Xylenes
Xylenes are any one of three isomers of dimethylbenzene, or a combination thereof. All are colorless, flammable liquids composed of a central benzene ring with two methyl groups attached at substituents. They can be applied as precursor chemicals and solvents.
Xylenes are flammable petrochemical products that can be produced via catalytic reforming and coal carbonization during coke production and found in crude oil, gasoline, and aircraft fuel. Xylenes were first isolated from wood tar and named by the French chemist Auguste Cahours.
What Is Xylene?
Xylene, more appropriately called xylenes, refers to any single or combination of the three isomers of dimethylbenzene. The isomeric forms are designated as ortho- (o-), meta- (m-), and para- (p-), a reference to the carbon in the benzene ring to which the two methyl groups are attached.
- o-isomer: 1,2-dimethylbenzene
- m-isomer: 1,3-dimethylbenzene
- p-isomer: 1,4-dimethylbenzene
Xylenes are colorless and can be detected by odor at concentrations as low as 0.08 to 3.7 ppm in air and tasted in water at 0.53 to 1.8 ppm.
Refer to the Certificate of Analysis or the Safety Data Sheet for specific information about xylene density and safety hazards.
What Is Xylene Used For?
Industrial Uses
p-Xylene is a precursor to terephthalic acid and dimethyl terephthalate, used to make polyethylene terephthalate plastic bottles and polyester clothing.
Xylene can be used as a solvent and is a common component of ink, rubber, adhesives, and paint and varnish thinners. Xylenes may be used to clean steel, silicon wafers, and integrated circuits. Medical applications include use as a solvent of dental materials and ear wax.
Laboratory Uses
Xylene can be used with dry ice in baths, to remove oil from microscope objectives, and as a cleaning agent or mounting material in histology procedures.
- (2)
- (2)
- (15)
- (11)
- (22)
- (5)
- (4)
- (2)
- (2)
- (1)
- (2)
- (5)
- (2)
- (1)
- (3)
- (2)
- (2)
- (2)
- (21)
- (6)
- (4)
- (21)
- (2)
- (26)
- (2)
- (3)
- (3)
- (2)
- (12)
- (4)
- (9)
- (2)
- (2)
- (2)
- (2)
- (5)
- (2)
- (5)
- (23)
- (4)
Résultats de la recherche filtrée
2,6-Dimethylphenylboronic acid, 98%
CAS: 100379-00-8 Formule moléculaire: C8H11BO2 Poids moléculaire (g/mol): 149.98 Numéro MDL: MFCD01009693 Clé InChI: ZXDTWWZIHJEZOG-UHFFFAOYSA-N Synonyme: 2,6-dimethylphenyl boronic acid,2,6-dimethylbenzeneboronic acid,2,6-dimethylphenyl boranediol,2,6-dimethylboronic acid,m-xylene-2-boronic acid,2,6-dimethyl-phenylboronic acid,boronic acid, 2,6-dimethylphenyl,2-borono-m-xylene,pubchem16357,acmc-1c3za CID PubChem: 583322 Nom IUPAC: (2,6-dimethylphenyl)boronic acid SMILES: CC1=CC=CC(C)=C1B(O)O
| Poids moléculaire (g/mol) | 149.98 |
|---|---|
| Synonyme | 2,6-dimethylphenyl boronic acid,2,6-dimethylbenzeneboronic acid,2,6-dimethylphenyl boranediol,2,6-dimethylboronic acid,m-xylene-2-boronic acid,2,6-dimethyl-phenylboronic acid,boronic acid, 2,6-dimethylphenyl,2-borono-m-xylene,pubchem16357,acmc-1c3za |
| Numéro MDL | MFCD01009693 |
| CAS | 100379-00-8 |
| CID PubChem | 583322 |
| Nom IUPAC | (2,6-dimethylphenyl)boronic acid |
| Clé InChI | ZXDTWWZIHJEZOG-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC(C)=C1B(O)O |
| Formule moléculaire | C8H11BO2 |
3,5-Dimethylbenzoic acid, 99%
CAS: 499-06-9 Formule moléculaire: C9H10O2 Poids moléculaire (g/mol): 150.18 Numéro MDL: MFCD00002525 Clé InChI: UMVOQQDNEYOJOK-UHFFFAOYSA-N Synonyme: mesitylenic acid,benzoic acid, 3,5-dimethyl,unii-ed8av34n0y,3,5-dimethyl benzoic acid,3,5-dimethyl-benzoic acid,ed8av34n0y,3,5-dimethylbenzoicacid,pubchem15440,3,5-dimethylbezoic acid,3,5 dimethylbenzoic acid CID PubChem: 10356 ChEBI: CHEBI:64821 Nom IUPAC: 3,5-dimethylbenzoic acid SMILES: CC1=CC(=CC(=C1)C(=O)O)C
| Poids moléculaire (g/mol) | 150.18 |
|---|---|
| Synonyme | mesitylenic acid,benzoic acid, 3,5-dimethyl,unii-ed8av34n0y,3,5-dimethyl benzoic acid,3,5-dimethyl-benzoic acid,ed8av34n0y,3,5-dimethylbenzoicacid,pubchem15440,3,5-dimethylbezoic acid,3,5 dimethylbenzoic acid |
| Numéro MDL | MFCD00002525 |
| CAS | 499-06-9 |
| CID PubChem | 10356 |
| ChEBI | CHEBI:64821 |
| Nom IUPAC | 3,5-dimethylbenzoic acid |
| Clé InChI | UMVOQQDNEYOJOK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(=O)O)C |
| Formule moléculaire | C9H10O2 |
2,4-Dimethylbenzoic acid, 98%
CAS: 611-01-8 Formule moléculaire: C9H10O2 Poids moléculaire (g/mol): 150.18 Numéro MDL: MFCD00002480 Clé InChI: BKYWPNROPGQIFZ-UHFFFAOYSA-N Synonyme: benzoic acid, 2,4-dimethyl,4-carboxy-1,3-dimethylbenzene,2,4-dimethyl benzoic acid,m-xylene-4-carboxylic acid,2,4-dimethyl-benzoic acid,2,4-dimethylbenzoicacid,m-xylylic acid,pubchem15441,2,4 dimethylbenzoic acid,benzoic acid,4-dimethyl CID PubChem: 11897 ChEBI: CHEBI:64811 Nom IUPAC: 2,4-dimethylbenzoic acid SMILES: CC1=CC=C(C(O)=O)C(C)=C1
| Poids moléculaire (g/mol) | 150.18 |
|---|---|
| Synonyme | benzoic acid, 2,4-dimethyl,4-carboxy-1,3-dimethylbenzene,2,4-dimethyl benzoic acid,m-xylene-4-carboxylic acid,2,4-dimethyl-benzoic acid,2,4-dimethylbenzoicacid,m-xylylic acid,pubchem15441,2,4 dimethylbenzoic acid,benzoic acid,4-dimethyl |
| Numéro MDL | MFCD00002480 |
| CAS | 611-01-8 |
| CID PubChem | 11897 |
| ChEBI | CHEBI:64811 |
| Nom IUPAC | 2,4-dimethylbenzoic acid |
| Clé InChI | BKYWPNROPGQIFZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C(O)=O)C(C)=C1 |
| Formule moléculaire | C9H10O2 |
2,4-Dimethylbenzoic acid, 97%
CAS: 611-01-8 Formule moléculaire: C9H10O2 Poids moléculaire (g/mol): 150.18 Numéro MDL: MFCD00002480 Clé InChI: BKYWPNROPGQIFZ-UHFFFAOYSA-N Synonyme: benzoic acid, 2,4-dimethyl,4-carboxy-1,3-dimethylbenzene,2,4-dimethyl benzoic acid,m-xylene-4-carboxylic acid,2,4-dimethyl-benzoic acid,2,4-dimethylbenzoicacid,m-xylylic acid,pubchem15441,2,4 dimethylbenzoic acid,benzoic acid,4-dimethyl CID PubChem: 11897 ChEBI: CHEBI:64811 Nom IUPAC: 2,4-dimethylbenzoic acid SMILES: CC1=CC=C(C(O)=O)C(C)=C1
| Poids moléculaire (g/mol) | 150.18 |
|---|---|
| Synonyme | benzoic acid, 2,4-dimethyl,4-carboxy-1,3-dimethylbenzene,2,4-dimethyl benzoic acid,m-xylene-4-carboxylic acid,2,4-dimethyl-benzoic acid,2,4-dimethylbenzoicacid,m-xylylic acid,pubchem15441,2,4 dimethylbenzoic acid,benzoic acid,4-dimethyl |
| Numéro MDL | MFCD00002480 |
| CAS | 611-01-8 |
| CID PubChem | 11897 |
| ChEBI | CHEBI:64811 |
| Nom IUPAC | 2,4-dimethylbenzoic acid |
| Clé InChI | BKYWPNROPGQIFZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C(O)=O)C(C)=C1 |
| Formule moléculaire | C9H10O2 |
3,4-Dimethylbenzoic acid, 98%
CAS: 619-04-5 Formule moléculaire: C9H10O2 Poids moléculaire (g/mol): 150.177 Numéro MDL: MFCD00002524 Clé InChI: OPVAJFQBSDUNQA-UHFFFAOYSA-N Synonyme: benzoic acid, 3,4-dimethyl,3,4-dimethyl-benzoic acid,1-carboxy-3,4-dimethylbenzene,o-xylene-4-carboxylic acid,3,4-dimethylbenzoicacid,pubchem14893,3,4-dimethyl benzoic acid,asym-o-xylylic acid,acmc-1b5p1,3, 4 dimethyl benzoic acid CID PubChem: 12073 ChEBI: CHEBI:64818 Nom IUPAC: 3,4-dimethylbenzoic acid SMILES: CC1=C(C=C(C=C1)C(=O)O)C
| Poids moléculaire (g/mol) | 150.177 |
|---|---|
| Synonyme | benzoic acid, 3,4-dimethyl,3,4-dimethyl-benzoic acid,1-carboxy-3,4-dimethylbenzene,o-xylene-4-carboxylic acid,3,4-dimethylbenzoicacid,pubchem14893,3,4-dimethyl benzoic acid,asym-o-xylylic acid,acmc-1b5p1,3, 4 dimethyl benzoic acid |
| Numéro MDL | MFCD00002524 |
| CAS | 619-04-5 |
| CID PubChem | 12073 |
| ChEBI | CHEBI:64818 |
| Nom IUPAC | 3,4-dimethylbenzoic acid |
| Clé InChI | OPVAJFQBSDUNQA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)O)C |
| Formule moléculaire | C9H10O2 |
2,3-Dimethylbenzoic acid, 98%
CAS: 603-79-2 Formule moléculaire: C9H10O2 Poids moléculaire (g/mol): 150.177 Numéro MDL: MFCD00002479 Clé InChI: RIZUCYSQUWMQLX-UHFFFAOYSA-N Synonyme: hemellitic acid,benzoic acid, 2,3-dimethyl,2,3-dimethylbenzoicacid,2,3-dimethyl benzoic acid,2,3-dimethyl-benzoic acid,unii-7irp8ca267,2,3-dimethylbenzenecarboxylic acid,vic-o-xylylic acid,methyl m-toluic acid,pubchem2549 CID PubChem: 11782 ChEBI: CHEBI:64823 Nom IUPAC: 2,3-dimethylbenzoic acid SMILES: CC1=CC=CC(=C1C)C(=O)O
| Poids moléculaire (g/mol) | 150.177 |
|---|---|
| Synonyme | hemellitic acid,benzoic acid, 2,3-dimethyl,2,3-dimethylbenzoicacid,2,3-dimethyl benzoic acid,2,3-dimethyl-benzoic acid,unii-7irp8ca267,2,3-dimethylbenzenecarboxylic acid,vic-o-xylylic acid,methyl m-toluic acid,pubchem2549 |
| Numéro MDL | MFCD00002479 |
| CAS | 603-79-2 |
| CID PubChem | 11782 |
| ChEBI | CHEBI:64823 |
| Nom IUPAC | 2,3-dimethylbenzoic acid |
| Clé InChI | RIZUCYSQUWMQLX-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC(=C1C)C(=O)O |
| Formule moléculaire | C9H10O2 |
2,6-Dimethylbenzoic acid, 98+%
CAS: 632-46-2 Formule moléculaire: C9H10O2 Poids moléculaire (g/mol): 150.177 Numéro MDL: MFCD00002483 Clé InChI: HCBHQDKBSKYGCK-UHFFFAOYSA-N Synonyme: benzoic acid, 2,6-dimethyl,2,6-dimethylbenzoicacid,2,6-dimethyl-benzoic acid,vic-m-xylylic acid,2,6-dimethyl benzoic acid,m-xylene-2-carboxylic acid,2,6-dimethylbenzene carboxylic acid,benzoic acid, 2,6-dimethyl-7ci,8ci,9ci,zlchem 286,vic.-m-xylylic acid CID PubChem: 12439 ChEBI: CHEBI:64827 Nom IUPAC: 2,6-dimethylbenzoic acid SMILES: CC1=C(C(=CC=C1)C)C(=O)O
| Poids moléculaire (g/mol) | 150.177 |
|---|---|
| Synonyme | benzoic acid, 2,6-dimethyl,2,6-dimethylbenzoicacid,2,6-dimethyl-benzoic acid,vic-m-xylylic acid,2,6-dimethyl benzoic acid,m-xylene-2-carboxylic acid,2,6-dimethylbenzene carboxylic acid,benzoic acid, 2,6-dimethyl-7ci,8ci,9ci,zlchem 286,vic.-m-xylylic acid |
| Numéro MDL | MFCD00002483 |
| CAS | 632-46-2 |
| CID PubChem | 12439 |
| ChEBI | CHEBI:64827 |
| Nom IUPAC | 2,6-dimethylbenzoic acid |
| Clé InChI | HCBHQDKBSKYGCK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)C(=O)O |
| Formule moléculaire | C9H10O2 |
3,5-Dimethylphenylacetic acid, 98+%
CAS: 42288-46-0 Formule moléculaire: C10H11O2 Poids moléculaire (g/mol): 163.20 Numéro MDL: MFCD00082776 Clé InChI: HDNBKTWQBJJYPD-UHFFFAOYSA-M Synonyme: 3,5-dimethylphenylacetic acid,2-3,5-dimethylphenyl acetic acid,3,5-dimethylphenyl acetic acid,benzeneacetic acid, 3,5-dimethyl,3,5-xylyl acetic acid,acmc-20anc9,ksc238q4h,3,5-dimethylbenzeneacetic acid,3,5-dimethyl-phenyl-acetic acid CID PubChem: 4749495 Nom IUPAC: 2-(3,5-dimethylphenyl)acetic acid SMILES: CC1=CC(CC([O-])=O)=CC(C)=C1
| Poids moléculaire (g/mol) | 163.20 |
|---|---|
| Synonyme | 3,5-dimethylphenylacetic acid,2-3,5-dimethylphenyl acetic acid,3,5-dimethylphenyl acetic acid,benzeneacetic acid, 3,5-dimethyl,3,5-xylyl acetic acid,acmc-20anc9,ksc238q4h,3,5-dimethylbenzeneacetic acid,3,5-dimethyl-phenyl-acetic acid |
| Numéro MDL | MFCD00082776 |
| CAS | 42288-46-0 |
| CID PubChem | 4749495 |
| Nom IUPAC | 2-(3,5-dimethylphenyl)acetic acid |
| Clé InChI | HDNBKTWQBJJYPD-UHFFFAOYSA-M |
| SMILES | CC1=CC(CC([O-])=O)=CC(C)=C1 |
| Formule moléculaire | C10H11O2 |
3,5-Dimethylbenzeneboronic acid, 98%
CAS: 172975-69-8 Formule moléculaire: C8H11BO2 Poids moléculaire (g/mol): 149.984 Numéro MDL: MFCD00185689 Clé InChI: DJGHSJBYKIQHIK-UHFFFAOYSA-N Synonyme: 3,5-dimethylphenyl boronic acid,3,5-dimethylbenzeneboronic acid,3,5-dimethylphenyl boranediol,m-xylene-5-boronic acid,boronic acid, 3,5-dimethylphenyl,pubchem1833,acmc-209e5l,ksc174i6l,3.5-dimethylphenylboronic acid CID PubChem: 2734349 Nom IUPAC: (3,5-dimethylphenyl)boronic acid SMILES: B(C1=CC(=CC(=C1)C)C)(O)O
| Poids moléculaire (g/mol) | 149.984 |
|---|---|
| Synonyme | 3,5-dimethylphenyl boronic acid,3,5-dimethylbenzeneboronic acid,3,5-dimethylphenyl boranediol,m-xylene-5-boronic acid,boronic acid, 3,5-dimethylphenyl,pubchem1833,acmc-209e5l,ksc174i6l,3.5-dimethylphenylboronic acid |
| Numéro MDL | MFCD00185689 |
| CAS | 172975-69-8 |
| CID PubChem | 2734349 |
| Nom IUPAC | (3,5-dimethylphenyl)boronic acid |
| Clé InChI | DJGHSJBYKIQHIK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)C)C)(O)O |
| Formule moléculaire | C8H11BO2 |
2,5-Dimethylbenzeneboronic acid, 98%
CAS: 85199-06-0 Formule moléculaire: C8H11BO2 Poids moléculaire (g/mol): 149.98 Numéro MDL: MFCD01863525 Clé InChI: OOMZKLJLVGQZGV-UHFFFAOYSA-N Synonyme: 2,5-dimethylphenyl boronic acid,2,5-dimethylbenzeneboronic acid,2,5-dimethylphenylboronicacid,2,5-dimethylphenyl boranediol,p-xylene-2-boronic acid,boronic acid, 2,5-dimethylphenyl,pubchem1831,p-xyleneboronic acid,ksc448a1r,2,5-dimehylphenylboronic acid CID PubChem: 2734347 Nom IUPAC: (2,5-dimethylphenyl)boronic acid SMILES: CC1=CC=C(C)C(=C1)B(O)O
| Poids moléculaire (g/mol) | 149.98 |
|---|---|
| Synonyme | 2,5-dimethylphenyl boronic acid,2,5-dimethylbenzeneboronic acid,2,5-dimethylphenylboronicacid,2,5-dimethylphenyl boranediol,p-xylene-2-boronic acid,boronic acid, 2,5-dimethylphenyl,pubchem1831,p-xyleneboronic acid,ksc448a1r,2,5-dimehylphenylboronic acid |
| Numéro MDL | MFCD01863525 |
| CAS | 85199-06-0 |
| CID PubChem | 2734347 |
| Nom IUPAC | (2,5-dimethylphenyl)boronic acid |
| Clé InChI | OOMZKLJLVGQZGV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C)C(=C1)B(O)O |
| Formule moléculaire | C8H11BO2 |
3,4-Dimethylphenylacetic acid, 98%
CAS: 17283-16-8 Formule moléculaire: C10H11O2 Poids moléculaire (g/mol): 163.20 Numéro MDL: MFCD02664684 Clé InChI: OTTPBKINJOYJGW-UHFFFAOYSA-M CID PubChem: 296013 Nom IUPAC: 2-(3,4-dimethylphenyl)acetic acid SMILES: CC1=CC=C(CC([O-])=O)C=C1C
| Poids moléculaire (g/mol) | 163.20 |
|---|---|
| Numéro MDL | MFCD02664684 |
| CAS | 17283-16-8 |
| CID PubChem | 296013 |
| Nom IUPAC | 2-(3,4-dimethylphenyl)acetic acid |
| Clé InChI | OTTPBKINJOYJGW-UHFFFAOYSA-M |
| SMILES | CC1=CC=C(CC([O-])=O)C=C1C |
| Formule moléculaire | C10H11O2 |
3,4-Dimethylbenzeneboronic acid, 98+%
CAS: 55499-43-9 Formule moléculaire: C8H11BO2 Poids moléculaire (g/mol): 149.98 Numéro MDL: MFCD01009694 Clé InChI: KDVZJKOYSOFXRV-UHFFFAOYSA-N Synonyme: 3,4-dimethylphenyl boronic acid,3,4-dimethylbenzeneboronic acid,3,4-dimethylphenyl boranediol,3,4-dimethylphenylboronicacid,4-borono-o-xylene,boronic acid, 3,4-dimethylphenyl,pubchem1832,acmc-209lna,3.4-dimethylbenzeneboronic acid,3,4-dimethyl phenylboronic acid CID PubChem: 2734348 Nom IUPAC: (3,4-dimethylphenyl)boronic acid SMILES: CC1=CC=C(C=C1C)B(O)O
| Poids moléculaire (g/mol) | 149.98 |
|---|---|
| Synonyme | 3,4-dimethylphenyl boronic acid,3,4-dimethylbenzeneboronic acid,3,4-dimethylphenyl boranediol,3,4-dimethylphenylboronicacid,4-borono-o-xylene,boronic acid, 3,4-dimethylphenyl,pubchem1832,acmc-209lna,3.4-dimethylbenzeneboronic acid,3,4-dimethyl phenylboronic acid |
| Numéro MDL | MFCD01009694 |
| CAS | 55499-43-9 |
| CID PubChem | 2734348 |
| Nom IUPAC | (3,4-dimethylphenyl)boronic acid |
| Clé InChI | KDVZJKOYSOFXRV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1C)B(O)O |
| Formule moléculaire | C8H11BO2 |
2,4-Dimethylbenzeneboronic acid, 97%
CAS: 55499-44-0 Formule moléculaire: C8H11BO2 Poids moléculaire (g/mol): 149.984 Numéro MDL: MFCD02683101 Clé InChI: TYONHSPZXLFWKI-UHFFFAOYSA-N Synonyme: 2,4-dimethylphenyl boronic acid,2,4-dimethylbenzeneboronic acid,2,4-dimethyl phenyl boronic acid,2,4-dimethylphenylboronicacid,4-dimethylphenylboronic acid,boronic acid, 2,4-dimethylphenyl,4-borono-m-xylene,pubchem9565,m-xylene-4-boronic acid,acmc-1ay9d CID PubChem: 4198739 Nom IUPAC: (2,4-dimethylphenyl)boronic acid SMILES: B(C1=C(C=C(C=C1)C)C)(O)O
| Poids moléculaire (g/mol) | 149.984 |
|---|---|
| Synonyme | 2,4-dimethylphenyl boronic acid,2,4-dimethylbenzeneboronic acid,2,4-dimethyl phenyl boronic acid,2,4-dimethylphenylboronicacid,4-dimethylphenylboronic acid,boronic acid, 2,4-dimethylphenyl,4-borono-m-xylene,pubchem9565,m-xylene-4-boronic acid,acmc-1ay9d |
| Numéro MDL | MFCD02683101 |
| CAS | 55499-44-0 |
| CID PubChem | 4198739 |
| Nom IUPAC | (2,4-dimethylphenyl)boronic acid |
| Clé InChI | TYONHSPZXLFWKI-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C)C)(O)O |
| Formule moléculaire | C8H11BO2 |
2,6-Dimethylbenzeneboronic acid, 97%
CAS: 100379-00-8 Formule moléculaire: C8H11BO2 Poids moléculaire (g/mol): 149.98 Numéro MDL: MFCD01009693 Clé InChI: ZXDTWWZIHJEZOG-UHFFFAOYSA-N Synonyme: 2,6-dimethylphenyl boronic acid,2,6-dimethylbenzeneboronic acid,2,6-dimethylphenyl boranediol,2,6-dimethylboronic acid,m-xylene-2-boronic acid,2,6-dimethyl-phenylboronic acid,boronic acid, 2,6-dimethylphenyl,2-borono-m-xylene,pubchem16357,acmc-1c3za CID PubChem: 583322 Nom IUPAC: (2,6-dimethylphenyl)boronic acid SMILES: CC1=CC=CC(C)=C1B(O)O
| Poids moléculaire (g/mol) | 149.98 |
|---|---|
| Synonyme | 2,6-dimethylphenyl boronic acid,2,6-dimethylbenzeneboronic acid,2,6-dimethylphenyl boranediol,2,6-dimethylboronic acid,m-xylene-2-boronic acid,2,6-dimethyl-phenylboronic acid,boronic acid, 2,6-dimethylphenyl,2-borono-m-xylene,pubchem16357,acmc-1c3za |
| Numéro MDL | MFCD01009693 |
| CAS | 100379-00-8 |
| CID PubChem | 583322 |
| Nom IUPAC | (2,6-dimethylphenyl)boronic acid |
| Clé InChI | ZXDTWWZIHJEZOG-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC(C)=C1B(O)O |
| Formule moléculaire | C8H11BO2 |
3,5-Dimethylbenzoic acid, 98+%
CAS: 499-06-9 Formule moléculaire: C9H10O2 Poids moléculaire (g/mol): 150.177 Numéro MDL: MFCD00002525 Clé InChI: UMVOQQDNEYOJOK-UHFFFAOYSA-N Synonyme: mesitylenic acid,benzoic acid, 3,5-dimethyl,unii-ed8av34n0y,3,5-dimethyl benzoic acid,3,5-dimethyl-benzoic acid,ed8av34n0y,3,5-dimethylbenzoicacid,pubchem15440,3,5-dimethylbezoic acid,3,5 dimethylbenzoic acid CID PubChem: 10356 ChEBI: CHEBI:64821 Nom IUPAC: 3,5-dimethylbenzoic acid SMILES: CC1=CC(=CC(=C1)C(=O)O)C
| Poids moléculaire (g/mol) | 150.177 |
|---|---|
| Synonyme | mesitylenic acid,benzoic acid, 3,5-dimethyl,unii-ed8av34n0y,3,5-dimethyl benzoic acid,3,5-dimethyl-benzoic acid,ed8av34n0y,3,5-dimethylbenzoicacid,pubchem15440,3,5-dimethylbezoic acid,3,5 dimethylbenzoic acid |
| Numéro MDL | MFCD00002525 |
| CAS | 499-06-9 |
| CID PubChem | 10356 |
| ChEBI | CHEBI:64821 |
| Nom IUPAC | 3,5-dimethylbenzoic acid |
| Clé InChI | UMVOQQDNEYOJOK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(=O)O)C |
| Formule moléculaire | C9H10O2 |