missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
BOC-L-Tyrosine methyleester, 97%, ACROS Organics™
Manufacturer: Acros Organics AC442020050
Specifications
| BOC-L-Tyrosine methyl ester | |
| Glass bottle | |
| White to Yellow | |
| 5g | |
| 97% | |
| boc-tyr-ome, boc-l-tyrosine methyl ester, n-boc-l-tyrosine methyl ester, n-tert-butoxycarbonyl-l-tyrosine methyl ester, methyl n-boc-l-tyrosinate, methyl 2s-2-tert-butoxycarbonyl amino-3-4-hydroxyphenyl propanoate, methyl 2s-2-tert-butoxy carbonyl amino-3-4-hydroxyphenyl propanoate, s-methyl 2-tert-butoxycarbonyl amino-3-4-hydroxyphenyl propanoate, s-2-tert-butoxycarbonylamino-3-4-hydroxy-phenyl-propionic acid methyl ester, s-2-tert-butoxycarbonylamino-3-4-hydroxy-phenyl-propionic acid methyl ester | |
| CC(C)(C)OC(=O)NC(CC1=CC=C(C=C1)O)C(=O)OC | |
| 295.335 | |
| 295.34 | |
| 97% |
| Authentic | |
| 50.2 | |
| 106.0°C to 107.0°C | |
| 4326-36-7 | |
| C15H21NO5 | |
| NQIFXJSLCUJHBB-LBPRGKRZSA-N | |
| methyl (2S)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate | |
| 7019130 | |
| Powder or Crystalline Powder |
Chemical Identifiers
| 4326-36-7 | |
| 295.335 | |
| boc-tyr-ome, boc-l-tyrosine methyl ester, n-boc-l-tyrosine methyl ester, n-tert-butoxycarbonyl-l-tyrosine methyl ester, methyl n-boc-l-tyrosinate, methyl 2s-2-tert-butoxycarbonyl amino-3-4-hydroxyphenyl propanoate, methyl 2s-2-tert-butoxy carbonyl amino-3-4-hydroxyphenyl propanoate, s-methyl 2-tert-butoxycarbonyl amino-3-4-hydroxyphenyl propanoate, s-2-tert-butoxycarbonylamino-3-4-hydroxy-phenyl-propionic acid methyl ester, s-2-tert-butoxycarbonylamino-3-4-hydroxy-phenyl-propionic acid methyl ester | |
| methyl (2S)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| C15H21NO5 | |
| NQIFXJSLCUJHBB-LBPRGKRZSA-N | |
| 7019130 | |
| CC(C)(C)OC(=O)NC(CC1=CC=C(C=C1)O)C(=O)OC |