Organo-Metalloid Compounds
- (6)
- (89)
- (11)
- (1)
- (14)
- (15)
- (3)
- (50)
- (5)
- (2)
- (2)
- (7)
- (3)
- (16)
- (2)
- (2)
- (4)
- (2)
- (4)
- (12)
- (2)
- (11)
- (3)
- (11)
- (8)
- (64)
- (2)
- (3)
- (3)
- (3)
- (1)
- (7)
- (3)
- (8)
- (3)
- (1)
- (2)
- (10)
- (5)
- (2)
Résultats de la recherche filtrée
LiChropur™ N-Methyl-N-trimethylsilyltrifluoroacetamide Activated I, For GC Derivatization, MilliporeSigma™ Supelco™
Activated with Ethanethiol and Ammonium iodide
| Synonyme | MSTFA activated I |
|---|---|
| Qualité | For GC derivatization |
| Conditionnement | Clear Glass Bottle |
| Indice de réfraction | n20/D 1.380 |
2-(4-Chlorosulfonylphenyl)ethyltrimethoxysilane, 50% solution in dichloromethane
CAS: 126519-89-9 Formule moléculaire: C11H17ClO5SSi Poids moléculaire (g/mol): 324.85 Numéro MDL: MFCD00054774 Clé InChI: NYIDSUMRGUILGR-UHFFFAOYSA-N Synonyme: 2-4-chlorosulfonylphenyl ethyltrimethoxysilane,4-2-trimethoxysilylethyl benzenesulfonyl chloride,4-2-trimethoxysilyl ethyl benzene-1-sulfonyl chloride,benzenesulfonylchloride, 4-2-trimethoxysilyl ethyl,2-4-chlorosulfonylphenyl ethyltrimethoxysilane in methylene chloride, has free sulfonic acid,4-2-trimethoxysilyl ethyl benzenesulfonyl chloride,acmc-20ete8,4-chlorosulfonyl phenethyltrimethoxysilane CID PubChem: 2733807 Nom IUPAC: 4-(2-trimethoxysilylethyl)benzenesulfonyl chloride SMILES: CO[Si](CCC1=CC=C(C=C1)S(Cl)(=O)=O)(OC)OC
| Poids moléculaire (g/mol) | 324.85 |
|---|---|
| Synonyme | 2-4-chlorosulfonylphenyl ethyltrimethoxysilane,4-2-trimethoxysilylethyl benzenesulfonyl chloride,4-2-trimethoxysilyl ethyl benzene-1-sulfonyl chloride,benzenesulfonylchloride, 4-2-trimethoxysilyl ethyl,2-4-chlorosulfonylphenyl ethyltrimethoxysilane in methylene chloride, has free sulfonic acid,4-2-trimethoxysilyl ethyl benzenesulfonyl chloride,acmc-20ete8,4-chlorosulfonyl phenethyltrimethoxysilane |
| Numéro MDL | MFCD00054774 |
| CAS | 126519-89-9 |
| CID PubChem | 2733807 |
| Nom IUPAC | 4-(2-trimethoxysilylethyl)benzenesulfonyl chloride |
| Clé InChI | NYIDSUMRGUILGR-UHFFFAOYSA-N |
| SMILES | CO[Si](CCC1=CC=C(C=C1)S(Cl)(=O)=O)(OC)OC |
| Formule moléculaire | C11H17ClO5SSi |
Lithium bis(trimethylsilyl)amide, 1.0M sol. in methyl tert-butyl ether, AcroSeal™
CAS: 4039-32-1 | C6H18LiNSi2 | 167.33 g/mol
| Poids moléculaire (g/mol) | 167.33 |
|---|---|
| Note relative au nom | 1.0M Solution in Methyl tert-Butyl Ether |
| Danger pour la santé 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Wear protective gloves/protective clothing/eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove conta |
| Danger pour la santé 1 | GHS Signal Word: Danger |
| Danger pour la santé 2 | GHS H Statement Causes severe skin burns and eye damage. Highly flammable liquid and vapor. Reacts violently with water. |
| SMILES | [Li+].C[Si](C)(C)[N-][Si](C)(C)C |
| Point d’ébullition | 55.0°C to 56.0°C |
| Forme physique | Solution |
| Poids de la formule | 167.33 |
| Gravité spécifique | 0.8 |
| Formule moléculaire | C6H18LiNSi2 |
| Point d’éclair | −28°C |
| Couleur | Brown to Yellow |
| Synonyme | lithium bis trimethylsilyl amide,lithium hexamethyldisilazide,lihmds,lhmds,hexamethyldisilazane lithium salt,unii-rc4n1i108m,lithiumbis trimethylsilyl amide,lithium bis trimethylsilyl azanide,lithium hexamethyldisilazane,lithium bis-trimethylsilyl amide |
| Numéro MDL | MFCD00008261 |
| Nom chimique ou matériau | Lithium bis(trimethylsilyl)amide |
| Fieser | 04,296; 05,393; 07,197; 12,280; 13,165; 14,194 |
| Numéro EINECS | 223-725-6 |
| CAS | 1634-04-4 |
| CID PubChem | 2733832 |
| Nom IUPAC | lithium;bis(trimethylsilyl)azanide |
| Clé InChI | YNESATAKKCNGOF-UHFFFAOYSA-N |
| TSCA | TSCA |
| Densité | 0.8000g/mL |
| Pourcentage de pureté | 21 to 25% active base (as LiNSi) |
Dimethoxydimethylsilane, 95+%, AcroSeal™
CAS: 1112-39-6 Formule moléculaire: C4H12O2Si Poids moléculaire (g/mol): 120.22 Numéro MDL: MFCD00025691 Clé InChI: JJQZDUKDJDQPMQ-UHFFFAOYSA-N Synonyme: dimethyldimethoxysilane,silane, dimethoxydimethyl,kbm 22,unii-a3qdb1rs1c,dimethyl dimethoxysilane,dimethoxy dimethyl silane,a3qdb1rs1c,dimethoxy-dimethylsilane,dimethyl dimethoxy silane,dimethyl dimethoxy silicane CID PubChem: 66187 Nom IUPAC: dimethoxydimethylsilane SMILES: CO[Si](C)(C)OC
| Poids moléculaire (g/mol) | 120.22 |
|---|---|
| Synonyme | dimethyldimethoxysilane,silane, dimethoxydimethyl,kbm 22,unii-a3qdb1rs1c,dimethyl dimethoxysilane,dimethoxy dimethyl silane,a3qdb1rs1c,dimethoxy-dimethylsilane,dimethyl dimethoxy silane,dimethyl dimethoxy silicane |
| Numéro MDL | MFCD00025691 |
| CAS | 1112-39-6 |
| CID PubChem | 66187 |
| Nom IUPAC | dimethoxydimethylsilane |
| Clé InChI | JJQZDUKDJDQPMQ-UHFFFAOYSA-N |
| SMILES | CO[Si](C)(C)OC |
| Formule moléculaire | C4H12O2Si |
Sodium tetraethylborate, 97%, pure, Thermo Scientific Chemicals
CAS: 15523-24-7 Formule moléculaire: C8H20BNa Poids moléculaire (g/mol): 150.04 Numéro MDL: MFCD00061547 Clé InChI: SZSBMTRYJRHYNI-UHFFFAOYSA-N Synonyme: sodium tetraethylborate,sodium tetraethylboranuide,borate 1-,tetraethyl-, sodium 1:1,sodium tetraethylborate 1-,et4bna,sodiotetraethylboron v,borate 1-, tetraethyl-, sodium,sodium tetraethylborate 1g CID PubChem: 23681030 Nom IUPAC: sodium;tetraethylboranuide SMILES: [B-](CC)(CC)(CC)CC.[Na+]
| Poids moléculaire (g/mol) | 150.04 |
|---|---|
| Synonyme | sodium tetraethylborate,sodium tetraethylboranuide,borate 1-,tetraethyl-, sodium 1:1,sodium tetraethylborate 1-,et4bna,sodiotetraethylboron v,borate 1-, tetraethyl-, sodium,sodium tetraethylborate 1g |
| Numéro MDL | MFCD00061547 |
| CAS | 15523-24-7 |
| CID PubChem | 23681030 |
| Nom IUPAC | sodium;tetraethylboranuide |
| Clé InChI | SZSBMTRYJRHYNI-UHFFFAOYSA-N |
| SMILES | [B-](CC)(CC)(CC)CC.[Na+] |
| Formule moléculaire | C8H20BNa |
(Trifluoromethyl)trimethylsilane, 0.5M solution in THF
CAS: 81290-20-2 Formule moléculaire: C5H11F3Si Poids moléculaire (g/mol): 156.22 Numéro MDL: MFCD00145454 Clé InChI: MTYSDPUZDZURPP-UHFFFAOYSA-N Synonyme: trifluoromethyl trimethylsilane,trimethyl trifluoromethyl silane,trifluoromethyltrimethylsilane,ruppert's reagent,tms-cf3,tfmtms,silane, trimethyl trifluoromethyl,unii-a009786qpj,trimethylsilyl trifluoromethane,ruppert-prakash reagent CID PubChem: 552549 SMILES: CC(C)(C)[SiH2]C(F)(F)F
| Poids moléculaire (g/mol) | 156.22 |
|---|---|
| Synonyme | trifluoromethyl trimethylsilane,trimethyl trifluoromethyl silane,trifluoromethyltrimethylsilane,ruppert's reagent,tms-cf3,tfmtms,silane, trimethyl trifluoromethyl,unii-a009786qpj,trimethylsilyl trifluoromethane,ruppert-prakash reagent |
| Numéro MDL | MFCD00145454 |
| CAS | 81290-20-2 |
| CID PubChem | 552549 |
| Clé InChI | MTYSDPUZDZURPP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[SiH2]C(F)(F)F |
| Formule moléculaire | C5H11F3Si |
(1-Ethoxycyclopropoxy)trimethylsilane, 97%
CAS: 27374-25-0 Formule moléculaire: C8H18O2Si Poids moléculaire (g/mol): 174.32 Numéro MDL: MFCD00074986 Clé InChI: BZMMRNKDONDVIB-UHFFFAOYSA-N Synonyme: 1-ethoxycyclopropoxy trimethylsilane,cyclopropanone ethyl trimethylsilyl acetal,1-ethoxycyclopropyloxy trimethylsilane,1-ethoxy-1-trimethylsiloxylcyclopropane,1-ethoxycyclopropyl oxy-trimethylsilane,1-ethoxycyclopropyl-oxy trimethylsilane,silane, 1-ethoxycyclopropyl oxy trimethyl,1-ethoxycyclopropyl oxy trimethylsilan,1-ethoxycyclopropyl oxy trimethylsilane CID PubChem: 2734686 Nom IUPAC: (1-ethoxycyclopropyl)oxy-trimethylsilane SMILES: CCOC1(CC1)O[Si](C)(C)C
| Poids moléculaire (g/mol) | 174.32 |
|---|---|
| Synonyme | 1-ethoxycyclopropoxy trimethylsilane,cyclopropanone ethyl trimethylsilyl acetal,1-ethoxycyclopropyloxy trimethylsilane,1-ethoxy-1-trimethylsiloxylcyclopropane,1-ethoxycyclopropyl oxy-trimethylsilane,1-ethoxycyclopropyl-oxy trimethylsilane,silane, 1-ethoxycyclopropyl oxy trimethyl,1-ethoxycyclopropyl oxy trimethylsilan,1-ethoxycyclopropyl oxy trimethylsilane |
| Numéro MDL | MFCD00074986 |
| CAS | 27374-25-0 |
| CID PubChem | 2734686 |
| Nom IUPAC | (1-ethoxycyclopropyl)oxy-trimethylsilane |
| Clé InChI | BZMMRNKDONDVIB-UHFFFAOYSA-N |
| SMILES | CCOC1(CC1)O[Si](C)(C)C |
| Formule moléculaire | C8H18O2Si |
Bis(trimethylsilyl)carbodiimide, 98%
CAS: 1000-70-0 Formule moléculaire: C7H18N2Si2 Poids moléculaire (g/mol): 186.4 Numéro MDL: MFCD00051538 Clé InChI: KSVMTHKYDGMXFJ-UHFFFAOYSA-N Synonyme: bis trimethylsilyl carbodiimide,carbodiimide, bis trimethylsilyl,n,n'-methanediylidenebis 1,1,1-trimethylsilanamine,silanamine, n,n'-methanetetraylbis 1,1,1-trimethyl,1,3-bis trimethylsilyl carbodiimide,n,n'-bis trimethylsilyl carbodiimide,n,n'-methane tetraylbis 1,1,1-trimethylsilanamine,carbodiimide, bis trimethylsilyl-7ci,8ci,n,n'-methanetetraylbis 1,1,1-trimethylsilylamine CID PubChem: 70473 Nom IUPAC: N,N'-bis(trimethylsilyl)methanediimine SMILES: C[Si](C)(C)N=C=N[Si](C)(C)C
| Poids moléculaire (g/mol) | 186.4 |
|---|---|
| Synonyme | bis trimethylsilyl carbodiimide,carbodiimide, bis trimethylsilyl,n,n'-methanediylidenebis 1,1,1-trimethylsilanamine,silanamine, n,n'-methanetetraylbis 1,1,1-trimethyl,1,3-bis trimethylsilyl carbodiimide,n,n'-bis trimethylsilyl carbodiimide,n,n'-methane tetraylbis 1,1,1-trimethylsilanamine,carbodiimide, bis trimethylsilyl-7ci,8ci,n,n'-methanetetraylbis 1,1,1-trimethylsilylamine |
| Numéro MDL | MFCD00051538 |
| CAS | 1000-70-0 |
| CID PubChem | 70473 |
| Nom IUPAC | N,N'-bis(trimethylsilyl)methanediimine |
| Clé InChI | KSVMTHKYDGMXFJ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)N=C=N[Si](C)(C)C |
| Formule moléculaire | C7H18N2Si2 |
N,O-Bis(trimethylsilyl)trifluoroacetamide, with 1% trimethylsilyl chloride
CAS: 25561-30-2 Formule moléculaire: C8H18F3NOSi2 Poids moléculaire (g/mol): 257.4 Numéro MDL: MFCD00008269 Clé InChI: XCOBLONWWXQEBS-GHXNOFRVSA-N Synonyme: bstfa,n,o-bis trimethylsilyl trifluoroacetamide,acetamide, 2,2,2-trifluoro-o,n-bis trimethylsilyl,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl acetimidate,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanimidate,trimethylsilyl 1z-2,2,2-trifluoro-n-z-trimethylsilyl ethanimidoate #,n,o-bis trimethylsilyl trifluoroacetamide bstfa,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanecarboximidate CID PubChem: 9601896 Nom IUPAC: trimethylsilyl (1Z)-2,2,2-trifluoro-N-trimethylsilylethanimidate SMILES: C[Si](C)(C)N=C(C(F)(F)F)O[Si](C)(C)C
| Poids moléculaire (g/mol) | 257.4 |
|---|---|
| Synonyme | bstfa,n,o-bis trimethylsilyl trifluoroacetamide,acetamide, 2,2,2-trifluoro-o,n-bis trimethylsilyl,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl acetimidate,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanimidate,trimethylsilyl 1z-2,2,2-trifluoro-n-z-trimethylsilyl ethanimidoate #,n,o-bis trimethylsilyl trifluoroacetamide bstfa,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanecarboximidate |
| Numéro MDL | MFCD00008269 |
| CAS | 25561-30-2 |
| CID PubChem | 9601896 |
| Nom IUPAC | trimethylsilyl (1Z)-2,2,2-trifluoro-N-trimethylsilylethanimidate |
| Clé InChI | XCOBLONWWXQEBS-GHXNOFRVSA-N |
| SMILES | C[Si](C)(C)N=C(C(F)(F)F)O[Si](C)(C)C |
| Formule moléculaire | C8H18F3NOSi2 |
Diphenyltetramethyldisilane, 97%
CAS: 1145-98-8 Formule moléculaire: C16H22Si2 Poids moléculaire (g/mol): 270.32 Numéro MDL: MFCD00054786 Clé InChI: IIOOIYHUTINYQO-UHFFFAOYSA-N Synonyme: 1,2-diphenyltetramethyldisilane,1,1,2,2-tetramethyl-1,2-diphenyldisilane,disilane,1,1,2,2-tetramethyl-1,2-diphenyl,1,2-diphenyl-1,1,2,2-tetramethyldisilane,tetramethyldiphenyldisilan,amtsi083,tetramethyldisilane-1,2-diyldibenzene,bisphenyl-1,1,2,2-tetramethyldisilane,dimethyl phenyl silyl-dimethyl-phenylsilane,1,1,2,2-tetramethyldiphenyldisilane CID PubChem: 136916 Nom IUPAC: [dimethyl(phenyl)silyl]-dimethyl-phenylsilane SMILES: C[Si](C)(C1=CC=CC=C1)[Si](C)(C)C2=CC=CC=C2
| Poids moléculaire (g/mol) | 270.32 |
|---|---|
| Synonyme | 1,2-diphenyltetramethyldisilane,1,1,2,2-tetramethyl-1,2-diphenyldisilane,disilane,1,1,2,2-tetramethyl-1,2-diphenyl,1,2-diphenyl-1,1,2,2-tetramethyldisilane,tetramethyldiphenyldisilan,amtsi083,tetramethyldisilane-1,2-diyldibenzene,bisphenyl-1,1,2,2-tetramethyldisilane,dimethyl phenyl silyl-dimethyl-phenylsilane,1,1,2,2-tetramethyldiphenyldisilane |
| Numéro MDL | MFCD00054786 |
| CAS | 1145-98-8 |
| CID PubChem | 136916 |
| Nom IUPAC | [dimethyl(phenyl)silyl]-dimethyl-phenylsilane |
| Clé InChI | IIOOIYHUTINYQO-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C1=CC=CC=C1)[Si](C)(C)C2=CC=CC=C2 |
| Formule moléculaire | C16H22Si2 |
Allyltrimethoxysilane, 97+%
CAS: 2551-83-9 Formule moléculaire: C6H14O3Si Poids moléculaire (g/mol): 162.26 Numéro MDL: MFCD00053865 Clé InChI: LFRDHGNFBLIJIY-UHFFFAOYSA-N Synonyme: allyltrimethoxysilane,silane, trimethoxy-2-propenyl,silane, trimethoxy-2-propen-1-yl,allyl trimethoxy silane,silane, allyltrimethoxy,allytrimethoxysilane,acmc-209gkn,trimethoxy prop-2-enyl silane,silane,trimethoxy-2-propen-1-yl CID PubChem: 75698 Nom IUPAC: trimethoxy(prop-2-enyl)silane SMILES: CO[Si](CC=C)(OC)OC
| Poids moléculaire (g/mol) | 162.26 |
|---|---|
| Synonyme | allyltrimethoxysilane,silane, trimethoxy-2-propenyl,silane, trimethoxy-2-propen-1-yl,allyl trimethoxy silane,silane, allyltrimethoxy,allytrimethoxysilane,acmc-209gkn,trimethoxy prop-2-enyl silane,silane,trimethoxy-2-propen-1-yl |
| Numéro MDL | MFCD00053865 |
| CAS | 2551-83-9 |
| CID PubChem | 75698 |
| Nom IUPAC | trimethoxy(prop-2-enyl)silane |
| Clé InChI | LFRDHGNFBLIJIY-UHFFFAOYSA-N |
| SMILES | CO[Si](CC=C)(OC)OC |
| Formule moléculaire | C6H14O3Si |
Methyltrichlorosilane, 98+%
CAS: 75-79-6 Formule moléculaire: CH3Cl3Si Poids moléculaire (g/mol): 149.48 Clé InChI: JLUFWMXJHAVVNN-UHFFFAOYSA-N Synonyme: methyltrichlorosilane,trichloro methyl silane,silane, trichloromethyl,methyl-trichlorsilan,methylsilicochloroform,trichloromethylsilicon,methylsilyl trichloride,monomethyltrichlorosilane,silane, methyltrichloro,trichlor-methylsilan CID PubChem: 6399 Nom IUPAC: trichloro(methyl)silane SMILES: C[Si](Cl)(Cl)Cl
| Poids moléculaire (g/mol) | 149.48 |
|---|---|
| Synonyme | methyltrichlorosilane,trichloro methyl silane,silane, trichloromethyl,methyl-trichlorsilan,methylsilicochloroform,trichloromethylsilicon,methylsilyl trichloride,monomethyltrichlorosilane,silane, methyltrichloro,trichlor-methylsilan |
| CAS | 75-79-6 |
| CID PubChem | 6399 |
| Nom IUPAC | trichloro(methyl)silane |
| Clé InChI | JLUFWMXJHAVVNN-UHFFFAOYSA-N |
| SMILES | C[Si](Cl)(Cl)Cl |
| Formule moléculaire | CH3Cl3Si |
Phenyltrichlorosilane, 95%
CAS: 98-13-5 Formule moléculaire: C6H5Cl3Si Poids moléculaire (g/mol): 211.55 Numéro MDL: MFCD00000479 Clé InChI: ORVMIVQULIKXCP-UHFFFAOYSA-N Synonyme: trichloro phenyl silane,phenyltrichlorosilane,silane, trichlorophenyl,phenyl trichlorosilane,phenylsilicon trichloride,silane, phenyltrichloro,silicon phenyl trichloride,benzene, trichlorosilyl,unii-m7199jl06m,phenyl-trichloro-silane CID PubChem: 7372 Nom IUPAC: trichloro(phenyl)silane SMILES: C1=CC=C(C=C1)[Si](Cl)(Cl)Cl
| Poids moléculaire (g/mol) | 211.55 |
|---|---|
| Synonyme | trichloro phenyl silane,phenyltrichlorosilane,silane, trichlorophenyl,phenyl trichlorosilane,phenylsilicon trichloride,silane, phenyltrichloro,silicon phenyl trichloride,benzene, trichlorosilyl,unii-m7199jl06m,phenyl-trichloro-silane |
| Numéro MDL | MFCD00000479 |
| CAS | 98-13-5 |
| CID PubChem | 7372 |
| Nom IUPAC | trichloro(phenyl)silane |
| Clé InChI | ORVMIVQULIKXCP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[Si](Cl)(Cl)Cl |
| Formule moléculaire | C6H5Cl3Si |
(3-chloropropyl)trimethoxysilane, 98+%
CAS: 2530-87-2 Formule moléculaire: C6H15ClO3Si Poids moléculaire (g/mol): 198.72 Numéro MDL: MFCD00000997 Clé InChI: OXYZDRAJMHGSMW-UHFFFAOYSA-N Synonyme: 3-chloropropyl trimethoxysilane,silane, 3-chloropropyl trimethoxy,3-chloropropyltrimethyoxysilane,sila-ace s 620,cps-m,silane 3-chloropropyl tris methoxy,3-trimethoxysilyl propyl chloride,unii-t21bnl1s7f,cptmo,3-chloropropyl trimethoxysilan CID PubChem: 62449 Nom IUPAC: 3-chloropropyl(trimethoxy)silane SMILES: CO[Si](CCCCl)(OC)OC
| Poids moléculaire (g/mol) | 198.72 |
|---|---|
| Synonyme | 3-chloropropyl trimethoxysilane,silane, 3-chloropropyl trimethoxy,3-chloropropyltrimethyoxysilane,sila-ace s 620,cps-m,silane 3-chloropropyl tris methoxy,3-trimethoxysilyl propyl chloride,unii-t21bnl1s7f,cptmo,3-chloropropyl trimethoxysilan |
| Numéro MDL | MFCD00000997 |
| CAS | 2530-87-2 |
| CID PubChem | 62449 |
| Nom IUPAC | 3-chloropropyl(trimethoxy)silane |
| Clé InChI | OXYZDRAJMHGSMW-UHFFFAOYSA-N |
| SMILES | CO[Si](CCCCl)(OC)OC |
| Formule moléculaire | C6H15ClO3Si |
Phenyl selenocyanate, 98%
CAS: 2179-79-5 Formule moléculaire: C7H5NSe Poids moléculaire (g/mol): 182.095 Numéro MDL: MFCD00216944 Clé InChI: NODWRXQVQYOJGN-UHFFFAOYSA-N Synonyme: phenylselenocyanate,phenylselanyl formonitrile,selenocyanic acid, phenyl ester,acmc-1cgab,phenyl selenocyanate,selenocyanic acid phenyl ester,2-phenyl-2-selenaethanenitrile CID PubChem: 555340 Nom IUPAC: phenyl selenocyanate SMILES: C1=CC=C(C=C1)[Se]C#N
| Poids moléculaire (g/mol) | 182.095 |
|---|---|
| Synonyme | phenylselenocyanate,phenylselanyl formonitrile,selenocyanic acid, phenyl ester,acmc-1cgab,phenyl selenocyanate,selenocyanic acid phenyl ester,2-phenyl-2-selenaethanenitrile |
| Numéro MDL | MFCD00216944 |
| CAS | 2179-79-5 |
| CID PubChem | 555340 |
| Nom IUPAC | phenyl selenocyanate |
| Clé InChI | NODWRXQVQYOJGN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[Se]C#N |
| Formule moléculaire | C7H5NSe |