Benzoic acid esters
- (14)
- (28)
- (1)
- (22)
- (7)
- (4)
- (4)
- (6)
- (1)
- (9)
- (1)
- (10)
- (1)
- (26)
- (3)
- (6)
- (2)
- (4)
- (26)
- (30)
- (16)
- (3)
- (4)
- (13)
- (5)
- (97)
- (24)
- (3)
- (5)
- (1)
- (33)
- (2)
- (3)
- (2)
- (2)
- (4)
- (2)
- (5)
- (3)
- (1)
Filtered Search Results
Isopropyl 4-hydroxybenzoate, 98%
CAS: 4191-73-5 Molecular Formula: C10H12O3 Molecular Weight (g/mol): 180.20 MDL Number: MFCD00016468 InChI Key: CMHMMKSPYOOVGI-UHFFFAOYSA-N Synonym: isopropyl 4-hydroxybenzoate,isopropylparaben,isopropyl p-hydroxybenzoate,isopropyl paraben,p-hydroxybenzoic acid isopropyl ester,isopropylhydroxybenzoate,unii-a6eox47qk0,p-oxybenzoesaureisopropylester,4-hydroxybenzoic acid isopropyl ester,benzoic acid, 4-hydroxy-, 1-methylethyl ester PubChem CID: 20161 IUPAC Name: propan-2-yl 4-hydroxybenzoate SMILES: CC(C)OC(=O)C1=CC=C(O)C=C1
| PubChem CID | 20161 |
|---|---|
| CAS | 4191-73-5 |
| Molecular Weight (g/mol) | 180.20 |
| MDL Number | MFCD00016468 |
| SMILES | CC(C)OC(=O)C1=CC=C(O)C=C1 |
| Synonym | isopropyl 4-hydroxybenzoate,isopropylparaben,isopropyl p-hydroxybenzoate,isopropyl paraben,p-hydroxybenzoic acid isopropyl ester,isopropylhydroxybenzoate,unii-a6eox47qk0,p-oxybenzoesaureisopropylester,4-hydroxybenzoic acid isopropyl ester,benzoic acid, 4-hydroxy-, 1-methylethyl ester |
| IUPAC Name | propan-2-yl 4-hydroxybenzoate |
| InChI Key | CMHMMKSPYOOVGI-UHFFFAOYSA-N |
| Molecular Formula | C10H12O3 |
n-Heptyl 4-hydroxybenzoate, 98%
CAS: 1085-12-7 Molecular Formula: C14H20O3 Molecular Weight (g/mol): 236.31 MDL Number: MFCD00016481 InChI Key: ZTJORNVITHUQJA-UHFFFAOYSA-N Synonym: heptylparaben,heptyl paraben,heptyl p-hydroxybenzoate,n-heptyl 4-hydroxybenzoate,nipaheptyl,staypro ws 7,n-heptyl p-hydroxybenzoate,benzoic acid, 4-hydroxy-, heptyl ester,p-hydroxybenzoic acid heptyl ester,p-oxybenzoesaureheptylester PubChem CID: 14138 ChEBI: CHEBI:34788 IUPAC Name: heptyl 4-hydroxybenzoate SMILES: CCCCCCCOC(=O)C1=CC=C(O)C=C1
| PubChem CID | 14138 |
|---|---|
| CAS | 1085-12-7 |
| Molecular Weight (g/mol) | 236.31 |
| ChEBI | CHEBI:34788 |
| MDL Number | MFCD00016481 |
| SMILES | CCCCCCCOC(=O)C1=CC=C(O)C=C1 |
| Synonym | heptylparaben,heptyl paraben,heptyl p-hydroxybenzoate,n-heptyl 4-hydroxybenzoate,nipaheptyl,staypro ws 7,n-heptyl p-hydroxybenzoate,benzoic acid, 4-hydroxy-, heptyl ester,p-hydroxybenzoic acid heptyl ester,p-oxybenzoesaureheptylester |
| IUPAC Name | heptyl 4-hydroxybenzoate |
| InChI Key | ZTJORNVITHUQJA-UHFFFAOYSA-N |
| Molecular Formula | C14H20O3 |
Isopropyl salicylate, 99%
CAS: 607-85-2 Molecular Formula: C10H12O3 Molecular Weight (g/mol): 180.203 MDL Number: MFCD00035703 InChI Key: YEULQIJMIOWCHB-UHFFFAOYSA-N Synonym: isopropyl salicylate,isopropyl 2-hydroxybenzoate,salicylic acid, isopropyl ester,iso-propyl salicylate,salicylic acid isopropyl ester,isopropyl o-hydroxybenzoate,benzoic acid, 2-hydroxy-, 1-methylethyl ester,1-methylethyl 2-hydroxybenzoate,methylethyl 2-hydroxybenzoate,opropyl salicylate PubChem CID: 11838 ChEBI: CHEBI:38703 IUPAC Name: propan-2-yl 2-hydroxybenzoate SMILES: CC(C)OC(=O)C1=CC=CC=C1O
| PubChem CID | 11838 |
|---|---|
| CAS | 607-85-2 |
| Molecular Weight (g/mol) | 180.203 |
| ChEBI | CHEBI:38703 |
| MDL Number | MFCD00035703 |
| SMILES | CC(C)OC(=O)C1=CC=CC=C1O |
| Synonym | isopropyl salicylate,isopropyl 2-hydroxybenzoate,salicylic acid, isopropyl ester,iso-propyl salicylate,salicylic acid isopropyl ester,isopropyl o-hydroxybenzoate,benzoic acid, 2-hydroxy-, 1-methylethyl ester,1-methylethyl 2-hydroxybenzoate,methylethyl 2-hydroxybenzoate,opropyl salicylate |
| IUPAC Name | propan-2-yl 2-hydroxybenzoate |
| InChI Key | YEULQIJMIOWCHB-UHFFFAOYSA-N |
| Molecular Formula | C10H12O3 |
Isobutyl 4-hydroxybenzoate, 98%
CAS: 2-3-4247 Molecular Formula: C11H14O3 Molecular Weight (g/mol): 194.23 MDL Number: MFCD00020167 InChI Key: XPJVKCRENWUEJH-UHFFFAOYSA-N Synonym: isobutyl 4-hydroxybenzoate,isobutylparaben,isobutyl p-hydroxybenzoate,isobutyl paraben,isobutyl-4-hydroxybenzoate,isobutyl parahydroxybenzoate,4-hydroxybenzoic acid isobutyl ester,benzoic acid, 4-hydroxy-, 2-methylpropyl ester,p-oxybenzoesaureisobutylester,unii-0qqj25x58g PubChem CID: 20240 IUPAC Name: 2-methylpropyl 4-hydroxybenzoate SMILES: CC(C)COC(=O)C1=CC=C(C=C1)O
| PubChem CID | 20240 |
|---|---|
| CAS | 2-3-4247 |
| Molecular Weight (g/mol) | 194.23 |
| MDL Number | MFCD00020167 |
| SMILES | CC(C)COC(=O)C1=CC=C(C=C1)O |
| Synonym | isobutyl 4-hydroxybenzoate,isobutylparaben,isobutyl p-hydroxybenzoate,isobutyl paraben,isobutyl-4-hydroxybenzoate,isobutyl parahydroxybenzoate,4-hydroxybenzoic acid isobutyl ester,benzoic acid, 4-hydroxy-, 2-methylpropyl ester,p-oxybenzoesaureisobutylester,unii-0qqj25x58g |
| IUPAC Name | 2-methylpropyl 4-hydroxybenzoate |
| InChI Key | XPJVKCRENWUEJH-UHFFFAOYSA-N |
| Molecular Formula | C11H14O3 |
Ethyl 3-hydroxybenzoate, 99%
CAS: 7781-98-8 Molecular Formula: C9H10O3 Molecular Weight (g/mol): 166.176 MDL Number: MFCD00002296 InChI Key: MWSMNBYIEBRXAL-UHFFFAOYSA-N Synonym: ethyl-3-hydroxybenzoate,benzoic acid, 3-hydroxy-, ethyl ester,3-hydroxybenzoic acid ethyl ester,m-ethoxycarbonylphenol,ethyl m-hydroxybenzoate,3-hydroxy-benzoic acid ethyl ester,benzoic acid, m-hydroxy-, ethyl ester,pubchem19923,acmc-209pbw,ethyl 3-oxidanylbenzoate PubChem CID: 24522 IUPAC Name: ethyl 3-hydroxybenzoate SMILES: CCOC(=O)C1=CC(=CC=C1)O
| PubChem CID | 24522 |
|---|---|
| CAS | 7781-98-8 |
| Molecular Weight (g/mol) | 166.176 |
| MDL Number | MFCD00002296 |
| SMILES | CCOC(=O)C1=CC(=CC=C1)O |
| Synonym | ethyl-3-hydroxybenzoate,benzoic acid, 3-hydroxy-, ethyl ester,3-hydroxybenzoic acid ethyl ester,m-ethoxycarbonylphenol,ethyl m-hydroxybenzoate,3-hydroxy-benzoic acid ethyl ester,benzoic acid, m-hydroxy-, ethyl ester,pubchem19923,acmc-209pbw,ethyl 3-oxidanylbenzoate |
| IUPAC Name | ethyl 3-hydroxybenzoate |
| InChI Key | MWSMNBYIEBRXAL-UHFFFAOYSA-N |
| Molecular Formula | C9H10O3 |
Methyl 2,5-dihydroxybenzoate, 98%
CAS: 2150-46-1 Molecular Formula: C8H8O4 Molecular Weight (g/mol): 168.15 MDL Number: MFCD00016464 InChI Key: XGDPKUKRQHHZTH-UHFFFAOYSA-N Synonym: methyl gentisate,gentisic acid methyl ester,methyl2,5-dihydroxybenzoate,benzoic acid, 2,5-dihydroxy-, methyl ester,methyl dihydroxybenzoate,2,5-dihydroxybenzoic acid methyl ester,gentisic acid, methyl ester,methyl-2,5-dihydroxybenzoate,unii-ls28b004km,rarechem al bf 0043 PubChem CID: 75077 IUPAC Name: methyl 2,5-dihydroxybenzoate SMILES: COC(=O)C1=CC(O)=CC=C1O
| PubChem CID | 75077 |
|---|---|
| CAS | 2150-46-1 |
| Molecular Weight (g/mol) | 168.15 |
| MDL Number | MFCD00016464 |
| SMILES | COC(=O)C1=CC(O)=CC=C1O |
| Synonym | methyl gentisate,gentisic acid methyl ester,methyl2,5-dihydroxybenzoate,benzoic acid, 2,5-dihydroxy-, methyl ester,methyl dihydroxybenzoate,2,5-dihydroxybenzoic acid methyl ester,gentisic acid, methyl ester,methyl-2,5-dihydroxybenzoate,unii-ls28b004km,rarechem al bf 0043 |
| IUPAC Name | methyl 2,5-dihydroxybenzoate |
| InChI Key | XGDPKUKRQHHZTH-UHFFFAOYSA-N |
| Molecular Formula | C8H8O4 |
3-Hydroxy-4-(methoxycarbonyl)phenylboronic acid pinacol ester, 97%
CAS: 1073371-99-9 Molecular Formula: C14H19BO5 Molecular Weight (g/mol): 278.11 MDL Number: MFCD08458200 InChI Key: SRYGMLVCVMGUTB-UHFFFAOYSA-N Synonym: methyl 2-hydroxy-4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl benzoate,3-hydroxy-4-methoxycarbonylphenylboronic acid, pinacol ester,methyl 4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl salicylate,methyl 2-hydroxy-4-tetramethyl-1,3,2-dioxaborolan-2-yl benzoate PubChem CID: 17998928 IUPAC Name: methyl 2-hydroxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate SMILES: COC(=O)C1=C(O)C=C(C=C1)B1OC(C)(C)C(C)(C)O1
| PubChem CID | 17998928 |
|---|---|
| CAS | 1073371-99-9 |
| Molecular Weight (g/mol) | 278.11 |
| MDL Number | MFCD08458200 |
| SMILES | COC(=O)C1=C(O)C=C(C=C1)B1OC(C)(C)C(C)(C)O1 |
| Synonym | methyl 2-hydroxy-4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl benzoate,3-hydroxy-4-methoxycarbonylphenylboronic acid, pinacol ester,methyl 4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl salicylate,methyl 2-hydroxy-4-tetramethyl-1,3,2-dioxaborolan-2-yl benzoate |
| IUPAC Name | methyl 2-hydroxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChI Key | SRYGMLVCVMGUTB-UHFFFAOYSA-N |
| Molecular Formula | C14H19BO5 |
Methyl 3-bromo-5-hydroxybenzoate, 97%, Thermo Scientific Chemicals
CAS: 192810-12-1 Molecular Formula: C8H7BrO3 Molecular Weight (g/mol): 231.045 MDL Number: MFCD10566800 InChI Key: KRTBWIIGEJIUSA-UHFFFAOYSA-N Synonym: 3-bromo-5-hydroxybenzoic acid methyl ester,acmc-209f1w,methyl3-bromo-5-hydroxybenzoate,methyl 3-bromo-5-hydroxylbenzoate,3-bromo-5-hydroxy-benzoic acid methyl ester,benzoic acid,3-bromo-5-hydroxy-,methyl ester,benzoic acid, 3-bromo-5-hydroxy-, methyl ester PubChem CID: 53216607 IUPAC Name: methyl 3-bromo-5-hydroxybenzoate SMILES: COC(=O)C1=CC(=CC(=C1)Br)O
| PubChem CID | 53216607 |
|---|---|
| CAS | 192810-12-1 |
| Molecular Weight (g/mol) | 231.045 |
| MDL Number | MFCD10566800 |
| SMILES | COC(=O)C1=CC(=CC(=C1)Br)O |
| Synonym | 3-bromo-5-hydroxybenzoic acid methyl ester,acmc-209f1w,methyl3-bromo-5-hydroxybenzoate,methyl 3-bromo-5-hydroxylbenzoate,3-bromo-5-hydroxy-benzoic acid methyl ester,benzoic acid,3-bromo-5-hydroxy-,methyl ester,benzoic acid, 3-bromo-5-hydroxy-, methyl ester |
| IUPAC Name | methyl 3-bromo-5-hydroxybenzoate |
| InChI Key | KRTBWIIGEJIUSA-UHFFFAOYSA-N |
| Molecular Formula | C8H7BrO3 |
Methyl 2,4-dihydroxybenzoate, 97%
CAS: 2150-47-2 Molecular Formula: C8H8O4 Molecular Weight (g/mol): 168.148 MDL Number: MFCD00002276 InChI Key: IIFCLXHRIYTHPV-UHFFFAOYSA-N Synonym: 2,4-dihydroxybenzoic acid methyl ester,benzoic acid, 2,4-dihydroxy-, methyl ester,methyl beta-resorcylate,methyl-2,4-dihydroxybenzoate,unii-xe68bu3oyj,xe68bu3oyj,.beta.-resorcylic acid, methyl ester,beta-resorcylic acid methyl ester,methyl benzoate, 2,4-dihydroxy,methyl b-resorcylate PubChem CID: 16523 IUPAC Name: methyl 2,4-dihydroxybenzoate SMILES: COC(=O)C1=C(C=C(C=C1)O)O
| PubChem CID | 16523 |
|---|---|
| CAS | 2150-47-2 |
| Molecular Weight (g/mol) | 168.148 |
| MDL Number | MFCD00002276 |
| SMILES | COC(=O)C1=C(C=C(C=C1)O)O |
| Synonym | 2,4-dihydroxybenzoic acid methyl ester,benzoic acid, 2,4-dihydroxy-, methyl ester,methyl beta-resorcylate,methyl-2,4-dihydroxybenzoate,unii-xe68bu3oyj,xe68bu3oyj,.beta.-resorcylic acid, methyl ester,beta-resorcylic acid methyl ester,methyl benzoate, 2,4-dihydroxy,methyl b-resorcylate |
| IUPAC Name | methyl 2,4-dihydroxybenzoate |
| InChI Key | IIFCLXHRIYTHPV-UHFFFAOYSA-N |
| Molecular Formula | C8H8O4 |
Methyl 3-bromo-4-hydroxybenzoate, 98%
CAS: 29415-97-2 Molecular Formula: C8H7BrO3 Molecular Weight (g/mol): 231.05 MDL Number: MFCD06203850 InChI Key: RKUNSPWAQIUGEZ-UHFFFAOYSA-N Synonym: methyl3-bromo-4-hydroxybenzoate,3-bromo-4-hydroxybenzoic acid methyl ester,benzoic acid, 3-bromo-4-hydroxy-, methyl ester,2-bromo-4-methoxycarbonyl phenol,methyl 4-hydroxy-3-bromobenzoate,methyl-3-bromo-4-hydroxybenzoate,methyl 3-bromo-4-hydroxy-benzoate,methyl 3-bromo-4-hydroxybenzoate,methyl 3-bromanyl-4-oxidanyl-benzoate,3-bromo-4-hydroxy-benzoic acid methyl ester PubChem CID: 4778958 IUPAC Name: methyl 3-bromo-4-hydroxybenzoate SMILES: COC(=O)C1=CC(Br)=C(O)C=C1
| PubChem CID | 4778958 |
|---|---|
| CAS | 29415-97-2 |
| Molecular Weight (g/mol) | 231.05 |
| MDL Number | MFCD06203850 |
| SMILES | COC(=O)C1=CC(Br)=C(O)C=C1 |
| Synonym | methyl3-bromo-4-hydroxybenzoate,3-bromo-4-hydroxybenzoic acid methyl ester,benzoic acid, 3-bromo-4-hydroxy-, methyl ester,2-bromo-4-methoxycarbonyl phenol,methyl 4-hydroxy-3-bromobenzoate,methyl-3-bromo-4-hydroxybenzoate,methyl 3-bromo-4-hydroxy-benzoate,methyl 3-bromo-4-hydroxybenzoate,methyl 3-bromanyl-4-oxidanyl-benzoate,3-bromo-4-hydroxy-benzoic acid methyl ester |
| IUPAC Name | methyl 3-bromo-4-hydroxybenzoate |
| InChI Key | RKUNSPWAQIUGEZ-UHFFFAOYSA-N |
| Molecular Formula | C8H7BrO3 |
Methyl 3-hydroxybenzoate, 99%
CAS: 19438-10-9 Molecular Formula: C8H8O3 Molecular Weight (g/mol): 152.15 MDL Number: MFCD00002295 InChI Key: YKUCHDXIBAQWSF-UHFFFAOYSA-N Synonym: methyl m-hydroxybenzoate,3-hydroxybenzoic acid methyl ester,m-carbomethoxyphenol,methyl m-oxybenzoate,m-hydroxybenzoic acid methyl ester,benzoic acid, 3-hydroxy-, methyl ester,3-hydroxy-benzoic acid methyl ester,unii-569m9g3stj,3-methoxycarbonyl phenol,benzoic acid, m-hydroxy-, methyl ester PubChem CID: 88068 IUPAC Name: methyl 3-hydroxybenzoate SMILES: COC(=O)C1=CC=CC(O)=C1
| PubChem CID | 88068 |
|---|---|
| CAS | 19438-10-9 |
| Molecular Weight (g/mol) | 152.15 |
| MDL Number | MFCD00002295 |
| SMILES | COC(=O)C1=CC=CC(O)=C1 |
| Synonym | methyl m-hydroxybenzoate,3-hydroxybenzoic acid methyl ester,m-carbomethoxyphenol,methyl m-oxybenzoate,m-hydroxybenzoic acid methyl ester,benzoic acid, 3-hydroxy-, methyl ester,3-hydroxy-benzoic acid methyl ester,unii-569m9g3stj,3-methoxycarbonyl phenol,benzoic acid, m-hydroxy-, methyl ester |
| IUPAC Name | methyl 3-hydroxybenzoate |
| InChI Key | YKUCHDXIBAQWSF-UHFFFAOYSA-N |
| Molecular Formula | C8H8O3 |
Ethyl salicylate, 99%
CAS: 118-61-6 Molecular Formula: C9H10O3 Molecular Weight (g/mol): 166.176 MDL Number: MFCD00002215 InChI Key: GYCKQBWUSACYIF-UHFFFAOYSA-N Synonym: ethyl salicylate,sal ethyl,mesotol,salotan,salicylic ether,salicylic acid, ethyl ester,benzoic acid, 2-hydroxy-, ethyl ester,ethyl o-hydroxybenzoate,o-ethoxycarbonyl phenol,2-hydroxybenzoic acid ethyl ester PubChem CID: 8365 IUPAC Name: ethyl 2-hydroxybenzoate SMILES: CCOC(=O)C1=CC=CC=C1O
| PubChem CID | 8365 |
|---|---|
| CAS | 118-61-6 |
| Molecular Weight (g/mol) | 166.176 |
| MDL Number | MFCD00002215 |
| SMILES | CCOC(=O)C1=CC=CC=C1O |
| Synonym | ethyl salicylate,sal ethyl,mesotol,salotan,salicylic ether,salicylic acid, ethyl ester,benzoic acid, 2-hydroxy-, ethyl ester,ethyl o-hydroxybenzoate,o-ethoxycarbonyl phenol,2-hydroxybenzoic acid ethyl ester |
| IUPAC Name | ethyl 2-hydroxybenzoate |
| InChI Key | GYCKQBWUSACYIF-UHFFFAOYSA-N |
| Molecular Formula | C9H10O3 |
Methyl 3,5-dibromo-2-hydroxybenzoate, 98%
CAS: 21702-79-4 Molecular Formula: C8H6Br2O3 Molecular Weight (g/mol): 309.94 MDL Number: MFCD00017534 InChI Key: KISQISIKTRRMOX-UHFFFAOYSA-N PubChem CID: 624217 IUPAC Name: methyl 3,5-dibromo-2-hydroxybenzoate SMILES: COC(=O)C1=CC(Br)=CC(Br)=C1O
| PubChem CID | 624217 |
|---|---|
| CAS | 21702-79-4 |
| Molecular Weight (g/mol) | 309.94 |
| MDL Number | MFCD00017534 |
| SMILES | COC(=O)C1=CC(Br)=CC(Br)=C1O |
| IUPAC Name | methyl 3,5-dibromo-2-hydroxybenzoate |
| InChI Key | KISQISIKTRRMOX-UHFFFAOYSA-N |
| Molecular Formula | C8H6Br2O3 |
Methyl salicylate, 99%
CAS: 119-36-8 Molecular Formula: C8H8O3 Molecular Weight (g/mol): 152.15 MDL Number: MFCD00002214 InChI Key: OSWPMRLSEDHDFF-UHFFFAOYSA-N Synonym: methyl salicylate,wintergreen oil,gaultheria oil,betula oil,teaberry oil,sweet birch oil,oil of wintergreen,analgit,spicewood oil,2-hydroxybenzoic acid methyl ester PubChem CID: 4133 ChEBI: CHEBI:31832 IUPAC Name: methyl 2-hydroxybenzoate SMILES: COC(=O)C1=CC=CC=C1O
| PubChem CID | 4133 |
|---|---|
| CAS | 119-36-8 |
| Molecular Weight (g/mol) | 152.15 |
| ChEBI | CHEBI:31832 |
| MDL Number | MFCD00002214 |
| SMILES | COC(=O)C1=CC=CC=C1O |
| Synonym | methyl salicylate,wintergreen oil,gaultheria oil,betula oil,teaberry oil,sweet birch oil,oil of wintergreen,analgit,spicewood oil,2-hydroxybenzoic acid methyl ester |
| IUPAC Name | methyl 2-hydroxybenzoate |
| InChI Key | OSWPMRLSEDHDFF-UHFFFAOYSA-N |
| Molecular Formula | C8H8O3 |
n-Octyl 4-hydroxybenzoate, 98%
CAS: 1219-38-1 Molecular Formula: C15H22O3 Molecular Weight (g/mol): 250.34 MDL Number: MFCD00016482 InChI Key: RIKCMEDSBFQFAL-UHFFFAOYSA-N Synonym: octylparaben,n-octyl 4-hydroxybenzoate,octyl paraben,octyl p-hydroxybenzoate,p-hydroxybenzoic acid octyl ester,benzoic acid, 4-hydroxy-, octyl ester,p-oxybenzoesaureoctylester,4-hydroxybenzoic acid n-octyl ester,unii-4uvk431k6b,p-oxybenzoesaureoctylester german PubChem CID: 14642 IUPAC Name: octyl 4-hydroxybenzoate SMILES: CCCCCCCCOC(=O)C1=CC=C(O)C=C1
| PubChem CID | 14642 |
|---|---|
| CAS | 1219-38-1 |
| Molecular Weight (g/mol) | 250.34 |
| MDL Number | MFCD00016482 |
| SMILES | CCCCCCCCOC(=O)C1=CC=C(O)C=C1 |
| Synonym | octylparaben,n-octyl 4-hydroxybenzoate,octyl paraben,octyl p-hydroxybenzoate,p-hydroxybenzoic acid octyl ester,benzoic acid, 4-hydroxy-, octyl ester,p-oxybenzoesaureoctylester,4-hydroxybenzoic acid n-octyl ester,unii-4uvk431k6b,p-oxybenzoesaureoctylester german |
| IUPAC Name | octyl 4-hydroxybenzoate |
| InChI Key | RIKCMEDSBFQFAL-UHFFFAOYSA-N |
| Molecular Formula | C15H22O3 |