missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals D-Phenylalanine, 99+%
CAS: 673-06-3 | C9H11NO2 | 165.19 g/mol
$180.83 - $510.90
Identifiants chimiques
| CAS | 673-06-3 |
|---|---|
| Molecular Formula | C9H11NO2 |
| Molecular Weight (g/mol) | 165.19 |
| MDL Number | MFCD00004270 |
| InChI Key | COLNVLDHVKWLRT-MRVPVSSYSA-N |
| Synonym | d-phenylalanine, h-d-phe-oh, 2r-2-amino-3-phenylpropanoic acid, d-phe, sabiden, phenylalanine d-form, alanine, phenyl-, d, d-diphenylalanine, r-2-amino-3-phenylpropanoic acid, d-alpha-amino-beta-phenylpropionic acid |
| PubChem CID | 71567 |
| ChEBI | CHEBI:16998 |
| IUPAC Name | (2R)-2-amino-3-phenylpropanoic acid |
| SMILES | N[C@H](CC1=CC=CC=C1)C(O)=O |
| Numéro de catalogue | Numéro du manufacturier. | Quantity | Packaging | Prix | Quantité | ||||
|---|---|---|---|---|---|---|---|---|---|
| Numéro de catalogue | Numéro du manufacturier. | Quantity | Packaging | Prix | Quantité | ||||
|
AC172040250
|
Thermo Scientific Chemicals
172040250 |
25 g | Glass Bottle |
chaque for $180.83
|
|
Vous avez déjà un compte ? Connectez-vous pour voir vos prix et disponibilités. Nouveau ici ? Inscrivez-vous dès aujourd'hui ! |
|||
|
AC172041000
|
Thermo Scientific Chemicals
172041000 |
100 g | Glass Bottle |
chaque for $510.90
|
|
Vous avez déjà un compte ? Connectez-vous pour voir vos prix et disponibilités. Nouveau ici ? Inscrivez-vous dès aujourd'hui ! |
|||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Identifiants chimiques
| 673-06-3 | |
| 165.19 | |
| COLNVLDHVKWLRT-MRVPVSSYSA-N | |
| 71567 | |
| (2R)-2-amino-3-phenylpropanoic acid |
| C9H11NO2 | |
| MFCD00004270 | |
| d-phenylalanine, h-d-phe-oh, 2r-2-amino-3-phenylpropanoic acid, d-phe, sabiden, phenylalanine d-form, alanine, phenyl-, d, d-diphenylalanine, r-2-amino-3-phenylpropanoic acid, d-alpha-amino-beta-phenylpropionic acid | |
| CHEBI:16998 | |
| N[C@H](CC1=CC=CC=C1)C(O)=O |
Spécifications
| 673-06-3 | |
| White | |
| Authentic | |
| 99+% | |
| Glass Bottle | |
| MFCD00004270 | |
| 14, 494 | |
| 0.1% max. | |
| COLNVLDHVKWLRT-MRVPVSSYSA-N | |
| (2R)-2-amino-3-phenylpropanoic acid | |
| 165.19 | |
| 71567 | |
| 165.19 | |
| Powder |
| 3ppm max. | |
| 20ppm max. | |
| 0.5% max. | |
| C9H11NO2 | |
| C6H5CH2CH(NH2)CO2H | |
| +32° to +35° (20°C, 589nm) (c=2, water) | |
| 15, 7382 | |
| d-phenylalanine, h-d-phe-oh, 2r-2-amino-3-phenylpropanoic acid, d-phe, sabiden, phenylalanine d-form, alanine, phenyl-, d, d-diphenylalanine, r-2-amino-3-phenylpropanoic acid, d-alpha-amino-beta-phenylpropionic acid | |
| N[C@H](CC1=CC=CC=C1)C(O)=O | |
| +33.50° (20°C c=2,H2O) | |
| 25 g | |
| CHEBI:16998 | |
| ≥99.0% | |
| D-Phenylalanine |
RUO – Research Use Only