Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Bismuth subgallate hydrate
CAS: 342406-26-2 Molecular Formula: C7H5BiO6 Molecular Weight (g/mol): 394.09 MDL Number: MFCD00044980 InChI Key: JAONZGLTYYUPCT-UHFFFAOYSA-K Synonym: bismuth subgallate,wismutgallathydroxid,dermatol,bismuth gallate,dermatol puder,bismuth subgallas,bismutum subgallicum,basic bismuth gallate,gallic acid bismuth basic salt,wismutgallat, basisches PubChem CID: 16682999 IUPAC Name: 4-hydroxy-1,3,2$l^{2}-benzodioxabismole-6-carboxylic acid;hydrate SMILES: O[Bi]1OC2=C(O1)C(O)=CC(=C2)C(O)=O
| PubChem CID | 16682999 |
|---|---|
| CAS | 342406-26-2 |
| Molecular Weight (g/mol) | 394.09 |
| MDL Number | MFCD00044980 |
| SMILES | O[Bi]1OC2=C(O1)C(O)=CC(=C2)C(O)=O |
| Synonym | bismuth subgallate,wismutgallathydroxid,dermatol,bismuth gallate,dermatol puder,bismuth subgallas,bismutum subgallicum,basic bismuth gallate,gallic acid bismuth basic salt,wismutgallat, basisches |
| IUPAC Name | 4-hydroxy-1,3,2$l^{2}-benzodioxabismole-6-carboxylic acid;hydrate |
| InChI Key | JAONZGLTYYUPCT-UHFFFAOYSA-K |
| Molecular Formula | C7H5BiO6 |
Bismuth(III) trifluoromethanesulfonate, 99%
CAS: 88189-03-1 Molecular Formula: C3BiF9O9S3 Molecular Weight (g/mol): 656.17 MDL Number: MFCD02093669 InChI Key: NYENCOMLZDQKNH-UHFFFAOYSA-K Synonym: bismuth iii trifluoromethanesulfonate,bismuth triflate,bismuth trifluoromethanesulfonate,bismuth 3+ triflate,bismuth triflate mi,bismuth 3+ trifluoromethanesulfonate,bismuth tris trifluoromethanesulfonate,bismuth iii triflate,bismuth 3+ ion tritriflate PubChem CID: 9917655 IUPAC Name: bismuth;trifluoromethanesulfonate SMILES: C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[Bi+3]
| PubChem CID | 9917655 |
|---|---|
| CAS | 88189-03-1 |
| Molecular Weight (g/mol) | 656.17 |
| MDL Number | MFCD02093669 |
| SMILES | C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[Bi+3] |
| Synonym | bismuth iii trifluoromethanesulfonate,bismuth triflate,bismuth trifluoromethanesulfonate,bismuth 3+ triflate,bismuth triflate mi,bismuth 3+ trifluoromethanesulfonate,bismuth tris trifluoromethanesulfonate,bismuth iii triflate,bismuth 3+ ion tritriflate |
| IUPAC Name | bismuth;trifluoromethanesulfonate |
| InChI Key | NYENCOMLZDQKNH-UHFFFAOYSA-K |
| Molecular Formula | C3BiF9O9S3 |
Bismuth 2-ethylhexanoate acid
CAS: 67874-71-9 Molecular Formula: C24H48BiO6 Molecular Weight (g/mol): 641.622 MDL Number: MFCD00043803 InChI Key: MWXWNYHYPMRCHN-UHFFFAOYSA-N Synonym: 2-Ethylhexanoic acid bismuth salt PubChem CID: 131857451 IUPAC Name: bismuth;2-ethylhexanoic acid SMILES: CCCCC(CC)C(=O)O.CCCCC(CC)C(=O)O.CCCCC(CC)C(=O)O.[Bi]
| PubChem CID | 131857451 |
|---|---|
| CAS | 67874-71-9 |
| Molecular Weight (g/mol) | 641.622 |
| MDL Number | MFCD00043803 |
| SMILES | CCCCC(CC)C(=O)O.CCCCC(CC)C(=O)O.CCCCC(CC)C(=O)O.[Bi] |
| Synonym | 2-Ethylhexanoic acid bismuth salt |
| IUPAC Name | bismuth;2-ethylhexanoic acid |
| InChI Key | MWXWNYHYPMRCHN-UHFFFAOYSA-N |
| Molecular Formula | C24H48BiO6 |
Bismuth(III) isopropoxide, Thermo Scientific Chemicals
CAS: 15049-67-9 Molecular Formula: C9H21BiO3 Molecular Weight (g/mol): 386.244 MDL Number: MFCD00799065 InChI Key: KNPRLIQQQKEOJN-UHFFFAOYSA-N Synonym: bismuth iii isopropoxide,triisopropoxybismuthine,acmc-20all6,bismuth 3+ tripropan-2-olate,bismuth 3+ tris propan-2-olate PubChem CID: 22648700 IUPAC Name: bismuth;propan-2-olate SMILES: CC(C)[O-].CC(C)[O-].CC(C)[O-].[Bi+3]
| PubChem CID | 22648700 |
|---|---|
| CAS | 15049-67-9 |
| Molecular Weight (g/mol) | 386.244 |
| MDL Number | MFCD00799065 |
| SMILES | CC(C)[O-].CC(C)[O-].CC(C)[O-].[Bi+3] |
| Synonym | bismuth iii isopropoxide,triisopropoxybismuthine,acmc-20all6,bismuth 3+ tripropan-2-olate,bismuth 3+ tris propan-2-olate |
| IUPAC Name | bismuth;propan-2-olate |
| InChI Key | KNPRLIQQQKEOJN-UHFFFAOYSA-N |
| Molecular Formula | C9H21BiO3 |
Ammonium bismuth citrate, Bi 48-52%, water ca 2%
CAS: 25530-63-6 Molecular Formula: C6H11BiNO7 Molecular Weight (g/mol): 418.134 MDL Number: MFCD00036420 InChI Key: JDINTLWFPXWXCT-UHFFFAOYSA-N Synonym: ammonium bismuth citrate PubChem CID: 87101692 IUPAC Name: azane;bismuth;2-hydroxypropane-1,2,3-tricarboxylic acid SMILES: C(C(=O)O)C(CC(=O)O)(C(=O)O)O.N.[Bi]
| PubChem CID | 87101692 |
|---|---|
| CAS | 25530-63-6 |
| Molecular Weight (g/mol) | 418.134 |
| MDL Number | MFCD00036420 |
| SMILES | C(C(=O)O)C(CC(=O)O)(C(=O)O)O.N.[Bi] |
| Synonym | ammonium bismuth citrate |
| IUPAC Name | azane;bismuth;2-hydroxypropane-1,2,3-tricarboxylic acid |
| InChI Key | JDINTLWFPXWXCT-UHFFFAOYSA-N |
| Molecular Formula | C6H11BiNO7 |
Bismuth Tripotassium Dicitrate, TCI America™
CAS: 57644-54-9 Molecular Formula: C12H10BiK3O14 Molecular Weight (g/mol): 704.473 MDL Number: MFCD02101411 InChI Key: ZQUAVILLCXTKTF-UHFFFAOYSA-H PubChem CID: 10101269 IUPAC Name: bismuth;tripotassium;2-hydroxypropane-1,2,3-tricarboxylate SMILES: C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.[K+].[K+].[K+].[Bi+3]
| PubChem CID | 10101269 |
|---|---|
| CAS | 57644-54-9 |
| Molecular Weight (g/mol) | 704.473 |
| MDL Number | MFCD02101411 |
| SMILES | C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.[K+].[K+].[K+].[Bi+3] |
| IUPAC Name | bismuth;tripotassium;2-hydroxypropane-1,2,3-tricarboxylate |
| InChI Key | ZQUAVILLCXTKTF-UHFFFAOYSA-H |
| Molecular Formula | C12H10BiK3O14 |
Tris(4-trifluoromethylphenyl)bismuth Dichloride 98.0+%, TCI America™
CAS: 121882-75-5 Molecular Formula: C21H12BiCl2F9 Molecular Weight (g/mol): 715.193 MDL Number: MFCD06797186 InChI Key: VOZWPVZQISDWJM-UHFFFAOYSA-L Synonym: Dichlorotris(4-trifluoromethylphenyl)bismuth PubChem CID: 44409351 IUPAC Name: dichloro-tris[4-(trifluoromethyl)phenyl]bismuth SMILES: C1=CC(=CC=C1C(F)(F)F)[Bi](C2=CC=C(C=C2)C(F)(F)F)(C3=CC=C(C=C3)C(F)(F)F)(Cl)Cl
| PubChem CID | 44409351 |
|---|---|
| CAS | 121882-75-5 |
| Molecular Weight (g/mol) | 715.193 |
| MDL Number | MFCD06797186 |
| SMILES | C1=CC(=CC=C1C(F)(F)F)[Bi](C2=CC=C(C=C2)C(F)(F)F)(C3=CC=C(C=C3)C(F)(F)F)(Cl)Cl |
| Synonym | Dichlorotris(4-trifluoromethylphenyl)bismuth |
| IUPAC Name | dichloro-tris[4-(trifluoromethyl)phenyl]bismuth |
| InChI Key | VOZWPVZQISDWJM-UHFFFAOYSA-L |
| Molecular Formula | C21H12BiCl2F9 |
TraceCERT™ Bismuth Standard for ICP, Certified Reference Material, MilliporeSigma™ Supelco™
This certified reference material (CRM) is produced and certified in accordance with ISO/IEC 17025 and ISO 17034. This CRM is traceable to the SI through a primary reference material from a NMI. Certified content incl. uncertainty and expiry date are stated on the enclosed certificate.
| CAS | 99-26-3 |
|---|
2,4,6-Tribromophenol, 98%
CAS: 118-79-6 Molecular Formula: C6H3Br3O Molecular Weight (g/mol): 330.80 MDL Number: MFCD00002150 InChI Key: BSWWXRFVMJHFBN-UHFFFAOYSA-N Synonym: tribromophenol,bromol,bromkal pur 3,xeroform,phenol, 2,4,6-tribromo,flammex 3bp,unii-ys6k3eu393,ccris 1658,great lakes ph-73,5175-83-7 bismuth 3+ salt PubChem CID: 1483 ChEBI: CHEBI:47696 IUPAC Name: 2,4,6-tribromophenol SMILES: OC1=C(Br)C=C(Br)C=C1Br
| PubChem CID | 1483 |
|---|---|
| CAS | 118-79-6 |
| Molecular Weight (g/mol) | 330.80 |
| ChEBI | CHEBI:47696 |
| MDL Number | MFCD00002150 |
| SMILES | OC1=C(Br)C=C(Br)C=C1Br |
| Synonym | tribromophenol,bromol,bromkal pur 3,xeroform,phenol, 2,4,6-tribromo,flammex 3bp,unii-ys6k3eu393,ccris 1658,great lakes ph-73,5175-83-7 bismuth 3+ salt |
| IUPAC Name | 2,4,6-tribromophenol |
| InChI Key | BSWWXRFVMJHFBN-UHFFFAOYSA-N |
| Molecular Formula | C6H3Br3O |
2,4,6-Tribromophenol, 98%
CAS: 118-79-6 Molecular Formula: C6H3Br3O Molecular Weight (g/mol): 330.80 MDL Number: MFCD00002150 InChI Key: BSWWXRFVMJHFBN-UHFFFAOYSA-N Synonym: tribromophenol,bromol,bromkal pur 3,xeroform,phenol, 2,4,6-tribromo,flammex 3bp,unii-ys6k3eu393,ccris 1658,great lakes ph-73,5175-83-7 bismuth 3+ salt PubChem CID: 1483 ChEBI: CHEBI:47696 IUPAC Name: 2,4,6-tribromophenol SMILES: OC1=C(Br)C=C(Br)C=C1Br
| PubChem CID | 1483 |
|---|---|
| CAS | 118-79-6 |
| Molecular Weight (g/mol) | 330.80 |
| ChEBI | CHEBI:47696 |
| MDL Number | MFCD00002150 |
| SMILES | OC1=C(Br)C=C(Br)C=C1Br |
| Synonym | tribromophenol,bromol,bromkal pur 3,xeroform,phenol, 2,4,6-tribromo,flammex 3bp,unii-ys6k3eu393,ccris 1658,great lakes ph-73,5175-83-7 bismuth 3+ salt |
| IUPAC Name | 2,4,6-tribromophenol |
| InChI Key | BSWWXRFVMJHFBN-UHFFFAOYSA-N |
| Molecular Formula | C6H3Br3O |
2,4,6-Tribromophenol 98.0+%, TCI America™
CAS: 118-79-6 Molecular Formula: C6H3Br3O Molecular Weight (g/mol): 330.80 MDL Number: MFCD00002150 InChI Key: BSWWXRFVMJHFBN-UHFFFAOYSA-N Synonym: tribromophenol,bromol,bromkal pur 3,xeroform,phenol, 2,4,6-tribromo,flammex 3bp,unii-ys6k3eu393,ccris 1658,great lakes ph-73,5175-83-7 bismuth 3+ salt PubChem CID: 1483 ChEBI: CHEBI:47696 IUPAC Name: 2,4,6-tribromophenol SMILES: OC1=C(Br)C=C(Br)C=C1Br
| PubChem CID | 1483 |
|---|---|
| CAS | 118-79-6 |
| Molecular Weight (g/mol) | 330.80 |
| ChEBI | CHEBI:47696 |
| MDL Number | MFCD00002150 |
| SMILES | OC1=C(Br)C=C(Br)C=C1Br |
| Synonym | tribromophenol,bromol,bromkal pur 3,xeroform,phenol, 2,4,6-tribromo,flammex 3bp,unii-ys6k3eu393,ccris 1658,great lakes ph-73,5175-83-7 bismuth 3+ salt |
| IUPAC Name | 2,4,6-tribromophenol |
| InChI Key | BSWWXRFVMJHFBN-UHFFFAOYSA-N |
| Molecular Formula | C6H3Br3O |