryloyl cystamine,n,n'-bisacrylylcystamine,2-propenamide, n,n'-dithiodi-2,1-ethanediyl bis,2,2'-bisacrylamino diethyldisulfide,bis-acrylylcystamine: bac,n,n'-dithiodi-2,1-ethanediyl bis acrylamide,n-2-2-prop-2-enamido ethyl disulfanyl ethyl prop-2-enamide,n-2-2-prop-2-enoylamino ethyldisulfanyl ethyl prop-2-enamide,acmc-20ak9p,n,n-bis-acrylylcystamine PubChem CID: 100602 IUPAC Name: N-[2-[2-(prop-2-enoylamino)ethyldisulfanyl]ethyl]prop-2-enamide SMILES: C=CC(=O)NCCSSCCNC(=O)C=C
| PubChem CID | 100602 |
|---|---|
| CAS | 60984-57-8 |
| Molecular Weight (g/mol) | 260.37 |
| MDL Number | MFCD00036225 |
| SMILES | C=CC(=O)NCCSSCCNC(=O)C=C |
| Synonym | n,n'-bis acryloyl cystamine,n,n'-bisacrylylcystamine,2-propenamide, n,n'-dithiodi-2,1-ethanediyl bis,2,2'-bisacrylamino diethyldisulfide,bis-acrylylcystamine: bac,n,n'-dithiodi-2,1-ethanediyl bis acrylamide,n-2-2-prop-2-enamido ethyl disulfanyl ethyl prop-2-enamide,n-2-2-prop-2-enoylamino ethyldisulfanyl ethyl prop-2-enamide,acmc-20ak9p,n,n-bis-acrylylcystamine |
| IUPAC Name | N-[2-[2-(prop-2-enoylamino)ethyldisulfanyl]ethyl]prop-2-enamide |
| InChI Key | DJVKJGIZQFBFGS-UHFFFAOYSA-N |
| Molecular Formula | C10H16N2O2S2 |
Sulfadiazine, 98%
CAS: 68-35-9 Molecular Formula: C10H10N4O2S Molecular Weight (g/mol): 250.276 MDL Number: MFCD00006065 InChI Key: SEEPANYCNGTZFQ-UHFFFAOYSA-N Synonym: sulfadiazine,sulphadiazine,sulfapyrimidine,sulfadiazin,sulfazine,sulfadiazene,liquadiazine,sulfapyrimidin,adiazin,adiazine PubChem CID: 5215 ChEBI: CHEBI:9328 IUPAC Name: 4-amino-N-pyrimidin-2-ylbenzenesulfonamide SMILES: C1=CN=C(N=C1)NS(=O)(=O)C2=CC=C(C=C2)N
| PubChem CID | 5215 |
|---|---|
| CAS | 68-35-9 |
| Molecular Weight (g/mol) | 250.276 |
| ChEBI | CHEBI:9328 |
| MDL Number | MFCD00006065 |
| SMILES | C1=CN=C(N=C1)NS(=O)(=O)C2=CC=C(C=C2)N |
| Synonym | sulfadiazine,sulphadiazine,sulfapyrimidine,sulfadiazin,sulfazine,sulfadiazene,liquadiazine,sulfapyrimidin,adiazin,adiazine |
| IUPAC Name | 4-amino-N-pyrimidin-2-ylbenzenesulfonamide |
| InChI Key | SEEPANYCNGTZFQ-UHFFFAOYSA-N |
| Molecular Formula | C10H10N4O2S |
3-(Phenylthio)thiophene, 97%
CAS: 16718-11-9 Molecular Formula: C10H8S2 Molecular Weight (g/mol): 192.29 MDL Number: MFCD00052043 InChI Key: WQYNBKIZHCGYCV-UHFFFAOYSA-N Synonym: 3-phenylthio thiophene,3-phenylsulfanyl thiophene,thiophene,3-phenylthio,3-phenylthiothiophene,acmc-1bt9i,3-phenylsulphanyl thiophene,phenyl-3-thienyl-sulphide PubChem CID: 2778902 IUPAC Name: 3-phenylsulfanylthiophene SMILES: S(C1=CSC=C1)C1=CC=CC=C1
| PubChem CID | 2778902 |
|---|---|
| CAS | 16718-11-9 |
| Molecular Weight (g/mol) | 192.29 |
| MDL Number | MFCD00052043 |
| SMILES | S(C1=CSC=C1)C1=CC=CC=C1 |
| Synonym | 3-phenylthio thiophene,3-phenylsulfanyl thiophene,thiophene,3-phenylthio,3-phenylthiothiophene,acmc-1bt9i,3-phenylsulphanyl thiophene,phenyl-3-thienyl-sulphide |
| IUPAC Name | 3-phenylsulfanylthiophene |
| InChI Key | WQYNBKIZHCGYCV-UHFFFAOYSA-N |
| Molecular Formula | C10H8S2 |
Diphenyl disulfide, 98%
CAS: 882-33-7 Molecular Formula: C12H10S2 Molecular Weight (g/mol): 218.332 MDL Number: MFCD00003065 InChI Key: GUUVPOWQJOLRAS-UHFFFAOYSA-N Synonym: diphenyl disulfide,phenyl disulfide,disulfide, diphenyl,diphenyldisulfide,1,2-diphenyldisulfane,phenyldisulfanyl benzene,diphenyl disulphide,biphenyl disulfide,disulfide diphenyl,phenyldithiobenzene PubChem CID: 13436 IUPAC Name: (phenyldisulfanyl)benzene SMILES: C1=CC=C(C=C1)SSC2=CC=CC=C2
| PubChem CID | 13436 |
|---|---|
| CAS | 882-33-7 |
| Molecular Weight (g/mol) | 218.332 |
| MDL Number | MFCD00003065 |
| SMILES | C1=CC=C(C=C1)SSC2=CC=CC=C2 |
| Synonym | diphenyl disulfide,phenyl disulfide,disulfide, diphenyl,diphenyldisulfide,1,2-diphenyldisulfane,phenyldisulfanyl benzene,diphenyl disulphide,biphenyl disulfide,disulfide diphenyl,phenyldithiobenzene |
| IUPAC Name | (phenyldisulfanyl)benzene |
| InChI Key | GUUVPOWQJOLRAS-UHFFFAOYSA-N |
| Molecular Formula | C12H10S2 |
Thioacetamide, 98%
CAS: 62-55-5 Molecular Formula: C2H5NS Molecular Weight (g/mol): 75.13 MDL Number: MFCD00008070 InChI Key: YUKQRDCYNOVPGJ-UHFFFAOYSA-N Synonym: thioacetamide,acetothioamide,thiacetamide,acetamide, thio,thioacetimidic acid,acetimidic acid, thio,usaf cb-21,usaf ek-1719,rcra waste number u218,acetic acid, thiono-, amide PubChem CID: 2723949 ChEBI: CHEBI:32497 IUPAC Name: ethanethioamide SMILES: CC(N)=S
| PubChem CID | 2723949 |
|---|---|
| CAS | 62-55-5 |
| Molecular Weight (g/mol) | 75.13 |
| ChEBI | CHEBI:32497 |
| MDL Number | MFCD00008070 |
| SMILES | CC(N)=S |
| Synonym | thioacetamide,acetothioamide,thiacetamide,acetamide, thio,thioacetimidic acid,acetimidic acid, thio,usaf cb-21,usaf ek-1719,rcra waste number u218,acetic acid, thiono-, amide |
| IUPAC Name | ethanethioamide |
| InChI Key | YUKQRDCYNOVPGJ-UHFFFAOYSA-N |
| Molecular Formula | C2H5NS |