missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Bromophenol Blue, ACS reagent
CAS: 115-39-9 | C19H10Br4O5S | 669.96 g/mol
Supplier: Thermo Scientific Chemicals 403140050
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
IndicatorSpecifications
| Bromophenol Blue | |
| Pure | |
| Passes Test | |
| MFCD00005875 | |
| 15, 1454 | |
| UDSAIICHUKSCKT-UHFFFAOYSA-N | |
| C1=CC=C2C(=C1)C(OS2(=O)=O)(C3=CC(=C(C(=C3)Br)O)Br)C4=CC(=C(C(=C4)Br)O)Br | |
| 669.96 | |
| CHEBI:59424 | |
| ACS Reagent | |
| from pH 3.0 (yellow) to pH 4.6 (blue) | |
| 5 g |
| 279.0°C | |
| 115-39-9 | |
| C19H10Br4O5S | |
| 19, I, 649 | |
| 3',3'',5',5''-Tetrabromophenolsulfonephthalein, BPB, 3', 3'', 5' | |
| Authentic | |
| 2,6-dibromo-4-[3-(3,5-dibromo-4-hydroxyphenyl)-1,1-dioxo-2,1,lambda{6}-benzoxathiol-3-yl]phenol | |
| 8272 | |
| 669.96 | |
| Glass bottle | |
| Orange/Pink to Red or Purple | |
| Powder |
Chemical Identifiers
| 115-39-9 | |
| 669.96 | |
| UDSAIICHUKSCKT-UHFFFAOYSA-N | |
| 8272 | |
| 2,6-dibromo-4-[3-(3,5-dibromo-4-hydroxyphenyl)-1,1-dioxo-2,1,lambda{6}-benzoxathiol-3-yl]phenol |
| C19H10Br4O5S | |
| MFCD00005875 | |
| 3',3'',5',5''-Tetrabromophenolsulfonephthalein, BPB, 3', 3'', 5' | |
| CHEBI:59424 | |
| C1=CC=C2C(=C1)C(OS2(=O)=O)(C3=CC(=C(C(=C3)Br)O)Br)C4=CC(=C(C(=C4)Br)O)Br |
RUO – Research Use Only