missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Quinidine, 98%, anhydrous, ACROS Organics™
$329.99 - $329.99
Chemical Identifiers
| CAS | 56-54-2 |
|---|---|
| Molecular Formula | C20H24N2O2 |
| Molecular Weight (g/mol) | 324.42 |
| MDL Number | MFCD00135581 |
| InChI Key | LOUPRKONTZGTKE-LHHVKLHASA-N |
| Synonym | +-quinidine |
| PubChem CID | 441074 |
| ChEBI | CHEBI:28593 |
| IUPAC Name | (S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
| SMILES | COC1=CC2=C(C=CN=C2C=C1)C(C3CC4CCN3CC4C=C)O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
| AC163680250 SDS |
Thermo Fisher Scientific
163680250 |
25g | Glass bottle |
Each for $329.99
|
|
AC163681000 SDS |
Thermo Fisher Scientific
AC163681000 |
100g | Glass bottle | N/A | N/A |
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
Chemical Identifiers
| 56-54-2 | |
| 324.42 | |
| LOUPRKONTZGTKE-LHHVKLHASA-N | |
| 441074 | |
| (S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
| C20H24N2O2 | |
| MFCD00135581 | |
| +-quinidine | |
| CHEBI:28593 | |
| COC1=CC2=C(C=CN=C2C=C1)C(C3CC4CCN3CC4C=C)O |
Specifications
| Authentic | |
| + 256.00 | |
| 170.0°C to 175.0°C | |
| 56-54-2 | |
| C20H24N2O2 | |
| 15, 8176 | |
| Solubility in water: 1g/2000mL (20°C)- 1g/800mL (100°C). Other solubilities: 1g/36mL alcohol- soluble in methanol,1g/56mL ether- 1g/1.6mL chloroform,practically insoluble in petroleum ether | |
| COC1=CC2=C(C=CN=C2C=C1)C(C3CC4CCN3CC4C=C)O | |
| 324.42 | |
| CHEBI:28593 | |
| Powder | |
| Quinidine |
| Glass bottle | |
| White | |
| 25g | |
| 98% | |
| MFCD00135581 | |
| +-quinidine | |
| LOUPRKONTZGTKE-LHHVKLHASA-N | |
| (S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol | |
| 441074 | |
| 324.42 | |
| 98% |
Safety and Handling
GHS H Statement
Toxic if swallowed.
May cause an allergic skin reaction.
GHS P Statement
IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
Wear protective gloves/protective clothing.
IF ON SKIN: Wash with plenty of soap and water.
If skin irritation or rash occurs: Get medical advice/at
GHS Signal Word: Danger
EINECSNumber : 200-279-