missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Triethyl citrate, 99%
CAS: 77-93-0 | C12H20O7 | 276.29 g/mol
$97.45 - $190.65
Identifiants chimiques
| CAS | 77-93-0 |
|---|---|
| Molecular Formula | C12H20O7 |
| Molecular Weight (g/mol) | 276.29 |
| InChI Key | DOOTYTYQINUNNV-UHFFFAOYSA-N |
| Synonym | triethyl citrate, ethyl citrate, citroflex 2, eudraflex, hydragen cat, citric acid, triethyl ester, triaethylcitrat, triethylcitrate, citric acid triethyl ester, 1,2,3-propanetricarboxylic acid, 2-hydroxy-, triethyl ester |
| PubChem CID | 6506 |
| IUPAC Name | triethyl 2-hydroxypropane-1,2,3-tricarboxylate |
| SMILES | CCOC(=O)CC(CC(=O)OCC)(C(=O)OCC)O |
| Numéro de catalogue | Numéro du manufacturier. | Quantity | Packaging | Prix | Quantité | ||||
|---|---|---|---|---|---|---|---|---|---|
| Numéro de catalogue | Numéro du manufacturier. | Quantity | Packaging | Prix | Quantité | ||||
|
AC375062500
|
Thermo Scientific Chemicals
375062500 |
250 g | Plastic bottle |
chaque for $97.45
|
|
Vous avez déjà un compte ? Connectez-vous pour voir vos prix et disponibilités. Nouveau ici ? Inscrivez-vous dès aujourd'hui ! |
|||
|
AC375060010
|
Thermo Scientific Chemicals
375060010 |
1 kg | Plastic bottle |
chaque for $190.65
|
|
Vous avez déjà un compte ? Connectez-vous pour voir vos prix et disponibilités. Nouveau ici ? Inscrivez-vous dès aujourd'hui ! |
|||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Identifiants chimiques
| 77-93-0 | |
| 276.29 | |
| triethyl citrate, ethyl citrate, citroflex 2, eudraflex, hydragen cat, citric acid, triethyl ester, triaethylcitrat, triethylcitrate, citric acid triethyl ester, 1,2,3-propanetricarboxylic acid, 2-hydroxy-, triethyl ester | |
| triethyl 2-hydroxypropane-1,2,3-tricarboxylate |
| C12H20O7 | |
| DOOTYTYQINUNNV-UHFFFAOYSA-N | |
| 6506 | |
| CCOC(=O)CC(CC(=O)OCC)(C(=O)OCC)O |
Spécifications
| 77-93-0 | |
| 1.1360g/mL | |
| 151°C | |
| 98.5% min. (GC) | |
| C12H20O7 | |
| 250 g | |
| 15,2325 | |
| Solubility in water: 5.7% (25°C) | |
| CCOC(=O)CC(CC(=O)OCC)(C(=O)OCC)O | |
| 276.29 | |
| 35.2 mPa.s (25°C) | |
| 99% | |
| Triethyl citrate |
| -46.0°C | |
| 294.0°C | |
| Authentic | |
| Plastic bottle | |
| 1.4400 to 1.4430 | |
| 1.136 | |
| triethyl citrate, ethyl citrate, citroflex 2, eudraflex, hydragen cat, citric acid, triethyl ester, triaethylcitrat, triethylcitrate, citric acid triethyl ester, 1,2,3-propanetricarboxylic acid, 2-hydroxy-, triethyl ester | |
| DOOTYTYQINUNNV-UHFFFAOYSA-N | |
| triethyl 2-hydroxypropane-1,2,3-tricarboxylate | |
| 6506 | |
| 276.29 | |
| Liquid |
Sécurité et manipulation
missing translation for 'einecsNumber' : 201-070-7
RUO – Research Use Only