Filtered Search Results
Thermo Scientific Chemicals Phenol water saturated sol., for molecular biology, DNAse, RNAse, Protease free, stab., free of oxides
CAS: 108-95-2 Molecular Formula: C6H6O Molecular Weight (g/mol): 94.11 MDL Number: MFCD00002143 InChI Key: ISWSIDIOOBJBQZ-UHFFFAOYSA-N Synonym: carbolic acid,hydroxybenzene,phenic acid,phenylic acid,oxybenzene,benzenol,phenyl hydrate,monophenol,phenyl hydroxide,phenylic alcohol PubChem CID: 996 ChEBI: CHEBI:15882 IUPAC Name: phenol SMILES: OC1=CC=CC=C1
| PubChem CID | 996 |
|---|---|
| CAS | 108-95-2 |
| Molecular Weight (g/mol) | 94.11 |
| ChEBI | CHEBI:15882 |
| MDL Number | MFCD00002143 |
| SMILES | OC1=CC=CC=C1 |
| Synonym | carbolic acid,hydroxybenzene,phenic acid,phenylic acid,oxybenzene,benzenol,phenyl hydrate,monophenol,phenyl hydroxide,phenylic alcohol |
| IUPAC Name | phenol |
| InChI Key | ISWSIDIOOBJBQZ-UHFFFAOYSA-N |
| Molecular Formula | C6H6O |
Thermo Scientific Chemicals Phenol/TRIS saturated sol., for molecular biology, stabilized, DNAse, RNAse and Protease free
Phenol/TRIS , CAS # 96210-45-6, is a molecular biology solvent system that can be used for the isolation of DNA. | CAS: 108-95-2 | C6H6O
N,N-Dimethylformamide, 99.8%, for molecular biology, DNAse, RNAse and Protease free
CAS: 68-12-2 Molecular Formula: C3H7NO Molecular Weight (g/mol): 73.10 MDL Number: MFCD00003284 InChI Key: ZMXDDKWLCZADIW-UHFFFAOYSA-N Synonym: dimethylformamide,dimethyl formamide,n,n-dimethylmethanamide,n-formyldimethylamine,formamide, n,n-dimethyl,dmf,dimethylformamid,dimetilformamide,dwumetyloformamid,dmfa PubChem CID: 6228 ChEBI: CHEBI:17741 IUPAC Name: N,N-dimethylformamide SMILES: CN(C)C=O
| PubChem CID | 6228 |
|---|---|
| CAS | 68-12-2 |
| Molecular Weight (g/mol) | 73.10 |
| ChEBI | CHEBI:17741 |
| MDL Number | MFCD00003284 |
| SMILES | CN(C)C=O |
| Synonym | dimethylformamide,dimethyl formamide,n,n-dimethylmethanamide,n-formyldimethylamine,formamide, n,n-dimethyl,dmf,dimethylformamid,dimetilformamide,dwumetyloformamid,dmfa |
| IUPAC Name | N,N-dimethylformamide |
| InChI Key | ZMXDDKWLCZADIW-UHFFFAOYSA-N |
| Molecular Formula | C3H7NO |
Glycerol, 99.5%, for molecular biology, DNAse, RNAse and Protease free
CAS: 56-81-5 Molecular Formula: C3H8O3 Molecular Weight (g/mol): 92.09 MDL Number: MFCD00004722 InChI Key: PEDCQBHIVMGVHV-UHFFFAOYSA-N Synonym: glycerol,glycerin,glycerine,1,2,3-propanetriol,glycyl alcohol,trihydroxypropane,glyceritol,propanetriol,1,2,3-trihydroxypropane,osmoglyn PubChem CID: 753 ChEBI: CHEBI:17754 IUPAC Name: propane-1,2,3-triol SMILES: OCC(O)CO
| PubChem CID | 753 |
|---|---|
| CAS | 56-81-5 |
| Molecular Weight (g/mol) | 92.09 |
| ChEBI | CHEBI:17754 |
| MDL Number | MFCD00004722 |
| SMILES | OCC(O)CO |
| Synonym | glycerol,glycerin,glycerine,1,2,3-propanetriol,glycyl alcohol,trihydroxypropane,glyceritol,propanetriol,1,2,3-trihydroxypropane,osmoglyn |
| IUPAC Name | propane-1,2,3-triol |
| InChI Key | PEDCQBHIVMGVHV-UHFFFAOYSA-N |
| Molecular Formula | C3H8O3 |
Isopropanol, 99.5%, for molecular biology, DNAse, RNAse and Protease free
CAS: 67-63-0 Molecular Formula: C3H8O Molecular Weight (g/mol): 60.096 MDL Number: MFCD00011674 InChI Key: KFZMGEQAYNKOFK-UHFFFAOYSA-N Synonym: isopropanol,2-propanol,isopropyl alcohol,2-hydroxypropane,alkolave,avantine,hartosol,dimethylcarbinol,sec-propyl alcohol,petrohol PubChem CID: 3776 ChEBI: CHEBI:17824 IUPAC Name: propan-2-ol SMILES: CC(C)O
| PubChem CID | 3776 |
|---|---|
| CAS | 67-63-0 |
| Molecular Weight (g/mol) | 60.096 |
| ChEBI | CHEBI:17824 |
| MDL Number | MFCD00011674 |
| SMILES | CC(C)O |
| Synonym | isopropanol,2-propanol,isopropyl alcohol,2-hydroxypropane,alkolave,avantine,hartosol,dimethylcarbinol,sec-propyl alcohol,petrohol |
| IUPAC Name | propan-2-ol |
| InChI Key | KFZMGEQAYNKOFK-UHFFFAOYSA-N |
| Molecular Formula | C3H8O |
Phenol/Chloroform/Isoamyl alcohol (25:24:1), stabilized, saturated with 100 mM Tris-EDTA to pH 8.0, for molecular
Phenol-Chloroform-Isoamyl alcohol mixture in the ratio of 25:24:1 (v/v/v), CAS # 136112-00-0, 67-66-3, 123-51-3, is a solution used in the purification of nucleic acids. | CAS: 136112-00-0 | C6H6O
| Color | Yellow to Orange |
|---|---|
| Physical Form | Solution |
| UN Number | 2927 |
| Chemical Name or Material | Phenol/Chloroform/Isoamyl alcohol (25:24:1), stabilized, saturated with 100 mM Tris-EDTA to pH 8.0 |
| Grade | Molecular Biology |
| Merck Index | 14, 7241 |
| Density | 1.2800g/mL |
| Treatment(s) | Stabilized |
| Name Note | DNase, RNase and Protease Free |
| CAS | 123-51-3 |
| MDL Number | MFCD00133763 |
| Health Hazard 2 | Suspected of causing genetic defects, Suspected of damaging the unborn child, Causes damage to organs through prolonged or repeated exposure, Causes severe skin burns and eye damage, May cause drowsiness or dizziness, Suspected of causing cancer, Repeated exposure may cause skin dryness or cracking, Toxic if swallowed, in contact with skin or if inhaled |
| pH | 7.8 to 8.2 (25°C) |
| Packaging | Glass bottle |
| Health Hazard 1 | Germ cell mutagenicity (category 2), Reproductive toxicity (category 2), Specific target organ toxicity after repeated exposure (category 1), Skin corrosion/irritation (category 1), Specific target organ toxicity after single exposure (category 3), Carcinogenicity (category 2), Acute toxicity (category 3) |
| Molecular Formula | C6H6O |
| Formula Weight | 94.11 |
| Specific Gravity | 1.28 |
Chloroform/isoamyl alcohol 24:1(v/v), for molecular biology, DNAse, RNAse and Protease free
CAS: 67-66-3 | CHCl3 | 119.37 g/mol
| PubChem CID | 6212 |
|---|---|
| CAS | 67-66-3 |
| Molecular Weight (g/mol) | 119.37 |
| ChEBI | CHEBI:35255 |
| MDL Number | MFCD00000826 |
| SMILES | ClC(Cl)Cl |
| Synonym | trichloromethane,formyl trichloride,methane, trichloro,trichloroform,methane trichloride,methenyl trichloride,methyl trichloride,trichlormethan,chloroforme,cloroformio |
| IUPAC Name | chloroform |
| InChI Key | HEDRZPFGACZZDS-UHFFFAOYSA-N |
| Molecular Formula | CHCl3 |
Formamide, 99%, for molecular biology, DNAse, RNAse and Protease free
CAS: 75-12-7 Molecular Formula: CH3NO Molecular Weight (g/mol): 45.04 MDL Number: MFCD00007941 InChI Key: ZHNUHDYFZUAESO-UHFFFAOYSA-N Synonym: methanamide,carbamaldehyde,formimidic acid,formic acid, amide,formamid,methanoic acid, amide,amid kyseliny mravenci,amid kyseliny mravenci czech,formic amide,hsdb 88 PubChem CID: 713 ChEBI: CHEBI:48431 IUPAC Name: formamide SMILES: NC=O
| PubChem CID | 713 |
|---|---|
| CAS | 75-12-7 |
| Molecular Weight (g/mol) | 45.04 |
| ChEBI | CHEBI:48431 |
| MDL Number | MFCD00007941 |
| SMILES | NC=O |
| Synonym | methanamide,carbamaldehyde,formimidic acid,formic acid, amide,formamid,methanoic acid, amide,amid kyseliny mravenci,amid kyseliny mravenci czech,formic amide,hsdb 88 |
| IUPAC Name | formamide |
| InChI Key | ZHNUHDYFZUAESO-UHFFFAOYSA-N |
| Molecular Formula | CH3NO |
Thermo Scientific Chemicals Tris EDTA buffer, for molecular biology, DNAse, RNAse, Protease free ready to use, pH 8.0
CAS: 38641-82-6 Molecular Formula: C14H27N3O11 Molecular Weight (g/mol): 413.38 MDL Number: MFCD00236359 InChI Key: VLEIUWBSEKKKFX-UHFFFAOYSA-N Synonym: 2-Amino-2-(hydroxymethyl)-1, 3-propanediol,TRIS,Tris buffer,Tromethamine,Tromethane PubChem CID: 16218629 IUPAC Name: 2-({2-[bis(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetic acid; 2-amino-2-(hydroxymethyl)propane-1,3-diol SMILES: NC(CO)(CO)CO.OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O
| PubChem CID | 16218629 |
|---|---|
| CAS | 38641-82-6 |
| Molecular Weight (g/mol) | 413.38 |
| MDL Number | MFCD00236359 |
| SMILES | NC(CO)(CO)CO.OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
| Synonym | 2-Amino-2-(hydroxymethyl)-1, 3-propanediol,TRIS,Tris buffer,Tromethamine,Tromethane |
| IUPAC Name | 2-({2-[bis(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetic acid; 2-amino-2-(hydroxymethyl)propane-1,3-diol |
| InChI Key | VLEIUWBSEKKKFX-UHFFFAOYSA-N |
| Molecular Formula | C14H27N3O11 |
Water, for molecular biology, DNAse, RNAse and Protease free
CAS: 7732-18-5 Molecular Formula: H2O Molecular Weight (g/mol): 18.015 MDL Number: MFCD00011332 InChI Key: XLYOFNOQVPJJNP-UHFFFAOYSA-N Synonym: dihydrogen oxide,dihydrogen monoxide PubChem CID: 962 ChEBI: CHEBI:15377 IUPAC Name: oxidane SMILES: O
| PubChem CID | 962 |
|---|---|
| CAS | 7732-18-5 |
| Molecular Weight (g/mol) | 18.015 |
| ChEBI | CHEBI:15377 |
| MDL Number | MFCD00011332 |
| SMILES | O |
| Synonym | dihydrogen oxide,dihydrogen monoxide |
| IUPAC Name | oxidane |
| InChI Key | XLYOFNOQVPJJNP-UHFFFAOYSA-N |
| Molecular Formula | H2O |
Thermo Scientific™ Sodium cacodylate, 0.1M buffer soln., pH 7.0
CAS: 6131-99-3 Molecular Formula: C2H6AsNaO2 Molecular Weight (g/mol): 159.98 MDL Number: MFCD00149079 InChI Key: IHQKEDIOMGYHEB-UHFFFAOYSA-M IUPAC Name: sodium dimethylarsinate SMILES: [Na+].C[As](C)([O-])=O
| CAS | 6131-99-3 |
|---|---|
| Molecular Weight (g/mol) | 159.98 |
| MDL Number | MFCD00149079 |
| SMILES | [Na+].C[As](C)([O-])=O |
| IUPAC Name | sodium dimethylarsinate |
| InChI Key | IHQKEDIOMGYHEB-UHFFFAOYSA-M |
| Molecular Formula | C2H6AsNaO2 |
Thermo Scientific™ Imidazole, Molecular Biology Grade, 99+%
CAS: 288-32-4 Molecular Formula: C3H4N2 Molecular Weight (g/mol): 68.08 MDL Number: MFCD00005183 InChI Key: RAXXELZNTBOGNW-UHFFFAOYSA-N Synonym: Glyoxaline; IUPAC Name: 1H-imidazole SMILES: N1C=CN=C1
| CAS | 288-32-4 |
|---|---|
| Molecular Weight (g/mol) | 68.08 |
| MDL Number | MFCD00005183 |
| SMILES | N1C=CN=C1 |
| Synonym | Glyoxaline; |
| IUPAC Name | 1H-imidazole |
| InChI Key | RAXXELZNTBOGNW-UHFFFAOYSA-N |
| Molecular Formula | C3H4N2 |