Acids
Organic and inorganic acids suitable for a wide variety of laboratory applications. Products are available in solid and liquid forms and in various pH values, quantities, reagent grades, and purities.
Acids are defined as substances that have a sour taste, a low pH (<7), and cause litmus paper to turn red. They also react with bases (yielding water and ionic compounds called salts) and produce hydrogen gas when used to dissolve metals such as zinc and iron.
Chemically, an acid is a molecule or ion that acts as a proton or hydrogen ion donor (Brønsted-Lowry acid) in a non-aqueous solution. In water, acids form hydronium ions (H3O+).
An acid is alternatively defined as a molecule or ion that accepts an electron pair (Lewis acid). One example is trifluoroborane, which has a boron atom capable of accepting an electron pair from ammonia (NH3) to form NH3-BF3.
Common inorganic acids include hydrochloric, sulfuric, nitric, and phosphoric acids. Common organic acids include acetic, benzoic, citric, and lactic acids.
In the laboratory, acids are used as reagents or catalysts in many types of chemical reactions.
Strong acids, such as sulfuric and hydrochloric acid, are highly corrosive and have extensive commercial applications.
- Sulfuric acid is used to process petroleum and minerals and to make other chemicals like nitric acid
- Hydrochloric acid is used to pickle steel and other metals
- Some acids are used as neutralizers to produce salts; for example, ammonium nitrate is produced by the reaction of nitric acid with ammonia
- Many acids are also used in the food and beverage industry
Do you need bulk and custom chemical solutions? Ask our Fisher Scientific Chemical Specialists.
Résultats de la recherche filtrée
Lactic Acid (USP/FCC), Fisher Chemical
CAS: 50-21-5 Formule moléculaire: C3H6O3 Poids moléculaire (g/mol): 90.08 Numéro MDL: MFCD00004520 Clé InChI: JVTAAEKCZFNVCJ-UHFFFAOYNA-N Synonyme: lactic acid,dl-lactic acid,2-hydroxypropionic acid,milk acid,lactate,polylactic acid,ethylidenelactic acid,lactovagan,tonsillosan,acidum lacticum CID PubChem: 612 ChEBI: CHEBI:78320 Nom IUPAC: 2-hydroxypropanoic acid SMILES: CC(O)C(O)=O
| Poids moléculaire (g/mol) | 90.08 |
|---|---|
| Synonyme | lactic acid,dl-lactic acid,2-hydroxypropionic acid,milk acid,lactate,polylactic acid,ethylidenelactic acid,lactovagan,tonsillosan,acidum lacticum |
| Numéro MDL | MFCD00004520 |
| CAS | 50-21-5 |
| CID PubChem | 612 |
| ChEBI | CHEBI:78320 |
| Nom IUPAC | 2-hydroxypropanoic acid |
| Clé InChI | JVTAAEKCZFNVCJ-UHFFFAOYNA-N |
| SMILES | CC(O)C(O)=O |
| Formule moléculaire | C3H6O3 |
Citric Acid Monohydrate (Granular/USP), Fisher Chemical™
CAS: 5949-29-1 Formule moléculaire: C6H10O8 Poids moléculaire (g/mol): 210.138 Numéro MDL: MFCD00149972 Clé InChI: YASYEJJMZJALEJ-UHFFFAOYSA-N Synonyme: citric acid monohydrate,citric acid hydrate,2-hydroxypropane-1,2,3-tricarboxylic acid hydrate,citric acid, monohydrate,unii-2968phw8qp,1,2,3-propanetricarboxylic acid, 2-hydroxy-, monohydrate,citrate,acidum citricum monohydricum,citric acid monohydrate usp CID PubChem: 22230 ChEBI: CHEBI:31404 Nom IUPAC: 2-hydroxypropane-1,2,3-tricarboxylic acid;hydrate SMILES: C(C(=O)O)C(CC(=O)O)(C(=O)O)O.O
| Poids moléculaire (g/mol) | 210.138 |
|---|---|
| Synonyme | citric acid monohydrate,citric acid hydrate,2-hydroxypropane-1,2,3-tricarboxylic acid hydrate,citric acid, monohydrate,unii-2968phw8qp,1,2,3-propanetricarboxylic acid, 2-hydroxy-, monohydrate,citrate,acidum citricum monohydricum,citric acid monohydrate usp |
| Numéro MDL | MFCD00149972 |
| CAS | 5949-29-1 |
| CID PubChem | 22230 |
| ChEBI | CHEBI:31404 |
| Nom IUPAC | 2-hydroxypropane-1,2,3-tricarboxylic acid;hydrate |
| Clé InChI | YASYEJJMZJALEJ-UHFFFAOYSA-N |
| SMILES | C(C(=O)O)C(CC(=O)O)(C(=O)O)O.O |
| Formule moléculaire | C6H10O8 |
Citric Acid, Anhydrous (Crystalline/USP), Fisher Chemical™
CAS: 77-92-9 Formule moléculaire: C6H8O7 Poids moléculaire (g/mol): 192.12 Numéro MDL: MFCD00011669 Clé InChI: KRKNYBCHXYNGOX-UHFFFAOYSA-N Synonyme: citric acid,citric acid, anhydrous,citro,anhydrous citric acid,citrate,aciletten,citretten,chemfill,hydrocerol a,1,2,3-propanetricarboxylic acid, 2-hydroxy CID PubChem: 311 ChEBI: CHEBI:30769 Nom IUPAC: 2-hydroxypropane-1,2,3-tricarboxylic acid SMILES: OC(=O)CC(O)(CC(O)=O)C(O)=O
| Poids moléculaire (g/mol) | 192.12 |
|---|---|
| Synonyme | citric acid,citric acid, anhydrous,citro,anhydrous citric acid,citrate,aciletten,citretten,chemfill,hydrocerol a,1,2,3-propanetricarboxylic acid, 2-hydroxy |
| Numéro MDL | MFCD00011669 |
| CAS | 77-92-9 |
| CID PubChem | 311 |
| ChEBI | CHEBI:30769 |
| Nom IUPAC | 2-hydroxypropane-1,2,3-tricarboxylic acid |
| Clé InChI | KRKNYBCHXYNGOX-UHFFFAOYSA-N |
| SMILES | OC(=O)CC(O)(CC(O)=O)C(O)=O |
| Formule moléculaire | C6H8O7 |
Acetic Acid, Glacial (USP/FCC), Fisher Chemical
CAS: 64-19-7 Formule moléculaire: C2H4O2 Poids moléculaire (g/mol): 60.05 Numéro MDL: MFCD00036152 Clé InChI: QTBSBXVTEAMEQO-UHFFFAOYSA-N Synonyme: ethanoic acid,ethylic acid,acetic acid, glacial,methanecarboxylic acid,vinegar acid,glacial,acetasol,acide acetique,essigsaeure CID PubChem: 176 ChEBI: CHEBI:15366 Nom IUPAC: acetic acid SMILES: CC(O)=O
| Poids moléculaire (g/mol) | 60.05 |
|---|---|
| Synonyme | ethanoic acid,ethylic acid,acetic acid, glacial,methanecarboxylic acid,vinegar acid,glacial,acetasol,acide acetique,essigsaeure |
| Numéro MDL | MFCD00036152 |
| CAS | 64-19-7 |
| CID PubChem | 176 |
| ChEBI | CHEBI:15366 |
| Nom IUPAC | acetic acid |
| Clé InChI | QTBSBXVTEAMEQO-UHFFFAOYSA-N |
| SMILES | CC(O)=O |
| Formule moléculaire | C2H4O2 |
| Poids moléculaire (g/mol) | 60.05 |
|---|---|
| Synonyme | ethanoic acid,ethylic acid,acetic acid, glacial,methanecarboxylic acid,vinegar acid,glacial,acetasol,acide acetique,essigsaeure |
| Numéro MDL | MFCD00036152 |
| CAS | 64-19-7 |
| CID PubChem | 176 |
| ChEBI | CHEBI:15366 |
| Nom IUPAC | acetic acid |
| Clé InChI | QTBSBXVTEAMEQO-UHFFFAOYSA-N |
| SMILES | CC(O)=O |
| Formule moléculaire | C2H4O2 |
Citric Acid, 10% (w/v) from USP grade material, Ricca Chemical
CAS: 7732-18-5 Formule moléculaire: C6H8O7 Poids moléculaire (g/mol): Mixture Numéro MDL: MFCD00011669 Clé InChI: KRKNYBCHXYNGOX-UHFFFAOYSA-N Synonyme: citric acid,citric acid, anhydrous,citro,anhydrous citric acid,citrate,aciletten,citretten,chemfill,hydrocerol a,1,2,3-propanetricarboxylic acid, 2-hydroxy CID PubChem: 311 ChEBI: CHEBI:30769 Nom IUPAC: 2-hydroxypropane-1,2,3-tricarboxylic acid SMILES: OC(=O)CC(O)(CC(O)=O)C(O)=O
| Poids moléculaire (g/mol) | Mixture |
|---|---|
| Synonyme | citric acid,citric acid, anhydrous,citro,anhydrous citric acid,citrate,aciletten,citretten,chemfill,hydrocerol a,1,2,3-propanetricarboxylic acid, 2-hydroxy |
| Numéro MDL | MFCD00011669 |
| CAS | 7732-18-5 |
| CID PubChem | 311 |
| ChEBI | CHEBI:30769 |
| Nom IUPAC | 2-hydroxypropane-1,2,3-tricarboxylic acid |
| Clé InChI | KRKNYBCHXYNGOX-UHFFFAOYSA-N |
| SMILES | OC(=O)CC(O)(CC(O)=O)C(O)=O |
| Formule moléculaire | C6H8O7 |
Acetic Acid (glacial), 100%, EMPROVE™ ESSENTIAL Ph Eur, BP, JP, USP, E 260, MilliporeSigma™
CAS: 64-19-7 Formule moléculaire: C2H4O2 Poids moléculaire (g/mol): 60.05 Synonyme: Ethanoic acid
| Poids moléculaire (g/mol) | 60.05 |
|---|---|
| Synonyme | Ethanoic acid |
| CAS | 64-19-7 |
| Formule moléculaire | C2H4O2 |
Sodium Acetate, Anhydrous, USP, 99-101%, Spectrum™ Chemical
CAS: 127-09-3 Formule moléculaire: C2H3NaO2 Poids moléculaire (g/mol): 82.03 Numéro MDL: MFCD00012459 Clé InChI: VMHLLURERBWHNL-UHFFFAOYSA-M Nom IUPAC: sodium acetate SMILES: [Na+].CC([O-])=O
| Poids moléculaire (g/mol) | 82.03 |
|---|---|
| Numéro MDL | MFCD00012459 |
| CAS | 127-09-3 |
| Nom IUPAC | sodium acetate |
| Clé InChI | VMHLLURERBWHNL-UHFFFAOYSA-M |
| SMILES | [Na+].CC([O-])=O |
| Formule moléculaire | C2H3NaO2 |
Salicylic Acid, Crystal, USP, 98-102%, Spectrum™ Chemical
CAS: 69-72-7 Formule moléculaire: C7H6O3 Poids moléculaire (g/mol): 138.12 Numéro MDL: MFCD00002439 Clé InChI: YGSDEFSMJLZEOE-UHFFFAOYSA-N Nom IUPAC: 2-hydroxybenzoic acid SMILES: OC(=O)C1=CC=CC=C1O
| Poids moléculaire (g/mol) | 138.12 |
|---|---|
| Numéro MDL | MFCD00002439 |
| CAS | 69-72-7 |
| Nom IUPAC | 2-hydroxybenzoic acid |
| Clé InChI | YGSDEFSMJLZEOE-UHFFFAOYSA-N |
| SMILES | OC(=O)C1=CC=CC=C1O |
| Formule moléculaire | C7H6O3 |
Salicylic Acid, Powder, USP, 98-102%, Spectrum™ Chemical
CAS: 69-72-7 Formule moléculaire: C7H6O3 Poids moléculaire (g/mol): 138.12 Numéro MDL: MFCD00002439 Clé InChI: YGSDEFSMJLZEOE-UHFFFAOYSA-N Nom IUPAC: 2-hydroxybenzoic acid SMILES: OC(=O)C1=CC=CC=C1O
| Poids moléculaire (g/mol) | 138.12 |
|---|---|
| Numéro MDL | MFCD00002439 |
| CAS | 69-72-7 |
| Nom IUPAC | 2-hydroxybenzoic acid |
| Clé InChI | YGSDEFSMJLZEOE-UHFFFAOYSA-N |
| SMILES | OC(=O)C1=CC=CC=C1O |
| Formule moléculaire | C7H6O3 |
Lactic Acid, Racemic, USP, 88-92%, Spectrum™ Chemical
CAS: 50-21-5 Formule moléculaire: C3H6O3 Poids moléculaire (g/mol): 90.08 Numéro MDL: MFCD00004520 Clé InChI: JVTAAEKCZFNVCJ-UHFFFAOYNA-N Nom IUPAC: 2-hydroxypropanoic acid SMILES: CC(O)C(O)=O
| Poids moléculaire (g/mol) | 90.08 |
|---|---|
| Numéro MDL | MFCD00004520 |
| CAS | 50-21-5 |
| Nom IUPAC | 2-hydroxypropanoic acid |
| Clé InChI | JVTAAEKCZFNVCJ-UHFFFAOYNA-N |
| SMILES | CC(O)C(O)=O |
| Formule moléculaire | C3H6O3 |
Glacial Acetic Acid, USP, 99.5-100.5%, Spectrum™ Chemical
CAS: 64-19-7 Formule moléculaire: C2H4O2 Poids moléculaire (g/mol): 60.05 Numéro MDL: MFCD00036152 Clé InChI: QTBSBXVTEAMEQO-UHFFFAOYSA-N Nom IUPAC: acetic acid SMILES: CC(O)=O
| Poids moléculaire (g/mol) | 60.05 |
|---|---|
| Numéro MDL | MFCD00036152 |
| CAS | 64-19-7 |
| Nom IUPAC | acetic acid |
| Clé InChI | QTBSBXVTEAMEQO-UHFFFAOYSA-N |
| SMILES | CC(O)=O |
| Formule moléculaire | C2H4O2 |
Hydrochloric Acid, USP™, Titripur™, MilliporeSigma™,
CAS: 7647-01-0 Formule moléculaire: ClH Poids moléculaire (g/mol): 36.46 Numéro MDL: MFCD00011324 MFCD00792839 Clé InChI: VEXZGXHMUGYJMC-UHFFFAOYSA-N Synonyme: hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid,chloorwaterstof CID PubChem: 313 ChEBI: CHEBI:17883 Nom IUPAC: hydrogen chloride SMILES: Cl
| Poids moléculaire (g/mol) | 36.46 |
|---|---|
| Synonyme | hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid,chloorwaterstof |
| Numéro MDL | MFCD00011324 MFCD00792839 |
| CAS | 7647-01-0 |
| CID PubChem | 313 |
| ChEBI | CHEBI:17883 |
| Nom IUPAC | hydrogen chloride |
| Clé InChI | VEXZGXHMUGYJMC-UHFFFAOYSA-N |
| SMILES | Cl |
| Formule moléculaire | ClH |
Sodium Acetate, Trihydrate, Granular, USP, 99-101%, Spectrum™ Chemical
CAS: 6131-90-4 Formule moléculaire: C2H9NaO5 Poids moléculaire (g/mol): 136.08 Clé InChI: AYRVGWHSXIMRAB-UHFFFAOYSA-M Nom IUPAC: sodium acetate trihydrate SMILES: O.O.O.[Na+].CC([O-])=O
| Poids moléculaire (g/mol) | 136.08 |
|---|---|
| CAS | 6131-90-4 |
| Nom IUPAC | sodium acetate trihydrate |
| Clé InChI | AYRVGWHSXIMRAB-UHFFFAOYSA-M |
| SMILES | O.O.O.[Na+].CC([O-])=O |
| Formule moléculaire | C2H9NaO5 |
Anhydrous Citric Acid, Granular, USP, 99.5-100.5%, Spectrum™ Chemical
CAS: 77-92-9 Formule moléculaire: C6H8O7 Poids moléculaire (g/mol): 192.12 Numéro MDL: MFCD00011669 Clé InChI: KRKNYBCHXYNGOX-UHFFFAOYSA-N Nom IUPAC: 2-hydroxypropane-1,2,3-tricarboxylic acid SMILES: OC(=O)CC(O)(CC(O)=O)C(O)=O
| Poids moléculaire (g/mol) | 192.12 |
|---|---|
| Numéro MDL | MFCD00011669 |
| CAS | 77-92-9 |
| Nom IUPAC | 2-hydroxypropane-1,2,3-tricarboxylic acid |
| Clé InChI | KRKNYBCHXYNGOX-UHFFFAOYSA-N |
| SMILES | OC(=O)CC(O)(CC(O)=O)C(O)=O |
| Formule moléculaire | C6H8O7 |