Benzoic acid esters
- (14)
- (28)
- (1)
- (22)
- (7)
- (4)
- (4)
- (6)
- (1)
- (9)
- (1)
- (10)
- (1)
- (26)
- (3)
- (6)
- (2)
- (4)
- (26)
- (30)
- (16)
- (3)
- (4)
- (13)
- (5)
- (97)
- (24)
- (3)
- (5)
- (1)
- (33)
- (2)
- (3)
- (2)
- (2)
- (4)
- (2)
- (5)
- (3)
- (1)
Filtered Search Results
Methyl salicylate, 99%
CAS: 119-36-8 Molecular Formula: C8H8O3 Molecular Weight (g/mol): 152.15 MDL Number: MFCD00002214 InChI Key: OSWPMRLSEDHDFF-UHFFFAOYSA-N Synonym: methyl salicylate,wintergreen oil,gaultheria oil,betula oil,teaberry oil,sweet birch oil,oil of wintergreen,analgit,spicewood oil,2-hydroxybenzoic acid methyl ester PubChem CID: 4133 ChEBI: CHEBI:31832 IUPAC Name: methyl 2-hydroxybenzoate SMILES: COC(=O)C1=CC=CC=C1O
| PubChem CID | 4133 |
|---|---|
| CAS | 119-36-8 |
| Molecular Weight (g/mol) | 152.15 |
| ChEBI | CHEBI:31832 |
| MDL Number | MFCD00002214 |
| SMILES | COC(=O)C1=CC=CC=C1O |
| Synonym | methyl salicylate,wintergreen oil,gaultheria oil,betula oil,teaberry oil,sweet birch oil,oil of wintergreen,analgit,spicewood oil,2-hydroxybenzoic acid methyl ester |
| IUPAC Name | methyl 2-hydroxybenzoate |
| InChI Key | OSWPMRLSEDHDFF-UHFFFAOYSA-N |
| Molecular Formula | C8H8O3 |
Benzyl salicylate, 99%
CAS: 118-58-1 Molecular Formula: C14H12O3 Molecular Weight (g/mol): 228.247 MDL Number: MFCD00020034 InChI Key: ZCTQGTTXIYCGGC-UHFFFAOYSA-N Synonym: benzyl salicylate,benzyl o-hydroxybenzoate,salicylic acid, benzyl ester,benzoic acid, 2-hydroxy-, phenylmethyl ester,phenylmethyl 2-hydroxybenzoate,salicylic acid benzyl ester,salicyclic acid, benzyl ester,salicylsaeurebenzylester,unii-wao5mnk9tu,salicyclic acid benzyl ester PubChem CID: 8363 IUPAC Name: benzyl 2-hydroxybenzoate SMILES: C1=CC=C(C=C1)COC(=O)C2=CC=CC=C2O
| PubChem CID | 8363 |
|---|---|
| CAS | 118-58-1 |
| Molecular Weight (g/mol) | 228.247 |
| MDL Number | MFCD00020034 |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=CC=CC=C2O |
| Synonym | benzyl salicylate,benzyl o-hydroxybenzoate,salicylic acid, benzyl ester,benzoic acid, 2-hydroxy-, phenylmethyl ester,phenylmethyl 2-hydroxybenzoate,salicylic acid benzyl ester,salicyclic acid, benzyl ester,salicylsaeurebenzylester,unii-wao5mnk9tu,salicyclic acid benzyl ester |
| IUPAC Name | benzyl 2-hydroxybenzoate |
| InChI Key | ZCTQGTTXIYCGGC-UHFFFAOYSA-N |
| Molecular Formula | C14H12O3 |
Methyl 3,5-dibromo-4-hydroxybenzoate, 98%
CAS: 41727-47-3 Molecular Formula: C8H6Br2O3 Molecular Weight (g/mol): 309.941 MDL Number: MFCD00016416 InChI Key: NVGJGYZKXBLIKY-UHFFFAOYSA-N Synonym: 3,5-dibromo-4-hydroxybenzoic acid methyl ester,3,5-dibromo-4-hydroxy-benzoic acid methyl ester,methyl 3,5-bis bromanyl-4-oxidanyl-benzoate,acmc-20akhs,pubchem3978,methyl dibromosalicylate,rarechem al bf 0231,timtec-bb sbb012530,labotest-bb lt00455670,labotest-bb lt03332530 PubChem CID: 726975 IUPAC Name: methyl 3,5-dibromo-4-hydroxybenzoate SMILES: COC(=O)C1=CC(=C(C(=C1)Br)O)Br
| PubChem CID | 726975 |
|---|---|
| CAS | 41727-47-3 |
| Molecular Weight (g/mol) | 309.941 |
| MDL Number | MFCD00016416 |
| SMILES | COC(=O)C1=CC(=C(C(=C1)Br)O)Br |
| Synonym | 3,5-dibromo-4-hydroxybenzoic acid methyl ester,3,5-dibromo-4-hydroxy-benzoic acid methyl ester,methyl 3,5-bis bromanyl-4-oxidanyl-benzoate,acmc-20akhs,pubchem3978,methyl dibromosalicylate,rarechem al bf 0231,timtec-bb sbb012530,labotest-bb lt00455670,labotest-bb lt03332530 |
| IUPAC Name | methyl 3,5-dibromo-4-hydroxybenzoate |
| InChI Key | NVGJGYZKXBLIKY-UHFFFAOYSA-N |
| Molecular Formula | C8H6Br2O3 |
Methyl 3-hydroxybenzoate, 99%
CAS: 19438-10-9 Molecular Formula: C8H8O3 Molecular Weight (g/mol): 152.15 MDL Number: MFCD00002295 InChI Key: YKUCHDXIBAQWSF-UHFFFAOYSA-N Synonym: methyl m-hydroxybenzoate,3-hydroxybenzoic acid methyl ester,m-carbomethoxyphenol,methyl m-oxybenzoate,m-hydroxybenzoic acid methyl ester,benzoic acid, 3-hydroxy-, methyl ester,3-hydroxy-benzoic acid methyl ester,unii-569m9g3stj,3-methoxycarbonyl phenol,benzoic acid, m-hydroxy-, methyl ester PubChem CID: 88068 IUPAC Name: methyl 3-hydroxybenzoate SMILES: COC(=O)C1=CC=CC(O)=C1
| PubChem CID | 88068 |
|---|---|
| CAS | 19438-10-9 |
| Molecular Weight (g/mol) | 152.15 |
| MDL Number | MFCD00002295 |
| SMILES | COC(=O)C1=CC=CC(O)=C1 |
| Synonym | methyl m-hydroxybenzoate,3-hydroxybenzoic acid methyl ester,m-carbomethoxyphenol,methyl m-oxybenzoate,m-hydroxybenzoic acid methyl ester,benzoic acid, 3-hydroxy-, methyl ester,3-hydroxy-benzoic acid methyl ester,unii-569m9g3stj,3-methoxycarbonyl phenol,benzoic acid, m-hydroxy-, methyl ester |
| IUPAC Name | methyl 3-hydroxybenzoate |
| InChI Key | YKUCHDXIBAQWSF-UHFFFAOYSA-N |
| Molecular Formula | C8H8O3 |
Ethyl 3-hydroxybenzoate, 99%
CAS: 7781-98-8 Molecular Formula: C9H10O3 Molecular Weight (g/mol): 166.176 MDL Number: MFCD00002296 InChI Key: MWSMNBYIEBRXAL-UHFFFAOYSA-N Synonym: ethyl-3-hydroxybenzoate,benzoic acid, 3-hydroxy-, ethyl ester,3-hydroxybenzoic acid ethyl ester,m-ethoxycarbonylphenol,ethyl m-hydroxybenzoate,3-hydroxy-benzoic acid ethyl ester,benzoic acid, m-hydroxy-, ethyl ester,pubchem19923,acmc-209pbw,ethyl 3-oxidanylbenzoate PubChem CID: 24522 IUPAC Name: ethyl 3-hydroxybenzoate SMILES: CCOC(=O)C1=CC(=CC=C1)O
| PubChem CID | 24522 |
|---|---|
| CAS | 7781-98-8 |
| Molecular Weight (g/mol) | 166.176 |
| MDL Number | MFCD00002296 |
| SMILES | CCOC(=O)C1=CC(=CC=C1)O |
| Synonym | ethyl-3-hydroxybenzoate,benzoic acid, 3-hydroxy-, ethyl ester,3-hydroxybenzoic acid ethyl ester,m-ethoxycarbonylphenol,ethyl m-hydroxybenzoate,3-hydroxy-benzoic acid ethyl ester,benzoic acid, m-hydroxy-, ethyl ester,pubchem19923,acmc-209pbw,ethyl 3-oxidanylbenzoate |
| IUPAC Name | ethyl 3-hydroxybenzoate |
| InChI Key | MWSMNBYIEBRXAL-UHFFFAOYSA-N |
| Molecular Formula | C9H10O3 |
Methyl 3,5-dihydroxybenzoate, 98%
CAS: 2150-44-9 Molecular Formula: C8H8O4 Molecular Weight (g/mol): 168.15 MDL Number: MFCD00002289 InChI Key: RNVFYQUEEMZKLR-UHFFFAOYSA-N Synonym: 3,5-dihydroxybenzoic acid methyl ester,benzoic acid, 3,5-dihydroxy-, methyl ester,methyl3,5-dihydroxybenzoate,methyl .alpha.-resorcylate,alpha-resorcinol carboxylic acid methyl ester,alpha-resorcylic acid, methyl ester,.alpha.-resorcylic acid, methyl ester,.alpha.-resorcinol carboxylic acid methyl ester,pubchem21357,methyl alpha-resorcylate PubChem CID: 75076 IUPAC Name: methyl 3,5-dihydroxybenzoate SMILES: COC(=O)C1=CC(O)=CC(O)=C1
| PubChem CID | 75076 |
|---|---|
| CAS | 2150-44-9 |
| Molecular Weight (g/mol) | 168.15 |
| MDL Number | MFCD00002289 |
| SMILES | COC(=O)C1=CC(O)=CC(O)=C1 |
| Synonym | 3,5-dihydroxybenzoic acid methyl ester,benzoic acid, 3,5-dihydroxy-, methyl ester,methyl3,5-dihydroxybenzoate,methyl .alpha.-resorcylate,alpha-resorcinol carboxylic acid methyl ester,alpha-resorcylic acid, methyl ester,.alpha.-resorcylic acid, methyl ester,.alpha.-resorcinol carboxylic acid methyl ester,pubchem21357,methyl alpha-resorcylate |
| IUPAC Name | methyl 3,5-dihydroxybenzoate |
| InChI Key | RNVFYQUEEMZKLR-UHFFFAOYSA-N |
| Molecular Formula | C8H8O4 |
Methyl 3-bromo-5-hydroxybenzoate, 97%, Thermo Scientific Chemicals
CAS: 192810-12-1 Molecular Formula: C8H7BrO3 Molecular Weight (g/mol): 231.045 MDL Number: MFCD10566800 InChI Key: KRTBWIIGEJIUSA-UHFFFAOYSA-N Synonym: 3-bromo-5-hydroxybenzoic acid methyl ester,acmc-209f1w,methyl3-bromo-5-hydroxybenzoate,methyl 3-bromo-5-hydroxylbenzoate,3-bromo-5-hydroxy-benzoic acid methyl ester,benzoic acid,3-bromo-5-hydroxy-,methyl ester,benzoic acid, 3-bromo-5-hydroxy-, methyl ester PubChem CID: 53216607 IUPAC Name: methyl 3-bromo-5-hydroxybenzoate SMILES: COC(=O)C1=CC(=CC(=C1)Br)O
| PubChem CID | 53216607 |
|---|---|
| CAS | 192810-12-1 |
| Molecular Weight (g/mol) | 231.045 |
| MDL Number | MFCD10566800 |
| SMILES | COC(=O)C1=CC(=CC(=C1)Br)O |
| Synonym | 3-bromo-5-hydroxybenzoic acid methyl ester,acmc-209f1w,methyl3-bromo-5-hydroxybenzoate,methyl 3-bromo-5-hydroxylbenzoate,3-bromo-5-hydroxy-benzoic acid methyl ester,benzoic acid,3-bromo-5-hydroxy-,methyl ester,benzoic acid, 3-bromo-5-hydroxy-, methyl ester |
| IUPAC Name | methyl 3-bromo-5-hydroxybenzoate |
| InChI Key | KRTBWIIGEJIUSA-UHFFFAOYSA-N |
| Molecular Formula | C8H7BrO3 |
Methyl 5-iodosalicylate, 99%
CAS: 4068-75-1 Molecular Formula: C8H7IO3 Molecular Weight (g/mol): 278.045 MDL Number: MFCD00016462 InChI Key: NRSWJTRJHPRZMH-UHFFFAOYSA-N PubChem CID: 248910 IUPAC Name: methyl 2-hydroxy-5-iodobenzoate SMILES: COC(=O)C1=C(C=CC(=C1)I)O
| PubChem CID | 248910 |
|---|---|
| CAS | 4068-75-1 |
| Molecular Weight (g/mol) | 278.045 |
| MDL Number | MFCD00016462 |
| SMILES | COC(=O)C1=C(C=CC(=C1)I)O |
| IUPAC Name | methyl 2-hydroxy-5-iodobenzoate |
| InChI Key | NRSWJTRJHPRZMH-UHFFFAOYSA-N |
| Molecular Formula | C8H7IO3 |
Methyl 4-methylsalicylate, 98+%
CAS: 4670-56-8 Molecular Formula: C9H10O3 Molecular Weight (g/mol): 166.176 MDL Number: MFCD00020130 InChI Key: UITFCFWKYAOJEJ-UHFFFAOYSA-N Synonym: methyl 4-methylsalicylate,methyl-4-methylsalicylate,benzoic acid, 2-hydroxy-4-methyl-, methyl ester,4-methylsalicylic acid methyl ester,methyl-4-methyl salicylate,methyl m-cresotate,2-hydroxy-4-methylbenzoic acid methyl ester,methyl 2-hydroxy-4-methyl-benzoate,2-hydroxy-4-methyl-benzoic acid methyl ester,methyl methylsalicylate PubChem CID: 78400 IUPAC Name: methyl 2-hydroxy-4-methylbenzoate SMILES: CC1=CC(=C(C=C1)C(=O)OC)O
| PubChem CID | 78400 |
|---|---|
| CAS | 4670-56-8 |
| Molecular Weight (g/mol) | 166.176 |
| MDL Number | MFCD00020130 |
| SMILES | CC1=CC(=C(C=C1)C(=O)OC)O |
| Synonym | methyl 4-methylsalicylate,methyl-4-methylsalicylate,benzoic acid, 2-hydroxy-4-methyl-, methyl ester,4-methylsalicylic acid methyl ester,methyl-4-methyl salicylate,methyl m-cresotate,2-hydroxy-4-methylbenzoic acid methyl ester,methyl 2-hydroxy-4-methyl-benzoate,2-hydroxy-4-methyl-benzoic acid methyl ester,methyl methylsalicylate |
| IUPAC Name | methyl 2-hydroxy-4-methylbenzoate |
| InChI Key | UITFCFWKYAOJEJ-UHFFFAOYSA-N |
| Molecular Formula | C9H10O3 |
Methyl 2-fluoro-4-hydroxybenzoate, 98%
CAS: 197507-22-5 Molecular Formula: C8H7FO3 Molecular Weight (g/mol): 170.139 MDL Number: MFCD09038282 InChI Key: WYSPMXSNCAFCFV-UHFFFAOYSA-N Synonym: 2-fluoro-4-hydroxy-benzoic acid methyl ester,2-fluoro-4-hydroxybenzoic acid methyl ester,benzoic acid, 2-fluoro-4-hydroxy-, methyl ester,methyl-2-fluoro4-hydroxybenzoate,methyl2-fluoro-4-hydroxybenzoate,methyl-2-fluoro-4-hydroxybenzoate,methyl 2-fluoro-4-hydroxy-benzoate,2-fluoro-4-hyroxybenzoic acid methyl ester PubChem CID: 22463192 IUPAC Name: methyl 2-fluoro-4-hydroxybenzoate SMILES: COC(=O)C1=C(C=C(C=C1)O)F
| PubChem CID | 22463192 |
|---|---|
| CAS | 197507-22-5 |
| Molecular Weight (g/mol) | 170.139 |
| MDL Number | MFCD09038282 |
| SMILES | COC(=O)C1=C(C=C(C=C1)O)F |
| Synonym | 2-fluoro-4-hydroxy-benzoic acid methyl ester,2-fluoro-4-hydroxybenzoic acid methyl ester,benzoic acid, 2-fluoro-4-hydroxy-, methyl ester,methyl-2-fluoro4-hydroxybenzoate,methyl2-fluoro-4-hydroxybenzoate,methyl-2-fluoro-4-hydroxybenzoate,methyl 2-fluoro-4-hydroxy-benzoate,2-fluoro-4-hyroxybenzoic acid methyl ester |
| IUPAC Name | methyl 2-fluoro-4-hydroxybenzoate |
| InChI Key | WYSPMXSNCAFCFV-UHFFFAOYSA-N |
| Molecular Formula | C8H7FO3 |
Methyl 2,5-dihydroxybenzoate, 98%
CAS: 2150-46-1 Molecular Formula: C8H8O4 Molecular Weight (g/mol): 168.15 MDL Number: MFCD00016464 InChI Key: XGDPKUKRQHHZTH-UHFFFAOYSA-N Synonym: methyl gentisate,gentisic acid methyl ester,methyl2,5-dihydroxybenzoate,benzoic acid, 2,5-dihydroxy-, methyl ester,methyl dihydroxybenzoate,2,5-dihydroxybenzoic acid methyl ester,gentisic acid, methyl ester,methyl-2,5-dihydroxybenzoate,unii-ls28b004km,rarechem al bf 0043 PubChem CID: 75077 IUPAC Name: methyl 2,5-dihydroxybenzoate SMILES: COC(=O)C1=CC(O)=CC=C1O
| PubChem CID | 75077 |
|---|---|
| CAS | 2150-46-1 |
| Molecular Weight (g/mol) | 168.15 |
| MDL Number | MFCD00016464 |
| SMILES | COC(=O)C1=CC(O)=CC=C1O |
| Synonym | methyl gentisate,gentisic acid methyl ester,methyl2,5-dihydroxybenzoate,benzoic acid, 2,5-dihydroxy-, methyl ester,methyl dihydroxybenzoate,2,5-dihydroxybenzoic acid methyl ester,gentisic acid, methyl ester,methyl-2,5-dihydroxybenzoate,unii-ls28b004km,rarechem al bf 0043 |
| IUPAC Name | methyl 2,5-dihydroxybenzoate |
| InChI Key | XGDPKUKRQHHZTH-UHFFFAOYSA-N |
| Molecular Formula | C8H8O4 |
Methyl 2,4-dihydroxybenzoate, 97%
CAS: 2150-47-2 Molecular Formula: C8H8O4 Molecular Weight (g/mol): 168.148 MDL Number: MFCD00002276 InChI Key: IIFCLXHRIYTHPV-UHFFFAOYSA-N Synonym: 2,4-dihydroxybenzoic acid methyl ester,benzoic acid, 2,4-dihydroxy-, methyl ester,methyl beta-resorcylate,methyl-2,4-dihydroxybenzoate,unii-xe68bu3oyj,xe68bu3oyj,.beta.-resorcylic acid, methyl ester,beta-resorcylic acid methyl ester,methyl benzoate, 2,4-dihydroxy,methyl b-resorcylate PubChem CID: 16523 IUPAC Name: methyl 2,4-dihydroxybenzoate SMILES: COC(=O)C1=C(C=C(C=C1)O)O
| PubChem CID | 16523 |
|---|---|
| CAS | 2150-47-2 |
| Molecular Weight (g/mol) | 168.148 |
| MDL Number | MFCD00002276 |
| SMILES | COC(=O)C1=C(C=C(C=C1)O)O |
| Synonym | 2,4-dihydroxybenzoic acid methyl ester,benzoic acid, 2,4-dihydroxy-, methyl ester,methyl beta-resorcylate,methyl-2,4-dihydroxybenzoate,unii-xe68bu3oyj,xe68bu3oyj,.beta.-resorcylic acid, methyl ester,beta-resorcylic acid methyl ester,methyl benzoate, 2,4-dihydroxy,methyl b-resorcylate |
| IUPAC Name | methyl 2,4-dihydroxybenzoate |
| InChI Key | IIFCLXHRIYTHPV-UHFFFAOYSA-N |
| Molecular Formula | C8H8O4 |
Methyl 3-bromo-4-hydroxybenzoate, 98%
CAS: 29415-97-2 Molecular Formula: C8H7BrO3 Molecular Weight (g/mol): 231.05 MDL Number: MFCD06203850 InChI Key: RKUNSPWAQIUGEZ-UHFFFAOYSA-N Synonym: methyl3-bromo-4-hydroxybenzoate,3-bromo-4-hydroxybenzoic acid methyl ester,benzoic acid, 3-bromo-4-hydroxy-, methyl ester,2-bromo-4-methoxycarbonyl phenol,methyl 4-hydroxy-3-bromobenzoate,methyl-3-bromo-4-hydroxybenzoate,methyl 3-bromo-4-hydroxy-benzoate,methyl 3-bromo-4-hydroxybenzoate,methyl 3-bromanyl-4-oxidanyl-benzoate,3-bromo-4-hydroxy-benzoic acid methyl ester PubChem CID: 4778958 IUPAC Name: methyl 3-bromo-4-hydroxybenzoate SMILES: COC(=O)C1=CC(Br)=C(O)C=C1
| PubChem CID | 4778958 |
|---|---|
| CAS | 29415-97-2 |
| Molecular Weight (g/mol) | 231.05 |
| MDL Number | MFCD06203850 |
| SMILES | COC(=O)C1=CC(Br)=C(O)C=C1 |
| Synonym | methyl3-bromo-4-hydroxybenzoate,3-bromo-4-hydroxybenzoic acid methyl ester,benzoic acid, 3-bromo-4-hydroxy-, methyl ester,2-bromo-4-methoxycarbonyl phenol,methyl 4-hydroxy-3-bromobenzoate,methyl-3-bromo-4-hydroxybenzoate,methyl 3-bromo-4-hydroxy-benzoate,methyl 3-bromo-4-hydroxybenzoate,methyl 3-bromanyl-4-oxidanyl-benzoate,3-bromo-4-hydroxy-benzoic acid methyl ester |
| IUPAC Name | methyl 3-bromo-4-hydroxybenzoate |
| InChI Key | RKUNSPWAQIUGEZ-UHFFFAOYSA-N |
| Molecular Formula | C8H7BrO3 |
Methyl 4-iodosalicylate, 98%
CAS: 18179-39-0 Molecular Formula: C8H7IO3 Molecular Weight (g/mol): 278.045 MDL Number: MFCD06797864 InChI Key: WUFUURSWOJROKY-UHFFFAOYSA-N Synonym: methyl 4-iodosalicylate,2-hydroxy-4-iodobenzoic acid methyl ester,benzoic acid,2-hydroxy-4-iodo-, methyl ester,methyl-4-iodosalicylate,methyl 4-iodosalicyclate,acmc-1c81e,methyl2-hydroxy-4-iodobenzoate,methyl 4-iodo-2-hydroxybenzoate,methyl-2-hydroxy-4-iodo-benzoate PubChem CID: 11380407 IUPAC Name: methyl 2-hydroxy-4-iodobenzoate SMILES: COC(=O)C1=C(C=C(C=C1)I)O
| PubChem CID | 11380407 |
|---|---|
| CAS | 18179-39-0 |
| Molecular Weight (g/mol) | 278.045 |
| MDL Number | MFCD06797864 |
| SMILES | COC(=O)C1=C(C=C(C=C1)I)O |
| Synonym | methyl 4-iodosalicylate,2-hydroxy-4-iodobenzoic acid methyl ester,benzoic acid,2-hydroxy-4-iodo-, methyl ester,methyl-4-iodosalicylate,methyl 4-iodosalicyclate,acmc-1c81e,methyl2-hydroxy-4-iodobenzoate,methyl 4-iodo-2-hydroxybenzoate,methyl-2-hydroxy-4-iodo-benzoate |
| IUPAC Name | methyl 2-hydroxy-4-iodobenzoate |
| InChI Key | WUFUURSWOJROKY-UHFFFAOYSA-N |
| Molecular Formula | C8H7IO3 |
Methyl salicylate, 98%
CAS: 119-36-8 Molecular Formula: C8H8O3 Molecular Weight (g/mol): 152.149 MDL Number: MFCD00002214 InChI Key: OSWPMRLSEDHDFF-UHFFFAOYSA-N Synonym: methyl salicylate,wintergreen oil,gaultheria oil,betula oil,teaberry oil,sweet birch oil,oil of wintergreen,analgit,spicewood oil,2-hydroxybenzoic acid methyl ester PubChem CID: 4133 ChEBI: CHEBI:31832 IUPAC Name: methyl 2-hydroxybenzoate SMILES: COC(=O)C1=CC=CC=C1O
| PubChem CID | 4133 |
|---|---|
| CAS | 119-36-8 |
| Molecular Weight (g/mol) | 152.149 |
| ChEBI | CHEBI:31832 |
| MDL Number | MFCD00002214 |
| SMILES | COC(=O)C1=CC=CC=C1O |
| Synonym | methyl salicylate,wintergreen oil,gaultheria oil,betula oil,teaberry oil,sweet birch oil,oil of wintergreen,analgit,spicewood oil,2-hydroxybenzoic acid methyl ester |
| IUPAC Name | methyl 2-hydroxybenzoate |
| InChI Key | OSWPMRLSEDHDFF-UHFFFAOYSA-N |
| Molecular Formula | C8H8O3 |