missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
MP Biomedicals Inc Chlorogenic acid, 99.45%, For HPLC analysis, MP Biomedicals™
Supplier: MP Biomedicals Inc 0215061801
Specifications
| Chlorogenic acid | |
| 327-97-9 | |
| 99.45% | |
| MFCD00003862 | |
| chlorogenic acid, 3-caffeoylquinic acid, chlorogenate, 3-o-caffeoylquinic acid, 3-3,4-dihydroxycinnamoyl quinic acid, heriguard, hlorogenic acid, caffeoyl quinic acid, 3-caffeoylquinate, unii-318adp12ri | |
| O[C@@H]1C[C@](O)(C[C@@H](OC(=O)\C=C\C2=CC=C(O)C(O)=C2)[C@@H]1O)C(O)=O | |
| 354.31 | |
| CHEBI:16112 | |
| Crystalline Powder |
| For HPLC analysis | |
| White | |
| C16H18O9 | |
| 1 g | |
| CWVRJTMFETXNAD-JUHZACGLSA-N | |
| (1S,3R,4R,5R)-3-{[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}-1,4,5-trihydroxycyclohexane-1-carboxylic acid | |
| 1794427 | |
| 354.3 |
Chemical Identifiers
| 327-97-9 | |
| 354.31 | |
| CWVRJTMFETXNAD-JUHZACGLSA-N | |
| 1794427 | |
| (1S,3R,4R,5R)-3-{[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}-1,4,5-trihydroxycyclohexane-1-carboxylic acid |
| C16H18O9 | |
| MFCD00003862 | |
| chlorogenic acid, 3-caffeoylquinic acid, chlorogenate, 3-o-caffeoylquinic acid, 3-3,4-dihydroxycinnamoyl quinic acid, heriguard, hlorogenic acid, caffeoyl quinic acid, 3-caffeoylquinate, unii-318adp12ri | |
| CHEBI:16112 | |
| O[C@@H]1C[C@](O)(C[C@@H](OC(=O)\C=C\C2=CC=C(O)C(O)=C2)[C@@H]1O)C(O)=O |