Inorganic Salts
Résultats de la recherche filtrée
Sodium Hypochlorite, Sterile, Made with USP Purified Water, 5% Solution, BAKER™, J.T. Baker™
CAS: 7681-52-9 Formule moléculaire: ClNaO Poids moléculaire (g/mol): 74.439 Clé InChI: SUKJFIGYRHOWBL-UHFFFAOYSA-N Synonyme: sodium hypochlorite,antiformin,sodium oxychloride,chlorox,clorox,javex,javelle water,hypochlorous acid, sodium salt,hypochlorite sodium,carrel-dakin solution CID PubChem: 23665760 ChEBI: CHEBI:32146 Nom IUPAC: sodium;hypochlorite SMILES: [O-]Cl.[Na+]
| Poids moléculaire (g/mol) | 74.439 |
|---|---|
| Synonyme | sodium hypochlorite,antiformin,sodium oxychloride,chlorox,clorox,javex,javelle water,hypochlorous acid, sodium salt,hypochlorite sodium,carrel-dakin solution |
| CAS | 7681-52-9 |
| CID PubChem | 23665760 |
| ChEBI | CHEBI:32146 |
| Nom IUPAC | sodium;hypochlorite |
| Clé InChI | SUKJFIGYRHOWBL-UHFFFAOYSA-N |
| SMILES | [O-]Cl.[Na+] |
| Formule moléculaire | ClNaO |
Ammonium sulfide, 20% solution in water
CAS: 12135-76-1 Formule moléculaire: H8N2S Poids moléculaire (g/mol): 68.14 Numéro MDL: MFCD00010892 Clé InChI: UXXGWUQNRMPNKH-UHFFFAOYSA-N Nom IUPAC: diamine sulfane SMILES: N.N.S
| Poids moléculaire (g/mol) | 68.14 |
|---|---|
| Numéro MDL | MFCD00010892 |
| CAS | 12135-76-1 |
| Nom IUPAC | diamine sulfane |
| Clé InChI | UXXGWUQNRMPNKH-UHFFFAOYSA-N |
| SMILES | N.N.S |
| Formule moléculaire | H8N2S |
| Poids moléculaire (g/mol) | 174.18 |
|---|---|
| Formule linéaire | K2HPO4 |
| Conditionnement | Glass bottle |
| ChEBI | CHEBI:32031 |
| SMILES | OP(=O)([O-])[O-].[K+].[K+] |
| Merck Index | 15, 7779 |
| Aspect | Clear colorless solution |
| Gravité spécifique | 1.13 |
| Poids de la formule | 174.18 |
| Formule moléculaire | HK2O4P |
| Synonyme | dipotassium hydrogen phosphate,dipotassium phosphate,dipotassium hydrogenphosphate,dibasic potassium phosphate,potassium hydrogen phosphate,potassium phosphate, dibasic,potassium dibasic phosphate,potassium phosphate dibasic,phosphoric acid, dipotassium salt,dipotassium monophosphate |
| Numéro MDL | MFCD00011383 |
| Nom chimique ou matériau | Potassium phosphate, dibasic |
| Concentration or Composition (by Analyte or Components) | 1.0M, exact strength on the certificate of analysis |
| Numéro EINECS | 231-834-5 |
| CAS | 7732-18-5 |
| CID PubChem | 24450 |
| Nom IUPAC | dipotassium;hydrogen phosphate |
| Clé InChI | ZPWVASYFFYYZEW-UHFFFAOYSA-L |
| Densité | 1.1300g/mL |
| Poids moléculaire (g/mol) | 254.23 |
|---|---|
| Numéro RTECS | RN1140000 |
| Formule linéaire | OsO4 |
| Point d’ébullition | 100.0°C |
| Gravité spécifique | 1.04 |
| Forme physique | Solution |
| Nom chimique ou matériau | Osmium tetroxide |
| Fieser | 01,759; 02,301; 04,361; 05,141; 06,424; 10,290; 12,358; 13,186; 14,235; 15,240; 16,249; 17,236 |
| Nom IUPAC | tetraoxoosmium |
| Clé InChI | VUVGYHUDAICLFK-UHFFFAOYSA-N |
| Danger pour la santé 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Immediately call a POISON CENTER or doctor/physician. IF INHALED: Remove to fresh air a |
| Danger pour la santé 1 | GHS Signal Word: Danger |
| Danger pour la santé 2 | GHS H Statement Causes serious eye damage. Fatal in contact with skin. Harmful if swallowed. Causes skin irritation. Harmful if inhaled. May cause allergy or asthma symptoms or breathing difficulties if inhaled. |
| Conditionnement | Glass bottle |
| SMILES | O=[Os](=O)(=O)=O |
| Merck Index | 15, 6990 |
| Poids de la formule | 254.2 |
| Formule moléculaire | O4Os |
| Informations sur la solubilité | Solubility in water: soluble |
| Couleur | Yellow |
| Synonyme | osmium tetroxide,osmium tetraoxide,osmic acid,perosmic oxide,osmic acid anhydride,osmium viii oxide,oso4,perosmic acid anhydride,osmiumtetroxide,osmium oxide, t-4 |
| Numéro MDL | MFCD00011150 |
| Concentration or Composition (by Analyte or Components) | 3.92 to 4.08% |
| Numéro EINECS | 244-058-7 |
| CAS | 7732-18-5 |
| CID PubChem | 30318 |
| TSCA | TSCA |
| Densité | 1.0400g/mL |
Potassium hydroxide, pure, 8N solution in water
CAS: 1310-58-3 Formule moléculaire: HKO Poids moléculaire (g/mol): 56.11 Numéro MDL: MFCD00003553 Clé InChI: KWYUFKZDYYNOTN-UHFFFAOYSA-M Synonyme: potassium hydroxide,caustic potash,potash lye,potassium hydrate,hydroxyde de potassium,potassa,potasse caustique,potassium hydroxide k oh,potassium hydroxide solution,caswell no. 693 CID PubChem: 14797 ChEBI: CHEBI:32035 SMILES: [OH-].[K+]
| Poids moléculaire (g/mol) | 56.11 |
|---|---|
| Synonyme | potassium hydroxide,caustic potash,potash lye,potassium hydrate,hydroxyde de potassium,potassa,potasse caustique,potassium hydroxide k oh,potassium hydroxide solution,caswell no. 693 |
| Numéro MDL | MFCD00003553 |
| CAS | 1310-58-3 |
| CID PubChem | 14797 |
| ChEBI | CHEBI:32035 |
| Clé InChI | KWYUFKZDYYNOTN-UHFFFAOYSA-M |
| SMILES | [OH-].[K+] |
| Formule moléculaire | HKO |
Iron(Iii) Oxide, purified, Honeywell Fluka™
CAS: 1309-37-1 Formule moléculaire: Fe2O3 Poids moléculaire (g/mol): 159.69 Numéro MDL: MFCD00011008 Clé InChI: JEIPFZHSYJVQDO-UHFFFAOYSA-N Nom IUPAC: trioxodiiron SMILES: [Fe][Fe](=O)(=O)=O
| Poids moléculaire (g/mol) | 159.69 |
|---|---|
| Numéro MDL | MFCD00011008 |
| CAS | 1309-37-1 |
| Nom IUPAC | trioxodiiron |
| Clé InChI | JEIPFZHSYJVQDO-UHFFFAOYSA-N |
| SMILES | [Fe][Fe](=O)(=O)=O |
| Formule moléculaire | Fe2O3 |
Copper(I) chloride, 99%, extra pure, purified
CAS: 7758-89-6 Formule moléculaire: ClCu Poids moléculaire (g/mol): 99 Numéro MDL: MFCD00010971 Clé InChI: OXBLHERUFWYNTN-UHFFFAOYSA-M Synonyme: cuprous chloride,copper i chloride,copper chloride cucl,copper monochloride,dicopper dichloride,copper 1+ chloride,cucl,chlorid medny czech CID PubChem: 62652 ChEBI: CHEBI:53472 Nom IUPAC: chlorocopper SMILES: Cl[Cu]
| Poids moléculaire (g/mol) | 99 |
|---|---|
| Synonyme | cuprous chloride,copper i chloride,copper chloride cucl,copper monochloride,dicopper dichloride,copper 1+ chloride,cucl,chlorid medny czech |
| Numéro MDL | MFCD00010971 |
| CAS | 7758-89-6 |
| CID PubChem | 62652 |
| ChEBI | CHEBI:53472 |
| Nom IUPAC | chlorocopper |
| Clé InChI | OXBLHERUFWYNTN-UHFFFAOYSA-M |
| SMILES | Cl[Cu] |
| Formule moléculaire | ClCu |
| Poids moléculaire (g/mol) | 465.61 |
|---|---|
| Danger pour la santé 3 | GHS P Statement: Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Avoid breathing dust/fume/gas/mist/vapors/spray. IF ON SKIN: Wash with plenty of soap and water. Wear protective gloves/protective clothing/eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification. |
| Danger pour la santé 1 | GHS Signal Word: Danger |
| Danger pour la santé 2 | GHS H Statement: May cause respiratory irritation. Causes serious eye irritation. Causes skin irritation. May intensify fire; oxidizer. |
| Conditionnement | Glass bottle |
| SMILES | [O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O.[Er+3] |
| Gravité spécifique | 1.44 |
| Poids de la formule | 465.61 |
| Formule moléculaire | Cl3ErO12 |
| Synonyme | erbium 3+ perchlorate,erbium perchlorate,perchloric acid,erbium 3+ salt 8ci,9ci,erbium iii perchlorate solution,perchloric acid erbium iii salt,erbium perchlorate aqueous solution |
| Numéro MDL | MFCD00016073 |
| Nom chimique ou matériau | Erbium(III) perchlorate |
| Numéro EINECS | 237-840-4 |
| CAS | 7732-18-5 |
| CID PubChem | 15335705 |
| Nom IUPAC | erbium(3+);triperchlorate |
| Clé InChI | FGBKFKCLWFRKEW-UHFFFAOYSA-K |
| Densité | 1.4400g/mL |
Aluminum lactate, 90-95%, contains ^=5% water
CAS: 18917-91-4 Formule moléculaire: C9H15AlO9 Poids moléculaire (g/mol): 294.19 Numéro MDL: MFCD20529175 Clé InChI: VXYADVIJALMOEQ-UHFFFAOYNA-K Nom IUPAC: bis[(2-hydroxypropanoyl)oxy]alumanyl 2-hydroxypropanoate SMILES: CC(O)C(=O)O[Al](OC(=O)C(C)O)OC(=O)C(C)O
| Poids moléculaire (g/mol) | 294.19 |
|---|---|
| Numéro MDL | MFCD20529175 |
| CAS | 18917-91-4 |
| Nom IUPAC | bis[(2-hydroxypropanoyl)oxy]alumanyl 2-hydroxypropanoate |
| Clé InChI | VXYADVIJALMOEQ-UHFFFAOYNA-K |
| SMILES | CC(O)C(=O)O[Al](OC(=O)C(C)O)OC(=O)C(C)O |
| Formule moléculaire | C9H15AlO9 |
Copper(II)-ethylenediamine complex, 1M solution in water
CAS: 14552-35-3 | C4H18CuN4O2 | 217.76 g/mol
| Poids moléculaire (g/mol) | 217.76 |
|---|---|
| Note relative au nom | 1M Solution in Water |
| Danger pour la santé 3 | GHS P Statement IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsi |
| Formule linéaire | Cu(H2NCH2CH2NH2)2(OH)2 |
| Danger pour la santé 1 | GHS Signal Word: Danger |
| Danger pour la santé 2 | GHS H Statement Causes severe skin burns and eye damage. |
| Conditionnement | Glass bottle |
| Gravité spécifique | 1.1 |
| Poids de la formule | 217.76 |
| Formule moléculaire | C4H18CuN4O2 |
| Informations sur la solubilité | Solubility in water: soluble |
| Point d’éclair | >110°C |
| Synonyme | Bis(ethylenediamine)copper(II)hydroxide |
| Numéro MDL | MFCD00274628 |
| Nom chimique ou matériau | Copper(II)-ethylenediamine complex |
| Numéro EINECS | 238-597-7 |
| CAS | 7732-18-5 |
| TSCA | TSCA |
| Densité | 1.1000g/mL |
| Poids moléculaire (g/mol) | 58.44 |
|---|---|
| Formule linéaire | NaCl |
| Danger pour la santé 1 | |
| Conditionnement | Glass bottle |
| Qualité | Pure |
| ChEBI | CHEBI:26710 |
| SMILES | [Na+].[Cl-] |
| Merck Index | 15,8734 |
| Gravité spécifique | 1.202 |
| Poids de la formule | 58.44 |
| Forme physique | Liquid |
| Formule moléculaire | ClNa |
| Couleur | Colorless |
| Synonyme | sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex |
| Numéro MDL | MFCD00003477 |
| Nom chimique ou matériau | Sodium chloride |
| Concentration or Composition (by Analyte or Components) | 25 to 28% |
| Numéro EINECS | 231-598-3 |
| CAS | 7732-18-5 |
| CID PubChem | 5234 |
| Clé InChI | FAPWRFPIFSIZLT-UHFFFAOYSA-M |
| Densité | 1.2020g/mL |
| Poids moléculaire (g/mol) | 165.07 |
|---|---|
| Synonyme | ruthenium tetroxide,ruthenium tetraoxide,unii-97e960g9rp,ruthenium viii oxide,ruthenium oxide ruo4,sodium perruthenate,ruthenium oxide ruo4 , t-4,ruo4,51429-86-8 tri-hydrochloride salt |
| Numéro MDL | MFCD00074857 |
| CAS | 20427-56-9 |
| CID PubChem | 119079 |
| Nom IUPAC | tetraoxoruthenium |
| Clé InChI | GJFMDWMEOCWXGJ-UHFFFAOYSA-N |
| SMILES | O=[Ru](=O)(=O)=O |
| Formule moléculaire | O4Ru |
Rhodium acetate, ca. 40% Rh, brown, water soluble
CAS: 42204-14-8 Formule moléculaire: C2H3O2Rh Poids moléculaire (g/mol): 161.95 Numéro MDL: MFCD03410291 Clé InChI: NENDHUHGFRLXEN-UHFFFAOYSA-M Synonyme: rhodium 3+ ion acetate CID PubChem: 3660445 Nom IUPAC: acetic acid;rhodium SMILES: [Rh].CC([O-])=O
| Poids moléculaire (g/mol) | 161.95 |
|---|---|
| Synonyme | rhodium 3+ ion acetate |
| Numéro MDL | MFCD03410291 |
| CAS | 42204-14-8 |
| CID PubChem | 3660445 |
| Nom IUPAC | acetic acid;rhodium |
| Clé InChI | NENDHUHGFRLXEN-UHFFFAOYSA-M |
| SMILES | [Rh].CC([O-])=O |
| Formule moléculaire | C2H3O2Rh |
Hydrogen peroxide, for analysis, 35 wt.% solution in water, stabilized
CAS: 7722-84-1 Formule moléculaire: H2O2 Poids moléculaire (g/mol): 34 Numéro MDL: MFCD00011333 Clé InChI: MHAJPDPJQMAIIY-UHFFFAOYSA-N Synonyme: oxydol,perhydrol,superoxol,interox,hydrogen dioxide,inhibine,peroxaan,albone,hioxyl,kastone CID PubChem: 784 ChEBI: CHEBI:16240 Nom IUPAC: hydrogen peroxide SMILES: OO
| Poids moléculaire (g/mol) | 34 |
|---|---|
| Synonyme | oxydol,perhydrol,superoxol,interox,hydrogen dioxide,inhibine,peroxaan,albone,hioxyl,kastone |
| Numéro MDL | MFCD00011333 |
| CAS | 7722-84-1 |
| CID PubChem | 784 |
| ChEBI | CHEBI:16240 |
| Nom IUPAC | hydrogen peroxide |
| Clé InChI | MHAJPDPJQMAIIY-UHFFFAOYSA-N |
| SMILES | OO |
| Formule moléculaire | H2O2 |
Sodium bromide, 99+% (dry wt.), water <1.0%
CAS: 7647-15-6 Formule moléculaire: BrNa Poids moléculaire (g/mol): 102.89 Numéro MDL: MFCD00003475 Clé InChI: JHJLBTNAGRQEKS-UHFFFAOYSA-M Synonyme: sodium bromide,bromide salt of sodium,sodium bromide nabr,sedoneural,sodiumbromide,trisodium tribromide,bromnatrium,nabr,bromnatrium german,caswell no. 750a CID PubChem: 253881 ChEBI: CHEBI:63004 SMILES: [Na+].[Br-]
| Poids moléculaire (g/mol) | 102.89 |
|---|---|
| Synonyme | sodium bromide,bromide salt of sodium,sodium bromide nabr,sedoneural,sodiumbromide,trisodium tribromide,bromnatrium,nabr,bromnatrium german,caswell no. 750a |
| Numéro MDL | MFCD00003475 |
| CAS | 7647-15-6 |
| CID PubChem | 253881 |
| ChEBI | CHEBI:63004 |
| Clé InChI | JHJLBTNAGRQEKS-UHFFFAOYSA-M |
| SMILES | [Na+].[Br-] |
| Formule moléculaire | BrNa |