Trifluoromethylbenzenes
- (4)
- (13)
- (6)
- (3)
- (2)
- (1)
- (5)
- (15)
- (1)
- (3)
- (8)
- (5)
- (36)
- (1)
- (3)
- (5)
- (3)
- (17)
- (1)
- (3)
- (2)
- (4)
- (6)
- (19)
- (2)
- (10)
- (20)
- (1)
- (6)
- (2)
- (1)
Filtered Search Results
| PubChem CID | 16217169 |
|---|---|
| CAS | 157834-21-4 |
| Molecular Weight (g/mol) | 207.919 |
| MDL Number | MFCD07784336 |
| Color | White |
| Physical Form | Crystalline Powder |
| SMILES | B(C1=C(C(=CC=C1)C(F)(F)F)F)(O)O |
| TSCA | No |
| IUPAC Name | [2-fluoro-3-(trifluoromethyl)phenyl]boronic acid |
| InChI Key | PKARAEQMGHJHMY-UHFFFAOYSA-N |
| Molecular Formula | C7H5BF4O2 |
| Formula Weight | 207.92 |
| Melting Point | 58°C |
4-(Trifluoromethyl)phenylboronic Acid (contains varying amounts of Anhydride), TCI America™
CAS: 128796-39-4 Molecular Formula: C7H6BF3O2 MDL Number: MFCD00151855 InChI Key: ALMFIOZYDASRRC-UHFFFAOYSA-N PubChem CID: 2734389 IUPAC Name: [4-(trifluoromethyl)phenyl]boronic acid
| PubChem CID | 2734389 |
|---|---|
| CAS | 128796-39-4 |
| MDL Number | MFCD00151855 |
| IUPAC Name | [4-(trifluoromethyl)phenyl]boronic acid |
| InChI Key | ALMFIOZYDASRRC-UHFFFAOYSA-N |
| Molecular Formula | C7H6BF3O2 |
| PubChem CID | 2763301 |
|---|---|
| CAS | 352535-96-7 |
| Molecular Weight (g/mol) | 207.919 |
| MDL Number | MFCD03701538 |
| Color | White |
| Physical Form | Crystalline Powder |
| SMILES | B(C1=C(C=CC(=C1)C(F)(F)F)F)(O)O |
| TSCA | No |
| IUPAC Name | [2-fluoro-5-(trifluoromethyl)phenyl]boronic acid |
| InChI Key | KUHVVLFCTMTYGR-UHFFFAOYSA-N |
| Molecular Formula | C7H5BF4O2 |
| Formula Weight | 207.92 |
| Melting Point | 109°C |
4-Methoxy-3-(trifluoromethyl)phenylboronic Acid (contains varying amounts of Anhydride), TCI America™
CAS: 149507-36-8 Molecular Formula: C8H8BF3O3 Molecular Weight (g/mol): 219.954 MDL Number: MFCD07363790 InChI Key: BUSMBMGODABSIN-UHFFFAOYSA-N Synonym: 4-methoxy-3-trifluoromethyl phenyl boronic acid,4-methoxy-3-trifluoromethylphenylboronic acid,3-trifluoromethyl-4-methoxy-phenylboronic acid,4-methoxy-3-trifluoromethylphenyl boronic acid,4-methoxy-3-trifluoromethyl benzeneboronic acid,4-methoxy-3-trifluoromethyl phenylboronic acid,boronic acid, 4-methoxy-3-trifluoromethyl phenyl,acmc-1c5ik PubChem CID: 17750052 IUPAC Name: [4-methoxy-3-(trifluoromethyl)phenyl]boronic acid SMILES: B(C1=CC(=C(C=C1)OC)C(F)(F)F)(O)O
| PubChem CID | 17750052 |
|---|---|
| CAS | 149507-36-8 |
| Molecular Weight (g/mol) | 219.954 |
| MDL Number | MFCD07363790 |
| SMILES | B(C1=CC(=C(C=C1)OC)C(F)(F)F)(O)O |
| Synonym | 4-methoxy-3-trifluoromethyl phenyl boronic acid,4-methoxy-3-trifluoromethylphenylboronic acid,3-trifluoromethyl-4-methoxy-phenylboronic acid,4-methoxy-3-trifluoromethylphenyl boronic acid,4-methoxy-3-trifluoromethyl benzeneboronic acid,4-methoxy-3-trifluoromethyl phenylboronic acid,boronic acid, 4-methoxy-3-trifluoromethyl phenyl,acmc-1c5ik |
| IUPAC Name | [4-methoxy-3-(trifluoromethyl)phenyl]boronic acid |
| InChI Key | BUSMBMGODABSIN-UHFFFAOYSA-N |
| Molecular Formula | C8H8BF3O3 |
| Boiling Point | 236°C |
|---|---|
| PubChem CID | 2782671 |
| CAS | 176976-42-4 |
| Molecular Weight (g/mol) | 224.37 |
| MDL Number | MFCD03094999 |
| Color | White |
| Physical Form | Crystalline Powder |
| SMILES | B(C1=CC(=C(C=C1)Cl)C(F)(F)F)(O)O |
| TSCA | No |
| IUPAC Name | [4-chloro-3-(trifluoromethyl)phenyl]boronic acid |
| InChI Key | XHKNQBNGLMOTDB-UHFFFAOYSA-N |
| Molecular Formula | C7H5BClF3O2 |
| Formula Weight | 224.37 |
4-Chloro-3-(trifluoromethyl)benzeneboronic acid, 96%
CAS: 176976-42-4 Molecular Formula: C7H5BClF3O2 Molecular Weight (g/mol): 224.37 MDL Number: MFCD03094999 InChI Key: XHKNQBNGLMOTDB-UHFFFAOYSA-N Synonym: 4-chloro-3-trifluoromethyl phenylboronic acid,4-chloro-3-trifluoromethyl benzeneboronic acid,4-chloro-3-trifluoromethylphenylboronic acid,4-chloro-3-trifluoromethyl phenyl boronic acid,4-chloro-3-trifluoromethyl phenylboronicacid,4-chloro-3-trifluoromethylphenyl boronic acid,boronic acid, 4-chloro-3-trifluoromethyl phenyl,pubchem1796,acmc-1cg57 PubChem CID: 2782671 IUPAC Name: [4-chloro-3-(trifluoromethyl)phenyl]boronic acid SMILES: B(C1=CC(=C(C=C1)Cl)C(F)(F)F)(O)O
| PubChem CID | 2782671 |
|---|---|
| CAS | 176976-42-4 |
| Molecular Weight (g/mol) | 224.37 |
| MDL Number | MFCD03094999 |
| SMILES | B(C1=CC(=C(C=C1)Cl)C(F)(F)F)(O)O |
| Synonym | 4-chloro-3-trifluoromethyl phenylboronic acid,4-chloro-3-trifluoromethyl benzeneboronic acid,4-chloro-3-trifluoromethylphenylboronic acid,4-chloro-3-trifluoromethyl phenyl boronic acid,4-chloro-3-trifluoromethyl phenylboronicacid,4-chloro-3-trifluoromethylphenyl boronic acid,boronic acid, 4-chloro-3-trifluoromethyl phenyl,pubchem1796,acmc-1cg57 |
| IUPAC Name | [4-chloro-3-(trifluoromethyl)phenyl]boronic acid |
| InChI Key | XHKNQBNGLMOTDB-UHFFFAOYSA-N |
| Molecular Formula | C7H5BClF3O2 |
2,6-Bis(trifluoromethyl)benzeneboronic acid, 97%
CAS: 681812-07-7 Molecular Formula: C8H5BF6O2 Molecular Weight (g/mol): 257.926 MDL Number: MFCD04039321 InChI Key: WAMPGNNEOZGBHR-UHFFFAOYSA-N Synonym: 2,6-bis trifluoromethyl phenyl boronic acid,2,6-bis trifluoromethyl phenylboronic acid,2,6-bis trifluoromethyl benzeneboronic acid,2,6-ditrifluoromethylphenyl boronic acid,boronic acid, 2,6-bis trifluoromethyl phenyl,acmc-1b92w,ablock ab-13-3574,2,6-bis-trifluoromethyl benzeneboronic acid PubChem CID: 2783239 IUPAC Name: [2,6-bis(trifluoromethyl)phenyl]boronic acid SMILES: B(C1=C(C=CC=C1C(F)(F)F)C(F)(F)F)(O)O
| PubChem CID | 2783239 |
|---|---|
| CAS | 681812-07-7 |
| Molecular Weight (g/mol) | 257.926 |
| MDL Number | MFCD04039321 |
| SMILES | B(C1=C(C=CC=C1C(F)(F)F)C(F)(F)F)(O)O |
| Synonym | 2,6-bis trifluoromethyl phenyl boronic acid,2,6-bis trifluoromethyl phenylboronic acid,2,6-bis trifluoromethyl benzeneboronic acid,2,6-ditrifluoromethylphenyl boronic acid,boronic acid, 2,6-bis trifluoromethyl phenyl,acmc-1b92w,ablock ab-13-3574,2,6-bis-trifluoromethyl benzeneboronic acid |
| IUPAC Name | [2,6-bis(trifluoromethyl)phenyl]boronic acid |
| InChI Key | WAMPGNNEOZGBHR-UHFFFAOYSA-N |
| Molecular Formula | C8H5BF6O2 |
4-Methoxy-3-(trifluoromethyl)benzeneboronic acid, 98%, Thermo Scientific Chemicals
CAS: 149507-36-8 Molecular Formula: C8H8BF3O3 Molecular Weight (g/mol): 219.954 MDL Number: MFCD07363790 InChI Key: BUSMBMGODABSIN-UHFFFAOYSA-N Synonym: 4-methoxy-3-trifluoromethyl phenyl boronic acid,4-methoxy-3-trifluoromethylphenylboronic acid,3-trifluoromethyl-4-methoxy-phenylboronic acid,4-methoxy-3-trifluoromethylphenyl boronic acid,4-methoxy-3-trifluoromethyl benzeneboronic acid,4-methoxy-3-trifluoromethyl phenylboronic acid,boronic acid, 4-methoxy-3-trifluoromethyl phenyl,acmc-1c5ik PubChem CID: 17750052 IUPAC Name: [4-methoxy-3-(trifluoromethyl)phenyl]boronic acid SMILES: B(C1=CC(=C(C=C1)OC)C(F)(F)F)(O)O
| PubChem CID | 17750052 |
|---|---|
| CAS | 149507-36-8 |
| Molecular Weight (g/mol) | 219.954 |
| MDL Number | MFCD07363790 |
| SMILES | B(C1=CC(=C(C=C1)OC)C(F)(F)F)(O)O |
| Synonym | 4-methoxy-3-trifluoromethyl phenyl boronic acid,4-methoxy-3-trifluoromethylphenylboronic acid,3-trifluoromethyl-4-methoxy-phenylboronic acid,4-methoxy-3-trifluoromethylphenyl boronic acid,4-methoxy-3-trifluoromethyl benzeneboronic acid,4-methoxy-3-trifluoromethyl phenylboronic acid,boronic acid, 4-methoxy-3-trifluoromethyl phenyl,acmc-1c5ik |
| IUPAC Name | [4-methoxy-3-(trifluoromethyl)phenyl]boronic acid |
| InChI Key | BUSMBMGODABSIN-UHFFFAOYSA-N |
| Molecular Formula | C8H8BF3O3 |
2-Chloro-4-(trifluoromethyl)benzeneboronic acid, 96%
CAS: 254993-59-4 Molecular Formula: C7H5BClF3O2 Molecular Weight (g/mol): 224.37 MDL Number: MFCD02684337 InChI Key: JKSUCAFAUNSPLO-UHFFFAOYSA-N Synonym: 2-chloro-4-trifluoromethyl phenylboronic acid,2-chloro-4-trifluoromethylphenylboronic acid,2-chloro-4-trifluoromethyl benzeneboronic acid,2-chloro-4-trifluoromethyl phenyl boronic acid,2-chloro-4-trifluoromethyl phenylboronicacid,2-chloro-4-trifluoromethylphenyl boronic acid,boronic acid, 2-chloro-4-trifluoromethyl phenyl,2-fluoro-4-iodophenylboronicacid PubChem CID: 2783251 IUPAC Name: [2-chloro-4-(trifluoromethyl)phenyl]boronic acid SMILES: OB(O)C1=C(Cl)C=C(C=C1)C(F)(F)F
| PubChem CID | 2783251 |
|---|---|
| CAS | 254993-59-4 |
| Molecular Weight (g/mol) | 224.37 |
| MDL Number | MFCD02684337 |
| SMILES | OB(O)C1=C(Cl)C=C(C=C1)C(F)(F)F |
| Synonym | 2-chloro-4-trifluoromethyl phenylboronic acid,2-chloro-4-trifluoromethylphenylboronic acid,2-chloro-4-trifluoromethyl benzeneboronic acid,2-chloro-4-trifluoromethyl phenyl boronic acid,2-chloro-4-trifluoromethyl phenylboronicacid,2-chloro-4-trifluoromethylphenyl boronic acid,boronic acid, 2-chloro-4-trifluoromethyl phenyl,2-fluoro-4-iodophenylboronicacid |
| IUPAC Name | [2-chloro-4-(trifluoromethyl)phenyl]boronic acid |
| InChI Key | JKSUCAFAUNSPLO-UHFFFAOYSA-N |
| Molecular Formula | C7H5BClF3O2 |
4-(Trifluoromethyl)benzeneboronic acid, 98%
CAS: 128796-39-4 Molecular Formula: C7H6BF3O2 Molecular Weight (g/mol): 189.93 MDL Number: MFCD00151855 InChI Key: ALMFIOZYDASRRC-UHFFFAOYSA-N Synonym: 4-trifluoromethyl phenylboronic acid,4-trifluoromethylphenylboronic acid,4-trifluoromethyl benzeneboronic acid,4-trifluoromethyl phenyl boronic acid,4-trifluoromethylphenyl boronic acid,4-trifluoromethyl phenyl boranediol,4-boronobenzotrifluoride,p-trifluoromethyl phenylboronic acid,4-trifluoromethylphenyl-boronic acid PubChem CID: 2734389 IUPAC Name: [4-(trifluoromethyl)phenyl]boronic acid SMILES: OB(O)C1=CC=C(C=C1)C(F)(F)F
| PubChem CID | 2734389 |
|---|---|
| CAS | 128796-39-4 |
| Molecular Weight (g/mol) | 189.93 |
| MDL Number | MFCD00151855 |
| SMILES | OB(O)C1=CC=C(C=C1)C(F)(F)F |
| Synonym | 4-trifluoromethyl phenylboronic acid,4-trifluoromethylphenylboronic acid,4-trifluoromethyl benzeneboronic acid,4-trifluoromethyl phenyl boronic acid,4-trifluoromethylphenyl boronic acid,4-trifluoromethyl phenyl boranediol,4-boronobenzotrifluoride,p-trifluoromethyl phenylboronic acid,4-trifluoromethylphenyl-boronic acid |
| IUPAC Name | [4-(trifluoromethyl)phenyl]boronic acid |
| InChI Key | ALMFIOZYDASRRC-UHFFFAOYSA-N |
| Molecular Formula | C7H6BF3O2 |
4-Trifluoromethylphenylboronic acid, 98%, Thermo Scientific Chemicals
CAS: 128796-39-4 Molecular Formula: C7H6BF3O2 Molecular Weight (g/mol): 189.93 MDL Number: MFCD00151855 InChI Key: ALMFIOZYDASRRC-UHFFFAOYSA-N Synonym: 4-trifluoromethyl phenylboronic acid,4-trifluoromethylphenylboronic acid,4-trifluoromethyl benzeneboronic acid,4-trifluoromethyl phenyl boronic acid,4-trifluoromethylphenyl boronic acid,4-trifluoromethyl phenyl boranediol,4-boronobenzotrifluoride,p-trifluoromethyl phenylboronic acid,4-trifluoromethylphenyl-boronic acid PubChem CID: 2734389 IUPAC Name: [4-(trifluoromethyl)phenyl]boronic acid SMILES: OB(O)C1=CC=C(C=C1)C(F)(F)F
| PubChem CID | 2734389 |
|---|---|
| CAS | 128796-39-4 |
| Molecular Weight (g/mol) | 189.93 |
| MDL Number | MFCD00151855 |
| SMILES | OB(O)C1=CC=C(C=C1)C(F)(F)F |
| Synonym | 4-trifluoromethyl phenylboronic acid,4-trifluoromethylphenylboronic acid,4-trifluoromethyl benzeneboronic acid,4-trifluoromethyl phenyl boronic acid,4-trifluoromethylphenyl boronic acid,4-trifluoromethyl phenyl boranediol,4-boronobenzotrifluoride,p-trifluoromethyl phenylboronic acid,4-trifluoromethylphenyl-boronic acid |
| IUPAC Name | [4-(trifluoromethyl)phenyl]boronic acid |
| InChI Key | ALMFIOZYDASRRC-UHFFFAOYSA-N |
| Molecular Formula | C7H6BF3O2 |
3,5-Bis(trifluoromethyl)phenylboronic Acid (contains varying amounts of Anhydride), TCI America™
CAS: 73852-19-4 Molecular Formula: C8H5BF6O2 Molecular Weight (g/mol): 257.93 MDL Number: MFCD00051850 InChI Key: BPTABBGLHGBJQR-UHFFFAOYSA-N Synonym: 3,5-bis trifluoromethyl phenylboronic acid,3,5-bis trifluoromethyl benzeneboronic acid,3,5-bis trifluoromethyl phenyl boronic acid,3,5-bis-trifluoromethylphenylboronic acid,3,5-bis trifluoromethylphenyl boronic acid,3,5-bis trifluoromethyl phenylboroic acid,btfpba,3,5-bis trifluoromethyl phenyl boranediol PubChem CID: 156265 IUPAC Name: [3,5-bis(trifluoromethyl)phenyl]boronic acid SMILES: OB(O)C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F
| PubChem CID | 156265 |
|---|---|
| CAS | 73852-19-4 |
| Molecular Weight (g/mol) | 257.93 |
| MDL Number | MFCD00051850 |
| SMILES | OB(O)C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F |
| Synonym | 3,5-bis trifluoromethyl phenylboronic acid,3,5-bis trifluoromethyl benzeneboronic acid,3,5-bis trifluoromethyl phenyl boronic acid,3,5-bis-trifluoromethylphenylboronic acid,3,5-bis trifluoromethylphenyl boronic acid,3,5-bis trifluoromethyl phenylboroic acid,btfpba,3,5-bis trifluoromethyl phenyl boranediol |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]boronic acid |
| InChI Key | BPTABBGLHGBJQR-UHFFFAOYSA-N |
| Molecular Formula | C8H5BF6O2 |
| PubChem CID | 2782667 |
|---|---|
| CAS | 153254-09-2 |
| MDL Number | MFCD01631349 |
| Color | White-Yellow |
| Physical Form | Crystalline Powder |
| TSCA | No |
| IUPAC Name | [2,4-bis(trifluoromethyl)phenyl]boronic acid |
| InChI Key | WLYPBMBWKYALCG-UHFFFAOYSA-N |
| Molecular Formula | C8H5BF6O2 |
| Formula Weight | 257.93 |
| PubChem CID | 16414145 |
|---|---|
| CAS | 503309-11-3 |
| Molecular Weight (g/mol) | 207.919 |
| MDL Number | MFCD03094995 |
| Color | White-Yellow |
| Physical Form | Crystalline Powder |
| SMILES | B(C1=C(C=C(C=C1)C(F)(F)F)F)(O)O |
| TSCA | No |
| IUPAC Name | [2-fluoro-4-(trifluoromethyl)phenyl]boronic acid |
| InChI Key | SSFSVKVWAURAAM-UHFFFAOYSA-N |
| Molecular Formula | C7H5BF4O2 |
| Formula Weight | 207.92 |
| Melting Point | 116°C |
| PubChem CID | 2782670 |
|---|---|
| CAS | 182344-18-9 |
| Molecular Weight (g/mol) | 224.37 |
| MDL Number | MFCD00797335 |
| Color | White |
| Physical Form | Crystalline Powder |
| SMILES | B(C1=C(C=CC(=C1)C(F)(F)F)Cl)(O)O |
| TSCA | No |
| IUPAC Name | [2-chloro-5-(trifluoromethyl)phenyl]boronic acid |
| InChI Key | YVMXEHZEYONARR-UHFFFAOYSA-N |
| Molecular Formula | C7H5BClF3O2 |
| Formula Weight | 224.37 |
| Melting Point | 108°C |