missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Safranin, 1% (w/v) Aqueous, Certified, LabChem™
Supplier: LabChem LC223507
Spécifications
| Safranin | |
| 477-73-6,7732-18-5 | |
| Red | |
| Poly Bottle | |
| C20H19ClN4 | |
| 125 mL | |
| basic red 2, safranine o, gossypimine, safranin, safranine t, safranin o, safranin t, safranine, tolusafranine, hidaco safranine | |
| QRYAEWIQIBAZOJ-UHFFFAOYSA-N | |
| 2,7-diamino-1,8-dimethyl-5-phenyl-5λâµ-phenazin-5-ylium chloride | |
| 2723800 | |
| Certified |
| 1% (w/v) Aqueous | |
| 99,1 | |
| 1g/mL | |
| C20H19ClN4 | |
| MFCD00011759 | |
| 1g/mL | |
| Soluble in water | |
| [Cl-].CC1=C(N)C=C2C(=C1)N=C1C(C)=C(N)C=CC1=[N+]2C1=CC=CC=C1 | |
| 350.85 | |
| 350.85 | |
| Liquid |
Chemical Identifiers
| 477-73-6 | |
| 350.85 | |
| QRYAEWIQIBAZOJ-UHFFFAOYSA-N | |
| 2723800 | |
| [Cl-].CC1=C(N)C=C2C(=C1)N=C1C(C)=C(N)C=CC1=[N+]2C1=CC=CC=C1 |
| C20H19ClN4 | |
| MFCD00011759 | |
| basic red 2, safranine o, gossypimine, safranin, safranine t, safranin o, safranin t, safranine, tolusafranine, hidaco safranine | |
| 2,7-diamino-1,8-dimethyl-5-phenyl-5λâµ-phenazin-5-ylium chloride |
Safety and Handling
GHS H Statement
Causes serious eye irritation.
GHS P Statement
Wear protective gloves, eye protection.
Wash exposed skin thoroughly after handling.
If in eyes: Rinse cautiously with water for several minutes.
Remove contact lenses, if present and easy to do.
Continue rinsing.
If eye irritation persists: Get medical advice/attention.
Warning
Recommended Storage : Room Temperature