missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Bromhexine hydrochloride, 98+%
A mucolytic agent | CAS: 611-75-6 | C14H21Br2ClN2 | 412.59 g/mol
$233.01 - $713.18
Chemical Identifiers
| CAS | 611-75-6 |
|---|---|
| Molecular Formula | C14H21Br2ClN2 |
| Molecular Weight (g/mol) | 412.59 |
| MDL Number | MFCD00056626 |
| InChI Key | SXIVGYTWSVJOLM-UHFFFAOYNA-N |
| Synonym | bromhexine hydrochloride, bromhexine hcl, auxit, bisolvon, broncokin, viscolyt, bromohexine hydrochloride, bromhexine chloride, quentan, unii-yc2zom3z8v |
| PubChem CID | 5702220 |
| ChEBI | CHEBI:31303 |
| IUPAC Name | hydrogen 2-(1-amino-1-cyclohexylethyl)-4,6-dibromoaniline chloride |
| SMILES | [H+].[Cl-].CC(N)(C1CCCCC1)C1=CC(Br)=CC(Br)=C1N |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAJ6345122
|
Thermo Scientific Chemicals
J6345122 |
100 g |
Each for $233.01
|
|
|||||
|
AAJ6345136
|
Thermo Scientific Chemicals
J6345136 |
500 g |
Each for $713.18
|
|
|||||
Description
A mucolytic agent
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 611-75-6 | |
| 412.59 | |
| SXIVGYTWSVJOLM-UHFFFAOYNA-N | |
| 5702220 | |
| hydrogen 2-(1-amino-1-cyclohexylethyl)-4,6-dibromoaniline chloride |
| C14H21Br2ClN2 | |
| MFCD00056626 | |
| bromhexine hydrochloride, bromhexine hcl, auxit, bisolvon, broncokin, viscolyt, bromohexine hydrochloride, bromhexine chloride, quentan, unii-yc2zom3z8v | |
| CHEBI:31303 | |
| [H+].[Cl-].CC(N)(C1CCCCC1)C1=CC(Br)=CC(Br)=C1N |
Specifications
| 611-75-6 | |
| White | |
| MFCD00056626 | |
| 4848376 | |
| bromhexine hydrochloride, bromhexine hcl, auxit, bisolvon, broncokin, viscolyt, bromohexine hydrochloride, bromhexine chloride, quentan, unii-yc2zom3z8v | |
| [H+].[Cl-].CC(N)(C1CCCCC1)C1=CC(Br)=CC(Br)=C1N | |
| 412.59 | |
| CHEBI:31303 | |
| ≥98% | |
| Bromhexine hydrochloride |
| 240°C to 244°C | |
| C14H21Br2ClN2 | |
| 100 g | |
| 14,1391 | |
| SXIVGYTWSVJOLM-UHFFFAOYNA-N | |
| hydrogen 2-(1-amino-1-cyclohexylethyl)-4,6-dibromoaniline chloride | |
| 5702220 | |
| 412.6 | |
| Powder |
Safety and Handling
EINECSNumber : 210-280-8
RTECSNumber : XS9950000
TSCA : No
Recommended Storage : Ambient temperatures
RUO – Research Use Only