Hydroxybenzoic Acid Derivatives
- (1)
- (1)
- (3)
- (144)
- (2)
- (46)
- (1)
- (2)
- (2)
- (3)
- (4)
- (11)
- (8)
- (9)
- (11)
- (3)
- (2)
- (4)
- (7)
- (2)
- (5)
- (5)
- (2)
- (4)
- (21)
- (1)
- (2)
- (418)
- (5)
- (4)
- (2)
- (1)
- (3)
- (2)
- (1)
- (3)
- (3)
- (4)
- (2)
- (4)
Filtered Search Results
Sodium Salicylate (Small Crystals, Free Flowing/USP), Fisher Chemical™
CAS: 54-21-7 Molecular Formula: C7H5NaO3 Molecular Weight (g/mol): 160.104 MDL Number: MFCD00002440 InChI Key: ABBQHOQBGMUPJH-UHFFFAOYSA-M Synonym: sodium salicylate,sodium 2-hydroxybenzoate,salsonin,clin,enterosalicyl,enterosalil,entrosalyl,glutosalyl,kerasalicyl,magsalyl PubChem CID: 16760658 ChEBI: CHEBI:9180 IUPAC Name: sodium;2-hydroxybenzoate SMILES: C1=CC=C(C(=C1)C(=O)[O-])O.[Na+]
| PubChem CID | 16760658 |
|---|---|
| CAS | 54-21-7 |
| Molecular Weight (g/mol) | 160.104 |
| ChEBI | CHEBI:9180 |
| MDL Number | MFCD00002440 |
| SMILES | C1=CC=C(C(=C1)C(=O)[O-])O.[Na+] |
| Synonym | sodium salicylate,sodium 2-hydroxybenzoate,salsonin,clin,enterosalicyl,enterosalil,entrosalyl,glutosalyl,kerasalicyl,magsalyl |
| IUPAC Name | sodium;2-hydroxybenzoate |
| InChI Key | ABBQHOQBGMUPJH-UHFFFAOYSA-M |
| Molecular Formula | C7H5NaO3 |
Sodium Salicylate (Powder/Certified), Fisher Chemical
CAS: 54-21-7 Molecular Formula: C7H5NaO3 Molecular Weight (g/mol): 160.104 MDL Number: MFCD00002440 InChI Key: ABBQHOQBGMUPJH-UHFFFAOYSA-M Synonym: sodium salicylate,sodium 2-hydroxybenzoate,salsonin,clin,enterosalicyl,enterosalil,entrosalyl,glutosalyl,kerasalicyl,magsalyl PubChem CID: 16760658 ChEBI: CHEBI:9180 IUPAC Name: sodium;2-hydroxybenzoate SMILES: C1=CC=C(C(=C1)C(=O)[O-])O.[Na+]
| PubChem CID | 16760658 |
|---|---|
| CAS | 54-21-7 |
| Molecular Weight (g/mol) | 160.104 |
| ChEBI | CHEBI:9180 |
| MDL Number | MFCD00002440 |
| SMILES | C1=CC=C(C(=C1)C(=O)[O-])O.[Na+] |
| Synonym | sodium salicylate,sodium 2-hydroxybenzoate,salsonin,clin,enterosalicyl,enterosalil,entrosalyl,glutosalyl,kerasalicyl,magsalyl |
| IUPAC Name | sodium;2-hydroxybenzoate |
| InChI Key | ABBQHOQBGMUPJH-UHFFFAOYSA-M |
| Molecular Formula | C7H5NaO3 |
Oxyclozanide, British Pharmacopoeia (BP) Reference Standard, MilliporeSigma™ Supelco™
This product is provided as delivered and specified by the issuing Pharmacopoeia. All information provided in support of this product, including SDS and any product information leaflets, has been developed and issued under the Authority of the issuing Pharmacopoeia.
2-Iodobenzoic acid, 98%
CAS: 88-67-5 Molecular Formula: C7H5IO2 Molecular Weight (g/mol): 248.01 InChI Key: CJNZAXGUTKBIHP-UHFFFAOYSA-N Synonym: o-iodobenzoic acid,benzoic acid, 2-iodo,iodobenzoic acid,benzoic acid, o-iodo,usaf ek-572,2-iodo benzoic acid,2-iodo-benzoic acid,benzoic acid, iodo,kyselina o-jodbenzoova,o-jod-benzoesaeure PubChem CID: 6941 ChEBI: CHEBI:287979 IUPAC Name: 2-iodobenzoic acid SMILES: C1=CC=C(C(=C1)C(=O)O)I
| PubChem CID | 6941 |
|---|---|
| CAS | 88-67-5 |
| Molecular Weight (g/mol) | 248.01 |
| ChEBI | CHEBI:287979 |
| SMILES | C1=CC=C(C(=C1)C(=O)O)I |
| Synonym | o-iodobenzoic acid,benzoic acid, 2-iodo,iodobenzoic acid,benzoic acid, o-iodo,usaf ek-572,2-iodo benzoic acid,2-iodo-benzoic acid,benzoic acid, iodo,kyselina o-jodbenzoova,o-jod-benzoesaeure |
| IUPAC Name | 2-iodobenzoic acid |
| InChI Key | CJNZAXGUTKBIHP-UHFFFAOYSA-N |
| Molecular Formula | C7H5IO2 |
Oxyclozanide, 98%, Thermo Scientific Chemicals
CAS: 2277-92-1 Molecular Formula: C13H6Cl5NO3 Molecular Weight (g/mol): 401.45 MDL Number: MFCD00864507 InChI Key: JYWIYHUXVMAGLG-UHFFFAOYSA-N Synonym: oxyclozanide,oxiclozanidum,zanil,oxyclozanid,zanilox,diplin,2,3,5-trichloro-n-3,5-dichloro-2-hydroxyphenyl-6-hydroxybenzamide,oxyclozanide inn:ban,oxyclozanidum inn-latin,oxiclozanida inn-spanish PubChem CID: 16779 IUPAC Name: 2,3,5-trichloro-N-(3,5-dichloro-2-hydroxyphenyl)-6-hydroxybenzamide SMILES: OC1=C(C(=O)NC2=CC(Cl)=CC(Cl)=C2O)C(Cl)=C(Cl)C=C1Cl
| PubChem CID | 16779 |
|---|---|
| CAS | 2277-92-1 |
| Molecular Weight (g/mol) | 401.45 |
| MDL Number | MFCD00864507 |
| SMILES | OC1=C(C(=O)NC2=CC(Cl)=CC(Cl)=C2O)C(Cl)=C(Cl)C=C1Cl |
| Synonym | oxyclozanide,oxiclozanidum,zanil,oxyclozanid,zanilox,diplin,2,3,5-trichloro-n-3,5-dichloro-2-hydroxyphenyl-6-hydroxybenzamide,oxyclozanide inn:ban,oxyclozanidum inn-latin,oxiclozanida inn-spanish |
| IUPAC Name | 2,3,5-trichloro-N-(3,5-dichloro-2-hydroxyphenyl)-6-hydroxybenzamide |
| InChI Key | JYWIYHUXVMAGLG-UHFFFAOYSA-N |
| Molecular Formula | C13H6Cl5NO3 |
2-Fluorobenzoyl chloride, 97%
CAS: 393-52-2 Molecular Formula: C7H4ClFO Molecular Weight (g/mol): 158.56 MDL Number: MFCD00000656 InChI Key: RAAGZOYMEQDCTD-UHFFFAOYSA-N Synonym: o-fluorobenzoyl chloride,benzoyl chloride, 2-fluoro,benzoyl chloride, o-fluoro,2-fluorobenzoylchloride,2-fluoro benzoyl chloride,unii-z4h017n76s,ccris 5914,fluorobenzoyl chloride,benzoyl chloride, fluoro,2-fluorobenzoic acid chloride PubChem CID: 9808 IUPAC Name: 2-fluorobenzoyl chloride SMILES: C1=CC=C(C(=C1)C(=O)Cl)F
| PubChem CID | 9808 |
|---|---|
| CAS | 393-52-2 |
| Molecular Weight (g/mol) | 158.56 |
| MDL Number | MFCD00000656 |
| SMILES | C1=CC=C(C(=C1)C(=O)Cl)F |
| Synonym | o-fluorobenzoyl chloride,benzoyl chloride, 2-fluoro,benzoyl chloride, o-fluoro,2-fluorobenzoylchloride,2-fluoro benzoyl chloride,unii-z4h017n76s,ccris 5914,fluorobenzoyl chloride,benzoyl chloride, fluoro,2-fluorobenzoic acid chloride |
| IUPAC Name | 2-fluorobenzoyl chloride |
| InChI Key | RAAGZOYMEQDCTD-UHFFFAOYSA-N |
| Molecular Formula | C7H4ClFO |
4-Bromo-2-fluorobenzoyl chloride, 99%
CAS: 151982-51-3 Molecular Formula: C7H3BrClFO Molecular Weight (g/mol): 237.46 MDL Number: MFCD03411584 InChI Key: PCFIABOQFAFDAU-UHFFFAOYSA-N Synonym: 2-fluoro-4-bromobenzoyl chloride,benzoyl chloride, 4-bromo-2-fluoro,benzoyl chloride,4-bromo-2-fluoro,acmc-20amnm,4-bromo-2-fluorobenzoylchloride,4-bromo-2-fluoro-benzoyl chloride,4-bromo-2-fluorobenzoic acid chloride,4-bromanyl-2-fluoranyl-benzoyl chloride PubChem CID: 2734026 IUPAC Name: 4-bromo-2-fluorobenzoyl chloride SMILES: C1=CC(=C(C=C1Br)F)C(=O)Cl
| PubChem CID | 2734026 |
|---|---|
| CAS | 151982-51-3 |
| Molecular Weight (g/mol) | 237.46 |
| MDL Number | MFCD03411584 |
| SMILES | C1=CC(=C(C=C1Br)F)C(=O)Cl |
| Synonym | 2-fluoro-4-bromobenzoyl chloride,benzoyl chloride, 4-bromo-2-fluoro,benzoyl chloride,4-bromo-2-fluoro,acmc-20amnm,4-bromo-2-fluorobenzoylchloride,4-bromo-2-fluoro-benzoyl chloride,4-bromo-2-fluorobenzoic acid chloride,4-bromanyl-2-fluoranyl-benzoyl chloride |
| IUPAC Name | 4-bromo-2-fluorobenzoyl chloride |
| InChI Key | PCFIABOQFAFDAU-UHFFFAOYSA-N |
| Molecular Formula | C7H3BrClFO |
4-Bromophthalic acid, 98%, Thermo Scientific Chemicals
CAS: 6968-28-1 Molecular Formula: C8H5BrO4 Molecular Weight (g/mol): 245.028 MDL Number: MFCD00043538 InChI Key: AZXKGUVDIORSED-UHFFFAOYSA-N Synonym: 4-bromophthalicacid,4-bromobenzene-1,2-dicarboxylic acid,1,2-benzenedicarboxylic acid, 4-bromo,zlchem 539,5-bromo-phthalic acid,acmc-209oah,#,4-bromo-1,2-benzenedicarboxylic acid,1,2-benzenedicarboxylicacid, 4-bromo,4-bromobenzene-1,2-dioic acid PubChem CID: 81428 IUPAC Name: 4-bromophthalic acid SMILES: C1=CC(=C(C=C1Br)C(=O)O)C(=O)O
| PubChem CID | 81428 |
|---|---|
| CAS | 6968-28-1 |
| Molecular Weight (g/mol) | 245.028 |
| MDL Number | MFCD00043538 |
| SMILES | C1=CC(=C(C=C1Br)C(=O)O)C(=O)O |
| Synonym | 4-bromophthalicacid,4-bromobenzene-1,2-dicarboxylic acid,1,2-benzenedicarboxylic acid, 4-bromo,zlchem 539,5-bromo-phthalic acid,acmc-209oah,#,4-bromo-1,2-benzenedicarboxylic acid,1,2-benzenedicarboxylicacid, 4-bromo,4-bromobenzene-1,2-dioic acid |
| IUPAC Name | 4-bromophthalic acid |
| InChI Key | AZXKGUVDIORSED-UHFFFAOYSA-N |
| Molecular Formula | C8H5BrO4 |
3-Methylsalicylic acid, 99%
CAS: 83-40-9 Molecular Formula: C8H8O3 Molecular Weight (g/mol): 152.15 MDL Number: MFCD00002448 InChI Key: WHSXTWFYRGOBGO-UHFFFAOYSA-N Synonym: 3-methylsalicylic acid,hydroxytoluic acid,o-cresotic acid,o-cresotinic acid,cresotic acid,o-homosalicylic acid,2-hydroxy-m-toluic acid,2,3-cresotinic acid,cresotinic acid,benzoic acid, 2-hydroxy-3-methyl PubChem CID: 6738 ChEBI: CHEBI:20141 IUPAC Name: 2-hydroxy-3-methylbenzoic acid SMILES: CC1=CC=CC(C(O)=O)=C1O
| PubChem CID | 6738 |
|---|---|
| CAS | 83-40-9 |
| Molecular Weight (g/mol) | 152.15 |
| ChEBI | CHEBI:20141 |
| MDL Number | MFCD00002448 |
| SMILES | CC1=CC=CC(C(O)=O)=C1O |
| Synonym | 3-methylsalicylic acid,hydroxytoluic acid,o-cresotic acid,o-cresotinic acid,cresotic acid,o-homosalicylic acid,2-hydroxy-m-toluic acid,2,3-cresotinic acid,cresotinic acid,benzoic acid, 2-hydroxy-3-methyl |
| IUPAC Name | 2-hydroxy-3-methylbenzoic acid |
| InChI Key | WHSXTWFYRGOBGO-UHFFFAOYSA-N |
| Molecular Formula | C8H8O3 |
Methyl 3,5-difluorobenzoate, 98%
CAS: 216393-55-4 Molecular Formula: C8H6F2O2 Molecular Weight (g/mol): 172.13 MDL Number: MFCD01318160 InChI Key: JBEJPGWPXIIQBB-UHFFFAOYSA-N PubChem CID: 2775360 IUPAC Name: methyl 3,5-difluorobenzoate SMILES: COC(=O)C1=CC(F)=CC(F)=C1
| PubChem CID | 2775360 |
|---|---|
| CAS | 216393-55-4 |
| Molecular Weight (g/mol) | 172.13 |
| MDL Number | MFCD01318160 |
| SMILES | COC(=O)C1=CC(F)=CC(F)=C1 |
| IUPAC Name | methyl 3,5-difluorobenzoate |
| InChI Key | JBEJPGWPXIIQBB-UHFFFAOYSA-N |
| Molecular Formula | C8H6F2O2 |
2-Chloro-6-methylbenzoic acid, 97%
CAS: 21327-86-6 Molecular Formula: C8H7ClO2 Molecular Weight (g/mol): 170.592 MDL Number: MFCD00045799 InChI Key: CEFMMQYDPGCYMG-UHFFFAOYSA-N Synonym: 6-chloro-o-toluic acid,2-chloro-6-methyl-benzoic acid,o-toluic acid, 6-chloro,2-chloro-6-methylbenzoicacid,benzoic acid, 2-chloro-6-methyl,benzoic acid, 6-chloro-4-methyl,6-chloro-2-methylbenzoic acid,pubchem4568,chloro-6-methylbenzoic acid,2-m-tolyloxymethyl oxirane PubChem CID: 88870 IUPAC Name: 2-chloro-6-methylbenzoic acid SMILES: CC1=C(C(=CC=C1)Cl)C(=O)O
| PubChem CID | 88870 |
|---|---|
| CAS | 21327-86-6 |
| Molecular Weight (g/mol) | 170.592 |
| MDL Number | MFCD00045799 |
| SMILES | CC1=C(C(=CC=C1)Cl)C(=O)O |
| Synonym | 6-chloro-o-toluic acid,2-chloro-6-methyl-benzoic acid,o-toluic acid, 6-chloro,2-chloro-6-methylbenzoicacid,benzoic acid, 2-chloro-6-methyl,benzoic acid, 6-chloro-4-methyl,6-chloro-2-methylbenzoic acid,pubchem4568,chloro-6-methylbenzoic acid,2-m-tolyloxymethyl oxirane |
| IUPAC Name | 2-chloro-6-methylbenzoic acid |
| InChI Key | CEFMMQYDPGCYMG-UHFFFAOYSA-N |
| Molecular Formula | C8H7ClO2 |
2-Bromo-4-fluorobenzoic acid, 98%
CAS: 1006-41-3 Molecular Formula: C7H4BrFO2 Molecular Weight (g/mol): 219.009 MDL Number: MFCD00055370 InChI Key: RRKPMLZRLKTDQV-UHFFFAOYSA-N Synonym: 2-bromo-4-fluorobenzoicacid,4-fluoro-2-bromobenzoic acid,2-bromo-4-fluoro-benzoic acid,benzoic acid, 2-bromo-4-fluoro,rarechem al bo 1996,buttpark 18\02-85,2-bromo-4-fluorbenzoic acid,pubchem1314,2-bromo-4-fluorobenzoic,2-bromofluorobenzoic acid PubChem CID: 1268169 IUPAC Name: 2-bromo-4-fluorobenzoic acid SMILES: C1=CC(=C(C=C1F)Br)C(=O)O
| PubChem CID | 1268169 |
|---|---|
| CAS | 1006-41-3 |
| Molecular Weight (g/mol) | 219.009 |
| MDL Number | MFCD00055370 |
| SMILES | C1=CC(=C(C=C1F)Br)C(=O)O |
| Synonym | 2-bromo-4-fluorobenzoicacid,4-fluoro-2-bromobenzoic acid,2-bromo-4-fluoro-benzoic acid,benzoic acid, 2-bromo-4-fluoro,rarechem al bo 1996,buttpark 18\02-85,2-bromo-4-fluorbenzoic acid,pubchem1314,2-bromo-4-fluorobenzoic,2-bromofluorobenzoic acid |
| IUPAC Name | 2-bromo-4-fluorobenzoic acid |
| InChI Key | RRKPMLZRLKTDQV-UHFFFAOYSA-N |
| Molecular Formula | C7H4BrFO2 |
2-Bromo-6-methylbenzoic acid, 98%
CAS: 90259-31-7 Molecular Formula: C8H7BrO2 Molecular Weight (g/mol): 215.05 MDL Number: MFCD01310788 InChI Key: ICXBPDJQFPIBSS-UHFFFAOYSA-N Synonym: 6-bromo-o-toluic acid,2-bromo-6-methyl-benzoic acid,6-bromo-2-methylbenzoic acid,benzoic acid, 2-bromo-6-methyl,bromtoluylsaure,bromotoluic acid,pubchem4715,acmc-209r5e,ksc494k9r,3-bromo-2-carboxytoluene PubChem CID: 2735589 IUPAC Name: 2-bromo-6-methylbenzoic acid SMILES: CC1=C(C(O)=O)C(Br)=CC=C1
| PubChem CID | 2735589 |
|---|---|
| CAS | 90259-31-7 |
| Molecular Weight (g/mol) | 215.05 |
| MDL Number | MFCD01310788 |
| SMILES | CC1=C(C(O)=O)C(Br)=CC=C1 |
| Synonym | 6-bromo-o-toluic acid,2-bromo-6-methyl-benzoic acid,6-bromo-2-methylbenzoic acid,benzoic acid, 2-bromo-6-methyl,bromtoluylsaure,bromotoluic acid,pubchem4715,acmc-209r5e,ksc494k9r,3-bromo-2-carboxytoluene |
| IUPAC Name | 2-bromo-6-methylbenzoic acid |
| InChI Key | ICXBPDJQFPIBSS-UHFFFAOYSA-N |
| Molecular Formula | C8H7BrO2 |
Ethyl 3-chlorobenzoate, 98+%
CAS: 1128-76-3 Molecular Formula: C9H9ClO2 Molecular Weight (g/mol): 184.619 MDL Number: MFCD00013634 InChI Key: LVFRSNCBCHABAM-UHFFFAOYSA-N Synonym: benzoic acid, 3-chloro-, ethyl ester,3-chlorobenzoic acid ethyl ester,ethyl m-chlorobenzoate,benzoic acid, m-chloro-, ethyl ester,3-chloro-benzoic acid ethyl ester,pubchem3704,acmc-1bt4u,ethyl3-chlorobenzoate,ksc495m6f,rarechem al bi 0056 PubChem CID: 70785 IUPAC Name: ethyl 3-chlorobenzoate SMILES: CCOC(=O)C1=CC(=CC=C1)Cl
| PubChem CID | 70785 |
|---|---|
| CAS | 1128-76-3 |
| Molecular Weight (g/mol) | 184.619 |
| MDL Number | MFCD00013634 |
| SMILES | CCOC(=O)C1=CC(=CC=C1)Cl |
| Synonym | benzoic acid, 3-chloro-, ethyl ester,3-chlorobenzoic acid ethyl ester,ethyl m-chlorobenzoate,benzoic acid, m-chloro-, ethyl ester,3-chloro-benzoic acid ethyl ester,pubchem3704,acmc-1bt4u,ethyl3-chlorobenzoate,ksc495m6f,rarechem al bi 0056 |
| IUPAC Name | ethyl 3-chlorobenzoate |
| InChI Key | LVFRSNCBCHABAM-UHFFFAOYSA-N |
| Molecular Formula | C9H9ClO2 |
2,3,5-Triiodobenzoic acid, 98+%
CAS: 88-82-4 Molecular Formula: C7H3I3O2 Molecular Weight (g/mol): 499.81 MDL Number: MFCD00002420 InChI Key: ZMZGFLUUZLELNE-UHFFFAOYSA-N Synonym: floraltone,tiba,triiodobenzoic acid,johnkolor,benzoic acid, 2,3,5-triiodo,2,3,5-tiba,caswell no. 890a,triiodobenzoic acid van,regin 8,kyselina 2,3,5-trijodbenzoova PubChem CID: 6948 ChEBI: CHEBI:73175 IUPAC Name: 2,3,5-triiodobenzoic acid SMILES: OC(=O)C1=CC(I)=CC(I)=C1I
| PubChem CID | 6948 |
|---|---|
| CAS | 88-82-4 |
| Molecular Weight (g/mol) | 499.81 |
| ChEBI | CHEBI:73175 |
| MDL Number | MFCD00002420 |
| SMILES | OC(=O)C1=CC(I)=CC(I)=C1I |
| Synonym | floraltone,tiba,triiodobenzoic acid,johnkolor,benzoic acid, 2,3,5-triiodo,2,3,5-tiba,caswell no. 890a,triiodobenzoic acid van,regin 8,kyselina 2,3,5-trijodbenzoova |
| IUPAC Name | 2,3,5-triiodobenzoic acid |
| InChI Key | ZMZGFLUUZLELNE-UHFFFAOYSA-N |
| Molecular Formula | C7H3I3O2 |