missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Bromophenol Blue, ACS reagent
CAS: 115-39-9 | C19H10Br4O5S | 669.96 g/mol
$46.68 - $268.82
Chemical Identifiers
| CAS | 115-39-9 |
|---|---|
| Molecular Formula | C19H10Br4O5S |
| Molecular Weight (g/mol) | 669.96 |
| MDL Number | MFCD00005875 |
| InChI Key | UDSAIICHUKSCKT-UHFFFAOYSA-N |
| Synonym | 3',3'',5',5''-Tetrabromophenolsulfonephthalein, BPB, 3', 3'', 5' |
| PubChem CID | 8272 |
| ChEBI | CHEBI:59424 |
| IUPAC Name | 2,6-dibromo-4-[3-(3,5-dibromo-4-hydroxyphenyl)-1,1-dioxo-2,1,lambda{6}-benzoxathiol-3-yl]phenol |
| SMILES | C1=CC=C2C(=C1)C(OS2(=O)=O)(C3=CC(=C(C(=C3)Br)O)Br)C4=CC(=C(C(=C4)Br)O)Br |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC403140050
|
Thermo Scientific Chemicals
403140050 |
5 g | Glass bottle |
Each for $46.68
Case of 6 Each for $280.08
|
|
||||
|
AC403140100
|
Thermo Scientific Chemicals
403140100 |
10 g | Glass bottle |
Each for $82.63
Case of 6 Each for $495.78
|
|
||||
|
AC403140500
|
Thermo Scientific Chemicals
403140500 |
50 g | Glass bottle |
Each for $268.82
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
IndicatorChemical Identifiers
| 115-39-9 | |
| 669.96 | |
| UDSAIICHUKSCKT-UHFFFAOYSA-N | |
| 8272 | |
| 2,6-dibromo-4-[3-(3,5-dibromo-4-hydroxyphenyl)-1,1-dioxo-2,1,lambda{6}-benzoxathiol-3-yl]phenol |
| C19H10Br4O5S | |
| MFCD00005875 | |
| 3',3'',5',5''-Tetrabromophenolsulfonephthalein, BPB, 3', 3'', 5' | |
| CHEBI:59424 | |
| C1=CC=C2C(=C1)C(OS2(=O)=O)(C3=CC(=C(C(=C3)Br)O)Br)C4=CC(=C(C(=C4)Br)O)Br |
Specifications
| 279.0°C | |
| Passes Test | |
| MFCD00005875 | |
| 15, 1454 | |
| UDSAIICHUKSCKT-UHFFFAOYSA-N | |
| C1=CC=C2C(=C1)C(OS2(=O)=O)(C3=CC(=C(C(=C3)Br)O)Br)C4=CC(=C(C(=C4)Br)O)Br | |
| 669.96 | |
| CHEBI:59424 | |
| ACS Reagent | |
| from pH 3.0 (yellow) to pH 4.6 (blue) | |
| 5 g | |
| Bromophenol Blue, Pure |
| 115-39-9 | |
| C19H10Br4O5S | |
| 19, I, 649 | |
| 3',3'',5',5''-Tetrabromophenolsulfonephthalein, BPB, 3', 3'', 5' | |
| Authentic | |
| 2,6-dibromo-4-[3-(3,5-dibromo-4-hydroxyphenyl)-1,1-dioxo-2,1,lambda{6}-benzoxathiol-3-yl]phenol | |
| 8272 | |
| 669.96 | |
| Glass bottle | |
| Orange/Pink to Red or Purple | |
| Powder |
RUO – Research Use Only