Learn More
Bromhexine hydrochloride, 98+%
A mucolytic agent | CAS: 611-75-6 | C14H21Br2ClN2 | 412.59 g/mol
Supplier: Thermo Scientific Chemicals J6345122
Description
A mucolytic agent
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Bromhexine hydrochloride | |
| 240°C to 244°C | |
| C14H21Br2ClN2 | |
| 100 g | |
| 14,1391 | |
| SXIVGYTWSVJOLM-UHFFFAOYNA-N | |
| hydrogen 2-(1-amino-1-cyclohexylethyl)-4,6-dibromoaniline chloride | |
| 5702220 | |
| 412.6 | |
| Powder |
| 611-75-6 | |
| White | |
| MFCD00056626 | |
| 4848376 | |
| bromhexine hydrochloride, bromhexine hcl, auxit, bisolvon, broncokin, viscolyt, bromohexine hydrochloride, bromhexine chloride, quentan, unii-yc2zom3z8v | |
| [H+].[Cl-].CC(N)(C1CCCCC1)C1=CC(Br)=CC(Br)=C1N | |
| 412.59 | |
| CHEBI:31303 | |
| ≥98% |
Chemical Identifiers
| 611-75-6 | |
| 412.59 | |
| SXIVGYTWSVJOLM-UHFFFAOYNA-N | |
| 5702220 | |
| hydrogen 2-(1-amino-1-cyclohexylethyl)-4,6-dibromoaniline chloride |
| C14H21Br2ClN2 | |
| MFCD00056626 | |
| bromhexine hydrochloride, bromhexine hcl, auxit, bisolvon, broncokin, viscolyt, bromohexine hydrochloride, bromhexine chloride, quentan, unii-yc2zom3z8v | |
| CHEBI:31303 | |
| [H+].[Cl-].CC(N)(C1CCCCC1)C1=CC(Br)=CC(Br)=C1N |
Safety and Handling
EINECSNumber : 210-280-8
RTECSNumber : XS9950000
TSCA : No
Recommended Storage : Ambient temperatures
RUO – Research Use Only