Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Magnesium Sulfate Anhydrous (Powder/Certified), Fisher Chemical™
CAS: 7487-88-9 Molecular Formula: MgO4S Molecular Weight (g/mol): 120.36 MDL Number: MFCD00011110 InChI Key: CSNNHWWHGAXBCP-UHFFFAOYSA-L Synonym: magnesium sulfate,magnesium sulphate,magnesium sulfate anhydrous,sulfuric acid magnesium salt 1:1,bitter salt,sal angalis,magnesium sulfate 1:1,mgso4,sal de sedlitz,tomix ot PubChem CID: 24083 ChEBI: CHEBI:32599 IUPAC Name: magnesium(2+) sulfate SMILES: [Mg++].[O-]S([O-])(=O)=O
| PubChem CID | 24083 |
|---|---|
| CAS | 7487-88-9 |
| Molecular Weight (g/mol) | 120.36 |
| ChEBI | CHEBI:32599 |
| MDL Number | MFCD00011110 |
| SMILES | [Mg++].[O-]S([O-])(=O)=O |
| Synonym | magnesium sulfate,magnesium sulphate,magnesium sulfate anhydrous,sulfuric acid magnesium salt 1:1,bitter salt,sal angalis,magnesium sulfate 1:1,mgso4,sal de sedlitz,tomix ot |
| IUPAC Name | magnesium(2+) sulfate |
| InChI Key | CSNNHWWHGAXBCP-UHFFFAOYSA-L |
| Molecular Formula | MgO4S |
Magnesium Chloride Hexahydrate, Fisher BioReagents
CAS: 7791-18-6 | Cl2H12MgO6 | 203.30 g/mol
| PubChem CID | 5360315 |
|---|---|
| CAS | 7791-18-6 |
| Molecular Weight (g/mol) | 203.30 |
| ChEBI | CHEBI:6636 |
| MDL Number | MFCD00011106 |
| SMILES | [Mg++].[Cl-].[Cl-] |
| Synonym | magnesium chloride,mgcl2,magnesium 2+ ion dichloride,chloromagnesite,magnesiumchlorid,magnesium ii chloride |
| IUPAC Name | magnesium;dichloride |
| InChI Key | TWRXJAOTZQYOKJ-UHFFFAOYSA-L |
| Molecular Formula | Cl2H12MgO6 |
Magnesium Chloride Hexahydrate (Crystalline/Certified ACS), Fisher Chemical™
CAS: 7791-18-6 Molecular Formula: Cl2H12MgO6 Molecular Weight (g/mol): 203.30 MDL Number: MFCD00149781 InChI Key: DHRRIBDTHFBPNG-UHFFFAOYSA-L IUPAC Name: magnesium(2+) hexahydrate dichloride SMILES: O.O.O.O.O.O.[Mg++].[Cl-].[Cl-]
| CAS | 7791-18-6 |
|---|---|
| Molecular Weight (g/mol) | 203.30 |
| MDL Number | MFCD00149781 |
| SMILES | O.O.O.O.O.O.[Mg++].[Cl-].[Cl-] |
| IUPAC Name | magnesium(2+) hexahydrate dichloride |
| InChI Key | DHRRIBDTHFBPNG-UHFFFAOYSA-L |
| Molecular Formula | Cl2H12MgO6 |
Phosphorus Pentoxide (Certified ACS), Fisher Chemical™
CAS: 1314-56-3 Molecular Formula: O5P2 Molecular Weight (g/mol): 141.94 MDL Number: MFCD00011440 InChI Key: DLYUQMMRRRQYAE-UHFFFAOYSA-N Synonym: Phosphoric Anhydride IUPAC Name: tricyclo[3.3.1.1³,⁷]tetraphosphoxane-1,3,5,7-tetrone SMILES: O=P12OP3(=O)OP(=O)(O1)OP(=O)(O2)O3
| CAS | 1314-56-3 |
|---|---|
| Molecular Weight (g/mol) | 141.94 |
| MDL Number | MFCD00011440 |
| SMILES | O=P12OP3(=O)OP(=O)(O1)OP(=O)(O2)O3 |
| Synonym | Phosphoric Anhydride |
| IUPAC Name | tricyclo[3.3.1.1³,⁷]tetraphosphoxane-1,3,5,7-tetrone |
| InChI Key | DLYUQMMRRRQYAE-UHFFFAOYSA-N |
| Molecular Formula | O5P2 |
Ferric Chloride Solution, 0.025% w/v (APHA), Fisher Chemical
CAS: 7705-08-0 Molecular Formula: Cl3Fe Molecular Weight (g/mol): 162.20 MDL Number: MFCD00011005 InChI Key: RBTARNINKXHZNM-UHFFFAOYSA-K Synonym: Iron (III) Chloride Solution, 0.025% w/v IUPAC Name: iron(3+) trichloride SMILES: [Cl-].[Cl-].[Cl-].[Fe+3]
| CAS | 7705-08-0 |
|---|---|
| Molecular Weight (g/mol) | 162.20 |
| MDL Number | MFCD00011005 |
| SMILES | [Cl-].[Cl-].[Cl-].[Fe+3] |
| Synonym | Iron (III) Chloride Solution, 0.025% w/v |
| IUPAC Name | iron(3+) trichloride |
| InChI Key | RBTARNINKXHZNM-UHFFFAOYSA-K |
| Molecular Formula | Cl3Fe |
Ferrous Ammonium Sulfate Hexahydrate (Crystalline/Certified ACS), Fisher Chemical™
CAS: 7783-85-9 Molecular Formula: FeH20N2O14S2 Molecular Weight (g/mol): 392.13 MDL Number: MFCD00150530 InChI Key: MQLVWQSVRZVNIP-UHFFFAOYSA-L Synonym: Mohr Salt,Iron (II) Ammonium Sulfate Hexahydrate IUPAC Name: λ²-iron(2+) diammonium hexahydrate disulfate SMILES: [NH4+].[NH4+].O.O.O.O.O.O.[Fe++].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O
| CAS | 7783-85-9 |
|---|---|
| Molecular Weight (g/mol) | 392.13 |
| MDL Number | MFCD00150530 |
| SMILES | [NH4+].[NH4+].O.O.O.O.O.O.[Fe++].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O |
| Synonym | Mohr Salt,Iron (II) Ammonium Sulfate Hexahydrate |
| IUPAC Name | λ²-iron(2+) diammonium hexahydrate disulfate |
| InChI Key | MQLVWQSVRZVNIP-UHFFFAOYSA-L |
| Molecular Formula | FeH20N2O14S2 |
Cupric Sulfate Pentahydrate (Fine Crystals/Certified ACS), Fisher Chemical™
CAS: 7758-99-8 Molecular Formula: CuH10O9S Molecular Weight (g/mol): 249.68 MDL Number: MFCD00149681 InChI Key: JZCCFEFSEZPSOG-UHFFFAOYSA-L Synonym: copper ii sulfate pentahydrate,copper sulfate pentahydrate,cupric sulfate pentahydrate,blue vitriol,calcanthite,bluestone,copper 2+ sulfate pentahydrate,triangle,vencedor,blue copperas PubChem CID: 24463 ChEBI: CHEBI:31440 IUPAC Name: copper(2+) pentahydrate sulfate SMILES: O.O.O.O.O.[Cu++].[O-]S([O-])(=O)=O
| PubChem CID | 24463 |
|---|---|
| CAS | 7758-99-8 |
| Molecular Weight (g/mol) | 249.68 |
| ChEBI | CHEBI:31440 |
| MDL Number | MFCD00149681 |
| SMILES | O.O.O.O.O.[Cu++].[O-]S([O-])(=O)=O |
| Synonym | copper ii sulfate pentahydrate,copper sulfate pentahydrate,cupric sulfate pentahydrate,blue vitriol,calcanthite,bluestone,copper 2+ sulfate pentahydrate,triangle,vencedor,blue copperas |
| IUPAC Name | copper(2+) pentahydrate sulfate |
| InChI Key | JZCCFEFSEZPSOG-UHFFFAOYSA-L |
| Molecular Formula | CuH10O9S |
Silver Nitrate (Crystalline/Certified ACS), Fisher Chemical™
CAS: 7761-88-8 Molecular Formula: AgNO3 Molecular Weight (g/mol): 169.87 MDL Number: MFCD00003414 InChI Key: SQGYOTSLMSWVJD-UHFFFAOYSA-N Synonym: silver nitrate,silvernitrate,lunar caustic,silbernitrat,argenti nitras,nitrate d'argent,nitric acid silver i salt,silver mononitrate,silver i nitrate,argerol PubChem CID: 24470 ChEBI: CHEBI:32130 IUPAC Name: silver(1+) nitrate SMILES: [Ag+].[O-][N+]([O-])=O
| PubChem CID | 24470 |
|---|---|
| CAS | 7761-88-8 |
| Molecular Weight (g/mol) | 169.87 |
| ChEBI | CHEBI:32130 |
| MDL Number | MFCD00003414 |
| SMILES | [Ag+].[O-][N+]([O-])=O |
| Synonym | silver nitrate,silvernitrate,lunar caustic,silbernitrat,argenti nitras,nitrate d'argent,nitric acid silver i salt,silver mononitrate,silver i nitrate,argerol |
| IUPAC Name | silver(1+) nitrate |
| InChI Key | SQGYOTSLMSWVJD-UHFFFAOYSA-N |
| Molecular Formula | AgNO3 |
Ferric Chloride Hexahydrate (Lumps/Certified ACS), Fisher Chemical™
CAS: 10025-77-1 Molecular Formula: Cl3FeH12O6 Molecular Weight (g/mol): 270.29 MDL Number: MFCD00149712 InChI Key: NQXWGWZJXJUMQB-UHFFFAOYSA-K Synonym: Iron (III) Chloride IUPAC Name: iron(3+) hexahydrate trichloride SMILES: O.O.O.O.O.O.[Cl-].[Cl-].[Cl-].[Fe+3]
| CAS | 10025-77-1 |
|---|---|
| Molecular Weight (g/mol) | 270.29 |
| MDL Number | MFCD00149712 |
| SMILES | O.O.O.O.O.O.[Cl-].[Cl-].[Cl-].[Fe+3] |
| Synonym | Iron (III) Chloride |
| IUPAC Name | iron(3+) hexahydrate trichloride |
| InChI Key | NQXWGWZJXJUMQB-UHFFFAOYSA-K |
| Molecular Formula | Cl3FeH12O6 |
Gold Chloride Trihydrate, Certified ACS, Fisher Chemical™
CAS: 16961-25-4 Molecular Formula: AuCl4H Molecular Weight (g/mol): 339.77 MDL Number: MFCD00149904 InChI Key: VDLSFRRYNGEBEJ-UHFFFAOYSA-K Synonym: Gold(III) chloride trihydrate, Tetrachloroauric acid trihydrate, Hydrogren tetrachloroaurate(III), Tetrachloroauric(III) acid, Chloroauric acid trihydrate IUPAC Name: trichlorogold hydrochloride SMILES: Cl.Cl[Au](Cl)Cl
| CAS | 16961-25-4 |
|---|---|
| Molecular Weight (g/mol) | 339.77 |
| MDL Number | MFCD00149904 |
| SMILES | Cl.Cl[Au](Cl)Cl |
| Synonym | Gold(III) chloride trihydrate, Tetrachloroauric acid trihydrate, Hydrogren tetrachloroaurate(III), Tetrachloroauric(III) acid, Chloroauric acid trihydrate |
| IUPAC Name | trichlorogold hydrochloride |
| InChI Key | VDLSFRRYNGEBEJ-UHFFFAOYSA-K |
| Molecular Formula | AuCl4H |
Manganese Sulfate Monohydrate (Crystalline/Certified ACS), Fisher Chemical™
CAS: 10034-96-5 Molecular Formula: H2MnO5S Molecular Weight (g/mol): 169.01 MDL Number: MFCD00149159 InChI Key: ISPYRSDWRDQNSW-UHFFFAOYSA-L Synonym: manganese sulfate monohydrate,manganese ii sulfate monohydrate,manganese sulfate hydrate,manganese ii sulfate hydrate,mnso4.h2o,manganous sulfate monohydrate,unii-w00lys4t26,manganese 2+ sulfate monohydrate,manganese sulfate usp,manganese 2+ sulfate hydrate PubChem CID: 177577 ChEBI: CHEBI:86364 IUPAC Name: manganese(2+) hydrate sulfate SMILES: O.[Mn++].[O-]S([O-])(=O)=O
| PubChem CID | 177577 |
|---|---|
| CAS | 10034-96-5 |
| Molecular Weight (g/mol) | 169.01 |
| ChEBI | CHEBI:86364 |
| MDL Number | MFCD00149159 |
| SMILES | O.[Mn++].[O-]S([O-])(=O)=O |
| Synonym | manganese sulfate monohydrate,manganese ii sulfate monohydrate,manganese sulfate hydrate,manganese ii sulfate hydrate,mnso4.h2o,manganous sulfate monohydrate,unii-w00lys4t26,manganese 2+ sulfate monohydrate,manganese sulfate usp,manganese 2+ sulfate hydrate |
| IUPAC Name | manganese(2+) hydrate sulfate |
| InChI Key | ISPYRSDWRDQNSW-UHFFFAOYSA-L |
| Molecular Formula | H2MnO5S |
Ferrous Sulfate Heptahydrate (Crystalline), ACS Grade, Fisher Chemical™
CAS: 7782-63-0 Molecular Formula: FeH14O11S Molecular Weight (g/mol): 278.01 MDL Number: MFCD00149719 InChI Key: SURQXAFEQWPFPV-UHFFFAOYSA-L Synonym: iron ii sulfate heptahydrate,ferrous sulfate heptahydrate,presfersul,melanterite mineral,iron sulfate heptahydrate,iron 2+ sulfate heptahydrate,fesofor,fesotyme,haemofort,ironate PubChem CID: 62662 ChEBI: CHEBI:75836 IUPAC Name: λ²-iron(2+) heptahydrate sulfate SMILES: O.O.O.O.O.O.O.[Fe++].[O-]S([O-])(=O)=O
| PubChem CID | 62662 |
|---|---|
| CAS | 7782-63-0 |
| Molecular Weight (g/mol) | 278.01 |
| ChEBI | CHEBI:75836 |
| MDL Number | MFCD00149719 |
| SMILES | O.O.O.O.O.O.O.[Fe++].[O-]S([O-])(=O)=O |
| Synonym | iron ii sulfate heptahydrate,ferrous sulfate heptahydrate,presfersul,melanterite mineral,iron sulfate heptahydrate,iron 2+ sulfate heptahydrate,fesofor,fesotyme,haemofort,ironate |
| IUPAC Name | λ²-iron(2+) heptahydrate sulfate |
| InChI Key | SURQXAFEQWPFPV-UHFFFAOYSA-L |
| Molecular Formula | FeH14O11S |
Sand, Ottawa (For Cement Testing), Fisher Chemical™
CAS: 14808-60-7 Molecular Formula: O2Si Molecular Weight (g/mol): 60.08 MDL Number: MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 InChI Key: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Synonym: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 IUPAC Name: silanedione SMILES: O=[Si]=O
| PubChem CID | 24261 |
|---|---|
| CAS | 14808-60-7 |
| Molecular Weight (g/mol) | 60.08 |
| ChEBI | CHEBI:30563 |
| MDL Number | MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 |
| SMILES | O=[Si]=O |
| Synonym | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
| IUPAC Name | silanedione |
| InChI Key | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
| Molecular Formula | O2Si |
Zinc Acetate Dihydrate (Cryst./Certified), Fisher Chemical
CAS: 5970-45-6 Molecular Formula: C4H10O6Zn Molecular Weight (g/mol): 219.498 MDL Number: MFCD00066961 InChI Key: BEAZKUGSCHFXIQ-UHFFFAOYSA-L Synonym: zinc acetate dihydrate,zinc diacetate dihydrate,zinc ii acetate dihydrate,unii-fm5526k07a,acetic acid zinc salt,zinc acetate usp,acetic acid, zinc salt, dihydrate,zinc acetate, dihydrate,galzin tn PubChem CID: 2724192 IUPAC Name: zinc;diacetate;dihydrate SMILES: CC(=O)[O-].CC(=O)[O-].O.O.[Zn+2]
| PubChem CID | 2724192 |
|---|---|
| CAS | 5970-45-6 |
| Molecular Weight (g/mol) | 219.498 |
| MDL Number | MFCD00066961 |
| SMILES | CC(=O)[O-].CC(=O)[O-].O.O.[Zn+2] |
| Synonym | zinc acetate dihydrate,zinc diacetate dihydrate,zinc ii acetate dihydrate,unii-fm5526k07a,acetic acid zinc salt,zinc acetate usp,acetic acid, zinc salt, dihydrate,zinc acetate, dihydrate,galzin tn |
| IUPAC Name | zinc;diacetate;dihydrate |
| InChI Key | BEAZKUGSCHFXIQ-UHFFFAOYSA-L |
| Molecular Formula | C4H10O6Zn |